{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bbbd17fe-2373-490c-86ec-5dcd38cca083",
          "code": "M01AX05",
          "comments": "ATC|MUSCULO-SKELETAL SYSTEM|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS, NON-STEROIDS|Other antiinflammatory and antirheumatic agents, non-steroids|glucosamine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=M01AX05&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "cdc9936c-419e-4a30-b8f6-2dc61729f4d7"
          ]
        },
        {
          "uuid": "2c674232-06d5-4323-a6de-73880929f02e",
          "code": "QM01AX05",
          "comments": "VATC|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS, NON-STEROIDS|Other antiinflammatory and antirheumatic agents, non-steroids|glucosamine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QM01AX05&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "cdc9936c-419e-4a30-b8f6-2dc61729f4d7"
          ]
        },
        {
          "uuid": "6a1c177d-9e98-4620-9e9f-3db380248823",
          "code": "3416-24-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3416-24-8",
          "code_system": "CAS",
          "references": [
            "cdc9936c-419e-4a30-b8f6-2dc61729f4d7",
            "e3fc1a09-1c3b-40a6-b7f3-30e866b55168"
          ]
        },
        {
          "uuid": "905e4446-9210-4487-8ff3-35a81dfe06d6",
          "code": "C83731",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C83731",
          "code_system": "NCI_THESAURUS",
          "references": [
            "cdc9936c-419e-4a30-b8f6-2dc61729f4d7"
          ]
        },
        {
          "uuid": "74eb34a2-1e03-4507-b043-3300eb0444eb",
          "code": "D005944",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68005944",
          "code_system": "MESH",
          "references": [
            "cdc9936c-419e-4a30-b8f6-2dc61729f4d7"
          ]
        },
        {
          "uuid": "b0d54b70-2caf-4708-a45b-bc47e2bd59cf",
          "code": "NBK547949",
          "comments": "LiverTox|HDS: Nutritional Sup|Arthritis|Essential nutrient",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK547949/",
          "code_system": "LIVERTOX",
          "references": [
            "49ff1972-3e3b-6be4-62ae-bdac6802392f"
          ]
        },
        {
          "uuid": "7e7d5f04-b032-4274-be37-daf1407cfcd6",
          "code": "90-77-7",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=90-77-7",
          "code_system": "CAS",
          "references": [
            "cdc9936c-419e-4a30-b8f6-2dc61729f4d7",
            "94cbdc6c-651b-414b-bdf5-739d22fde022"
          ]
        },
        {
          "uuid": "015853b9-3167-43e4-8c1e-ef5552a37555",
          "code": "GLUCOSAMINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Glucosamine",
          "code_system": "WIKIPEDIA",
          "references": [
            "cdc9936c-419e-4a30-b8f6-2dc61729f4d7"
          ]
        },
        {
          "uuid": "1f7b5c1e-9f99-4bd3-89ad-a1c40a0f2a97",
          "code": "SUB07937MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "cdc9936c-419e-4a30-b8f6-2dc61729f4d7"
          ]
        },
        {
          "uuid": "990fe792-f706-45f7-9523-ee83643f2d58",
          "code": "3120",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3120",
          "code_system": "INN",
          "references": [
            "cdc9936c-419e-4a30-b8f6-2dc61729f4d7"
          ]
        },
        {
          "uuid": "f98e2442-c9b0-4a66-b35b-4d11faf10b7a",
          "code": "222-311-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.020.284",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "cdc9936c-419e-4a30-b8f6-2dc61729f4d7"
          ]
        },
        {
          "uuid": "f463ccb4-1717-443b-84ce-0a3ca6cea739",
          "code": "4845",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/4845/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "cdc9936c-419e-4a30-b8f6-2dc61729f4d7"
          ]
        },
        {
          "uuid": "a05fed25-da81-4956-bd14-225996b89b7b",
          "code": "m5764",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5764?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "cdc9936c-419e-4a30-b8f6-2dc61729f4d7"
          ]
        },
        {
          "uuid": "ee56ff1f-6802-47a3-be09-f14c18dd3767",
          "code": "DB01296",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01296",
          "code_system": "DRUG BANK",
          "references": [
            "cdc9936c-419e-4a30-b8f6-2dc61729f4d7"
