{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "871f46e7-b710-473c-a29f-d61bba6f44a3",
          "code": "99103-03-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=99103-03-4",
          "code_system": "CAS",
          "references": [
            "31eebb83-1a41-44ad-82d4-f826d4e03ee0",
            "633f7bc2-d3b5-401a-afe5-d59dbfdd646d"
          ]
        },
        {
          "uuid": "11aa206b-98ac-46cf-bfd3-5215c6f12a1c",
          "code": "10892731",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10892731",
          "code_system": "PUBCHEM",
          "references": [
            "31eebb83-1a41-44ad-82d4-f826d4e03ee0"
          ]
        },
        {
          "uuid": "39c16707-82e6-116a-33cd-02b893725c40",
          "code": "DTXSID30872934",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30872934",
          "code_system": "EPA CompTox",
          "references": [
            "eb10e7c6-675a-4820-31ec-07631bb81384"
          ]
        },
        {
          "uuid": "d38cc499-b082-480c-94f9-b85d0a58229d",
          "code": "N0P2X2L8U0",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "ab385a04-9542-4218-81f1-cae06b9dea98",
          "type": "RACEMATE->ENANTIOMER",
          "related_substance": {
            "uuid": "0421b35e-f128-460d-9775-7a1d111039bd",
            "refuuid": "826d7272-7f6b-4562-ba9f-8aa66bf32b37",
            "name": "BISOPROLOL",
            "unii": "Y41JS2NL6U",
            "linking_id": "Y41JS2NL6U",
            "ref_pname": "BISOPROLOL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ccc88785-a52c-4a89-9fae-53c79849b5ee",
          "name": "(-)-BISOPROLOL",
          "stdName": "(-)-BISOPROLOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30c40b67-75b3-4536-9a7e-dd417b6838ff",
            "fee88620-bdcc-4847-a2ea-cf31b8fc96c0"
          ],
          "display_name": false
        },
        {
          "uuid": "26285c8d-97ee-4a4f-94dd-f3f654279ef1",
          "name": "(2S)-1-(4-((2-(1-METHYLETHOXY)ETHOXY)METHYL)PHENOXY)-3-((1-METHYLETHYL)AMINO)-2-PROPANOL",
          "stdName": "(2S)-1-(4-((2-(1-METHYLETHOXY)ETHOXY)METHYL)PHENOXY)-3-((1-METHYLETHYL)AMINO)-2-PROPANOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30c40b67-75b3-4536-9a7e-dd417b6838ff",
            "fee88620-bdcc-4847-a2ea-cf31b8fc96c0"
          ],
          "display_name": false
        },
        {
          "uuid": "31a5d37d-3b0e-4c60-8b69-7cd67313ab59",
          "name": "(S)-BISOPROLOL",
          "stdName": "(S)-BISOPROLOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30c40b67-75b3-4536-9a7e-dd417b6838ff",
            "fee88620-bdcc-4847-a2ea-cf31b8fc96c0"
          ],
          "display_name": false
        },
        {
          "uuid": "d4c020f7-ce4d-4259-9379-94424294f3d5",
          "name": "2-PROPANOL, 1-(4-((2-(1-METHYLETHOXY)ETHOXY)METHYL)PHENOXY)-3-((1-METHYLETHYL)AMINO)-, (2S)-",
          "stdName": "2-PROPANOL, 1-(4-((2-(1-METHYLETHOXY)ETHOXY)METHYL)PHENOXY)-3-((1-METHYLETHYL)AMINO)-, (2S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30c40b67-75b3-4536-9a7e-dd417b6838ff",
            "fee88620-bdcc-4847-a2ea-cf31b8fc96c0"
          ],
          "display_name": false
        },
        {
          "uuid": "053c7580-be1e-4370-a644-e5a37311c5d3",
          "name": "2-PROPANOL, 1-(4-((2-(1-METHYLETHOXY)ETHOXY)METHYL)PHENOXY)-3-((1-METHYLETHYL)AMINO)-, (S)-",
          "stdName": "2-PROPANOL, 1-(4-((2-(1-METHYLETHOXY)ETHOXY)METHYL)PHENOXY)-3-((1-METHYLETHYL)AMINO)-, (S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30c40b67-75b3-4536-9a7e-dd417b6838ff",
            "fee88620-bdcc-4847-a2ea-cf31b8fc96c0"
          ],
          "display_name": false
        },
        {
          "uuid": "b3fda805-9bc0-4d0a-86d1-f1af9a494c4f",
          "name": "BISOPROLOL, (S)-",
          "stdName": "BISOPROLOL, (S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30c40b67-75b3-4536-9a7e-dd417b6838ff",
            "fee88620-bdcc-4847-a2ea-cf31b8fc96c0"
          ],
          "display_name": true
        },
        {
          "uuid": "defcddfc-2383-45ad-b950-79fb02acfa0b",
          "name": "S-(-)-BISOPROLOL",
          "stdName": "S-(-)-BISOPROLOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30c40b67-75b3-4536-9a7e-dd417b6838ff",
            "fee88620-bdcc-4847-a2ea-cf31b8fc96c0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "30c40b67-75b3-4536-9a7e-dd417b6838ff",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fee88620-bdcc-4847-a2ea-cf31b8fc96c0",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "31eebb83-1a41-44ad-82d4-f826d4e03ee0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393061000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "69648bb1-713a-4bdb-9d58-f866f5679bb0",
