{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e25aeeed-10f7-4b7e-81f8-9303c2e6f512",
          "code": "1836-75-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1836-75-5",
          "code_system": "CAS",
          "references": [
            "60ad7511-114a-45a2-9dc9-98a6757e4d0b",
            "76ba0994-6ffc-4788-9bdf-95b21fb9cd51"
          ]
        },
        {
          "uuid": "1170c07c-8ea9-4454-9137-d1558e740b5f",
          "code": "C44411",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C44411",
          "code_system": "NCI_THESAURUS",
          "references": [
            "60ad7511-114a-45a2-9dc9-98a6757e4d0b"
          ]
        },
        {
          "uuid": "7ecffc12-8fa3-411e-b5f3-95a1b11052ab",
          "code": "C007350",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67007350",
          "code_system": "MESH",
          "references": [
            "60ad7511-114a-45a2-9dc9-98a6757e4d0b"
          ]
        },
        {
          "uuid": "c4e218da-ae10-4029-93e8-4f35c417bb8b",
          "code": "NITROFEN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Nitrofen",
          "code_system": "WIKIPEDIA",
          "references": [
            "60ad7511-114a-45a2-9dc9-98a6757e4d0b"
          ]
        },
        {
          "uuid": "4078be46-3f37-4326-91f3-d871d22d8c8a",
          "code": "38201",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:421",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "60ad7511-114a-45a2-9dc9-98a6757e4d0b"
          ]
        },
        {
          "uuid": "75dde9d8-3736-486a-b0a0-2555fb80c3a9",
          "code": "217-406-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.015.824",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "60ad7511-114a-45a2-9dc9-98a6757e4d0b"
          ]
        },
        {
          "uuid": "b83db016-a6d6-4bf6-813a-e1cca16755d3",
          "code": "m7955",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7955?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "60ad7511-114a-45a2-9dc9-98a6757e4d0b"
          ]
        },
        {
          "uuid": "31c73699-dd4b-4264-a0c2-5e93c8d6709a",
          "code": "15787",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15787",
          "code_system": "PUBCHEM",
          "references": [
            "60ad7511-114a-45a2-9dc9-98a6757e4d0b"
          ]
        },
        {
          "uuid": "20000616-8e00-23c2-8222-666d192a0946",
          "code": "1578",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1578",
          "code_system": "HSDB",
          "references": [
            "15183d35-5ba9-25e6-96a6-019b0f628ca4"
          ]
        },
        {
          "uuid": "ce972463-f621-e274-d594-de02cf2ff9b4",
          "code": "DTXSID7020970",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7020970",
          "code_system": "EPA CompTox",
          "references": [
            "edc62c2f-96de-2bb7-bd5b-58940fc5b8f0"
          ]
        },
        {
          "uuid": "fa941c14-3622-72b3-a1b2-e8cd06d4d4a4",
          "code": "C45179",
          "comments": "Chemical Modifier[C1932]|Carcinogen[C347]|Chemical Carcinogen[C1743]|Organic Carcinogen[C45175]|Organo-nitrogen Carcinogen[C45176]|Nitro-compound Carcinogen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45179",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f84d9376-3857-1980-8e12-3eec63c4775c"
          ]
        },
        {
          "uuid": "4b0cf615-65f2-4741-af66-31ed57a72732",
          "code": "N71UYG034A",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "196c9d40-e059-253c-48db-b53f97b71624",
          "code": "nitrofen",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/nitrofen.html",
          "code_system": "ALANWOOD",
          "references": [
            "28a4b547-8af4-def2-572b-4e05b4a994e6"
          ]
        },
        {
          "uuid": "e0eb0e0f-6006-0f51-b561-c5fc29574bf8",
          "code": "300000053431",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2b5ee2ef-a2b0-ebbb-b08e-f88f07608e70"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6b6b4310-c49f-4c5a-b31a-1e1aadf85cf5",
          "name": "2,4-DICHLORO-1-(4-NITROPHENOXY)BENZENE",
          "stdName": "2,4-DICHLORO-1-(4-NITROPHENOXY)BENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f8b6fe4-e434-40f4-954d-67e2295710a5",
            "02e55c4a-8b0f-4108-b98b-448e0097b923"
          ],
          "display_name": false
        },
        {
          "uuid": "c2139001-4504-488b-9a26-1824b2f87727",
