{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a973d3ea-bb32-4266-b9ad-ce3933ada78e",
          "code": "C01EB02",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|CARDIAC THERAPY|OTHER CARDIAC PREPARATIONS|Other cardiac preparations|camphora",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C01EB02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "5ba8982c-a491-43a6-87c3-80b02e822abf"
          ]
        },
        {
          "uuid": "ebd472cb-e97c-42f9-bfdc-affead5a55ca",
          "code": "D-CAMPHOR",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=4447",
          "code_system": "JECFA EVALUATION",
          "references": [
            "5ba8982c-a491-43a6-87c3-80b02e822abf"
          ]
        },
        {
          "uuid": "45d07f2e-179a-4ef8-a1b0-32afdbf90531",
          "code": "QC01EB02",
          "comments": "VATC|CARDIAC THERAPY|OTHER CARDIAC PREPARATIONS|Other cardiac preparations|camphora",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC01EB02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "5ba8982c-a491-43a6-87c3-80b02e822abf"
          ]
        },
        {
          "uuid": "d38d47a8-4fd8-4f66-bf7d-0401572e27de",
          "code": "464-49-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=464-49-3",
          "code_system": "CAS",
          "references": [
            "5ba8982c-a491-43a6-87c3-80b02e822abf",
            "fbc4c6dc-da4f-440a-b2fb-493b1d19433f"
          ]
        },
        {
          "uuid": "de9e6aea-0ec1-4c8f-865d-d42b4069df5e",
          "code": "C436264",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67436264",
          "code_system": "MESH",
          "references": [
            "5ba8982c-a491-43a6-87c3-80b02e822abf"
          ]
        },
        {
          "uuid": "7d599cdf-207f-4eeb-9607-3de72fad9260",
          "code": "21 CFR 171.515",
          "comments": "PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION|Subpart F--Flavoring Agents and Related Substances|Sec. 172.515 Synthetic flavoring substances and adjuvants.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=172.515",
          "code_system": "CFR",
          "references": [
            "5ba8982c-a491-43a6-87c3-80b02e822abf"
          ]
        },
        {
          "uuid": "755efa1f-f5aa-4258-9cbe-8f60abdd9bd9",
          "code": "207-355-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.688",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "5ba8982c-a491-43a6-87c3-80b02e822abf"
          ]
        },
        {
          "uuid": "6be6f1fc-8f56-4728-86c4-3987cc265483",
          "code": "1298738",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1298738/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "5ba8982c-a491-43a6-87c3-80b02e822abf"
          ]
        },
        {
          "uuid": "5fef3ef7-856f-4720-b33c-0a9aad14cac8",
          "code": "m3004",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3004?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "5ba8982c-a491-43a6-87c3-80b02e822abf"
          ]
        },
        {
          "uuid": "2adf6009-8c49-444b-9ec9-00909bc10345",
          "code": "SUB11890MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "5ba8982c-a491-43a6-87c3-80b02e822abf"
          ]
        },
        {
          "uuid": "ca0deea4-407f-496f-8c81-cff5e1b05145",
          "code": "SUB69012",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "5ba8982c-a491-43a6-87c3-80b02e822abf"
          ]
        },
        {
          "uuid": "6f9d6e75-21a2-4920-a6e0-6e57966f2351",
          "code": "CHEMBL504760",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL504760",
          "code_system": "ChEMBL",
          "references": [
            "5ba8982c-a491-43a6-87c3-80b02e822abf"
          ]
        },
        {
          "uuid": "bba4f4fb-cc9c-4d11-ba7f-949bb6778b1d",
          "code": "SUB13214MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "5ba8982c-a491-43a6-87c3-80b02e822abf"
          ]
        },
        {
          "uuid": "d4429a57-212b-4bec-a704-5035fcf7a486",
          "code": "159055",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/159055",
          "code_system": "PUBCHEM",
          "references": [
            "5ba8982c-a491-43a6-87c3-80b02e822abf"
          ]