          ]
        },
        {
          "uuid": "30e31e57-c61d-45f3-ae26-779fd3261e1b",
          "code": "CHEMBL606759",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL606759",
          "code_system": "ChEMBL",
          "references": [
            "cdc9936c-419e-4a30-b8f6-2dc61729f4d7"
          ]
        },
        {
          "uuid": "b86dcd49-4995-4623-88c8-7eab51a211ab",
          "code": "3034366",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3034366",
          "code_system": "PUBCHEM",
          "references": [
            "cdc9936c-419e-4a30-b8f6-2dc61729f4d7"
          ]
        },
        {
          "uuid": "c285e17d-d571-84ce-64ea-d938440e3d17",
          "code": "7469",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7469",
          "code_system": "HSDB",
          "references": [
            "bb0c2cae-c10c-c408-ac37-c1f1641a7b81"
          ]
        },
        {
          "uuid": "1363a2a7-f834-863a-d36a-a9c1baa6b04c",
          "code": "DTXSID4023098",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4023098",
          "code_system": "EPA CompTox",
          "references": [
            "627cea25-3386-2dfe-7d91-f1219f821ad3"
          ]
        },
        {
          "uuid": "7f77ee3e-2143-4f7f-8a9d-3afbfe4c4b32",
          "code": "34948-66-8",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=34948-66-8",
          "code_system": "CAS",
          "references": [
            "184eb94c-e533-4d17-bccb-8d9e21619636",
            "0b87450d-0790-4f4c-bf2f-31f22d566382"
          ]
        },
        {
          "uuid": "23263790-771f-ba30-2834-d0403d4fc515",
          "code": "C1505",
          "comments": "Dietary Supplement",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "49ff1972-3e3b-6be4-62ae-bdac6802392f"
          ]
        },
        {
          "uuid": "23fa976c-8e30-679d-b7a2-3f60d0af4c20",
          "code": "80093-8",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|Glucosamine [Moles/volume] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/80093-8/",
          "code_system": "LOINC",
          "references": [
            "49ff1972-3e3b-6be4-62ae-bdac6802392f"
          ]
        },
        {
          "uuid": "c106524f-1116-17d2-8a3b-9262b89ed200",
          "code": "80098-7",
          "comments": "LOINC|ACTIVE|CHEM|Urine|Glucosamine/Creatinine [Molar ratio] in Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/80098-7/",
          "code_system": "LOINC",
          "references": [
            "49ff1972-3e3b-6be4-62ae-bdac6802392f"
          ]
        },
        {
          "uuid": "6fae8086-ef8f-47be-ab96-3a3b4cf09f5c",
          "code": "N08U5BOQ1K",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3b9b23ce-db52-19d6-45c0-29bd109601d5",
          "code": "Glucosamine",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM950/",
          "code_system": "LACTMED",
          "references": [
            "49ff1972-3e3b-6be4-62ae-bdac6802392f"
          ]
        },
        {
          "uuid": "69711570-224f-2d70-3f09-cc7949fd93d6",
          "code": "1307",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1307",
          "code_system": "DRUG CENTRAL",
          "references": [
            "49ff1972-3e3b-6be4-62ae-bdac6802392f"
          ]
        },
        {
          "uuid": "f2a92bdc-e181-6be2-4764-1e499fe92afa",
          "code": "2165 (Number of products:92)",
          "comments": "Dietary Supplement Label Database|TBD|Glucosamine (unspecified)",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2165&item=Glucosamine (unspecified)",
          "code_system": "DSLD",
          "references": [
            "49ff1972-3e3b-6be4-62ae-bdac6802392f"
          ]
        },
        {
          "uuid": "32a274bb-899e-5609-57d5-64e67c69d461",
          "code": "17315",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17315",
          "code_system": "CHEBI",
          "references": [
            "49ff1972-3e3b-6be4-62ae-bdac6802392f"
          ]
        },
        {
          "uuid": "58c4426d-c0be-ead8-28af-0416b8acedd1",
          "code": "47977",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:47977",
          "code_system": "CHEBI",
          "references": [
            "49ff1972-3e3b-6be4-62ae-bdac6802392f"
          ]
        },
        {
          "uuid": "408e77e0-dee9-f52b-9158-ba20979bce4a",
          "code": "20993",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:20993",
          "code_system": "CHEBI",
