{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8ad11a16-6a83-4783-bae4-506294b44f92",
          "code": "39831-55-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=39831-55-5",
          "code_system": "CAS",
          "references": [
            "b3e89094-0ee2-48ff-8cb7-0526acdb8816",
            "9608807a-32c4-440f-84fd-1db00c15ab8e"
          ]
        },
        {
          "uuid": "58944c98-25cf-4e51-a319-806fd5e17636",
          "code": "C230",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C230",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b3e89094-0ee2-48ff-8cb7-0526acdb8816"
          ]
        },
        {
          "uuid": "1dcc91ba-b34b-4e5f-baa0-c922a567c8f7",
          "code": "254-648-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.049.662",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b3e89094-0ee2-48ff-8cb7-0526acdb8816"
          ]
        },
        {
          "uuid": "17a2681e-4ea6-4374-be55-52d5a1476497",
          "code": "AMIKACIN SULFATE",
          "comments": "Description: White or almost white, crystalline powder. Solubility: Freely soluble in water, practically insoluble in acetone R or ethanol (~750 g/l) TS. Category: Antibacterial. Storage: Amikacin sulfate should be kept in a tightly closed container, or if sterile, in a hermetically closed container. Labelling: The label states:- whether the substance is the (1:2) sulfate or the (1:1.8) sulfate form,- the content in terms of Amikacin, calculated with reference to the dried and sulfate-free substance,- where applicable, that the substances is free from bacterial endotoxins,- where applicable, that the substance is sterile.",
          "type": "PRIMARY",
          "url": "http://apps.who.int/phint/pdf/b/Jb.6.1.16.pdf",
          "code_system": "WHO INTERNATIONAL PHARMACOPEIA",
          "references": [
            "b3e89094-0ee2-48ff-8cb7-0526acdb8816"
          ]
        },
        {
          "uuid": "bbdee785-b216-419a-9403-8c03d6609686",
          "code": "643",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/643/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "b3e89094-0ee2-48ff-8cb7-0526acdb8816"
          ]
        },
        {
          "uuid": "d6bbfc1b-01c6-4bc4-b4db-ee7e5b202adc",
          "code": "m1670",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1670?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "b3e89094-0ee2-48ff-8cb7-0526acdb8816"
          ]
        },
        {
          "uuid": "eff7a51e-8719-414f-b6a2-2c2f14c3d592",
          "code": "SUB00444MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "b3e89094-0ee2-48ff-8cb7-0526acdb8816"
          ]
        },
        {
          "uuid": "a9feb047-f2fd-48b9-a2fe-23e81ed87e72",
          "code": "CHEMBL177",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL177",
          "code_system": "ChEMBL",
          "references": [
            "b3e89094-0ee2-48ff-8cb7-0526acdb8816"
          ]
        },
        {
          "uuid": "5c558f6b-0f5f-482a-9bb8-68cba0d00d69",
          "code": "38351",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/38351",
          "code_system": "PUBCHEM",
          "references": [
            "b3e89094-0ee2-48ff-8cb7-0526acdb8816"
          ]
        },
        {
          "uuid": "4657bdb6-fc84-7dce-181c-2cd7fc6e86b8",
          "code": "458114",
          "comments": "ORPHAN DRUG|Designated|Management of cystic fibrosis patients with Pseudomonas aeruginosa lung infections",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=458114",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "ff38415f-af04-0c05-9758-fc318787a0ba",
          "code": "C2363",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antibiotic[C258]|Aminoglycoside Antibiotic",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2363",
          "code_system": "NCI_THESAURUS",
          "references": [
            "6bdbd06b-61b0-049e-c15d-8e2f06daaa8a"
          ]
        },
        {
          "uuid": "b2ecc0be-1485-5a9b-ff76-0010fa4e44fb",
          "code": "EU/3/06/387",
          "comments": "EU ORPHAN DRUG|Positive|Treatment of Pseudomonas aeruginosa lung infection in cystic fibrosis",
          "type": "PRIMARY",
          "url": "https://www.ema.europa.eu/en/medicines/human/orphan-designations/eu306387",
          "code_system": "EU-Orphan Drug",
          "references": [
            "6bdbd06b-61b0-049e-c15d-8e2f06daaa8a"
          ]
        },
        {
          "uuid": "f2cc5be3-2349-484b-9b5d-1fb2bef8de2e",
          "code": "N6M33094FD",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4f75da21-c7a7-e846-bf2a-d426343d32f1",