        },
        {
          "uuid": "c64ff7ad-9ecf-14dd-c02e-7cd0eb63cf3c",
          "code": "DTXSID4024721",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4024721",
          "code_system": "EPA CompTox",
          "references": [
            "652adf8e-c20a-7c76-ec21-2c67561412c8"
          ]
        },
        {
          "uuid": "f2ce548e-cd38-4746-9bbf-78466e989a82",
          "code": "N20HL7Q941",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "58c45bc9-d14c-9040-c6eb-fa224a379bf3",
          "code": "15396",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:15396",
          "code_system": "CHEBI",
          "references": [
            "f43f4a62-0697-f70f-831a-8b1c664311ed"
          ]
        },
        {
          "uuid": "8a0a6b0e-e234-f3bf-034b-b3d269ead147",
          "code": "N20HL7Q941",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=N20HL7Q941",
          "code_system": "DAILYMED",
          "references": [
            "5699ed9e-af65-8f4d-d95d-24b840a39a64"
          ]
        },
        {
          "uuid": "49cbffb5-e7c0-cffb-5c3e-f45293111261",
          "code": "d-camphor",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/d-camphor.html",
          "code_system": "ALANWOOD",
          "references": [
            "216ebdf4-9682-f885-0fff-0b7c8ef53b3e"
          ]
        },
        {
          "uuid": "e49567ca-df32-de23-9cd5-89888970fa38",
          "code": "1087508",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1087508",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "90486097-2329-8dc8-5545-b0fa717a3d09"
          ]
        },
        {
          "uuid": "5350e007-ae2e-b5c1-2273-e8904afa5d52",
          "code": "755918",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=755918",
          "code_system": "NSC",
          "references": [
            "6d48f6e6-bf19-616e-98bb-86850263e0f9"
          ]
        },
        {
          "uuid": "764bbfd1-7734-a207-95fe-98ef2561cb44",
          "code": "1394",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1394/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "31212a72-1a6d-a264-bebf-fa5c8f311abc"
          ]
        },
        {
          "uuid": "ac42cb18-17de-f8be-a927-25de8abf6828",
          "code": "100000076084",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a43b44b1-1845-6026-2c90-aae692a0fdee"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "bd50390d-8a38-4b7d-ba9b-eae53acd03fb",
          "amount": {
            "uuid": "56580d3e-9185-4dbf-9b59-c801625668b1"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "9772098f-4549-4af1-bcca-a11ad7bb7b1b",
            "refuuid": "81bf1b3f-7fe5-407c-b1e7-55b52f149b8e",
            "name": "CAMPHOR (NATURAL)",
            "unii": "N20HL7Q941",
            "linking_id": "N20HL7Q941",
            "ref_pname": "CAMPHOR (NATURAL)",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ca1584c5-a01f-4784-87af-ef560451cbc2",
          "name": "(+)-2-BORNANONE",
          "stdName": "(+)-2-BORNANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1f358ee-cb81-410e-b72b-d407041e2fc8",
            "0804c121-4f8a-4a35-bdce-551abe929af4"
          ],
          "display_name": false
        },
        {
          "uuid": "1ef494aa-d907-4e98-ac53-109660826144",
          "name": "(+)-CAMPHOR",
          "stdName": "(+)-CAMPHOR",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a9d4dfc1-efba-40f5-a932-012aebec4327",
            "c5520b2f-773c-4c45-9a0d-22d91a07f83d",
            "a1f358ee-cb81-410e-b72b-d407041e2fc8",
            "0804c121-4f8a-4a35-bdce-551abe929af4"
          ],
          "display_name": false
        },
        {
          "uuid": "65d184ad-9cf0-488c-8d26-3eea9c5ddef0",
          "name": "(+)-CAMPHOR [FCC]",
          "stdName": "(+)-CAMPHOR [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a9d4dfc1-efba-40f5-a932-012aebec4327",
            "a1f358ee-cb81-410e-b72b-d407041e2fc8"
          ],
          "display_name": false
        },
        {
          "uuid": "726ac9f5-9876-40fb-9c5a-af7a62cb5c4f",
          "name": "(1R,4R)-(+)-CAMPHOR",
          "stdName": "(1R,4R)-(+)-CAMPHOR",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1f358ee-cb81-410e-b72b-d407041e2fc8",
            "0804c121-4f8a-4a35-bdce-551abe929af4"
