{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "01c1d955-9d2a-41ee-81a5-fcf505bea934",
          "code": "LINALYL PHENYLACETATE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=4527",
          "code_system": "JECFA EVALUATION",
          "references": [
            "1c4fc2d5-9d7a-423e-a26c-6ddbcbc6a5da"
          ]
        },
        {
          "uuid": "f0343f6c-1506-40d2-910f-c7070bbf3bc2",
          "code": "7143-69-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7143-69-3",
          "code_system": "CAS",
          "references": [
            "1c4fc2d5-9d7a-423e-a26c-6ddbcbc6a5da",
            "30a36b7c-9f4c-461d-984e-b5f7696be8aa"
          ]
        },
        {
          "uuid": "a91b70d1-4858-47ed-97f6-f8788884d203",
          "code": "C475602",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67475602",
          "code_system": "MESH",
          "references": [
            "1c4fc2d5-9d7a-423e-a26c-6ddbcbc6a5da"
          ]
        },
        {
          "uuid": "3e77d210-3ebf-42b4-a4a9-35ee9a6b7af7",
          "code": "230-444-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.027.677",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "1c4fc2d5-9d7a-423e-a26c-6ddbcbc6a5da"
          ]
        },
        {
          "uuid": "8d8e2227-ab09-4d99-8d7b-15cfcab65089",
          "code": "251529",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/251529",
          "code_system": "PUBCHEM",
          "references": [
            "1c4fc2d5-9d7a-423e-a26c-6ddbcbc6a5da"
          ]
        },
        {
          "uuid": "3189b572-6e08-4dc0-94ad-24adfa2160fe",
          "code": "N73NNZ8H94",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0d6240ac-0f36-c3db-9a3c-55f4f9ef4212",
          "code": "72028",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=72028",
          "code_system": "NSC",
          "references": [
            "399748e8-34d2-8da7-47c2-93ca8fa7bfc9"
          ]
        },
        {
          "uuid": "1a052492-489e-5744-5d68-0aa3181b67b8",
          "code": "DTXSID90864012",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90864012",
          "code_system": "EPA CompTox",
          "references": [
            "41d786f7-9cb4-67c9-07cb-2a229d52733d"
          ]
        },
        {
          "uuid": "79c447e6-a41c-107d-21a2-283b4edda5b9",
          "code": "952",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/952/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "de05a61e-7317-2a44-4a9b-70e20c70a8b7"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f2348da8-eb37-4110-bb6f-35c660bc0b1d",
          "name": "(±)-LINALYL PHENYLACETATE",
          "stdName": "(+/-)-LINALYL PHENYLACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5dc98415-f436-45a2-b31e-3cf43857b962",
            "2f97c3e3-6f44-4408-8107-da49895007ab"
          ],
          "display_name": false
        },
        {
          "uuid": "80730c60-7358-45be-bdbe-1e6aa7746424",
          "name": "ACETIC ACID, PHENYL-, 1,5-DIMETHYL-1-VINYL-4-HEXENYL ESTER",
          "stdName": "ACETIC ACID, PHENYL-, 1,5-DIMETHYL-1-VINYL-4-HEXENYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5dc98415-f436-45a2-b31e-3cf43857b962",
            "ac4f6b13-42f1-4df2-a817-26a4f1e9c859"
          ],
          "display_name": false
        },
        {
          "uuid": "71d57f22-abeb-4fc4-9f93-64613aad14c9",
          "name": "BENZENEACETIC ACID, 1,5-DIMETHYL-1-ETHENYL-4-HEXENYL ESTER",
          "stdName": "BENZENEACETIC ACID, 1,5-DIMETHYL-1-ETHENYL-4-HEXENYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5dc98415-f436-45a2-b31e-3cf43857b962",
            "ac4f6b13-42f1-4df2-a817-26a4f1e9c859"
          ],
          "display_name": false
        },
        {
          "uuid": "4c24d473-a57d-45e6-bc38-ec0a4725795c",
          "name": "BENZENEACETIC ACID, 1-ETHENYL-1,5-DIMETHYL-4-HEXEN-1-YL ESTER",
          "stdName": "BENZENEACETIC ACID, 1-ETHENYL-1,5-DIMETHYL-4-HEXEN-1-YL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5dc98415-f436-45a2-b31e-3cf43857b962",
            "ac4f6b13-42f1-4df2-a817-26a4f1e9c859"
          ],
          "display_name": false
        },
        {
          "uuid": "2ffba8fd-76fe-44a6-a6d2-002e0e16561e",
          "name": "BENZENEACETIC ACID, 1-ETHENYL-1,5-DIMETHYL-4-HEXENYL ESTER",