          "name": "2,4-DICHLOROPHENYL 4-NITROPHENYL ETHER",
          "stdName": "2,4-DICHLOROPHENYL 4-NITROPHENYL ETHER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec45854a-75c1-4380-afe4-ac463bb8ca13",
            "02e55c4a-8b0f-4108-b98b-448e0097b923"
          ],
          "display_name": false
        },
        {
          "uuid": "dfafbb15-2587-4c8c-94c8-387a94cab8f7",
          "name": "NITROFEN",
          "stdName": "NITROFEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6a92d7a-7011-45a0-ae5e-f55731e87f24",
            "ecd9c03a-6054-4c92-bc20-85d9259ca9a9",
            "120952cb-41ea-488d-b3fe-ad32fc0012d9",
            "1e3c7de7-c90f-4dd2-8aa3-820dbe1d1fa5",
            "8a614d6d-b77f-48ea-98ab-43d4b6e56674",
            "0623ad1d-bbac-4f18-8ba0-1183ab760293",
            "3d7ca2a1-0221-4fbb-9028-1ee275c00dcc",
            "e7c7d3e6-2693-464e-bf5f-ad2e53be48d6"
          ],
          "display_name": true
        },
        {
          "uuid": "a8b84b07-6208-42e5-b7a8-e406b42f2da2",
          "name": "NITROFEN [HSDB]",
          "stdName": "NITROFEN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7c7d3e6-2693-464e-bf5f-ad2e53be48d6",
            "3d7ca2a1-0221-4fbb-9028-1ee275c00dcc"
          ],
          "display_name": false
        },
        {
          "uuid": "46f0cd27-3344-a06f-0ad5-d51e556e64be",
          "name": "NITROFEN [IARC]",
          "stdName": "NITROFEN [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0790667-e33c-b78d-a42f-0844f4c41bb5"
          ],
          "display_name": false
        },
        {
          "uuid": "123fdbe5-2d18-45d4-a652-d07b870cb885",
          "name": "NITROFEN [ISO]",
          "stdName": "NITROFEN [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "120952cb-41ea-488d-b3fe-ad32fc0012d9",
            "3d7ca2a1-0221-4fbb-9028-1ee275c00dcc"
          ],
          "display_name": false
        },
        {
          "uuid": "7bcab7f7-7666-454b-8d0d-db8bc49a8c61",
          "name": "NITROFEN [MI]",
          "stdName": "NITROFEN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0623ad1d-bbac-4f18-8ba0-1183ab760293",
            "3d7ca2a1-0221-4fbb-9028-1ee275c00dcc"
          ],
          "display_name": false
        },
        {
          "uuid": "9400007b-b99c-48db-b6bc-c60de9046800",
          "name": "TOK",
          "stdName": "TOK",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a614d6d-b77f-48ea-98ab-43d4b6e56674",
            "3d7ca2a1-0221-4fbb-9028-1ee275c00dcc"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8a614d6d-b77f-48ea-98ab-43d4b6e56674",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3d7ca2a1-0221-4fbb-9028-1ee275c00dcc",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02e55c4a-8b0f-4108-b98b-448e0097b923",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec45854a-75c1-4380-afe4-ac463bb8ca13",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f8b6fe4-e434-40f4-954d-67e2295710a5",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0623ad1d-bbac-4f18-8ba0-1183ab760293",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7c7d3e6-2693-464e-bf5f-ad2e53be48d6",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "120952cb-41ea-488d-b3fe-ad32fc0012d9",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60ad7511-114a-45a2-9dc9-98a6757e4d0b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389690000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "beba688f-17ad-4c8e-9bff-224833d4999f",
          "citation": "SRS import [N71UYG034A]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=N71UYG034A",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389690000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6a92d7a-7011-45a0-ae5e-f55731e87f24",
          "citation": "NITROFEN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ecd9c03a-6054-4c92-bc20-85d9259ca9a9",
          "citation": "NITROFEN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1e3c7de7-c90f-4dd2-8aa3-820dbe1d1fa5",
          "citation": "NITROFEN [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "15183d35-5ba9-25e6-96a6-019b0f628ca4",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+1836-75-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "edc62c2f-96de-2bb7-bd5b-58940fc5b8f0",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1836-75-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e0790667-e33c-b78d-a42f-0844f4c41bb5",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "f84d9376-3857-1980-8e12-3eec63c4775c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "28a4b547-8af4-def2-572b-4e05b4a994e6",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "76ba0994-6ffc-4788-9bdf-95b21fb9cd51",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2b5ee2ef-a2b0-ebbb-b08e-f88f07608e70",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "30d8429b-12e0-4a83-b516-47f0233711e6",