          ],
          "display_name": false
        },
        {
          "uuid": "073006a2-4891-4e26-98ef-132596cae74c",
          "name": "CAMPHOR (NATURAL)",
          "stdName": "CAMPHOR (NATURAL)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "655a09f2-8f97-4939-b9a7-0e4fd5dc5ef0",
            "a1f358ee-cb81-410e-b72b-d407041e2fc8"
          ],
          "display_name": true
        },
        {
          "uuid": "113e0730-a227-44d8-bf0b-922fb778666b",
          "name": "CAMPHOR D-FORM",
          "stdName": "CAMPHOR D-FORM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10c040d0-a4f2-4bcf-8c3c-91a3410b76da",
            "3388457e-7d42-45d7-870e-b36ba7a266fa",
            "a1f358ee-cb81-410e-b72b-d407041e2fc8"
          ],
          "display_name": false
        },
        {
          "uuid": "b855239e-08d5-43aa-8b04-18f508a6973b",
          "name": "CAMPHOR D-FORM [MI]",
          "stdName": "CAMPHOR D-FORM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3388457e-7d42-45d7-870e-b36ba7a266fa",
            "a1f358ee-cb81-410e-b72b-d407041e2fc8"
          ],
          "display_name": false
        },
        {
          "uuid": "eda028d6-32d0-4b67-9e82-c4fc1544158b",
          "name": "CAMPHOR [USP-RS]",
          "stdName": "CAMPHOR [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb8fa806-7988-452c-930a-b08ef7f03b8d",
            "a1f358ee-cb81-410e-b72b-d407041e2fc8"
          ],
          "display_name": false
        },
        {
          "uuid": "b52bca04-76c7-4780-afa1-095e3ccf8f23",
          "name": "CAMPHOR, (+)-",
          "stdName": "CAMPHOR, (+)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "655a09f2-8f97-4939-b9a7-0e4fd5dc5ef0",
            "a1f358ee-cb81-410e-b72b-d407041e2fc8"
          ],
          "display_name": false
        },
        {
          "uuid": "c2a8367f-fadc-42f3-b93d-49510759114a",
          "name": "CAMPHOR, D-",
          "stdName": "CAMPHOR, D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1f358ee-cb81-410e-b72b-d407041e2fc8",
            "0804c121-4f8a-4a35-bdce-551abe929af4"
          ],
          "display_name": false
        },
        {
          "uuid": "791ea8c9-3e95-415c-a189-3c535f6bc558",
          "name": "CAMPHORA",
          "stdName": "CAMPHORA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bf5ec684-cffc-4763-8e6b-d238f9a1024c",
            "962fb524-d296-428a-b16d-40aeb3fe9872",
            "a1f358ee-cb81-410e-b72b-d407041e2fc8",
            "30026682-dff9-45cd-a741-38d581fa4a27"
          ],
          "display_name": false
        },
        {
          "uuid": "8c3c01f7-1673-495e-b1d7-ab641c7cca65",
          "name": "CAMPHORA [HPUS]",
          "stdName": "CAMPHORA [HPUS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "962fb524-d296-428a-b16d-40aeb3fe9872",
            "30026682-dff9-45cd-a741-38d581fa4a27"
          ],
          "display_name": false
        },
        {
          "uuid": "68fe94b3-0dbd-47e9-8271-01d14f3763d1",
          "name": "D-CAMPHOR",
          "stdName": "D-CAMPHOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7931726d-b663-4b8f-bbb4-aa843f911ee0",
            "a1f358ee-cb81-410e-b72b-d407041e2fc8",
            "0804c121-4f8a-4a35-bdce-551abe929af4",
            "d64c401d-9d26-4162-a044-b72da81bdf1c",
            "78b426af-9775-4652-833e-1540f19f3a43",
            "b739a136-bfbd-4021-bb09-296d39ae3805"
          ],
          "display_name": false
        },
        {
          "uuid": "84488cd2-d79f-cab2-9be1-a94387c6f672",
          "name": "D-CAMPHOR [EP MONOGRAPH]",
          "stdName": "D-CAMPHOR [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b9ae00ce-4478-f873-dfda-d7ceaff7dac4"
          ],
          "display_name": false
        },
        {
          "uuid": "2e7f65b9-871c-47a5-aee7-fd604b351896",
          "name": "D-CAMPHOR [FHFI]",
          "stdName": "D-CAMPHOR [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1f358ee-cb81-410e-b72b-d407041e2fc8",
            "b739a136-bfbd-4021-bb09-296d39ae3805"
          ],
          "display_name": false
        },
        {
          "uuid": "b01d030f-64f2-484a-a8da-d16d5cd2e642",
          "name": "D-CAMPHOR [JAN]",