          "code": "DBSALT000351",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DBSALT000351",
          "code_system": "DRUG BANK",
          "references": [
            "6bdbd06b-61b0-049e-c15d-8e2f06daaa8a"
          ]
        },
        {
          "uuid": "aa7bbeed-2aac-7ff7-d685-a8f6d9b1133f",
          "code": "1019494",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1019494",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "6bdbd06b-61b0-049e-c15d-8e2f06daaa8a"
          ]
        },
        {
          "uuid": "ad297b68-f4a5-99cd-0066-ce51629812ff",
          "code": "2638",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:2638",
          "code_system": "CHEBI",
          "references": [
            "6bdbd06b-61b0-049e-c15d-8e2f06daaa8a"
          ]
        },
        {
          "uuid": "a8f52943-5d70-d0d0-6074-037a416f340d",
          "code": "N6M33094FD",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=N6M33094FD",
          "code_system": "DAILYMED",
          "references": [
            "0365ffdc-bee8-9a9d-b05d-3b6ac1a98429"
          ]
        },
        {
          "uuid": "9460651c-2e85-248f-60c1-4cdd665c7e4b",
          "code": "755846",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=755846",
          "code_system": "NSC",
          "references": [
            "ea7f097b-3e87-6cb2-03f9-fb367ed82180"
          ]
        },
        {
          "uuid": "54c5f8f8-4e55-e405-b427-0d4cac7da0aa",
          "code": "DTXSID601045247",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID601045247",
          "code_system": "EPA CompTox",
          "references": [
            "7eed3fbf-e8ea-2b9b-92a8-d7286d0c686a"
          ]
        },
        {
          "uuid": "ca838394-0f0e-5153-ebf5-474d0657577d",
          "code": "100000085153",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "27fbdef9-ce56-dfa3-d3f9-b1b93b40325b"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "6ff69e5d-01eb-4c42-b6bc-0823c17f0d40",
          "citation": "USP Dictionary 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "01125278-747e-4e40-9f7d-8b139ad8a404",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ab85f2d-a4d6-4a64-9e44-b12b04bd97b6",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "12ce64c3-7d75-4d92-babc-4db71e2799b0",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d3ede8b4-1045-428a-ad78-7f152d620557",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a3614ea-a154-4155-b53c-1ef6b6c7826a",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "70ee8c01-c06a-4409-a243-58bba8dec740",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a1296815-e0a7-4342-a38e-3e934362bb14",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f01582d-dade-4e52-8cac-3c68aeb53bb2",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b10a6f07-d9e9-4060-abf8-f834cdcd2745",
          "citation": "FDA SRS 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89e16abe-bf99-43a3-a865-02d07ef309be",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4457303c-49ab-40ae-ac7f-68f9236470c4",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8263b0b5-6eb7-4c59-a99c-d0db968007a5",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f41af882-a8b8-4484-a276-803d4b21e88e",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00fbcd91-ece4-46c8-8acf-8ca61a9fb607",
          "citation": "http://www.drugoffice.gov.hk/eps/productDetailActionNew.do?lang=en&section=consumer&id=120969",
          "url": "http://www.drugoffice.gov.hk/eps/productDetailActionNew.do?lang=en&section=consumer&id=120969",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa83724a-64c7-41ef-8ee5-a0d57f48da94",
          "citation": "WHO-IP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3e89094-0ee2-48ff-8cb7-0526acdb8816",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389706000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3e11b9b-d8d5-4d44-a6da-115c34a3933a",
          "citation": "THE INTERNATIONAL PHARMACOPOEIA FIFTH EDITION",
          "url": "http://apps.who.int/phint/en/p/docf/",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c33cb01a-c0ff-4665-96d0-50dc673d9b28",
          "citation": "SRS import [N6M33094FD]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=N6M33094FD",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389706000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b171f9e9-cd4e-4bc1-8d7c-ebefdfb6223c",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27216869-f200-41df-a9b1-8054b8f96fa5",
