{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5b766a99-113b-41bb-9524-c95eccb38be8",
          "code": "283594-90-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=283594-90-1",
          "code_system": "CAS",
          "references": [
            "070ff729-7aeb-4a4d-be22-d261c69c322b",
            "6afbcd8d-98c5-43cb-a62f-f844e70837e3"
          ]
        },
        {
          "uuid": "3d91064e-0c48-4a8c-8a93-2ecc46e14c6e",
          "code": "24875",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3926",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "070ff729-7aeb-4a4d-be22-d261c69c322b"
          ]
        },
        {
          "uuid": "bbf304a9-1b7b-457a-9995-bdaab21bae8c",
          "code": "m10156",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10156?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "070ff729-7aeb-4a4d-be22-d261c69c322b"
          ]
        },
        {
          "uuid": "233ce3a6-5ee0-40e8-9e27-891fe1838d83",
          "code": "9907412",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9907412",
          "code_system": "PUBCHEM",
          "references": [
            "070ff729-7aeb-4a4d-be22-d261c69c322b"
          ]
        },
        {
          "uuid": "11465918-5e97-daf1-e44c-0ebfced8b3b0",
          "code": "7882",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7882",
          "code_system": "HSDB",
          "references": [
            "f2eb01bc-f563-fbaa-a5bb-05cbeeb8cee4"
          ]
        },
        {
          "uuid": "dba9abd3-7e5d-c7bb-2ef0-b4b86b650631",
          "code": "DTXSID1034929",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1034929",
          "code_system": "EPA CompTox",
          "references": [
            "66fdd473-ee04-8dac-2bf6-96a2c80a004f"
          ]
        },
        {
          "uuid": "36520574-6945-4b9f-a13d-9f656b2c9f60",
          "code": "N726NTQ5ZC",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1190dedb-67a2-b77b-c895-dff1d9ece738",
          "code": "38640",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:38640",
          "code_system": "CHEBI",
          "references": [
            "996d71c7-b8ec-d4b8-09fa-f3c3f42c796a"
          ]
        },
        {
          "uuid": "6dcf841f-614d-ee2b-d309-81d806b3b327",
          "code": "spiromesifen",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/spiromesifen.html",
          "code_system": "ALANWOOD",
          "references": [
            "6b0610c1-a695-52c8-b9af-32f0e12bba4c"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f06f317b-526c-4c65-97a0-6571a1597c70",
          "name": "2-OXO-3-(2,4,6-TRIMETHYLPHENYL)-1-OXASPIRO(4.4)NON-3-EN-4-YL 3,3-DIMETHYLBUTANOATE",
          "stdName": "2-OXO-3-(2,4,6-TRIMETHYLPHENYL)-1-OXASPIRO(4.4)NON-3-EN-4-YL 3,3-DIMETHYLBUTANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9edde8b9-a80b-43c2-b40e-232e5f476e80",
            "7bf97dc9-eab3-48d2-b947-c12a7744427e"
          ],
          "display_name": false
        },
        {
          "uuid": "4b3d9466-1051-4625-b749-877a16d311ef",
          "name": "3-MESITYL-2-OXO-1-OXASPIRO(4.4)NON-3-EN-4-YL 3,3-DIMETHYLBUTYRATE",
          "stdName": "3-MESITYL-2-OXO-1-OXASPIRO(4.4)NON-3-EN-4-YL 3,3-DIMETHYLBUTYRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "904855de-9bee-405c-962d-0ce675bf551a",
            "7bf97dc9-eab3-48d2-b947-c12a7744427e"
          ],
          "display_name": false
        },
        {
          "uuid": "39da7ce5-a484-49e2-9c1a-9a43add2dd42",
          "name": "SPIROMESIFEN",
          "stdName": "SPIROMESIFEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70d15ca0-5b64-425e-8f93-6094091bff1f",
            "80f3944a-ae59-4ed4-9ac5-d12eaae250d3",
            "aa552612-2ebb-41b7-97ce-a93b04994b5f",
            "b77ac58a-4df8-42da-8fe8-14037687ec3d",
            "aa3ee2cc-9d06-4308-97a0-75d3cd7b90b3",
            "efe06bf8-2241-4fcc-8f4b-3a0bbc1bc7c9"
          ],
          "display_name": true
        },
        {
          "uuid": "750c988e-80e2-4def-aea1-ca2df9af119e",
          "name": "SPIROMESIFEN [ISO]",
          "stdName": "SPIROMESIFEN [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70d15ca0-5b64-425e-8f93-6094091bff1f",
            "aa552612-2ebb-41b7-97ce-a93b04994b5f"
          ],
          "display_name": false
        },
        {
          "uuid": "c92ad94a-ffd0-4aa6-a55b-4deb1062f44e",
          "name": "SPIROMESIFEN [MI]",
          "stdName": "SPIROMESIFEN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa552612-2ebb-41b7-97ce-a93b04994b5f",
            "aa3ee2cc-9d06-4308-97a0-75d3cd7b90b3"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9edde8b9-a80b-43c2-b40e-232e5f476e80",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa3ee2cc-9d06-4308-97a0-75d3cd7b90b3",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa552612-2ebb-41b7-97ce-a93b04994b5f",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "70d15ca0-5b64-425e-8f93-6094091bff1f",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "070ff729-7aeb-4a4d-be22-d261c69c322b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390914000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3fe4c006-9059-4763-a05b-750e71b2f78f",
          "citation": "SRS import [N726NTQ5ZC]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=N726NTQ5ZC",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390914000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dabd3398-cd7c-405c-b009-1785972f9672",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b77ac58a-4df8-42da-8fe8-14037687ec3d",
          "citation": "SPIROMESIFEN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "efe06bf8-2241-4fcc-8f4b-3a0bbc1bc7c9",
