{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3488bb36-6f0e-4931-9b49-56899ab35782",
          "code": "477773-67-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=477773-67-4",
          "code_system": "CAS",
          "references": [
            "c2ad633f-b322-4e6e-9056-423cec2f08f1",
            "a68310c4-890c-4308-8463-54b13bce2ce9"
          ]
        },
        {
          "uuid": "83a2aba2-33b2-4d19-98a5-485601df6f25",
          "code": "1366229",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1366229/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "c2ad633f-b322-4e6e-9056-423cec2f08f1"
          ]
        },
        {
          "uuid": "c6aeb522-bdb8-4051-88d7-6c79db805df1",
          "code": "23683102",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23683102",
          "code_system": "PUBCHEM",
          "references": [
            "c2ad633f-b322-4e6e-9056-423cec2f08f1"
          ]
        },
        {
          "uuid": "42486028-fc8d-a7cc-9bb3-a7b176f7569e",
          "code": "DTXSID10197273",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10197273",
          "code_system": "EPA CompTox",
          "references": [
            "10192e67-1a42-66bb-2e95-43951017f155"
          ]
        },
        {
          "uuid": "12a11530-418a-4bd7-bed3-a4a87b5f7a4f",
          "code": "1370630",
          "type": "ALTERNATIVE",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1370630/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "e0c2c29f-aedc-e2c3-aac5-ed0d01329349"
          ]
        },
        {
          "uuid": "de69b11f-f4ea-4ca4-b3e2-3398ae889a9a",
          "code": "N02RVN6NYP",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6d617c01-5605-83ef-f5b9-2aa566a5771f",
          "code": "N02RVN6NYP",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=N02RVN6NYP",
          "code_system": "DAILYMED",
          "references": [
            "c14666e1-6bab-35bb-c377-52faff9bd2fe"
          ]
        },
        {
          "uuid": "c0150a23-c991-48c1-b3da-3859ac40f03d",
          "code": "300000032422",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "165009bc-2457-4bc5-7065-92e7a10bd448"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a0ab5d23-66df-4358-99e1-276a66545fc0",
          "name": "AZELOGLICINA",
          "stdName": "AZELOGLICINA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f8e1b5b0-c7a6-42cf-971b-ca464594a5b6",
            "b95a7b61-d726-4ed2-b07a-2c5b66e480d0"
          ],
          "display_name": false
        },
        {
          "uuid": "6470e2d7-e404-438a-c05c-2b9cc479dcc7",
          "name": "AZELOYL DIGLYCINATE",
          "stdName": "AZELOYL DIGLYCINATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0c2c29f-aedc-e2c3-aac5-ed0d01329349"
          ],
          "display_name": false
        },
        {
          "uuid": "1fbb4f1d-9b20-c8e7-a369-4339893c3a26",
          "name": "Azeloyl diglycinate [WHO-DD]",
          "stdName": "AZELOYL DIGLYCINATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dda592b0-2bb9-9d18-cde0-d40cca399c4a"
          ],
          "display_name": false
        },
        {
          "uuid": "a5d6b2f9-95b1-4bcc-b760-6adbd43ef57c",
          "name": "CORUM 5150",
          "stdName": "CORUM 5150",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f8e1b5b0-c7a6-42cf-971b-ca464594a5b6",
            "b95a7b61-d726-4ed2-b07a-2c5b66e480d0"
          ],
          "display_name": false
        },
        {
          "uuid": "d12bc769-376b-445f-8e0e-ae616e5ab83b",
          "name": "GLYCINE, N,N'-(1,9-DIOXO-1,9-NONANEDIYL)BIS-, MONOPOTASSIUM SALT",
          "stdName": "GLYCINE, N,N'-(1,9-DIOXO-1,9-NONANEDIYL)BIS-, MONOPOTASSIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46047b73-6530-4e0e-88e0-d10f9297b109",
            "f8e1b5b0-c7a6-42cf-971b-ca464594a5b6"
          ],
          "display_name": false
        },
        {
          "uuid": "17d9a70f-8456-411f-b214-05b0a178ff45",
          "name": "GLYCINE, N,N'-(1,9-DIOXO-1,9-NONANEDIYL)BIS-, POTASSIUM SALT (1:1)",
          "stdName": "GLYCINE, N,N'-(1,9-DIOXO-1,9-NONANEDIYL)BIS-, POTASSIUM SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46047b73-6530-4e0e-88e0-d10f9297b109",
            "f8e1b5b0-c7a6-42cf-971b-ca464594a5b6"
          ],
          "display_name": false
        },
        {
          "uuid": "2ecd5454-c7c1-41b7-8f7b-353eef13c33c",
          "name": "POTASSIUM AZELOYL DIGLYCINATE",
          "stdName": "POTASSIUM AZELOYL DIGLYCINATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f8e1b5b0-c7a6-42cf-971b-ca464594a5b6",
            "d3887908-a854-43da-bd3b-13d14ae34182",
            "b95a7b61-d726-4ed2-b07a-2c5b66e480d0"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "a045762b-7f5e-42fb-ab87-13cb16093a7d",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "b9751d3a-e7e2-7d50-bec4-d2ddb163350e",
          "name": "Potassium azeloyl diglycinate [WHO-DD]",
          "stdName": "POTASSIUM AZELOYL DIGLYCINATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dda592b0-2bb9-9d18-cde0-d40cca399c4a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b95a7b61-d726-4ed2-b07a-2c5b66e480d0",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f8e1b5b0-c7a6-42cf-971b-ca464594a5b6",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "46047b73-6530-4e0e-88e0-d10f9297b109",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c2ad633f-b322-4e6e-9056-423cec2f08f1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391547000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10a0bb23-f299-4563-a478-29382956b6be",