          "citation": "AMIKACIN SULFATE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "22f8a022-0062-4f51-b35b-08fd126b16ff",
          "citation": "AMIKACIN SULFATE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c2744833-750e-407e-b1db-275b7c32d435",
          "citation": "AMIKACIN SULFATE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bdc37920-7829-4d3d-b35d-4b65ea7cc55f",
          "citation": "AMIKACIN SULFATE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "09e23db2-e93f-493e-9f0f-d09d87173bd0",
          "citation": "AMIKACIN SULFATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4b2758dd-e09d-4f26-b39d-588c3b9c7407",
          "citation": "AMIKACIN SULFATE [GREEN BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cda5ecf4-92ec-4d26-8f9a-fb0ff97e2354",
          "citation": "AMIKACIN SULFATE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "097d1277-8a33-4718-9c93-13975f429dc6",
          "citation": "AMIKACIN SULFATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "14e02a0d-6a16-4b2d-9c16-2d80705b29e3",
          "citation": "AMIKACIN SULFATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8d993fbe-b611-4c8a-8b57-f8664651c23b",
          "citation": "AMIKACIN SULFATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8d95b0aa-bef0-4afd-a440-f11a1985f3e9",
          "citation": "AMIKACIN SULFATE [WHO-IP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "df568f18-fd85-efef-5d73-97c677f6c7c8",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b1db52a2-060f-2010-8ebd-b92beffc633a",
          "citation": "http://online6.edqm.eu/ep906/mobile/#documentPage",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "76745b1b-e20d-0124-b329-6ad9975c4287",
          "citation": "Drug Information Handbook, 2016-2017 - 25th edition;  Lexicomp Drug Reference Handbook;  ISBN13: 9781591953531",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ef8703ed-0c1f-91e8-8920-3758c4214766",
          "citation": "https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=499ab990-2b21-474f-aaba-d86388965f40",
          "doc_type": "DAILYMED",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f41a0d2f-7ae7-34a6-3ef6-87f55b742dff",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/label/2018/207356s000lbl.pdf",
          "doc_type": "DRUGS@FDA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "6bdbd06b-61b0-049e-c15d-8e2f06daaa8a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "9608807a-32c4-440f-84fd-1db00c15ab8e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4170a33e-46bb-7b15-bc87-b6d9d4fa6166",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "ea7f097b-3e87-6cb2-03f9-fb367ed82180",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "1fad6c02-413d-1826-ea69-604d1944e972",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "0365ffdc-bee8-9a9d-b05d-3b6ac1a98429",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "8dc0ace0-5f90-fde8-330c-5c66bcae6271",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "7eed3fbf-e8ea-2b9b-92a8-d7286d0c686a",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "27fbdef9-ce56-dfa3-d3f9-b1b93b40325b",
          "citation": "EMA 2023",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "323808ff-9d59-4d2f-ab35-f200c1d4220b",
          "id": "323808ff-9d59-4d2f-ab35-f200c1d4220b",
          "molfile": "\n  Marvin  01132102412D          \n\n  5  4  0  0  1  0            999 V2000\n    9.7459   -5.7667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5709   -5.7667    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3959   -5.7667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5667   -4.9417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5667   -6.5917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\n  2  5  2  0  0  0  0\nM  END",
          "smiles": "OS(=O)(=O)O",
          "formula": "H2O4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "3ee3f9ea-787d-44e9-9254-a82ebee53e59"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "98.0796",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "7fda0a22-7176-4a5b-be82-9d348dd56204",
          "id": "7fda0a22-7176-4a5b-be82-9d348dd56204",
