{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2a836ff9-9604-4285-af1a-08560ac25f15",
          "code": "813-93-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=813-93-4",
          "code_system": "CAS",
          "references": [
            "c8ac5495-a15d-45d7-bf7a-50240213d2a3",
            "fc78b71b-f337-4aba-9379-6276d7d7f6c1"
          ]
        },
        {
          "uuid": "6b080c8c-1bbe-4d7c-bd9e-c81f28f5f3ae",
          "code": "C78025",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C78025",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c8ac5495-a15d-45d7-bf7a-50240213d2a3"
          ]
        },
        {
          "uuid": "c68d8188-2733-407c-b3d5-84f2df56e95c",
          "code": "C002791",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67002791",
          "code_system": "MESH",
          "references": [
            "c8ac5495-a15d-45d7-bf7a-50240213d2a3"
          ]
        },
        {
          "uuid": "6533e241-7292-45ad-9a7c-86800d906286",
          "code": "212-390-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.011.264",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c8ac5495-a15d-45d7-bf7a-50240213d2a3"
          ]
        },
        {
          "uuid": "8a41bd25-b500-47e1-8b2c-7dba62a25336",
          "code": "SUB32895",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "c8ac5495-a15d-45d7-bf7a-50240213d2a3"
          ]
        },
        {
          "uuid": "b7570374-7a6f-e091-acc1-1439f88bdb38",
          "code": "DTXSID6074330",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6074330",
          "code_system": "EPA CompTox",
          "references": [
            "b7d4ead9-2adc-8770-2145-881322e4ccea"
          ]
        },
        {
          "uuid": "0fd6a4a7-dac6-fe29-3af0-5cb3aff2fb46",
          "code": "C266",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Digestive System or Metabolism[C78276]|Antidiarrheal Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C266",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3ec46609-59a9-8e92-38c1-9aac8b91570b"
          ]
        },
        {
          "uuid": "92903543-a391-98e2-289f-6da8e5643895",
          "code": "13135",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13135",
          "code_system": "PUBCHEM",
          "references": [
            "34735905-8d30-32d0-d960-c2ec496da872"
          ]
        },
        {
          "uuid": "09fda6a5-f6d1-df14-153f-3dc261324686",
          "code": "3466 (Number of products:4)",
          "comments": "Dietary Supplement Label Database|chemical|Bismuth Citrate",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3466&item=Bismuth Citrate",
          "code_system": "DSLD",
          "references": [
            "3ec46609-59a9-8e92-38c1-9aac8b91570b"
          ]
        },
        {
          "uuid": "3bb23b9e-4b66-4ef0-a867-67b357f8a166",
          "code": "N04867Y76N",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ef638fd4-9869-9edc-8e72-e0b9319ee1ec",
          "code": "1075531",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1075531",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "3ec46609-59a9-8e92-38c1-9aac8b91570b"
          ]
        },
        {
          "uuid": "da798017-6461-fabb-e428-0282087e6726",
          "code": "100000126277",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "83a10385-9243-c74b-0630-82d6a5f3af82"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "0baefa0b-803b-4219-813e-04b71ced472a",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "3c2c1689-6151-49ee-a7fd-7362353f7f6a",
            "refuuid": "6735e420-936a-4d22-9c79-4a4ec5b35246",
            "name": "BISMUTH CATION",
            "unii": "ZS9CD1I8YE",
            "linking_id": "ZS9CD1I8YE",
            "ref_pname": "BISMUTH CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "06f898f3-7138-4f4d-a3f7-c3a0ca556c2e",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "14181c7b-92f5-441f-9ae9-78d4f956e00d",
            "refuuid": "7495c063-0afe-4404-b6dc-1327ce06fa4e",
            "name": "Anhydrous citric acid",
            "unii": "XF417D3PSL",
            "linking_id": "XF417D3PSL",
            "ref_pname": "Anhydrous citric acid",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "91cb61aa-f7c5-4908-921f-1b38d0302b94",
          "name": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, BISMUTH(3+) SALT (1:1)",
          "stdName": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, BISMUTH(3+) SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "20598cb2-0620-46b7-8ae3-6776d5c3f386",
            "ef4cf2a8-37ea-4d9b-8ed0-7cb41193f297"
          ],
          "display_name": false