          "references": [
            "49ff1972-3e3b-6be4-62ae-bdac6802392f"
          ]
        },
        {
          "uuid": "b867426b-4761-6c55-4634-4dcc5b20f9c9",
          "code": "5417",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:5417",
          "code_system": "CHEBI",
          "references": [
            "49ff1972-3e3b-6be4-62ae-bdac6802392f"
          ]
        },
        {
          "uuid": "3fad4d28-019a-2d65-66ab-8a224ee47bdc",
          "code": "100000092644",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "7a3bfc73-6b71-b182-ff19-a46f58697a06"
          ]
        },
        {
          "uuid": "c8188a3b-e27d-23d0-0747-e4064e4f4254",
          "code": "N08U5BOQ1K",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=N08U5BOQ1K",
          "code_system": "DAILYMED",
          "references": [
            "abd71f8d-40d0-ac8c-8c2a-ef8c255c90d4"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "04894f89-d88f-42a8-b862-f3bd5c15419a",
          "amount": {
            "uuid": "dffb25cb-f034-4a74-a17f-dfe28c71dfe2"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "6e6f0c21-7f4d-4c03-9054-a98e2d190bfd",
            "refuuid": "2cec419b-f063-4993-a7a6-3b252fe501c6",
            "name": "GLUCOSAMINE",
            "unii": "N08U5BOQ1K",
            "linking_id": "N08U5BOQ1K",
            "ref_pname": "GLUCOSAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8fd1aa89-2233-4712-aaff-64fbe62a3c79",
          "amount": {
            "uuid": "a1903173-0f93-4e56-9fb0-f8b189d31ddb"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "91b74f00-47d5-40ff-a504-0a4da9573250",
            "refuuid": "8fb24a98-0f97-442a-b81f-9aef01c92ec0",
            "name": "LEVOMEFOLATE GLUCOSAMINE",
            "unii": "Q65PL71Q1A",
            "linking_id": "Q65PL71Q1A",
            "ref_pname": "LEVOMEFOLATE GLUCOSAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d2341b85-ce61-480d-9881-1a039bb0ad87",
          "amount": {
            "uuid": "d0d9b350-ad71-4e8a-b270-657be520e3c2"
          },
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "e3e7c750-3a60-4f16-8ee0-d5d01b23af2a",
            "refuuid": "25512c74-b547-4fa6-9e3b-1efb8e47d70a",
            "name": "ALTERNATIVE DEFINITION for [GLUCOSAMINE]",
            "linking_id": "25512c74-b547-4fa6-9e3b-1efb8e47d70a",
            "ref_pname": "NO NAME"
          }
        },
        {
          "uuid": "eb47244a-575c-4004-868e-2479448c4fda",
          "amount": {
            "uuid": "3bf8045f-e387-4e35-bb51-e85571209459"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "94f96c93-a3f2-451a-8e19-23c50e08bfaa"
          ],
          "related_substance": {
            "uuid": "0e670d21-f47c-40da-966a-0397b28d12b2",
            "refuuid": "284e728c-b8c4-4124-9052-e153241e1a58",
            "name": "GLUCOSAMINE HYDROBROMIDE",
            "unii": "47BY4DVA8E",
            "linking_id": "47BY4DVA8E",
            "ref_pname": "GLUCOSAMINE HYDROBROMIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3cdd5ab9-ee6d-48e6-86e9-c5993ec97801",
          "amount": {
            "uuid": "d8044680-6090-44e4-b4b4-ef883589a04c"
          },
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "1408882b-77eb-4d2f-b8cf-32706f3f22c0",
            "refuuid": "1b3a7347-0737-40de-a4ec-decbfb2cd808",
            "name": "ALTERNATIVE DEFINITION for [GLUCOSAMINE]",
            "linking_id": "1b3a7347-0737-40de-a4ec-decbfb2cd808",
            "ref_pname": "NO NAME"
          }
        },
        {
          "uuid": "15450493-88c6-4b7b-8476-7da4bddbefd0",
          "amount": {
            "uuid": "13313e9a-4c89-471b-b09e-7212ebf8c6c1"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "bdd168e5-70c6-4cbc-b98c-a13bee9b064a"
          ],
          "related_substance": {
            "uuid": "34d4c8de-09e9-47a1-8df3-8e7b60b12449",
            "refuuid": "e79aea6d-527f-46db-a322-0b04d55d8a16",
            "name": "GLUCOSAMINE HYDRIODIDE",
            "unii": "MWX90Q450N",
            "linking_id": "MWX90Q450N",
            "ref_pname": "GLUCOSAMINE HYDRIODIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4ed2ccd8-f776-406b-ac46-3bea1c021f80",
          "name": "(2R,3R,4S,5R)-2-AMINO-3,4,5,6-TETRAHYDROXYHEXANAL",
          "stdName": "(2R,3R,4S,5R)-2-AMINO-3,4,5,6-TETRAHYDROXYHEXANAL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0bec64e-3ea8-4b7a-8153-77c99ddb6034"
          ],
          "display_name": false
        },
        {
