{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8aef7746-b8a3-48ed-9e03-eca129a5399a",
          "code": "519-02-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=519-02-8",
          "code_system": "CAS",
          "references": [
            "4b92a4e3-06fe-42cc-857b-5a6c7168ba65",
            "d764af3b-049b-4e09-8e33-28d004af0961"
          ]
        },
        {
          "uuid": "d832d624-e2d1-4f0e-aaa0-d0eee5d85d45",
          "code": "m7097",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7097?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4b92a4e3-06fe-42cc-857b-5a6c7168ba65"
          ]
        },
        {
          "uuid": "20324ee3-bf26-4e8e-9857-3cffeeb531f8",
          "code": "SUB33947",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "4b92a4e3-06fe-42cc-857b-5a6c7168ba65"
          ]
        },
        {
          "uuid": "5bbe0f08-0b63-438c-867e-573f71b1cc48",
          "code": "91466",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91466",
          "code_system": "PUBCHEM",
          "references": [
            "4b92a4e3-06fe-42cc-857b-5a6c7168ba65"
          ]
        },
        {
          "uuid": "02c2ff71-49c9-8238-f1a8-df866253eec2",
          "code": "Matrine",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Matrine",
          "code_system": "WIKIPEDIA",
          "references": [
            "5573b4ed-d3c7-61fd-e47c-36d8f4087826"
          ]
        },
        {
          "uuid": "bec4ad4a-9bf0-daaf-2f3b-f9d21ab61cb7",
          "code": "DTXSID00274188",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00274188",
          "code_system": "EPA CompTox",
          "references": [
            "c1d11b46-6d0f-f046-25b7-ededc6b56654"
          ]
        },
        {
          "uuid": "85eae117-b7c4-1b40-d4be-aa84671bff86",
          "code": "2049547",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2049547/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "ec3e310a-4d33-be24-a107-9727827c25d7"
          ]
        },
        {
          "uuid": "c11e990a-bd10-42d3-be2d-29628b2005fa",
          "code": "N390W430AC",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3e151bac-84b1-eac4-9dc0-64ef30e49ce4",
          "code": "146051",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=146051",
          "code_system": "NSC",
          "references": [
            "f54d24ee-4664-68bb-d745-936b4c3f0200"
          ]
        },
        {
          "uuid": "c686e0c6-6cf8-b4f4-fdc8-fdaab60cd45f",
          "code": "100000127809",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "230a5a5b-dea6-e6de-8851-330fac060a47"
          ]
        },
        {
          "uuid": "64613180-9e2b-12bb-ab23-ecd9afda49be",
          "code": "N390W430AC",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=N390W430AC",
          "code_system": "DAILYMED",
          "references": [
            "a2648cf7-85cc-27dd-a860-7285b4d10f89"
          ]
        },
        {
          "uuid": "cca58c15-881b-99cb-17eb-52d5b8f5a086",
          "code": "matrine",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/matrine.html",
          "code_system": "ALANWOOD",
          "references": [
            "3fa20225-b96a-0023-90ac-b72c7c8ac13c"
          ]
        },
        {
          "uuid": "eb0a7d8a-a8be-0a9a-c221-06bd90041ee2",
          "code": "318810",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=318810",
          "code_system": "NSC",
          "references": [
            "f54d24ee-4664-68bb-d745-936b4c3f0200"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5959a21d-aaf5-48d1-9175-c826d8273052",
          "name": "(+)-MATRINE",
          "stdName": "(+)-MATRINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ce1b319-4319-4cfd-8873-2f1f269258e8",
            "a49c776d-f5e2-4c6a-b74e-6da985592379"
          ],
          "display_name": false
        },
        {
          "uuid": "763d9edd-dc6b-4f8a-bc94-f6a41f690d0b",
          "name": ".ALPHA.-MATRINE",
          "stdName": ".ALPHA.-MATRINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ce1b319-4319-4cfd-8873-2f1f269258e8",
            "a49c776d-f5e2-4c6a-b74e-6da985592379"
          ],
          "display_name": false
        },
        {
          "uuid": "cddb1a97-78f8-4fcb-9ebd-b4ff393ba576",
          "name": "1H,5H,10H-DIPYRIDO(2,1-F:3',2',1'-IJ)(1,6)NAPHTHYRIDIN-10-ONE, DODECAHYDRO-, (7AS,13AR,13BR,13CS)-",
          "stdName": "1H,5H,10H-DIPYRIDO(2,1-F:3',2',1'-IJ)(1,6)NAPHTHYRIDIN-10-ONE, DODECAHYDRO-, (7AS,13AR,13BR,13CS)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ce1b319-4319-4cfd-8873-2f1f269258e8",
            "a49c776d-f5e2-4c6a-b74e-6da985592379"
          ],
          "display_name": false
        },
        {
          "uuid": "34577619-8930-4bba-a6dc-98d647c62b66",
          "name": "MATRIDIN-15-ONE",