          "citation": "SRS import [N0P2X2L8U0]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=N0P2X2L8U0",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393061000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eb10e7c6-675a-4820-31ec-07631bb81384",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=99103-03-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "633f7bc2-d3b5-401a-afe5-d59dbfdd646d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4401b61a-45ab-4858-a8d7-3b96299dcdd5",
          "id": "4401b61a-45ab-4858-a8d7-3b96299dcdd5",
          "molfile": "\n  Marvin  01132103352D          \n\n 23 23  0  0  1  0            999 V2000\n    6.9390   -3.5520    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.9390   -4.3341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6784   -3.0307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4889   -3.6042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2425   -3.1207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2425   -2.3529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8587   -3.5758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1618   -3.1207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4318   -3.4572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4318   -4.1113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1380   -4.5332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1380   -5.3389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4318   -5.7655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4318   -6.4147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1190   -6.8934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9532   -6.3769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6832   -6.9693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5315   -6.4147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2567   -6.9314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1572   -6.4147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2567   -7.6613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7019   -5.3389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7019   -4.5332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  8  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  5  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 23 10  2  0  0  0  0\n 12 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 22  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 19  1  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
          "smiles": "CC(C)NC[C@@H](COc1ccc(cc1)COCCOC(C)C)O",
          "formula": "C18H31NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7a7bade6-5dd6-41d5-bea9-509962d54105"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "325.4437",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "878756d4-f58e-49cc-997e-4b8929a42b2c",
      "version": "3",
      "structure": {
        "id": "b889135d-6f5e-44c6-a60b-a92a5ebe1d10",
        "molfile": "\n  Marvin  01132109332D          \n\n 23 23  0  0  1  0            999 V2000\n    8.4889   -3.6042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6784   -3.0307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9390   -3.5520    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.1618   -3.1207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4318   -3.4572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4318   -4.1113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1380   -4.5332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1380   -5.3389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4318   -5.7655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7019   -5.3389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7019   -4.5332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4318   -6.4147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1190   -6.8934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9532   -6.3769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6832   -6.9693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5315   -6.4147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2567   -6.9314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1572   -6.4147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2567   -7.6613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9390   -4.3341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2425   -3.1207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2425   -2.3529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8587   -3.5758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11  6  1  0  0  0  0\n 12  9  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  1  0  0  0  0\n  3 20  1  6  0  0  0\n 21  1  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 21  1  0  0  0  0\nM  END",
        "smiles": "CC(C)NC[C@@H](COc1ccc(cc1)COCCOC(C)C)O",
        "formula": "C18H31NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "325.4437",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "69648bb1-713a-4bdb-9d58-f866f5679bb0",
          "30c40b67-75b3-4536-9a7e-dd417b6838ff"
        ],
        "stereo_centers": 1
      },
      "unii": "N0P2X2L8U0"
    }
  ]
}