          "uuid": "3525e8b2-3e53-4d20-bd59-c3dfe3efec0b",
          "name": "(3R,4R,5S,6R)-3-AMINO-6-(HYDROXYMETHYL)TETRAHYDRO-2H-PYRAN-2,4,5-TRIOL",
          "stdName": "(3R,4R,5S,6R)-3-AMINO-6-(HYDROXYMETHYL)TETRAHYDRO-2H-PYRAN-2,4,5-TRIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0bec64e-3ea8-4b7a-8153-77c99ddb6034"
          ],
          "display_name": false
        },
        {
          "uuid": "974c7661-8d58-4143-802b-5bf921ceca54",
          "name": "2-AMINO-2-DEOXY-D-GLUCOSE",
          "stdName": "2-AMINO-2-DEOXY-D-GLUCOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "474f446b-8592-41a1-b95b-d39133de3d30"
          ],
          "display_name": false
        },
        {
          "uuid": "128bb0c5-cdd4-4d22-86e9-bd47e639e164",
          "name": "CHITOSAMINE",
          "stdName": "CHITOSAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "474f446b-8592-41a1-b95b-d39133de3d30"
          ],
          "display_name": false
        },
        {
          "uuid": "302db0ab-c8dc-46d9-bac9-af2cf072fd91",
          "name": "D-(+)-GLUCOSAMINE",
          "stdName": "D-(+)-GLUCOSAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dba635a6-b276-4762-9256-d7a9eb4dc7e7"
          ],
          "display_name": false
        },
        {
          "uuid": "88db5108-aca5-4a58-8dca-0292a080fe3f",
          "name": "D-GLUCOPYRANOSE, 2-AMINO-2-DEOXY-",
          "stdName": "D-GLUCOPYRANOSE, 2-AMINO-2-DEOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "184eb94c-e533-4d17-bccb-8d9e21619636"
          ],
          "display_name": false
        },
        {
          "uuid": "e14bd89a-301d-4195-89fb-d6eb6f08b9e7",
          "name": "D-GLUCOSE, 2-AMINO-2-DEOXY-",
          "stdName": "D-GLUCOSE, 2-AMINO-2-DEOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6ccc8ca-44d4-4bd0-bba2-a09f1f44a7ae"
          ],
          "display_name": false
        },
        {
          "uuid": "35951f0e-14e4-4ada-8920-174c6b08ec28",
          "name": "GLUCOPYRANOSE, 2-AMINO-2-DEOXY-",
          "stdName": "GLUCOPYRANOSE, 2-AMINO-2-DEOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "184eb94c-e533-4d17-bccb-8d9e21619636"
          ],
          "display_name": false
        },
        {
          "uuid": "2f411133-921f-456c-af00-bf082241658f",
          "name": "GLUCOPYRANOSE, 2-AMINO-2-DEOXY-, D-",
          "stdName": "GLUCOPYRANOSE, 2-AMINO-2-DEOXY-, D-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "184eb94c-e533-4d17-bccb-8d9e21619636"
          ],
          "display_name": false
        },
        {
          "uuid": "87984fae-09d6-4b49-b831-216a0185c5e7",
          "name": "GLUCOSAMINE",
          "stdName": "GLUCOSAMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0e321822-b406-4bae-af53-d9f35c48faea",
            "523881d5-0418-4e04-b4fe-d68d51dd3820",
            "f94dc46e-d6f8-4fea-a055-9988dd59b46f",
            "f3cc3a22-be64-4dc0-9dc1-85fd73841cff",
            "eda7eb63-dec2-4a5a-b806-28856aee4592",
            "c16a2e21-c68b-4f45-b24f-f23ceabd5cb1",
            "15502d96-3b12-405c-b9a6-f1c395eaacf1",
            "f6ccc8ca-44d4-4bd0-bba2-a09f1f44a7ae",
            "5d7fce0a-87a9-4342-bce5-a2e4a89f82c4",
            "e4d176b3-c72a-4318-9d62-81b7e4af8ed0",
            "b84054b2-60d4-45cd-ae6d-32f6afdbaab7",
            "1f905dbc-3591-49c2-bb0e-15d3cd94aca6",
            "4b75174e-1534-43d3-a4b8-432db0691125",
            "123bcb09-544a-4b9c-a2af-f1de36631c1e",
            "fc907f1a-be00-4e35-9fa8-b4451b3152f7",
            "67f9ce2b-fd84-464e-9e52-0be1a6d04183",
            "b3730a82-74f2-435d-8dc5-01af675b6d13"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "0a0d51ba-5b89-43ed-a5af-90917e56f45b",
              "name_org": "INN"
            },
            {
              "uuid": "60c9b110-0ef7-45eb-8110-b1d69bf2a0cd",
              "name_org": "USAN"
            },
            {
              "uuid": "b605409f-2a57-4ffe-9745-9d7909dd84b8",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "bab3f018-2fdc-499c-a96d-fcab717ef40c",
          "name": "GLUCOSAMINE [HSDB]",
          "stdName": "GLUCOSAMINE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b75174e-1534-43d3-a4b8-432db0691125"
          ],
          "display_name": false
        },
        {
          "uuid": "8d995bae-87ea-4440-b1de-e0d7db64b62f",
          "name": "GLUCOSAMINE [MART.]",
          "stdName": "GLUCOSAMINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "123bcb09-544a-4b9c-a2af-f1de36631c1e"
          ],