          "stdName": "MATRIDIN-15-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ce1b319-4319-4cfd-8873-2f1f269258e8",
            "a49c776d-f5e2-4c6a-b74e-6da985592379"
          ],
          "display_name": false
        },
        {
          "uuid": "e8516c0e-48b9-4f39-9256-5699008e22c3",
          "name": "MATRINE",
          "stdName": "MATRINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e1244a03-7ee6-4e4a-aefb-bc470790e0fb",
            "58ae7c05-c2dc-4759-ba74-d4d33d1ddd4c",
            "8a19c702-b85e-4d18-a3e4-eae35996bb76",
            "488180f7-dea4-411f-848b-4e595eeb7beb",
            "aa29ff12-055b-4dca-85bc-c425fef648f8",
            "6a6f50b2-3570-4fe8-b140-5f6573e42df9",
            "416d212d-50b7-4d65-9863-27267d838fc8",
            "a49c776d-f5e2-4c6a-b74e-6da985592379"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ba62d9a3-d161-4e0b-8cb2-98691f241f9b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "81a06ef3-61ef-4c45-992b-27cac10e810f",
          "name": "MATRINE [MI]",
          "stdName": "MATRINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58ae7c05-c2dc-4759-ba74-d4d33d1ddd4c",
            "a49c776d-f5e2-4c6a-b74e-6da985592379"
          ],
          "display_name": false
        },
        {
          "uuid": "312ce1d6-c460-de0d-607d-8d559a5883ae",
          "name": "Matrine [WHO-DD]",
          "stdName": "MATRINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "250f8b63-825e-c5db-a570-75881c75e635"
          ],
          "display_name": false
        },
        {
          "uuid": "eb18d277-b7ea-45ec-8277-effc703a08ea",
          "name": "NSC-146051",
          "stdName": "NSC-146051",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ce1b319-4319-4cfd-8873-2f1f269258e8",
            "a49c776d-f5e2-4c6a-b74e-6da985592379"
          ],
          "display_name": false
        },
        {
          "uuid": "108e5c42-9e31-443e-a579-09f9c1d689c6",
          "name": "NSC-318810",
          "stdName": "NSC-318810",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ce1b319-4319-4cfd-8873-2f1f269258e8",
            "a49c776d-f5e2-4c6a-b74e-6da985592379"
          ],
          "display_name": false
        },
        {
          "uuid": "1fb9680c-7508-4cf4-bc2c-09c07b0f710e",
          "name": "VEGARD",
          "stdName": "VEGARD",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ce1b319-4319-4cfd-8873-2f1f269258e8",
            "a49c776d-f5e2-4c6a-b74e-6da985592379"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8a19c702-b85e-4d18-a3e4-eae35996bb76",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a49c776d-f5e2-4c6a-b74e-6da985592379",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6a6f50b2-3570-4fe8-b140-5f6573e42df9",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "58ae7c05-c2dc-4759-ba74-d4d33d1ddd4c",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "488180f7-dea4-411f-848b-4e595eeb7beb",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3ce1b319-4319-4cfd-8873-2f1f269258e8",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b92a4e3-06fe-42cc-857b-5a6c7168ba65",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392328000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37c9caa8-e649-49ae-b892-fa2a39c92096",
          "citation": "SRS import [N390W430AC]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=N390W430AC",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392328000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e1244a03-7ee6-4e4a-aefb-bc470790e0fb",
          "citation": "MATRINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "416d212d-50b7-4d65-9863-27267d838fc8",
          "citation": "MATRINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "aa29ff12-055b-4dca-85bc-c425fef648f8",
          "citation": "MATRINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5573b4ed-d3c7-61fd-e47c-36d8f4087826",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Matrine",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c1d11b46-6d0f-f046-25b7-ededc6b56654",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=519-02-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "337ca101-3021-5ccb-d116-d9ed1e8ab4b4",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d764af3b-049b-4e09-8e33-28d004af0961",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ec3e310a-4d33-be24-a107-9727827c25d7",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "3fa20225-b96a-0023-90ac-b72c7c8ac13c",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "f54d24ee-4664-68bb-d745-936b4c3f0200",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "250f8b63-825e-c5db-a570-75881c75e635",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "a2648cf7-85cc-27dd-a860-7285b4d10f89",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "230a5a5b-dea6-e6de-8851-330fac060a47",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7a07d19b-9612-4de0-8d9c-3bcda6b6712f",
