{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3ab53932-724f-40d2-ad94-b9a086448fee",
          "code": "208-146-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.407",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "26286072-6a95-45dc-b82d-3452b95c9e3d"
          ]
        },
        {
          "uuid": "285faa39-0499-49df-86e3-74c897ae15c5",
          "code": "439242",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439242",
          "code_system": "PUBCHEM",
          "references": [
            "26286072-6a95-45dc-b82d-3452b95c9e3d"
          ]
        },
        {
          "uuid": "341a4268-f851-4cf4-a2f1-42b87d636aa7",
          "code": "512-69-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=512-69-6",
          "code_system": "CAS",
          "references": [
            "26286072-6a95-45dc-b82d-3452b95c9e3d",
            "f8958bbc-7622-45ea-9437-4ac67f232bca"
          ]
        },
        {
          "uuid": "6440a895-33ce-44bd-83e1-015fd964ab47",
          "code": "C68475",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68475",
          "code_system": "NCI_THESAURUS",
          "references": [
            "26286072-6a95-45dc-b82d-3452b95c9e3d"
          ]
        },
        {
          "uuid": "893c99d3-59b8-4c49-aa96-e8775a94e9af",
          "code": "RAFFINOSE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Raffinose",
          "code_system": "WIKIPEDIA",
          "references": [
            "26286072-6a95-45dc-b82d-3452b95c9e3d"
          ]
        },
        {
          "uuid": "3bd4a348-c8ff-4536-af2c-bd3eb6ffc872",
          "code": "1362905",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1362905/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "26286072-6a95-45dc-b82d-3452b95c9e3d"
          ]
        },
        {
          "uuid": "1666c380-41ae-4ed4-ba82-5a64ebeb2971",
          "code": "m9483",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9483?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "26286072-6a95-45dc-b82d-3452b95c9e3d"
          ]
        },
        {
          "uuid": "d51ab2d1-a75a-8ea5-7252-b938d76f2754",
          "code": "DTXSID8041111",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8041111",
          "code_system": "EPA CompTox",
          "references": [
            "b53410a2-0eec-28d2-d531-d4ff1bf97d58"
          ]
        },
        {
          "uuid": "c89ff801-d49f-fb83-16a3-6a5597aa2eaa",
          "code": "C714",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Dietary Carbohydrate[C68470]|Oligosaccharide",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C714",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2ec96f8c-6238-a70a-8b9e-ade0b8a35d6f"
          ]
        },
        {
          "uuid": "81c703b6-3d04-4fb5-9879-1c90c1f6b76c",
          "code": "N5O3QU595M",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "fa070fdf-0717-e588-7d4b-9cf4d7959740",
          "code": "16634",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16634",
          "code_system": "CHEBI",
          "references": [
            "2ec96f8c-6238-a70a-8b9e-ade0b8a35d6f"
          ]
        },
        {
          "uuid": "54f43c8e-ca4b-8f6d-96a3-d1c9d2d84d88",
          "code": "N5O3QU595M",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=N5O3QU595M",
          "code_system": "DAILYMED",
          "references": [
            "eea03ec2-9fd5-d238-db12-8bc058c64ff5"
          ]
        },
        {
          "uuid": "03d0cabb-8928-279c-f96e-8322d2a5799d",
          "code": "2025",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=2025",
          "code_system": "NSC",
          "references": [
            "71ce353f-5722-abd1-7174-6c5c7b887e2e"
          ]
        },
        {
          "uuid": "24bb0fac-c5dc-65b8-f44e-7f70df4bae15",
          "code": "170228",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=170228",
          "code_system": "NSC",
          "references": [
            "71ce353f-5722-abd1-7174-6c5c7b887e2e"
          ]
        },
        {
          "uuid": "f579e989-0c72-7a69-336a-c609b8471ee9",
          "code": "100000088583",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "86fcc696-fbb0-091c-7f94-cfc85d77368e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9e8f2701-359e-4b9c-8300-92f57ae15cb4",
          "name": ".BETA.-D-FRUCTOFURANOSYL-O-.ALPHA.-D-GALACTOPYRANOSYL-(1->6)-.ALPHA.-D-GLUCOPYRANOSIDE",
          "stdName": ".BETA.-D-FRUCTOFURANOSYL-O-.ALPHA.-D-GALACTOPYRANOSYL-(1->6)-.ALPHA.-D-GLUCOPYRANOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b06cc2e5-9560-48b6-a4c5-3eea6b6d6177",
            "5107b70a-f456-4a8e-ab6b-468ba8beb0a9"
          ],
          "display_name": false
        },
        {
          "uuid": "f652de38-f0e8-4a2c-b8f8-2726dd22f0cf",
          "name": "D-RAFFINOSE",
          "stdName": "D-RAFFINOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beda8205-13b8-4b50-abc8-0f72fe219c52",
            "5107b70a-f456-4a8e-ab6b-468ba8beb0a9"
          ],
          "display_name": false
        },
        {
          "uuid": "2269080f-13a5-436d-95d9-64d22e7aa8ed",
          "name": "GOSSYPOSE",
          "stdName": "GOSSYPOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b06cc2e5-9560-48b6-a4c5-3eea6b6d6177",
            "5107b70a-f456-4a8e-ab6b-468ba8beb0a9"
          ],
          "display_name": false
        },
        {
          "uuid": "997ef431-83b0-4135-add1-9cd54d80b6f8",
          "name": "MELITOSE",
          "stdName": "MELITOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b06cc2e5-9560-48b6-a4c5-3eea6b6d6177",
            "5107b70a-f456-4a8e-ab6b-468ba8beb0a9"
          ],
          "display_name": false
        },
        {
          "uuid": "a4441ab7-3733-4795-891e-13ff57805dac",
          "name": "MELITRIOSE",
          "stdName": "MELITRIOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b06cc2e5-9560-48b6-a4c5-3eea6b6d6177",
            "5107b70a-f456-4a8e-ab6b-468ba8beb0a9"
          ],
          "display_name": false