          "molfile": "\n  Marvin  01132106382D          \n\n 40 42  0  0  1  0            999 V2000\n    7.5449   -8.5667    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.5375   -9.3917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2574   -8.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9699   -8.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6824   -8.1542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8324   -8.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8250   -7.3292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1616   -8.5792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4074   -8.1542    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.6954   -8.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9834   -8.1542    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.2704   -8.5625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9834   -7.3292    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.2704   -6.9125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5584   -7.3292    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    2.5584   -8.1542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8454   -8.5708    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    1.8375   -9.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1209   -9.8042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1334   -8.1542    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    0.4167   -8.5625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1334   -7.3292    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    0.4167   -6.9167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8454   -6.9208    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    1.8375   -6.0958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6954   -6.9125    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.6875   -6.0875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4074   -7.3292    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.1167   -6.9125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1246   -5.3583    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.8366   -4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8366   -4.1250    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.5459   -3.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2584   -4.1208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1246   -3.7083    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.1167   -2.8833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4125   -4.1250    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.6959   -3.7125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4125   -4.9500    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.6292   -5.3583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  6  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  6  0  0  0\n  9 10  1  0  0  0  0\n  9 28  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  6  0  0  0\n 13 11  1  0  0  0  0\n 13 14  1  1  0  0  0\n 26 13  1  0  0  0  0\n 15 14  1  1  0  0  0\n 15 16  1  0  0  0  0\n 24 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  6  0  0  0\n 17 20  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 21  1  1  0  0  0\n 20 22  1  0  0  0  0\n 22 23  1  6  0  0  0\n 22 24  1  0  0  0  0\n 24 25  1  1  0  0  0\n 26 27  1  6  0  0  0\n 28 26  1  0  0  0  0\n 28 29  1  1  0  0  0\n 30 29  1  6  0  0  0\n 30 31  1  0  0  0  0\n 39 30  1  0  0  0  0\n 32 31  1  0  0  0  0\n 32 33  1  1  0  0  0\n 35 32  1  0  0  0  0\n 33 34  1  0  0  0  0\n 35 36  1  6  0  0  0\n 37 35  1  0  0  0  0\n 37 38  1  1  0  0  0\n 39 37  1  0  0  0  0\n 39 40  1  6  0  0  0\nM  END",
          "smiles": "C(CN)[C@@H](C(=O)N[C@@H]1C[C@@H]([C@H]([C@@H]([C@H]1O[C@@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)N)O)O)O[C@@H]3[C@@H]([C@H]([C@@H]([C@@H](CN)O3)O)O)O)N)O",
          "formula": "C22H43N5O13",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c1444a88-c3f0-4709-891d-6fc1b856b80a"
          },
          "defined_stereo": 16,
          "ez_centers": 0,
          "molecular_weight": "585.6034",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 16
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b7fad284-791f-4d47-861e-5fce8f9cc93a",
      "version": "37",
      "structure": {
        "id": "7aef071c-721d-4bcf-995d-482aae0d5369",