          "id": "7a07d19b-9612-4de0-8d9c-3bcda6b6712f",
          "molfile": "\n  Marvin  01132106202D          \n\n 22 25  0  0  1  0            999 V2000\n    7.9310   -6.4955    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.6460   -6.9074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3608   -6.4955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3608   -5.6716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6460   -5.2598    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6460   -4.4359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9320   -4.0244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2160   -4.4359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2160   -5.2598    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.5011   -5.6716    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.7863   -5.2598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0712   -5.6716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0712   -6.4955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7863   -6.9074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7863   -7.7360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5011   -6.4955    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2160   -6.9074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9310   -5.6716    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.9310   -7.3195    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2160   -6.0837    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5011   -4.8479    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9310   -4.3597    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n 17  1  1  0  0  0  0\n  1 18  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 18  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 18  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 16  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n  1 19  1  6  0  0  0\n  9 20  1  6  0  0  0\n 10 21  1  1  0  0  0\n 18 22  1  6  0  0  0\nM  END",
          "smiles": "C1C[C@]2([H])[C@@]3([H])CCCN4CCC[C@@]([H])(CN2C(=O)C1)[C@@]34[H]",
          "formula": "C15H24N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "256a911a-f134-4a1f-b4fb-b1e30668f275"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "248.3644",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1e7cd53b-f270-40fe-b380-149345bb2fdc",
      "version": "14",
      "structure": {
        "id": "8caaf9da-67dc-458d-8838-fc1d7dc85625",
        "molfile": "\n  Marvin  01132107182D          \n\n 22 25  0  0  1  0            999 V2000\n    8.6460   -5.2598    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6460   -4.4359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9320   -4.0244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2160   -4.4359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2160   -5.2598    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.5011   -5.6716    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.5011   -6.4955    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2160   -6.9074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9310   -6.4955    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.9310   -5.6716    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.9310   -4.3597    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6460   -6.9074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3608   -6.4955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3608   -5.6716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9310   -7.3195    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7863   -6.9074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0712   -6.4955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0712   -5.6716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7863   -5.2598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7863   -7.7360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5011   -4.8479    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2160   -6.0837    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  1 10  1  0  0  0  0\n  5 10  1  0  0  0  0\n 10 11  1  6  0  0  0\n 12  9  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14  1  1  0  0  0  0\n  9 15  1  6  0  0  0\n 16  7  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19  6  1  0  0  0  0\n 16 20  2  0  0  0  0\n  6 21  1  1  0  0  0\n  5 22  1  6  0  0  0\nM  END",
        "smiles": "C1C[C@]2([H])[C@@]3([H])CCCN4CCC[C@@]([H])(CN2C(=O)C1)[C@@]34[H]",
        "formula": "C15H24N2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "248.3644",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "488180f7-dea4-411f-848b-4e595eeb7beb",
          "37c9caa8-e649-49ae-b892-fa2a39c92096"
        ],
        "stereo_centers": 4
      },
      "unii": "N390W430AC"
    }
  ]
}