        },
        {
          "uuid": "2ed00b6b-6bd9-481f-a0d4-f0b632f46cef",
          "name": "NSC-170228",
          "stdName": "NSC-170228",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5107b70a-f456-4a8e-ab6b-468ba8beb0a9",
            "68042396-e8e3-4034-a31b-aff2c1b9b56f"
          ],
          "display_name": false
        },
        {
          "uuid": "b708f613-fcd3-4138-b26f-e32e2375f788",
          "name": "NSC-2025",
          "stdName": "NSC-2025",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5107b70a-f456-4a8e-ab6b-468ba8beb0a9",
            "68042396-e8e3-4034-a31b-aff2c1b9b56f"
          ],
          "display_name": false
        },
        {
          "uuid": "f62bfad9-df8c-486d-b751-cfb120ea769a",
          "name": "RAFFINOSE",
          "stdName": "RAFFINOSE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94c1e729-7c63-4a11-a5f2-8403b844e5fc",
            "6f92a0b4-4232-471d-9a4b-75b927d79d0e",
            "beda8205-13b8-4b50-abc8-0f72fe219c52",
            "b708267a-3a59-4fef-800e-f1d7f8bc04dc",
            "0beba492-046b-45d0-9fa3-8c8efbd00795",
            "af4945ca-7ade-4e05-a1f4-936043ff723d",
            "5107b70a-f456-4a8e-ab6b-468ba8beb0a9",
            "b7503dcd-a769-4f28-bd97-f4c5f4a9c8bd"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "851be795-bb2c-48ef-ab4f-5bf64907ba6f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "16bd172e-d5fa-42a5-8344-b11273064573",
          "name": "RAFFINOSE [MI]",
          "stdName": "RAFFINOSE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f92a0b4-4232-471d-9a4b-75b927d79d0e",
            "5107b70a-f456-4a8e-ab6b-468ba8beb0a9"
          ],
          "display_name": false
        },
        {
          "uuid": "38d86eb7-3a83-3126-a1ca-f9a04a1287b1",
          "name": "Raffinose [WHO-DD]",
          "stdName": "RAFFINOSE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4305623-c786-6485-a7d8-bcb7f1f1ac33"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "beda8205-13b8-4b50-abc8-0f72fe219c52",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b06cc2e5-9560-48b6-a4c5-3eea6b6d6177",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5107b70a-f456-4a8e-ab6b-468ba8beb0a9",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6f92a0b4-4232-471d-9a4b-75b927d79d0e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b708267a-3a59-4fef-800e-f1d7f8bc04dc",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0beba492-046b-45d0-9fa3-8c8efbd00795",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "68042396-e8e3-4034-a31b-aff2c1b9b56f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "26286072-6a95-45dc-b82d-3452b95c9e3d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389724000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fcc85fac-d198-45ca-89d5-6e8769014dcf",
          "citation": "SRS import [N5O3QU595M]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=N5O3QU595M",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389724000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "94c1e729-7c63-4a11-a5f2-8403b844e5fc",
          "citation": "RAFFINOSE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "af4945ca-7ade-4e05-a1f4-936043ff723d",
          "citation": "RAFFINOSE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b7503dcd-a769-4f28-bd97-f4c5f4a9c8bd",
          "citation": "RAFFINOSE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b53410a2-0eec-28d2-d531-d4ff1bf97d58",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=512-69-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2ec96f8c-6238-a70a-8b9e-ade0b8a35d6f",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d4305623-c786-6485-a7d8-bcb7f1f1ac33",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f8958bbc-7622-45ea-9437-4ac67f232bca",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "71ce353f-5722-abd1-7174-6c5c7b887e2e",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "eea03ec2-9fd5-d238-db12-8bc058c64ff5",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "86fcc696-fbb0-091c-7f94-cfc85d77368e",
          "citation": "EMA 2023",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ac8ee7e4-f293-494f-abce-5c3f6be4bcaf",
          "id": "ac8ee7e4-f293-494f-abce-5c3f6be4bcaf",
          "molfile": "\n  Marvin  01132108572D          \n\n 34 36  0  0  1  0            999 V2000\n    8.0370   -3.0802    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.7427   -2.6573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4561   -3.0621    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3513   -2.5897    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6888   -3.0785    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.6812   -2.2554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9584   -1.8507    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8867   -3.2988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0684   -3.3064    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.6501   -2.5866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8224   -2.5943    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    3.4042   -1.8744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9331   -1.8880    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1054   -1.8958    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    0.6825   -1.1854    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1452   -1.1931    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -0.5634   -0.4827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3614   -0.6368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5501   -1.9112    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -1.3637   -1.9188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1319   -2.6215    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   -0.5367   -3.3443    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6958   -2.6138    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    1.1188   -3.3289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4081   -3.3171    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.5803   -3.3248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8262   -4.0275    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.4120   -4.7457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6541   -4.0198    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.0675   -4.7397    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9610   -3.8563    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.4942   -4.5325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7934   -3.8486    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.2869   -4.5158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  4  1  0  0  0  0\n 33  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  8  1  6  0  0  0\n 31  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  9  8  1  6  0  0  0\n  9 10  1  0  0  0  0\n 29  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  1  0  0  0\n 25 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  6  0  0  0\n 14 15  1  0  0  0  0\n 14 23  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  1  0  0  0\n 19 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 20  1  1  0  0  0\n 21 19  1  0  0  0  0\n 21 22  1  1  0  0  0\n 23 21  1  0  0  0  0\n 23 24  1  6  0  0  0\n 25 26  1  6  0  0  0\n 25 27  1  0  0  0  0\n 27 28  1  1  0  0  0\n 27 29  1  0  0  0  0\n 29 30  1  6  0  0  0\n 31 32  1  6  0  0  0\n 31 33  1  0  0  0  0\n 33 34  1  1  0  0  0\nM  END",
          "smiles": "C([C@@H]1[C@@H]([C@@H]([C@H]([C@@H](OC[C@@H]2[C@H]([C@@H]([C@H]([C@H](O2)O[C@@]3(CO)[C@H]([C@@H]([C@@H](CO)O3)O)O)O)O)O)O1)O)O)O)O",
          "formula": "C18H32O16",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3aa3fd8e-44a1-428c-baa3-8461fed1c5cd"
          },
          "defined_stereo": 14,
          "ez_centers": 0,
          "molecular_weight": "504.4378",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 14
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ec08f8f0-a812-4c7e-8873-f1654360fe82",
      "version": "12",
      "structure": {
        "id": "967c9f08-7c6a-4884-b423-2559db750cd9",
        "molfile": "\n  Marvin  01132107492D          \n\n 35 37  0  0  1  0            999 V2000\n    6.6888   -3.0785    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.9610   -3.8563    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.7934   -3.8486    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.2869   -4.5158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0370   -3.0802    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.3513   -2.5897    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7427   -2.6573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4561   -3.0621    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4942   -4.5325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8867   -3.2988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0684   -3.3064    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.6541   -4.0198    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.8262   -4.0275    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.4081   -3.3171    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.5803   -3.3248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8224   -2.5943    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.6501   -2.5866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4042   -1.8744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9331   -1.8880    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1054   -1.8958    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.6958   -2.6138    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -0.1319   -2.6215    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -0.5501   -1.9112    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -1.3637   -1.9188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1452   -1.1931    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.6825   -1.1854    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5634   -0.4827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3614   -0.6368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5367   -3.3443    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1188   -3.3289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4120   -4.7457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0675   -4.7397    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4819   -4.0169    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6812   -2.2554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9584   -1.8507    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  1  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  1  1  0  0  0  0\n  5  7  1  6  0  0  0\n  8  7  1  0  0  0  0\n  2  9  1  6  0  0  0\n  1 10  1  6  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  6  0  0  0\n 16 14  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 11  1  0  0  0  0\n 16 18  1  1  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  6  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  1  1  0  0  0\n 25 23  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 20  1  0  0  0  0\n 25 27  1  1  0  0  0\n 28 27  1  0  0  0  0\n 22 29  1  1  0  0  0\n 21 30  1  6  0  0  0\n 13 31  1  1  0  0  0\n 12 32  1  6  0  0  0\n 11 33  1  1  0  0  0\n  1 34  1  1  0  0  0\n 35 34  1  0  0  0  0\nM  END",
        "smiles": "C([C@@H]1[C@@H]([C@@H]([C@H]([C@@H](OC[C@@H]2[C@H]([C@@H]([C@H]([C@]([H])(O2)O[C@@]3(CO)[C@H]([C@@H]([C@@H](CO)O3)O)O)O)O)O)O1)O)O)O)O",
        "formula": "C18H32O16",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 14,
        "ez_centers": 0,
        "molecular_weight": "504.4378",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "beda8205-13b8-4b50-abc8-0f72fe219c52",
          "fcc85fac-d198-45ca-89d5-6e8769014dcf"
        ],
        "stereo_centers": 14
      },
      "unii": "N5O3QU595M"
    }
  ]
}