        "molfile": "\n  Marvin  01132106232D          \n\n 52 52  0  0  1  0            999 V2000\n    5.4125   -4.1250    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.4125   -4.9500    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.1246   -5.3583    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.8366   -4.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8366   -4.1250    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.1246   -3.7083    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.4074   -8.1542    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.1616   -8.5792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8324   -8.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5449   -8.5667    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.2574   -8.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9699   -8.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6824   -8.1542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9834   -7.3292    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.9834   -8.1542    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.6954   -8.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4074   -7.3292    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.6954   -6.9125    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.5584   -7.3292    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.5584   -8.1542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2704   -8.5625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2704   -6.9125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8454   -6.9208    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.1334   -7.3292    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.1334   -8.1542    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.8454   -8.5708    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.8375   -6.0958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4167   -6.9167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4167   -8.5625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8375   -9.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1209   -9.8042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2709   -7.7417    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6875   -6.0875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1167   -6.9125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8250   -7.3292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5375   -9.3917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1167   -2.8833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5459   -3.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2584   -4.1208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4042   -5.7667    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6292   -5.3583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6959   -3.7125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7459   -5.7667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5709   -5.7667    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3959   -5.7667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5667   -4.9417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5667   -6.5917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7459   -5.7667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5709   -5.7667    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3959   -5.7667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5667   -4.9417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5667   -6.5917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n 17 34  1  1  0  0  0\n 15 16  1  0  0  0  0\n  9 35  2  0  0  0  0\n 16  7  1  0  0  0  0\n 10 36  1  6  0  0  0\n 34  3  1  0  0  0  0\n  7 17  1  0  0  0  0\n  6 37  1  6  0  0  0\n 17 18  1  0  0  0  0\n  5 38  1  1  0  0  0\n 19 20  1  0  0  0  0\n 38 39  1  0  0  0  0\n  8  9  1  0  0  0  0\n  3 40  1  1  0  0  0\n  1  6  1  0  0  0  0\n  2 41  1  6  0  0  0\n  9 10  1  0  0  0  0\n  1 42  1  1  0  0  0\n  2  3  1  0  0  0  0\n 19 22  1  0  0  0  0\n 15 21  1  6  0  0  0\n 14 22  1  1  0  0  0\n 10 11  1  0  0  0  0\n  3  4  1  0  0  0  0\n 11 12  1  0  0  0  0\n  4  5  1  0  0  0  0\n 20 26  1  0  0  0  0\n 19 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 12 13  1  0  0  0  0\n 23 27  1  1  0  0  0\n 14 15  1  0  0  0  0\n 24 28  1  6  0  0  0\n  5  6  1  0  0  0  0\n 25 29  1  1  0  0  0\n 26 30  1  6  0  0  0\n 30 31  1  0  0  0  0\n 43 44  1  0  0  0  0\n 44 45  1  0  0  0  0\n 44 46  2  0  0  0  0\n 44 47  2  0  0  0  0\n  7  8  1  6  0  0  0\n 19 32  1  6  0  0  0\n  1  2  1  0  0  0  0\n 18 33  1  6  0  0  0\n 14 18  1  0  0  0  0\n 48 49  1  0  0  0  0\n 49 50  1  0  0  0  0\n 49 51  2  0  0  0  0\n 49 52  2  0  0  0  0\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 10  43  44  45  46  47  48  49  50  51  52\nM  SPA   1  5  43  44  45  46  47\nM  SDI   1  4    9.3259   -7.0117    9.3259   -4.5217\nM  SDI   1  4   11.8159   -4.5217   11.8159   -7.0117\nM  SMT   1 2\nM  END",
        "smiles": "C(CN)[C@@H](C(=O)N[C@@H]1C[C@@H]([C@H]([C@@H]([C@H]1O[C@]2([H])[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)N)O)O)O[C@]3([H])[C@@H]([C@H]([C@@H]([C@@H](CN)O3)O)O)O)N)O.OS(=O)(=O)O.OS(=O)(=O)O",