          "stdName": "D-CAMPHOR [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "740a916f-b720-6dc8-2b62-85f31a63b3db"
          ],
          "display_name": false
        },
        {
          "uuid": "33ad2fe0-2200-2d6f-71fb-f1e450a70314",
          "name": "D-camphor [WHO-DD]",
          "stdName": "D-CAMPHOR [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "342ac2f3-7d8e-08ad-12d8-2305179cad98"
          ],
          "display_name": false
        },
        {
          "uuid": "871a0a1a-04c3-4ee5-8f0a-1e58a7cb560e",
          "name": "DEXTROCAMPHOR",
          "stdName": "DEXTROCAMPHOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1f358ee-cb81-410e-b72b-d407041e2fc8",
            "57963b66-20ea-4918-9c49-4a1ffc41e4e9"
          ],
          "display_name": false
        },
        {
          "uuid": "b3413a50-520d-4875-b519-a101aaf7b6e8",
          "name": "FEMA NO. 2230",
          "stdName": "FEMA NO. 2230",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "934fd20b-316c-41e4-a86b-9aea3315dcc9"
          ],
          "display_name": false
        },
        {
          "uuid": "009917df-78a3-412a-9d01-9d0e4429106a",
          "name": "NATURAL CAMPHOR",
          "stdName": "NATURAL CAMPHOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "630d6f05-640e-42b3-b995-43e705be08bf",
            "a1f358ee-cb81-410e-b72b-d407041e2fc8"
          ],
          "display_name": false
        },
        {
          "uuid": "6887c5e9-0974-c648-8cee-977855121d10",
          "name": "NSC-755918",
          "stdName": "NSC-755918",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d48f6e6-bf19-616e-98bb-86850263e0f9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0804c121-4f8a-4a35-bdce-551abe929af4",
          "citation": "SAX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a1f358ee-cb81-410e-b72b-d407041e2fc8",
          "citation": "SAX DANGEROUS PROPERTIES",
          "doc_type": "SAX DANGEROUS PROPERTIES",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "655a09f2-8f97-4939-b9a7-0e4fd5dc5ef0",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "630d6f05-640e-42b3-b995-43e705be08bf",
          "citation": "USP 32",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30026682-dff9-45cd-a741-38d581fa4a27",
          "citation": "HPUS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "934fd20b-316c-41e4-a86b-9aea3315dcc9",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "962fb524-d296-428a-b16d-40aeb3fe9872",
          "citation": "HPUS 2011",
          "doc_type": "HOMEOPATHIC PHARMACOPOEIA US",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78b426af-9775-4652-833e-1540f19f3a43",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b739a136-bfbd-4021-bb09-296d39ae3805",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a9d4dfc1-efba-40f5-a932-012aebec4327",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57963b66-20ea-4918-9c49-4a1ffc41e4e9",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3388457e-7d42-45d7-870e-b36ba7a266fa",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb8fa806-7988-452c-930a-b08ef7f03b8d",
          "citation": "USP-RS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5ba8982c-a491-43a6-87c3-80b02e822abf",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389696000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e2ead2b9-398d-4340-b426-acc1e8f05638",
          "citation": "SRS import [N20HL7Q941]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=N20HL7Q941",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389696000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf5ec684-cffc-4763-8e6b-d238f9a1024c",
          "citation": "CAMPHORA [HPUS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d64c401d-9d26-4162-a044-b72da81bdf1c",
          "citation": "D-CAMPHOR [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7931726d-b663-4b8f-bbb4-aa843f911ee0",
          "citation": "D-CAMPHOR [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c5520b2f-773c-4c45-9a0d-22d91a07f83d",
          "citation": "(+)-CAMPHOR [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "10c040d0-a4f2-4bcf-8c3c-91a3410b76da",