          "stdName": "BENZENEACETIC ACID, 1-ETHENYL-1,5-DIMETHYL-4-HEXENYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5dc98415-f436-45a2-b31e-3cf43857b962",
            "ac4f6b13-42f1-4df2-a817-26a4f1e9c859"
          ],
          "display_name": false
        },
        {
          "uuid": "524492e1-3367-4a1b-96a9-e9b905750139",
          "name": "FEMA NO. 3501",
          "stdName": "FEMA NO. 3501",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5dc98415-f436-45a2-b31e-3cf43857b962",
            "ac4f6b13-42f1-4df2-a817-26a4f1e9c859"
          ],
          "display_name": false
        },
        {
          "uuid": "ac9f6d5b-9d29-4f07-b06d-ae4c5780ff93",
          "name": "LINALYL .ALPHA.-TOLUATE",
          "stdName": "LINALYL .ALPHA.-TOLUATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5dc98415-f436-45a2-b31e-3cf43857b962",
            "ac4f6b13-42f1-4df2-a817-26a4f1e9c859"
          ],
          "display_name": false
        },
        {
          "uuid": "25c65a14-c872-42ed-8ba2-8bfaf90feddc",
          "name": "LINALYL PHENYL ACETATE",
          "stdName": "LINALYL PHENYL ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ff7c1e6-d68c-495c-a333-f94d65201e86",
            "5dc98415-f436-45a2-b31e-3cf43857b962"
          ],
          "display_name": false
        },
        {
          "uuid": "3138b14d-1f74-4fad-b57a-eb417cde2686",
          "name": "LINALYL PHENYLACETATE",
          "stdName": "LINALYL PHENYLACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5dc98415-f436-45a2-b31e-3cf43857b962",
            "2ef6c53b-7df6-4a0d-8e33-8796157337b1",
            "b37a011a-76c0-48bb-b2dc-9e89bf5a37a5",
            "ac4f6b13-42f1-4df2-a817-26a4f1e9c859"
          ],
          "display_name": true
        },
        {
          "uuid": "99bead96-2ee0-451d-a1e4-41dfa13ba85f",
          "name": "LINALYL PHENYLACETATE [FHFI]",
          "stdName": "LINALYL PHENYLACETATE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5dc98415-f436-45a2-b31e-3cf43857b962",
            "b37a011a-76c0-48bb-b2dc-9e89bf5a37a5"
          ],
          "display_name": false
        },
        {
          "uuid": "1a81acf9-a6d6-447c-92a8-11f88a399212",
          "name": "LINALYL PHENYLACETATE, (±)-",
          "stdName": "LINALYL PHENYLACETATE, (+/-)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5dc98415-f436-45a2-b31e-3cf43857b962",
            "2f97c3e3-6f44-4408-8107-da49895007ab"
          ],
          "display_name": false
        },
        {
          "uuid": "c92626ae-b887-49fd-b66f-778e84a2078f",
          "name": "NSC-72028",
          "stdName": "NSC-72028",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5dc98415-f436-45a2-b31e-3cf43857b962",
            "ac4f6b13-42f1-4df2-a817-26a4f1e9c859"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ac4f6b13-42f1-4df2-a817-26a4f1e9c859",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5dc98415-f436-45a2-b31e-3cf43857b962",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2f97c3e3-6f44-4408-8107-da49895007ab",
          "citation": "FDA-SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5ff7c1e6-d68c-495c-a333-f94d65201e86",
          "citation": "GRAS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b37a011a-76c0-48bb-b2dc-9e89bf5a37a5",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c4fc2d5-9d7a-423e-a26c-6ddbcbc6a5da",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391107000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "651c87a7-5651-4207-a1e8-66cbef95bcbb",
          "citation": "SRS import [N73NNZ8H94]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=N73NNZ8H94",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391107000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ef6c53b-7df6-4a0d-8e33-8796157337b1",
          "citation": "LINALYL PHENYLACETATE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "30a36b7c-9f4c-461d-984e-b5f7696be8aa",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "399748e8-34d2-8da7-47c2-93ca8fa7bfc9",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "41d786f7-9cb4-67c9-07cb-2a229d52733d",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "de05a61e-7317-2a44-4a9b-70e20c70a8b7",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c5709728-a87e-4bf7-be2e-4ca90fc1d668",