          "citation": "SPIROMESIFEN [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "80f3944a-ae59-4ed4-9ac5-d12eaae250d3",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7bf97dc9-eab3-48d2-b947-c12a7744427e",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "904855de-9bee-405c-962d-0ce675bf551a",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f2eb01bc-f563-fbaa-a5bb-05cbeeb8cee4",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+283594-90-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "66fdd473-ee04-8dac-2bf6-96a2c80a004f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=283594-90-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6b0610c1-a695-52c8-b9af-32f0e12bba4c",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "6afbcd8d-98c5-43cb-a62f-f844e70837e3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "996d71c7-b8ec-d4b8-09fa-f3c3f42c796a",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "21d1e406-9cd7-416c-ba74-bc993fba4ab7",
          "id": "21d1e406-9cd7-416c-ba74-bc993fba4ab7",
          "molfile": "\n  Marvin  01132101542D          \n\n 27 29  0  0  0  0            999 V2000\n    8.7577   -8.0879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6676   -7.2678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3384   -6.7767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2463   -5.9547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9118   -5.4646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4903   -5.6280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4015   -4.8077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6902   -4.4013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9751   -4.8123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2595   -4.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2595   -3.5786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5485   -4.8170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8330   -4.4087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1175   -4.8215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8330   -3.5831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0472   -5.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8626   -3.5998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0534   -3.4282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9637   -2.6094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7192   -2.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2748   -2.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6691   -3.5116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0079   -4.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8192   -4.4237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8256   -6.1131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0691   -5.7763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9141   -6.9325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 27  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 25  2  0  0  0  0\n  8  7  2  0  0  0  0\n  7 23  1  0  0  0  0\n  9  8  1  0  0  0  0\n 17  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 21 17  1  0  0  0  0\n 22 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  2  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  1  0  0  0  0\nM  END",
          "smiles": "Cc1cc(C)c(c(C)c1)C2=C(C3(CCCC3)OC2=O)OC(=O)CC(C)(C)C",
          "formula": "C23H30O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c7a6a302-9517-4099-bb3c-c968cb770e5a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "370.4828",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4cbf8352-f9ef-40ce-9811-e144851784fd",
      "version": "8",
      "structure": {
        "id": "86a55c11-578a-423d-bac1-256cdf59a053",
        "molfile": "\n  Marvin  01132106592D          \n\n 27 29  0  0  0  0            999 V2000\n    6.9637   -2.6094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0534   -3.4282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8626   -3.5998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2748   -2.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7192   -2.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6902   -4.4013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4015   -4.8077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0079   -4.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6691   -3.5116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8192   -4.4237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4903   -5.6280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8256   -6.1131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9141   -6.9325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6676   -7.2678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3384   -6.7767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2463   -5.9547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9118   -5.4646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7577   -8.0879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0691   -5.7763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9751   -4.8123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2595   -4.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5485   -4.8170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8330   -4.4087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1175   -4.8215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8330   -3.5831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0472   -5.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2595   -3.5786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9  3  1  0  0  0  0\n  8 10  2  0  0  0  0\n  7 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 11  1  0  0  0  0\n 16 17  1  0  0  0  0\n 14 18  1  0  0  0  0\n 12 19  1  0  0  0  0\n 20  6  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 23 25  1  0  0  0  0\n 23 26  1  0  0  0  0\n 21 27  2  0  0  0  0\nM  END",
        "smiles": "Cc1cc(C)c(c(C)c1)C2=C(C3(CCCC3)OC2=O)OC(=O)CC(C)(C)C",
        "formula": "C23H30O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "370.4828",
        "optical_activity": "NONE",
        "references": [
          "3fe4c006-9059-4763-a05b-750e71b2f78f",
          "dabd3398-cd7c-405c-b009-1785972f9672"
        ],
        "stereo_centers": 0
      },
      "unii": "N726NTQ5ZC"
    }
  ]
}