          "display_name": false
        },
        {
          "uuid": "629cf186-3d76-4a62-bf93-f79de995a707",
          "name": "GLUCOSAMINE [MI]",
          "stdName": "GLUCOSAMINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e4d176b3-c72a-4318-9d62-81b7e4af8ed0"
          ],
          "display_name": false
        },
        {
          "uuid": "75a645e1-3b88-472a-9907-80f5eabe4287",
          "name": "GLUCOSAMINE [USAN]",
          "stdName": "GLUCOSAMINE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eda7eb63-dec2-4a5a-b806-28856aee4592"
          ],
          "display_name": false
        },
        {
          "uuid": "1452f96e-7ade-4728-81b4-db4733d8afbb",
          "name": "GLUCOSAMINE [VANDF]",
          "stdName": "GLUCOSAMINE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "523881d5-0418-4e04-b4fe-d68d51dd3820"
          ],
          "display_name": false
        },
        {
          "uuid": "87f99ac7-c491-ce58-bab1-30092876efac",
          "name": "Glucosamine [WHO-DD]",
          "stdName": "GLUCOSAMINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "88b30cd2-ae63-c9a4-defb-6327e7c82849"
          ],
          "display_name": false
        },
        {
          "uuid": "4d0c772a-815f-439b-b8db-a7114e0548ac",
          "name": "MEDIFLEX",
          "stdName": "MEDIFLEX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "184eb94c-e533-4d17-bccb-8d9e21619636"
          ],
          "display_name": false
        },
        {
          "uuid": "e6b47265-6729-451b-b921-8bcb6561ae36",
          "name": "glucosamine [INN]",
          "stdName": "GLUCOSAMINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3cc3a22-be64-4dc0-9dc1-85fd73841cff"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "523881d5-0418-4e04-b4fe-d68d51dd3820",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c0bec64e-3ea8-4b7a-8153-77c99ddb6034",
          "citation": "CHEMDRAW",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "184eb94c-e533-4d17-bccb-8d9e21619636",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dba635a6-b276-4762-9256-d7a9eb4dc7e7",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cdc9936c-419e-4a30-b8f6-2dc61729f4d7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389660000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2dac4f6b-539c-450a-b98e-d4ff475ca5af",
          "citation": "SRS import [N08U5BOQ1K]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=N08U5BOQ1K",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389660000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e321822-b406-4bae-af53-d9f35c48faea",
          "citation": "GLUCOSAMINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "67f9ce2b-fd84-464e-9e52-0be1a6d04183",
          "citation": "GLUCOSAMINE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "15502d96-3b12-405c-b9a6-f1c395eaacf1",
          "citation": "GLUCOSAMINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5d7fce0a-87a9-4342-bce5-a2e4a89f82c4",
          "citation": "GLUCOSAMINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1f905dbc-3591-49c2-bb0e-15d3cd94aca6",
          "citation": "GLUCOSAMINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b3730a82-74f2-435d-8dc5-01af675b6d13",
          "citation": "GLUCOSAMINE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c16a2e21-c68b-4f45-b24f-f23ceabd5cb1",
          "citation": "GLUCOSAMINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f94dc46e-d6f8-4fea-a055-9988dd59b46f",
          "citation": "GLUCOSAMINE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f6ccc8ca-44d4-4bd0-bba2-a09f1f44a7ae",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "474f446b-8592-41a1-b95b-d39133de3d30",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f3cc3a22-be64-4dc0-9dc1-85fd73841cff",
          "citation": "INN Proposed List 27",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL27.