        },
        {
          "uuid": "0f24a72b-dbea-4f75-be14-7c906a17f703",
          "name": "BISMUTH CITRATE",
          "stdName": "BISMUTH CITRATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "21df2f64-81d0-4364-9fb0-4995640a4c12",
            "a72dccf8-66ab-4baa-aee7-f20a570db801",
            "6c452ff8-a591-4d7c-acea-a9dd1b057081",
            "4432f423-42e0-46c5-bcfe-8a57969e2925",
            "0ea28531-d577-4982-bfa8-16fd60f94d4d",
            "f8c7e1b8-2991-4246-99cc-c90eaf295a04",
            "79e26f47-c1be-4718-9462-5f7d391d00de",
            "c8f9d7cf-7d86-4a47-a61f-658155cd0920",
            "041517e9-e9e3-4ddc-8486-ba0504376f2f",
            "3edffa95-356e-46a6-a4b1-09284aa6a129",
            "3a6b9b58-c3c5-4f48-bc6c-2182b2bb16bc",
            "5c8bc2eb-a206-4a22-b3a4-59fc504a4e5d"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "c9120be8-9c9a-42e9-944a-06a08794c52f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "9c24aa3c-bd9d-4749-bcbe-c1bc9247d0d2",
          "name": "BISMUTH CITRATE [MART.]",
          "stdName": "BISMUTH CITRATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ea28531-d577-4982-bfa8-16fd60f94d4d"
          ],
          "display_name": false
        },
        {
          "uuid": "b7774148-f142-324f-a4d0-f4f2e51a1168",
          "name": "BISMUTH CITRATE [USP MONOGRAPH]",
          "stdName": "BISMUTH CITRATE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60578dc9-2c8a-7df3-b9f9-4fbf6f1eb6a7"
          ],
          "display_name": false
        },
        {
          "uuid": "e3f8ddcc-7bce-4e6f-888a-68e40c927df9",
          "name": "BISMUTH CITRATE [USP-RS]",
          "stdName": "BISMUTH CITRATE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "041517e9-e9e3-4ddc-8486-ba0504376f2f",
            "c8f9d7cf-7d86-4a47-a61f-658155cd0920"
          ],
          "display_name": false
        },
        {
          "uuid": "baa8da73-aae1-d973-b41b-3eac2543d31b",
          "name": "Bismuth citrate [WHO-DD]",
          "stdName": "BISMUTH CITRATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3eaed07-3439-5f58-763d-ff3f8aec3eea"
          ],
          "display_name": false
        },
        {
          "uuid": "69b4b71e-1b8a-4797-a95a-175078ac89ed",
          "name": "TEGOKAT 752",
          "stdName": "TEGOKAT 752",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8f9d7cf-7d86-4a47-a61f-658155cd0920",
            "ef4cf2a8-37ea-4d9b-8ed0-7cb41193f297"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3a6b9b58-c3c5-4f48-bc6c-2182b2bb16bc",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ef4cf2a8-37ea-4d9b-8ed0-7cb41193f297",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20598cb2-0620-46b7-8ae3-6776d5c3f386",
          "citation": "ACD 9.0(21CFR)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "21df2f64-81d0-4364-9fb0-4995640a4c12",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ea28531-d577-4982-bfa8-16fd60f94d4d",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8f9d7cf-7d86-4a47-a61f-658155cd0920",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a72dccf8-66ab-4baa-aee7-f20a570db801",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "041517e9-e9e3-4ddc-8486-ba0504376f2f",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c8bc2eb-a206-4a22-b3a4-59fc504a4e5d",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8ac5495-a15d-45d7-bf7a-50240213d2a3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389912000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "05ec8347-36c2-423a-872e-fb95d654780a",
          "citation": "SRS import [N04867Y76N]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=N04867Y76N",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389912000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3edffa95-356e-46a6-a4b1-09284aa6a129",
          "citation": "BISMUTH CITRATE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f8c7e1b8-2991-4246-99cc-c90eaf295a04",
          "citation": "BISMUTH CITRATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4432f423-42e0-46c5-bcfe-8a57969e2925",
          "citation": "BISMUTH CITRATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6c452ff8-a591-4d7c-acea-a9dd1b057081",
          "citation": "BISMUTH CITRATE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "79e26f47-c1be-4718-9462-5f7d391d00de",
