{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "da38d954-e71e-4af2-a3ec-ff4ea12a8f7c", "code": "162520-00-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=162520-00-5", "code_system": "CAS", "references": [ "06a619e9-80fd-4b32-9341-112e88b5a83a", "59b4add1-39f5-482e-b5bf-d5e85bd6d089" ] }, { "uuid": "60282f73-dce8-4077-895c-d83fa4f469cc", "code": "C71146", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C71146", "code_system": "NCI_THESAURUS", "references": [ "06a619e9-80fd-4b32-9341-112e88b5a83a" ] }, { "uuid": "e0ce6b55-3aaa-4fd8-9861-02ed7aebf9b9", "code": "8825", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=8825", "code_system": "INN", "references": [ "06a619e9-80fd-4b32-9341-112e88b5a83a" ] }, { "uuid": "e33a61fe-367e-4dd2-88f2-6ef5be1efc48", "code": "CHEMBL23293", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL23293", "code_system": "ChEMBL", "references": [ "06a619e9-80fd-4b32-9341-112e88b5a83a" ] }, { "uuid": "22694fb3-9071-4517-b42f-3c8847dc71fd", "code": "5469318", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5469318", "code_system": "PUBCHEM", "references": [ "06a619e9-80fd-4b32-9341-112e88b5a83a" ] }, { "uuid": "8a563aac-c9ad-128b-156e-823ab4de1737", "code": "231306", "comments": "ORPHAN DRUG|Designated/Withdrawn|Treatment of pancreatic cancer.", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=231306", "code_system": "FDA ORPHAN DRUG" }, { "uuid": "be5184db-c96b-fc87-9b14-fbb32e620e33", "code": "C1902", "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Signal Transduction Inhibitor[C2189]|Ras Inhibitor", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1902", "code_system": "NCI_THESAURUS", "references": [ "6f581db4-348b-99b1-2b7b-f5a1c42438e4" ] }, { "uuid": "9de405af-772a-63f7-60da-0dc0a3dba60e", "code": "EU/3/11/871", "comments": "EU ORPHAN DRUG|Withdrawn|Treatment of pancreatic cancer", "type": "PRIMARY", "url": "https://www.ema.europa.eu/en/medicines/human/orphan-designations/eu311871", "code_system": "EU-Orphan Drug", "references": [ "6f581db4-348b-99b1-2b7b-f5a1c42438e4" ] }, { "uuid": "c0f2e235-41c3-49f6-af3f-c7bfa5dd9725", "code": "MZH0OM550M", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "f8b1a6c9-3544-1575-a0a1-94643765dac2", "code": "DB12681", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB12681", "code_system": "DRUG BANK", "references": [ "6f581db4-348b-99b1-2b7b-f5a1c42438e4" ] }, { "uuid": "9f9203c6-efda-e0da-1272-15b1d828e288", "code": "DTXSID501025654", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID501025654", "code_system": "EPA CompTox", "references": [ "6f581db4-348b-99b1-2b7b-f5a1c42438e4" ] }, { "uuid": "b4791b8a-1f08-df1f-323a-3290f1be583b", "code": "100000177250", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "7a2faae9-9009-9517-6c07-82c53f7a37ed" ] }, { "uuid": "471e36c3-1747-4c4e-51dd-9237beb3db21", "code": "SS-64", "type": "PRIMARY", "url": "https://searchusan.ama-assn.org/finder/usan/search/SS-64/relevant/1/", "code_system": "USAN", "references": [ "c1595e67-4398-887d-560e-fbc17287401f" ] } ], "relationships": [ { "uuid": "cbad6a85-3d26-42b7-9243-150a1a47a264", "amount": { "uuid": "1a8e2355-fbe9-42e3-bd2c-15e6cbef3645" }, "type": "ACTIVE MOIETY", "related_substance": { "uuid": "36c57f76-8589-43ce-b165-ffebe301dc8d", "refuuid": "7afcba49-97ce-40aa-b2fc-28904fcf16c5", "name": "SALIRASIB", "unii": "MZH0OM550M", "linking_id": "MZH0OM550M", "ref_pname": "SALIRASIB", "substance_class": "reference" } }, { "uuid": "2cab63ea-3906-4b59-ba34-75968e80cf30", "amount": { "uuid": "6c70c154-0c97-4b53-ac4f-ef3609c3f53d" }, "type": "TARGET->INHIBITOR", "references": [ "567d9415-0ad6-49d1-8429-ac647f38ef96" ], "related_substance": { "uuid": "98c9f7bf-1552-4735-bc31-751e6f64347a", "refuuid": "c4e47ea5-c430-4bb8-90c5-7a1b23dffba5", "name": "GTPASE KRAS", "unii": "Q250P2D9Y8", "linking_id": "Q250P2D9Y8", "ref_pname": "GTPASE KRAS", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "88aec5f6-9277-4b17-aeac-4843dd99808b", "name": "FARNESYLTHIOSALICYLATE", "stdName": "FARNESYLTHIOSALICYLATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d1219fb3-8be0-4a41-b454-b759a4a143df", "8e363696-87f3-43d4-83c2-9be3302599c5" ], "display_name": false }, { "uuid": "9aaf8440-00c2-c385-6737-c9564ecb1964", "name": "S-Farnesylthiosalicylic acid", "stdName": "S-FARNESYLTHIOSALICYLIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "5d2de8c1-0487-afef-6a1c-37c00415c7c7" ], "display_name": false }, { "uuid": "1c73478f-ede7-4c82-8f8c-3593ccb6c67f", "name": "SALIRASIB", "stdName": "SALIRASIB", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "3e2daaba-c3d2-4c79-b8c6-730a8e19b0f3", "fb26e484-1603-4ef1-b896-65e0fdf71f41", "9fdf5277-5e91-4c90-94d9-0de3046828ef", "978610e9-e3f3-47f5-9b6a-fe103c1e221c", "63dc6b68-b9c5-4aa3-8b27-5013dddc7c7e", "84fa7162-fac5-4918-9252-dbac35afd75b", "8e363696-87f3-43d4-83c2-9be3302599c5", "295775af-ef11-4d9e-ab6c-c101f345badb" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "a2cc6309-dffb-4a26-a9cf-f9b2a9b8073e", "name_org": "INN" }, { "uuid": "b99bc780-3b90-4764-b486-08a2b0b34b4e", "name_org": "USAN" } ] }, { "uuid": "233c24d6-525b-4e05-bd82-0c47cf2ffd4b", "name": "SALIRASIB [USAN]", "stdName": "SALIRASIB [USAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "84fa7162-fac5-4918-9252-dbac35afd75b" ], "display_name": false }, { "uuid": "67b2d7cb-3211-6be8-7852-051b135f613d", "name": "Salirasib [WHO-DD]", "stdName": "SALIRASIB [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "dd1a4f35-1cab-0142-27a9-a62f2b474ad1" ], "display_name": false }, { "uuid": "fbe55ef2-e5cc-4246-85df-b4a7b913f9b9", "name": "salirasib [INN]", "stdName": "SALIRASIB [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3e2daaba-c3d2-4c79-b8c6-730a8e19b0f3" ], "display_name": false } ], "references": [ { "uuid": "295775af-ef11-4d9e-ab6c-c101f345badb", "citation": "USP Dictionary 2007", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "3e2daaba-c3d2-4c79-b8c6-730a8e19b0f3", "citation": "INN Proposed List 97", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL97.