          "id": "c5709728-a87e-4bf7-be2e-4ca90fc1d668",
          "molfile": "\n  Marvin  01132110122D          \n\n 20 20  0  0  0  0            999 V2000\n    5.6064   -3.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3226   -3.2344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0365   -3.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3226   -2.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6064   -1.9992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8925   -2.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1829   -1.9992    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.7705   -1.2829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4668   -2.4117    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7528   -1.9992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7528   -1.1742    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0366   -2.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0366   -3.2344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7528   -3.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7528   -4.4719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0366   -4.8844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3250   -4.4719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3250   -3.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5910   -1.2829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4160   -1.2829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 19  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 18  2  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 20  2  0  0  0  0\nM  END",
          "smiles": "C=CC(C)(CCC=C(C)C)OC(=O)Cc1ccccc1",
          "formula": "C18H24O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ee3919cd-de90-48c7-a201-2bf471994f75"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "272.3826",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "73587cc6-873a-4ee0-b634-2a380a28dfcc",
      "version": "7",
      "structure": {
        "id": "1477b953-c2f8-454f-9930-772a4f0f0e4f",
        "molfile": "\n  Marvin  01132101162D          \n\n 20 20  0  0  0  0            999 V2000\n    2.0366   -4.8844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7528   -4.4719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3250   -4.4719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6064   -3.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0365   -3.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7528   -3.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3250   -3.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3226   -3.2344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0366   -3.2344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3226   -2.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7528   -1.1742    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0366   -2.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4160   -1.2829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6064   -1.9992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7528   -1.9992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7705   -1.2829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5910   -1.2829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8925   -2.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4668   -2.4117    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1829   -1.9992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  6  2  2  0  0  0  0\n  7  3  1  0  0  0  0\n  8  4  1  0  0  0  0\n  8  5  1  0  0  0  0\n  9  6  1  0  0  0  0\n  9  7  2  0  0  0  0\n 10  8  2  0  0  0  0\n 12  9  1  0  0  0  0\n 14 10  1  0  0  0  0\n 15 11  2  0  0  0  0\n 15 12  1  0  0  0  0\n 17 13  2  0  0  0  0\n 18 14  1  0  0  0  0\n 19 15  1  0  0  0  0\n 20 16  1  0  0  0  0\n 20 17  1  0  0  0  0\n 20 18  1  0  0  0  0\n 20 19  1  0  0  0  0\nM  END",
        "smiles": "C=CC(C)(CCC=C(C)C)OC(=O)Cc1ccccc1",
        "formula": "C18H24O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "272.3826",
        "optical_activity": "( + / - )",
        "references": [
          "651c87a7-5651-4207-a1e8-66cbef95bcbb",
          "ac4f6b13-42f1-4df2-a817-26a4f1e9c859"
        ],
        "stereo_centers": 1
      },
      "unii": "N73NNZ8H94"
    }
  ]
}