{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "4f82a58e-302c-40f1-a4a3-f1ca81d560ef", "code": "153250-52-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=153250-52-3", "code_system": "CAS", "references": [ "9894468e-fe2a-4c3d-bfdf-858e0e3f9ec3", "3b4c373e-e0e8-4bae-ba12-6036d3430cb0" ] }, { "uuid": "03c9385a-38a7-44df-88ab-e8487add60d5", "code": "FCN NO. 713", "comments": "FCN|NUCLEATING AGENT|PROPYLENE POLYMERS", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=713", "code_system": "Food Contact Sustance Notif, (FCN No.)", "references": [ "9894468e-fe2a-4c3d-bfdf-858e0e3f9ec3" ] }, { "uuid": "814accfc-63b0-4e2c-9d5f-e3cecad84e47", "code": "21987656", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21987656", "code_system": "PUBCHEM", "references": [ "9894468e-fe2a-4c3d-bfdf-858e0e3f9ec3" ] }, { "uuid": "fe08e569-3275-9e4a-4662-ad649d1bc044", "code": "DTXSID3074785", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3074785", "code_system": "EPA CompTox", "references": [ "5bcb0d52-d150-827c-6037-bae1664d9d8f" ] }, { "uuid": "d98a9d3c-82d6-4a8f-9d44-1b7bacde60d5", "code": "N0B5159U0C", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "2efa0998-36dc-4af3-b75b-6ad183c07d54", "name": "2,6-NAPHTHALENEDICARBOXAMIDE, N,N'-DICYCLOHEXYL-", "stdName": "2,6-NAPHTHALENEDICARBOXAMIDE, N,N'-DICYCLOHEXYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "dda2cdb8-ae58-4531-9475-95a00625ef09", "8d2ed7e3-a47f-415f-b694-2cca45f436d3" ], "display_name": false }, { "uuid": "1a8d2a7d-44c5-4bad-b796-f1fff05a2909", "name": "2,6-NAPHTHALENEDICARBOXAMIDE, N2,N6-DICYCLOHEXYL-", "stdName": "2,6-NAPHTHALENEDICARBOXAMIDE, N2,N6-DICYCLOHEXYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8c8a198e-44c5-4d5a-b39f-a61ed828f2d4", "8d2ed7e3-a47f-415f-b694-2cca45f436d3" ], "display_name": false }, { "uuid": "03f77fc6-1524-4b5d-925b-dbfbcee7a083", "name": "N,N'-DICYCLOHEXYL-2,6-NAPHTHALENEDICARBOXAMIDE", "stdName": "N,N'-DICYCLOHEXYL-2,6-NAPHTHALENEDICARBOXAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "dda2cdb8-ae58-4531-9475-95a00625ef09", "8d2ed7e3-a47f-415f-b694-2cca45f436d3" ], "display_name": true }, { "uuid": "eabf2318-fdb9-4646-ba2a-57bacf8e6630", "name": "NJ STAR NU 100", "stdName": "NJ STAR NU 100", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "dda2cdb8-ae58-4531-9475-95a00625ef09", "8d2ed7e3-a47f-415f-b694-2cca45f436d3" ], "display_name": false }, { "uuid": "d5775fd8-e04c-4d47-beea-792c4b052c74", "name": "NJ STAR NU-100", "stdName": "NJ STAR NU-100", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "dda2cdb8-ae58-4531-9475-95a00625ef09", "8d2ed7e3-a47f-415f-b694-2cca45f436d3" ], "display_name": false }, { "uuid": "3fe4bd50-e2be-43c3-88a6-ea07ddd47e18", "name": "NJSTAR NU-100", "stdName": "NJSTAR NU-100", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "8d2ed7e3-a47f-415f-b694-2cca45f436d3", "b40ff899-5ef1-4a0b-b2d7-ce043283d11f" ], "display_name": false } ], "references": [ { "uuid": "dda2cdb8-ae58-4531-9475-95a00625ef09", "citation": "http://www.lookchem.com/cas-153/153250-52-3.html", "url": "http://www.lookchem.com/cas-153/153250-52-3.html", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "8d2ed7e3-a47f-415f-b694-2cca45f436d3", "citation": "WEB PAGE", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b40ff899-5ef1-4a0b-b2d7-ce043283d11f", "citation": "http://www.ppadditives.com/docs/English/TDS/NJSTAR%20NU-100.pdf", "url": "http://www.ppadditives.com/docs/English/TDS/NJSTAR%20NU-100.pdf", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8c8a198e-44c5-4d5a-b39f-a61ed828f2d4", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9894468e-fe2a-4c3d-bfdf-858e0e3f9ec3", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391307000, "tags": [ "NOMEN" ] }, { "uuid": "7c4c9f7a-0986-4e29-857e-53c3010a088c", "citation": "SRS import [N0B5159U0C]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=N0B5159U0C", "doc_type": "SRS", "public_domain": true, "document_date": 1493391307000, "tags": [ "NOMEN" ] }, { "uuid": "5bcb0d52-d150-827c-6037-bae1664d9d8f", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=153250-52-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "3b4c373e-e0e8-4bae-ba12-6036d3430cb0", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "dc33c2c8-9fad-48ae-bce7-4de8c42f30be", "id": "dc33c2c8-9fad-48ae-bce7-4de8c42f30be", "molfile": "\n Marvin 01132111252D \n\n 28 31 0 0 0 0 999 V2000\n 1.3733 -3.3554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3733 -2.5308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6587 -2.1185 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0559 -2.5308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7705 -2.1185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4851 -2.5308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4851 -3.3554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7705 -3.7677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0559 -3.3554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0879 -2.1185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0879 -1.2940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8026 -0.8817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5172 -1.2940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2043 -0.8817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9189 -1.2940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9189 -2.1185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2043 -2.5308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5172 -2.1185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8026 -2.5308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6335 -0.8817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6335 -0.0571 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3482 -1.2940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0628 -0.8817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0628 -0.0571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7774 0.3552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4921 -0.0571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4921 -0.8817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7774 -1.2940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 2 3 1 0 0 0 0\n 10 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 9 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 11 1 0 0 0 0\n 19 10 2 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 18 13 2 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 15 20 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 20 21 2 0 0 0 0\n 20 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 28 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\nM END", "smiles": "C1CCC(CC1)NC(=O)c2ccc3cc(ccc3c2)C(=O)NC4CCCCC4", "formula": "C24H30N2O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "f5234350-865c-4137-938c-33940f4191ca" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "378.5081", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "cb279f1a-413a-4e39-b8a6-9e1e7f438537", "version": "3", "structure": { "id": "83c9f546-ffa9-428a-a6e1-c1070eb5dd46", "molfile": "\n Marvin 01132106502D \n\n 28 31 0 0 0 0 999 V2000\n 7.7774 -1.2940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0628 -0.8817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3482 -1.2940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6335 -0.8817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9189 -1.2940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9189 -2.1185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2043 -2.5308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5172 -2.1185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5172 -1.2940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2043 -0.8817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8026 -0.8817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0879 -1.2940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0879 -2.1185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3733 -2.5308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6587 -2.1185 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0559 -2.5308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7705 -2.1185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4851 -2.5308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4851 -3.3554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7705 -3.7677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0559 -3.3554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3733 -3.3554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8026 -2.5308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6335 -0.0571 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0628 -0.0571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7774 0.3552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4921 -0.0571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4921 -0.8817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 10 9 2 0 0 0 0\n 10 5 1 0 0 0 0\n 11 9 1 0 0 0 0\n 12 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 16 21 1 0 0 0 0\n 14 22 2 0 0 0 0\n 23 13 2 0 0 0 0\n 8 23 1 0 0 0 0\n 4 24 2 0 0 0 0\n 2 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 1 1 0 0 0 0\nM END", "smiles": "C1CCC(CC1)NC(=O)c2ccc3cc(ccc3c2)C(=O)NC4CCCCC4", "formula": "C24H30N2O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "378.5081", "optical_activity": "NONE", "references": [ "7c4c9f7a-0986-4e29-857e-53c3010a088c", "dda2cdb8-ae58-4531-9475-95a00625ef09" ], "stereo_centers": 0 }, "unii": "N0B5159U0C" } ] }