{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ed43bc94-922b-441f-a961-c040bad842af",
          "code": "1220-94-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1220-94-6",
          "code_system": "CAS",
          "references": [
            "bf87908f-1651-47a7-93f5-d8cf11f8e950",
            "f599f556-5fcc-4fd6-a837-23562caf9cdb"
          ]
        },
        {
          "uuid": "16648eeb-cd81-41e5-b5c8-0ffb956cb4dd",
          "code": "214-944-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.013.586",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "bf87908f-1651-47a7-93f5-d8cf11f8e950"
          ]
        },
        {
          "uuid": "f6540f83-e849-4e93-a7fa-d2acee5de8e7",
          "code": "14650",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/14650",
          "code_system": "PUBCHEM",
          "references": [
            "bf87908f-1651-47a7-93f5-d8cf11f8e950"
          ]
        },
        {
          "uuid": "c181b4a4-9d98-7d7d-823a-6c5aebc9b262",
          "code": "DTXSID8051621",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8051621",
          "code_system": "EPA CompTox",
          "references": [
            "8ff26943-74cc-e558-5dda-5de8d2a01f71"
          ]
        },
        {
          "uuid": "63ed2ae9-8165-44e6-b4cb-bf1ce5143937",
          "code": "N6G7KN58RR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "dd9ef693-72a1-4d49-9c1e-810aa54de45d",
          "name": "1-AMINO-4-(METHYLAMINO)-9,10-ANTHRACENEDIONE",
          "stdName": "1-AMINO-4-(METHYLAMINO)-9,10-ANTHRACENEDIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26c6af29-0e50-4801-b0c9-3f7b744ce3ef"
          ],
          "display_name": false
        },
        {
          "uuid": "82feeb8d-f35c-d2c2-bed0-63ef3325a199",
          "name": "9,10-ANTHRACENEDIONE, 1-AMINO-4-(METHYLAMINO)-",
          "stdName": "9,10-ANTHRACENEDIONE, 1-AMINO-4-(METHYLAMINO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67043c85-e70b-441c-7ed0-6519c045cc7c"
          ],
          "display_name": false
        },
        {
          "uuid": "da35bd75-cded-847d-8577-e9dfaa76985b",
          "name": "CI 61105",
          "stdName": "CI 61105",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67043c85-e70b-441c-7ed0-6519c045cc7c"
          ],
          "display_name": false
        },
        {
          "uuid": "af99d3bf-cb47-78df-469a-dda4f8939af6",
          "name": "DISPERSE VIOLET 4",
          "stdName": "DISPERSE VIOLET 4",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67043c85-e70b-441c-7ed0-6519c045cc7c"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "63c6bba4-8515-44e5-85cd-e0816c90dd12",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "2f453647-046a-31a2-cd3f-4a188c1b070f",
          "name": "LOWADENE VIOLET 4",
          "stdName": "LOWADENE VIOLET 4",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67043c85-e70b-441c-7ed0-6519c045cc7c"
          ],
          "display_name": false
        },
        {
          "uuid": "c41460a2-e095-79a3-f9e7-52942a7d9780",
          "name": "SOLVENT VIOLET 12",
          "stdName": "SOLVENT VIOLET 12",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67043c85-e70b-441c-7ed0-6519c045cc7c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "26c6af29-0e50-4801-b0c9-3f7b744ce3ef",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf87908f-1651-47a7-93f5-d8cf11f8e950",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392159000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ff26943-74cc-e558-5dda-5de8d2a01f71",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1220-94-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "67043c85-e70b-441c-7ed0-6519c045cc7c",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f599f556-5fcc-4fd6-a837-23562caf9cdb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ffdbdc98-0229-4a5e-b2c2-92439479762c",
          "id": "ffdbdc98-0229-4a5e-b2c2-92439479762c",
          "molfile": "\n  Marvin  01132113142D          \n\n 19 21  0  0  0  0            999 V2000\n    0.2875   -4.0126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7038   -3.3045    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7124   -2.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.0729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7081   -0.8412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7038   -0.0129    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4206   -1.2446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1329   -0.8283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1244    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8540   -1.2403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5663   -0.8240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2830   -1.2317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2915   -2.0643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5750   -2.4805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8582   -2.0686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1416   -2.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1329   -3.3045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4248   -2.0772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3 19  2  0  0  0  0\n  5  4  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  8 19  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 16  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 19 17  1  0  0  0  0\nM  END",
          "smiles": "CNc1ccc(c2c1C(=O)c3ccccc3C2=O)N",
          "formula": "C15H12N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "abc470e6-e417-4a58-babe-793edbd229dd"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "252.2685",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cafed510-b523-4c80-8e36-2b705630f5d5",
      "version": "6",
      "structure": {
        "id": "29963559-1159-463f-9f03-0e3b96977835",
        "molfile": "\n  Marvin  01132102162D          \n\n 19 21  0  0  0  0            999 V2000\n    0.0000   -1.2489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.0729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7124   -2.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7081   -0.8412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4206   -1.2446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4248   -2.0772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1416   -2.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1329   -0.8283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8540   -1.2403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8582   -2.0686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5750   -2.4805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2915   -2.0643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2830   -1.2317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5663   -0.8240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1244    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1329   -3.3045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7038   -3.3045    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2875   -4.0126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7038   -0.0129    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  4  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  6  2  0  0  0  0\n  3 17  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4 19  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  8  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7 10  1  0  0  0  0\n  7 16  2  0  0  0  0\n  8  9  1  0  0  0  0\n  8 15  2  0  0  0  0\n  9 10  2  0  0  0  0\n  9 14  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
        "smiles": "CNc1ccc(c2c1C(=O)c3ccccc3C2=O)N",
        "formula": "C15H12N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "252.2685",
        "optical_activity": "NONE",
        "references": [
          "26c6af29-0e50-4801-b0c9-3f7b744ce3ef",
          "67043c85-e70b-441c-7ed0-6519c045cc7c"
        ],
        "stereo_centers": 0
      },
      "unii": "N6G7KN58RR"
    }
  ]
}