        "formula": "C22H43N5O13.2H2O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 16,
        "ez_centers": 0,
        "molecular_weight": "781.7626",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b171f9e9-cd4e-4bc1-8d7c-ebefdfb6223c",
          "c33cb01a-c0ff-4665-96d0-50dc673d9b28"
        ],
        "stereo_centers": 16
      },
      "unii": "N6M33094FD",
      "relationships": [
        {
          "uuid": "30dad7dd-a678-4c23-a08c-0f5af4091ec5",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "23143737-5ebb-401b-bead-f61e4bc4a4c7",
            "refuuid": "48393bad-868a-4c88-a444-701356bfb177",
            "name": "AMIKACIN",
            "unii": "84319SGC3C",
            "linking_id": "84319SGC3C",
            "ref_pname": "AMIKACIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a4ac19aa-38ba-4e94-bf92-6be61dc7b4a4",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "ea78f1f8-3064-4e20-a094-efa941bc6e31",
            "refuuid": "48393bad-868a-4c88-a444-701356bfb177",
            "name": "AMIKACIN",
            "unii": "84319SGC3C",
            "linking_id": "84319SGC3C",
            "ref_pname": "AMIKACIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6b8b4201-689d-456c-8a9f-c6aeee67d4c3",
          "amount": {
            "uuid": "656d798b-f033-4a4b-860d-479e220a5113",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 102,
            "low_limit": 96.5
          },
          "comments": "Amikacin sulfate is a semi-synthetic product derived from a fermentation product, kanamycin A. Amikacin sulfate (1:2) contains not less than 96.5% and not more than 102.0% of amikacin sulfate (C22H43N5O13,2H2SO4), calculated with reference to the dried substance. Amikacin sulfate (1:1.8) contains not less than 96.5% and not more than 102.0% of amikacin sulfate (C22H43N5O13,1.8H2SO4), calculated with reference to the dried substance.",
          "type": "IMPURITY->PARENT",
          "references": [
            "b3e11b9b-d8d5-4d44-a6da-115c34a3933a",
            "b1db52a2-060f-2010-8ebd-b92beffc633a"
          ],
          "related_substance": {
            "uuid": "de3673e9-35bb-4b28-9abc-1f9ed1e73d49",
            "refuuid": "fa1ae237-5d06-4a1b-90ef-7d5c0173587c",
            "name": "KANAMYCIN A",
            "unii": "EQK9Q303C5",
            "linking_id": "EQK9Q303C5",
            "ref_pname": "KANAMYCIN A",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e023d559-a247-4f49-b345-580ddffff490",
          "type": "IMPURITY->PARENT",
          "references": [
            "b1db52a2-060f-2010-8ebd-b92beffc633a"
          ],
          "related_substance": {
            "uuid": "9a7eccb4-ce86-4c0b-97a0-8b7a4ca68744",
            "refuuid": "2a57de0d-9d4a-4ce6-92e1-c96c53c9c434",
            "name": "KANAMYCIN",
            "unii": "RUC37XUP2P",
            "linking_id": "RUC37XUP2P",
            "ref_pname": "KANAMYCIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1af5efaf-6945-4720-8bfd-410c4c8ba684",
          "amount": {
            "uuid": "0a6a0cf5-2e94-45ca-a366-a22b243edaf3",
            "type": "WEIGHT PERCENT",
            "units": "%",
            "high_limit": 0.5,
            "non_numeric_value": "peak area"
          },
          "type": "IMPURITY->PARENT",
          "related_substance": {
            "uuid": "981190c2-ea2f-4bec-b94f-15525fd0d626",
            "refuuid": "8a78cbec-ad33-44b2-9844-760c3be6bbf2",
            "name": "4-AMINO-2-HYDROXYBUTYRIC ACID, (S)-(-)-",
            "unii": "2Z3NQ8MG2T",
            "linking_id": "2Z3NQ8MG2T",
            "ref_pname": "4-AMINO-2-HYDROXYBUTYRIC ACID, (S)-(-)-"
          }
        }
      ],
      "names": [
        {
          "uuid": "db88a857-a10f-4d63-b9d3-410badc63f87",
          "name": "AMIKACIN (AS SULFATE)",
          "stdName": "AMIKACIN (AS SULFATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00fbcd91-ece4-46c8-8acf-8ca61a9fb607"
          ],
          "display_name": false
        },
        {
          "uuid": "a0306180-b4f4-449a-be45-956c54a1c66e",
          "name": "AMIKACIN SULFATE",
          "stdName": "AMIKACIN SULFATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09e23db2-e93f-493e-9f0f-d09d87173bd0",
            "f41af882-a8b8-4484-a276-803d4b21e88e",
            "27216869-f200-41df-a9b1-8054b8f96fa5",
            "b10a6f07-d9e9-4060-abf8-f834cdcd2745",
            "4b2758dd-e09d-4f26-b39d-588c3b9c7407",
            "4457303c-49ab-40ae-ac7f-68f9236470c4",
            "9a3614ea-a154-4155-b53c-1ef6b6c7826a",