          "citation": "BISMUTH CITRATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b7d4ead9-2adc-8770-2145-881322e4ccea",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=813-93-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3ec46609-59a9-8e92-38c1-9aac8b91570b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "fc78b71b-f337-4aba-9379-6276d7d7f6c1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "34735905-8d30-32d0-d960-c2ec496da872",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "60578dc9-2c8a-7df3-b9f9-4fbf6f1eb6a7",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "f3eaed07-3439-5f58-763d-ff3f8aec3eea",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "997d6adf-27ca-b1b3-910c-37782880df8a",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "83a10385-9243-c74b-0630-82d6a5f3af82",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "dab3f0e6-44a9-45d2-9035-a964f0af6ddd",
          "id": "dab3f0e6-44a9-45d2-9035-a964f0af6ddd",
          "molfile": "\n  Marvin  01132111212D          \n\n  1  0  0  0  0  0            999 V2000\n   10.0834   -2.8559    0.0000 Bi  0  1  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   3\nM  END",
          "smiles": "[Bi+3]",
          "formula": "Bi",
          "atropisomerism": "No",
          "charge": 3,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cec5379a-1cd8-4352-a067-69378dc5051b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "208.9804",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "d7125fe5-fa6c-496b-a883-ebc51fa8c792",
          "id": "d7125fe5-fa6c-496b-a883-ebc51fa8c792",
          "molfile": "\n  Marvin  01132111092D          \n\n 13 12  0  0  0  0            999 V2000\n    6.9895   -1.6201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9937   -2.4468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2797   -2.8601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5657   -2.4551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6346   -2.9311    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.5615   -1.6284    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7076   -2.8601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4216   -2.4468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1356   -2.8559    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.4174   -1.6201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9895   -3.2735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7034   -3.6868    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.2672   -3.6868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  7  2  1  0  0  0  0\n 11  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  2  0  0  0  0\nM  CHG  3   5  -1   9  -1  12  -1\nM  END",
          "smiles": "C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O",
          "formula": "C6H5O7",
          "atropisomerism": "No",
          "charge": -3,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cbae7d69-401e-4226-8722-46f4f9fe0503"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "189.1",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6213fb63-3fa7-4dc1-9929-2503d96fa3bb",
      "version": "20",
      "structure": {
        "id": "742c9b22-008f-42c9-aa23-e5fc77594e3a",
        "molfile": "\n  Marvin  01132106012D          \n\n 14 12  0  0  0  0            999 V2000\n    6.9937   -2.4468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2797   -2.8601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7076   -2.8601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9895   -3.2735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4216   -2.4468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5657   -2.4551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7034   -3.6868    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.6346   -2.9311    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.1356   -2.8559    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.2672   -3.6868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4174   -1.6201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5615   -1.6284    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9895   -1.6201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0834   -2.8559    0.0000 Bi  0  1  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  4  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10  4  2  0  0  0  0\n 11  5  2  0  0  0  0\n 12  6  2  0  0  0  0\n 13  1  1  0  0  0  0\nM  CHG  4   7  -1   8  -1   9  -1  14   3\nM  END",
        "smiles": "C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.[Bi+3]",
        "formula": "C6H5O7.Bi",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "398.0804",
        "optical_activity": "NONE",
        "references": [
          "ef4cf2a8-37ea-4d9b-8ed0-7cb41193f297",
          "05ec8347-36c2-423a-872e-fb95d654780a"
        ],
        "stereo_centers": 0
      },
      "unii": "N04867Y76N"
    }
  ]
}