          "citation": "CAMPHOR D-FORM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "740a916f-b720-6dc8-2b62-85f31a63b3db",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "652adf8e-c20a-7c76-ec21-2c67561412c8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=464-49-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "216ebdf4-9682-f885-0fff-0b7c8ef53b3e",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "342ac2f3-7d8e-08ad-12d8-2305179cad98",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "fbc4c6dc-da4f-440a-b2fb-493b1d19433f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6d48f6e6-bf19-616e-98bb-86850263e0f9",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b9ae00ce-4478-f873-dfda-d7ceaff7dac4",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "f43f4a62-0697-f70f-831a-8b1c664311ed",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "90486097-2329-8dc8-5545-b0fa717a3d09",
          "citation": "USP/NF",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "5699ed9e-af65-8f4d-d95d-24b840a39a64",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "31212a72-1a6d-a264-bebf-fa5c8f311abc",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        },
        {
          "uuid": "a43b44b1-1845-6026-2c90-aae692a0fdee",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7a997f01-7fbd-41ee-bf1a-6ab834210328",
          "id": "7a997f01-7fbd-41ee-bf1a-6ab834210328",
          "molfile": "\n  Marvin  01132106222D          \n\n 11 12  0  0  1  0            999 V2000\n    1.7515   -4.0276    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    2.4628   -3.6215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4628   -2.8006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7515   -2.3827    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    1.7486   -1.5440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0461   -2.8006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3172   -2.3827    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0461   -3.6215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1338   -3.1741    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.9281   -2.9014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9311   -3.4407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  8  1  0  0  0  0\n  1  9  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  1  0  0  0\n  6  4  1  0  0  0  0\n  4  9  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  6  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  1  0  0  0  0\nM  END",
          "smiles": "CC1(C)[C@@H]2CC[C@@]1(C)C(=O)C2",
          "formula": "C10H16O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9f68d973-daae-460a-951a-ce2729682de5"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "152.2338",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "81bf1b3f-7fe5-407c-b1e7-55b52f149b8e",
      "version": "20",
      "structure": {
        "id": "29d5bb32-dc18-4c82-91a9-57c4fc375faf",
        "molfile": "\n  Marvin  01132102172D          \n\n 11 12  0  0  1  0            999 V2000\n    1.7515   -2.3827    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.1338   -3.1741    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.0461   -2.8006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7515   -4.0276    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.0461   -3.6215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4628   -2.8006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4628   -3.6215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3172   -2.3827    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7486   -1.5440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9281   -2.9014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9311   -3.4407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  1  0  0  0\n  5  3  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  3  2  0  0  0  0\n  9  1  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  7  4  1  0  0  0  0\nM  END",
        "smiles": "CC1(C)[C@@H]2CC[C@@]1(C)C(=O)C2",
        "formula": "C10H16O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "152.2338",
        "optical_activity": "( + )",
        "references": [
          "0804c121-4f8a-4a35-bdce-551abe929af4",
          "e2ead2b9-398d-4340-b426-acc1e8f05638"
        ],
        "stereo_centers": 2
      },
      "unii": "N20HL7Q941"
    }
  ]
}