            "d3ede8b4-1045-428a-ad78-7f152d620557",
            "70ee8c01-c06a-4409-a243-58bba8dec740",
            "6ff69e5d-01eb-4c42-b6bc-0823c17f0d40",
            "22f8a022-0062-4f51-b35b-08fd126b16ff",
            "aa83724a-64c7-41ef-8ee5-a0d57f48da94",
            "c2744833-750e-407e-b1db-275b7c32d435",
            "89e16abe-bf99-43a3-a865-02d07ef309be",
            "097d1277-8a33-4718-9c93-13975f429dc6",
            "8d993fbe-b611-4c8a-8b57-f8664651c23b",
            "9f01582d-dade-4e52-8cac-3c68aeb53bb2",
            "14e02a0d-6a16-4b2d-9c16-2d80705b29e3",
            "cda5ecf4-92ec-4d26-8f9a-fb0ff97e2354",
            "8263b0b5-6eb7-4c59-a99c-d0db968007a5",
            "8d95b0aa-bef0-4afd-a440-f11a1985f3e9",
            "a1296815-e0a7-4342-a38e-3e934362bb14",
            "bdc37920-7829-4d3d-b35d-4b65ea7cc55f"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "82fd0253-b9e8-4a4e-907f-16ed2febf963",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "ab95ea66-873c-6cf9-db1b-3be84cfe19c0",
          "name": "AMIKACIN SULFATE [EP IMPURITY]",
          "stdName": "AMIKACIN SULFATE [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9a3614ea-a154-4155-b53c-1ef6b6c7826a"
          ],
          "display_name": false
        },
        {
          "uuid": "cf178852-e489-2fb5-a916-55ea503809c0",
          "name": "AMIKACIN SULFATE [EP MONOGRAPH]",
          "stdName": "AMIKACIN SULFATE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fad6c02-413d-1826-ea69-604d1944e972"
          ],
          "display_name": false
        },
        {
          "uuid": "160bd40e-2d59-4289-b27d-00a15f4f47e3",
          "name": "AMIKACIN SULFATE [GREEN BOOK]",
          "stdName": "AMIKACIN SULFATE [GREEN BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b10a6f07-d9e9-4060-abf8-f834cdcd2745"
          ],
          "display_name": false
        },
        {
          "uuid": "9190450c-a69a-4bd1-8665-b8d382ac21e1",
          "name": "AMIKACIN SULFATE [JAN]",
          "stdName": "AMIKACIN SULFATE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "df568f18-fd85-efef-5d73-97c677f6c7c8"
          ],
          "display_name": false
        },
        {
          "uuid": "c8381e8c-55ce-41a3-925a-a3400978c43e",
          "name": "AMIKACIN SULFATE [MART.]",
          "stdName": "AMIKACIN SULFATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9f01582d-dade-4e52-8cac-3c68aeb53bb2"
          ],
          "display_name": false
        },
        {
          "uuid": "44d2e7dd-fc20-4974-b694-d1d1eeed07f6",
          "name": "AMIKACIN SULFATE [MI]",
          "stdName": "AMIKACIN SULFATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f41af882-a8b8-4484-a276-803d4b21e88e"
          ],
          "display_name": false
        },
        {
          "uuid": "f11629fe-a67b-4809-8355-d83d495b7bc8",
          "name": "AMIKACIN SULFATE [ORANGE BOOK]",
          "stdName": "AMIKACIN SULFATE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1296815-e0a7-4342-a38e-3e934362bb14"
          ],
          "display_name": false
        },
        {
          "uuid": "4cdcb3b7-449a-49bd-8d46-202027675d1a",
          "name": "AMIKACIN SULFATE [USAN]",
          "stdName": "AMIKACIN SULFATE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d3ede8b4-1045-428a-ad78-7f152d620557"
          ],
          "display_name": false
        },
        {
          "uuid": "cdecd916-8c7f-eb3a-44d3-f255b11733e7",
          "name": "AMIKACIN SULFATE [USP MONOGRAPH]",
          "stdName": "AMIKACIN SULFATE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4170a33e-46bb-7b15-bc87-b6d9d4fa6166"
          ],
          "display_name": false
        },
        {
          "uuid": "0961bb54-c3cb-44e0-b9de-acba9f1902e9",
          "name": "AMIKACIN SULFATE [USP-RS]",
          "stdName": "AMIKACIN SULFATE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "89e16abe-bf99-43a3-a865-02d07ef309be"
          ],
          "display_name": false
        },
        {
          "uuid": "e045a739-e875-46c7-ab6a-599a72fb2709",
          "name": "AMIKACIN SULFATE [VANDF]",
          "stdName": "AMIKACIN SULFATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8263b0b5-6eb7-4c59-a99c-d0db968007a5"
          ],
          "display_name": false
        },
        {
          "uuid": "a9ec8576-0dfd-4615-942a-8c9fe6b29b0e",
          "name": "AMIKACIN SULPHATE",
          "stdName": "AMIKACIN SULPHATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "12ce64c3-7d75-4d92-babc-4db71e2799b0"
          ],
          "display_name": false
        },
        {
          "uuid": "2f333de6-fba0-4011-8f23-5529766b69a8",