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "eda7eb63-dec2-4a5a-b806-28856aee4592",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "123bcb09-544a-4b9c-a2af-f1de36631c1e",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4d176b3-c72a-4318-9d62-81b7e4af8ed0",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b84054b2-60d4-45cd-ae6d-32f6afdbaab7",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b75174e-1534-43d3-a4b8-432db0691125",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc907f1a-be00-4e35-9fa8-b4451b3152f7",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb0c2cae-c10c-c408-ac37-c1f1641a7b81",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+3416-24-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bd4ffb8e-6ad1-399d-c2d8-eb997fd2e86f",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+3416-24-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "627cea25-3386-2dfe-7d91-f1219f821ad3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3416-24-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "49ff1972-3e3b-6be4-62ae-bdac6802392f",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0b87450d-0790-4f4c-bf2f-31f22d566382",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "94cbdc6c-651b-414b-bdf5-739d22fde022",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e3fc1a09-1c3b-40a6-b7f3-30e866b55168",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "bdd168e5-70c6-4cbc-b98c-a13bee9b064a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "94f96c93-a3f2-451a-8e19-23c50e08bfaa",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "abd71f8d-40d0-ac8c-8c2a-ef8c255c90d4",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "88b30cd2-ae63-c9a4-defb-6327e7c82849",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "7a3bfc73-6b71-b182-ff19-a46f58697a06",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6fdc382f-b228-428e-975e-e0b419cdcc22",
          "id": "6fdc382f-b228-428e-975e-e0b419cdcc22",
          "molfile": "\n  Marvin  01132105482D          \n\n 12 11  0  0  1  0            999 V2000\n   10.4636   -7.6844    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.4636   -6.8595    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1781   -8.0970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1781   -8.9220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7492   -8.0970    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.7492   -8.9220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0348   -7.6844    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.0348   -6.8595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3203   -8.0970    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.3203   -8.9220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6059   -7.6844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8914   -8.0970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  6  1  1  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  1  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  6  0  0  0\n  9 11  1  0  0  0  0\n 12 11  1  0  0  0  0\nM  END",
          "smiles": "C(=O)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)N",
          "formula": "C6H13NO5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b6063c1c-d380-428d-8544-e86bef95ef35"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "179.1714",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2cec419b-f063-4993-a7a6-3b252fe501c6",
      "version": "39",
      "structure": {
        "id": "8e2e1352-61ea-4d00-80cf-d5ac484fab61",
        "molfile": "\n  Marvin  01132107232D          \n\n 12 11  0  0  1  0            999 V2000\n    6.8914   -8.0970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6059   -7.6844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3203   -8.0970    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.0348   -7.6844    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.7492   -8.0970    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.4636   -7.6844    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.1781   -8.0970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1781   -8.9220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4636   -6.8595    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7492   -8.9220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0348   -6.8595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3203   -8.9220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  6  9  1  1  0  0  0\n  5 10  1  1  0  0  0\n  4 11  1  1  0  0  0\n  3 12  1  6  0  0  0\nM  END",
        "smiles": "C(=O)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)N",
        "formula": "C6H13NO5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "179.1714",
        "optical_activity": "( + )",
        "references": [
          "f6ccc8ca-44d4-4bd0-bba2-a09f1f44a7ae",
          "2dac4f6b-539c-450a-b98e-d4ff475ca5af",
          "f3cc3a22-be64-4dc0-9dc1-85fd73841cff"
        ],
        "stereo_centers": 4
      },
      "unii": "N08U5BOQ1K"
    }
  ]
}