          "citation": "SRS import [N02RVN6NYP]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=N02RVN6NYP",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391547000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d3887908-a854-43da-bd3b-13d14ae34182",
          "citation": "POTASSIUM AZELOYL DIGLYCINATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "10192e67-1a42-66bb-2e95-43951017f155",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=477773-67-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e0c2c29f-aedc-e2c3-aac5-ed0d01329349",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a68310c4-890c-4308-8463-54b13bce2ce9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c14666e1-6bab-35bb-c377-52faff9bd2fe",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "165009bc-2457-4bc5-7065-92e7a10bd448",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "dda592b0-2bb9-9d18-cde0-d40cca399c4a",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1f858282-0b4e-4ba2-aa12-8e08dec4dc79",
          "id": "1f858282-0b4e-4ba2-aa12-8e08dec4dc79",
          "molfile": "\n  Marvin  01132101482D          \n\n  1  0  0  0  0  0            999 V2000\n   16.0399   -7.2097    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[K+]",
          "formula": "K",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b4982b98-9852-4f7f-8ce2-a898fb3219be"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "39.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "92376a46-f0c3-4664-a1d1-f9550a21f54f",
          "id": "92376a46-f0c3-4664-a1d1-f9550a21f54f",
          "molfile": "\n  Marvin  01132107352D          \n\n 21 20  0  0  0  0            999 V2000\n   14.7384   -7.0774    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0239   -7.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0239   -8.3148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3095   -7.0774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5950   -7.4899    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8806   -7.0774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8806   -6.2524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1661   -7.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4516   -7.0774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7372   -7.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0227   -7.0774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3083   -7.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5938   -7.0774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8795   -7.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1650   -7.0774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1650   -6.2524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4506   -7.4899    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7361   -7.0774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0216   -7.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3072   -7.0774    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.0216   -8.3148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 17 15  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 19 21  2  0  0  0  0\nM  CHG  1  20  -1\nM  END",
          "smiles": "C(CCCC(=O)NCC(=O)O)CCCC(=O)NCC(=O)[O-]",
          "formula": "C13H21N2O6",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "75f1ef30-1a15-4fdc-8762-ad2f7b40630a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "301.3162",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "afe2ae77-6578-4563-9158-b48b5cd3ce2e",
      "version": "11",
      "structure": {
        "id": "4fa85d08-b1b9-48b4-bd3d-0c85318ab78d",
        "molfile": "\n  Marvin  01132104092D          \n\n 22 20  0  0  0  0            999 V2000\n    3.3072   -7.0774    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0216   -7.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7361   -7.0774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4506   -7.4899    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1650   -7.0774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8795   -7.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5938   -7.0774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3083   -7.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0227   -7.0774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7372   -7.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4516   -7.0774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1661   -7.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8806   -7.0774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5950   -7.4899    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3095   -7.0774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0239   -7.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7384   -7.0774    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.0216   -8.3148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1650   -6.2524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8806   -6.2524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0239   -8.3148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0399   -7.2097    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n  2 18  2  0  0  0  0\n  5 19  2  0  0  0  0\n 13 20  2  0  0  0  0\n 16 21  2  0  0  0  0\nM  CHG  2  17  -1  22   1\nM  END",
        "smiles": "C(CCCC(=O)NCC(=O)O)CCCC(=O)NCC(=O)[O-].[K+]",
        "formula": "C13H21N2O6.K",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "340.4145",
        "optical_activity": "NONE",
        "references": [
          "46047b73-6530-4e0e-88e0-d10f9297b109",
          "10a0bb23-f299-4563-a478-29382956b6be"
        ],
        "stereo_centers": 0
      },
      "unii": "N02RVN6NYP"
    }
  ]
}