          "id": "30d8429b-12e0-4a83-b516-47f0233711e6",
          "molfile": "\n  Marvin  01132102372D          \n\n 18 19  0  0  0  0            999 V2000\n    0.0000   -1.2474    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.7158   -0.8402    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    0.7158    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4393   -1.2630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1577   -0.8584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8656   -1.2707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8656   -2.0928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5580   -2.5207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2816   -2.1110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2816   -1.3096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0207   -0.8895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7209   -1.3381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4651   -0.9206    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.7260   -2.1395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0207   -2.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0207   -3.3791    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.1317   -2.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4263   -2.0721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n 18  4  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n 17  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 15  9  2  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 18  1  0  0  0  0\nM  CHG  2   1  -1   2   1\nM  END",
          "smiles": "c1cc(c(cc1Cl)Cl)Oc2ccc(cc2)[N+](=O)[O-]",
          "formula": "C12H7Cl2NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d98c8586-6565-4838-a643-8370dd37abce"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "284.0952",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "846a6078-f793-4b3f-9782-cc8624fcab9c",
      "version": "9",
      "structure": {
        "id": "aaf64356-5dad-44e4-bb6e-8c3d518d32be",
        "molfile": "\n  Marvin  01132108522D          \n\n 18 19  0  0  0  0            999 V2000\n    0.7158   -0.8402    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    4.2816   -2.1110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0207   -2.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4393   -1.2630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2474    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.7260   -2.1395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5580   -2.5207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7158    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2816   -1.3096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4263   -2.0721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1577   -0.8584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7209   -1.3381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8656   -2.0928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0207   -3.3791    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.0207   -0.8895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8656   -1.2707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1317   -2.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4651   -0.9206    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  7  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7 13  1  0  0  0  0\n  8  1  2  0  0  0  0\n  9  2  1  0  0  0  0\n 10  4  2  0  0  0  0\n 11  4  1  0  0  0  0\n 12 15  1  0  0  0  0\n 13 16  1  0  0  0  0\n 14  3  1  0  0  0  0\n 15  9  2  0  0  0  0\n 16 11  2  0  0  0  0\n 17 10  1  0  0  0  0\n 18 12  1  0  0  0  0\n 17 13  2  0  0  0  0\n 12  6  2  0  0  0  0\nM  CHG  2   1   1   5  -1\nM  END",
        "smiles": "c1cc(c(cc1Cl)Cl)Oc2ccc(cc2)[N+](=O)[O-]",
        "formula": "C12H7Cl2NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "284.0952",
        "optical_activity": "NONE",
        "references": [
          "beba688f-17ad-4c8e-9bff-224833d4999f",
          "8a614d6d-b77f-48ea-98ab-43d4b6e56674"
        ],
        "stereo_centers": 0
      },
      "unii": "N71UYG034A"
    }
  ]
}