          "name": "AMIKACINI SULFAS [WHO-IP]",
          "stdName": "AMIKACINI SULFAS [WHO-IP]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa83724a-64c7-41ef-8ee5-a0d57f48da94"
          ],
          "display_name": false
        },
        {
          "uuid": "a113ce9e-8bb2-4a33-8816-cb29aec748ba",
          "name": "AMIKIN",
          "stdName": "AMIKIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2ab85f2d-a4d6-4a64-9e44-b12b04bd97b6"
          ],
          "display_name": false
        },
        {
          "uuid": "df0216aa-db1c-e91a-f8c4-465461e98713",
          "name": "ARIKAYCE",
          "stdName": "ARIKAYCE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef8703ed-0c1f-91e8-8920-3758c4214766",
            "f41a0d2f-7ae7-34a6-3ef6-87f55b742dff"
          ],
          "display_name": false
        },
        {
          "uuid": "a47f6e77-7c22-3024-6a16-ef6b0303c162",
          "name": "Amikacin sulfate [WHO-DD]",
          "stdName": "AMIKACIN SULFATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8dc0ace0-5f90-fde8-330c-5c66bcae6271"
          ],
          "display_name": false
        },
        {
          "uuid": "26df330a-9738-4e38-9bab-c0915e0197d8",
          "name": "BB-K8",
          "stdName": "BB-K8",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01125278-747e-4e40-9f7d-8b139ad8a404"
          ],
          "display_name": false
        },
        {
          "uuid": "ba8c21d4-c6a7-4acb-849e-cc12f8e2e175",
          "name": "D-STREPTAMINE, O-3-AMINO-3-DEOXY-.ALPHA.-D-GLUCOPYRANOSYL-(1->6)-O-(6-AMINO-6-DEOXY-.ALPHA.-D-GLUCOPYRANOSYL-(1->4))-N(SUP 1)-(4-AMINO-2-HYDROXY-1-OXOBUTYL)-2-DEOXY-, (S)-, SULFATE (1:2) (SALT)",
          "stdName": "D-STREPTAMINE, O-3-AMINO-3-DEOXY-.ALPHA.-D-GLUCOPYRANOSYL-(1->6)-O-(6-AMINO-6-DEOXY-.ALPHA.-D-GLUCOPYRANOSYL-(1->4))-N(SUP 1)-(4-AMINO-2-HYDROXY-1-OXOBUTYL)-2-DEOXY-, (S)-, SULFATE (1:2) (SALT)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01125278-747e-4e40-9f7d-8b139ad8a404"
          ],
          "display_name": false
        },
        {
          "uuid": "75767213-d11b-4854-8daf-8e291331bab6",
          "name": "D-STREPTAMINE, O-3-AMINO-3-DEOXY-.ALPHA.-D-GLUCOPYRANOSYL-(1->6)-O-(6-AMINO-6-DEOXY-.ALPHA.-D-GLUCOPYRANOSYL-(1->4))-N(SUP 1)-(4-AMINO-2-HYDROXY-1-OXOBUTYL)-2-DEOXY-, (S)-, SULPHATE (1:2) (SALT)",
          "stdName": "D-STREPTAMINE, O-3-AMINO-3-DEOXY-.ALPHA.-D-GLUCOPYRANOSYL-(1->6)-O-(6-AMINO-6-DEOXY-.ALPHA.-D-GLUCOPYRANOSYL-(1->4))-N(SUP 1)-(4-AMINO-2-HYDROXY-1-OXOBUTYL)-2-DEOXY-, (S)-, SULPHATE (1:2) (SALT)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "12ce64c3-7d75-4d92-babc-4db71e2799b0"
          ],
          "display_name": false
        },
        {
          "uuid": "f5ef3cc0-226a-c994-dde2-ba96062019a3",
          "name": "NSC-755846",
          "stdName": "NSC-755846",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ea7f097b-3e87-6cb2-03f9-fb367ed82180"
          ],
          "display_name": false
        },
        {
          "uuid": "e5a493dc-b832-4097-87c8-8efcba522d55",
          "name": "O-3-AMINO-3-DEOXY-.ALPHA.-D-GLUCOPYRANOSYL-(1->4)-O-(6-AMINO-6-DEOXY-.ALPHA.-D-GLUCOPYRANOSYL-(1->6))-N(SUP 3)-(4-AMINO-L-2-HYDROXYBUTYRYL)-2-DEOXY-L-STREPTAMINE SULFATE (1:2)",
          "stdName": "O-3-AMINO-3-DEOXY-.ALPHA.-D-GLUCOPYRANOSYL-(1->4)-O-(6-AMINO-6-DEOXY-.ALPHA.-D-GLUCOPYRANOSYL-(1->6))-N(SUP 3)-(4-AMINO-L-2-HYDROXYBUTYRYL)-2-DEOXY-L-STREPTAMINE SULFATE (1:2)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2ab85f2d-a4d6-4a64-9e44-b12b04bd97b6"
          ],
          "display_name": false
        },
        {
          "uuid": "9511bf9b-b793-4cd4-a4ab-785dcf37a4bb",
          "name": "O-3-AMINO-3-DEOXY-.ALPHA.-D-GLUCOPYRANOSYL-(1->4)-O-(6-AMINO-6-DEOXY-.ALPHA.-D-GLUCOPYRANOSYL-(1->6))-N(SUP 3)-(4-AMINO-L-2-HYDROXYBUTYRYL)-2-DEOXY-L-STREPTAMINE SULPHATE (1:2)",
          "stdName": "O-3-AMINO-3-DEOXY-.ALPHA.-D-GLUCOPYRANOSYL-(1->4)-O-(6-AMINO-6-DEOXY-.ALPHA.-D-GLUCOPYRANOSYL-(1->6))-N(SUP 3)-(4-AMINO-L-2-HYDROXYBUTYRYL)-2-DEOXY-L-STREPTAMINE SULPHATE (1:2)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "12ce64c3-7d75-4d92-babc-4db71e2799b0"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "2eb5b43c-bf5e-4a9f-9b19-23decba4eb1d",
          "name": "Volume of Distribution",
          "value": {
            "uuid": "7f591663-5682-47a4-9617-a82a2457e9c1",
            "average": 0.25,
            "units": "Liters/Kilogram"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "76745b1b-e20d-0124-b329-6ad9975c4287"
          ]
        }
      ]
    }
  ]
}