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "84fa7162-fac5-4918-9252-dbac35afd75b", "citation": "USP DICTIONARY 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9fdf5277-5e91-4c90-94d9-0de3046828ef", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8e363696-87f3-43d4-83c2-9be3302599c5", "citation": "WHO DRUG DICTIONARY", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d1219fb3-8be0-4a41-b454-b759a4a143df", "citation": "clin trials", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "06a619e9-80fd-4b32-9341-112e88b5a83a", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389916000, "tags": [ "NOMEN" ] }, { "uuid": "2ae82e0d-13ed-4f20-8523-5dd93aa481a2", "citation": "SRS import [MZH0OM550M]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=MZH0OM550M", "doc_type": "SRS", "public_domain": true, "document_date": 1493389916000, "tags": [ "NOMEN" ] }, { "uuid": "c0ed3c77-bf00-4397-b850-84e11ec649b4", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "63dc6b68-b9c5-4aa3-8b27-5013dddc7c7e", "citation": "SALIRASIB [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "fb26e484-1603-4ef1-b896-65e0fdf71f41", "citation": "SALIRASIB [USAN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "978610e9-e3f3-47f5-9b6a-fe103c1e221c", "citation": "SALIRASIB [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "6f581db4-348b-99b1-2b7b-f5a1c42438e4", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "9a39ea59-007b-9eaf-c20c-d15a7401e305", "citation": "USAN COUN 2006", "doc_type": "USANCOUN", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "59b4add1-39f5-482e-b5bf-d5e85bd6d089", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "c1595e67-4398-887d-560e-fbc17287401f", "citation": "USAD COUN", "doc_type": "USANCOUN", "public_domain": true }, { "uuid": "5d2de8c1-0487-afef-6a1c-37c00415c7c7", "citation": "USP", "doc_type": "USP", "public_domain": true }, { "uuid": "dd1a4f35-1cab-0142-27a9-a62f2b474ad1", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "567d9415-0ad6-49d1-8429-ac647f38ef96", "citation": "https://www.sciencedirect.com/topics/medicine-and-dentistry/salirasib#:~:text=Salirasib%20exerts%20its%20pharmacological%20activity,that%20allow%20uncontrolled%20cell%20proliferation.", "url": "https://www.sciencedirect.com/topics/medicine-and-dentistry/salirasib#:~:text=Salirasib%20exerts%20its%20pharmacological%20activity,that%20allow%20uncontrolled%20cell%20proliferation.", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "7a2faae9-9009-9517-6c07-82c53f7a37ed", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "255d07e9-2b04-4f6a-aa3b-1be01fc6bede", "id": "255d07e9-2b04-4f6a-aa3b-1be01fc6bede", "molfile": "\n Marvin 01132102042D \n\n 25 25 0 0 0 0 999 V2000\n 9.7403 0.1401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0308 -0.2774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0381 -1.1037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3125 0.1284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6030 -0.2891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8848 0.1168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1753 -0.3008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1826 -1.1270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4570 0.1051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7475 -0.3124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0293 0.0934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3198 -0.3241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3270 -1.1503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6015 0.0818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8920 -0.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1737 0.0701 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4648 -0.3478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2525 0.0615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9645 -0.3504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9653 -1.1783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2513 -1.5931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4668 -1.1779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1796 -1.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8920 -1.1708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1828 -2.4117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 2 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 7 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 12 2 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 22 17 2 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 25 2 0 0 0 0\nM END", "smiles": "CC(=CCC/C(=C/CC/C(=C/CSc1ccccc1C(=O)O)/C)/C)C", "formula": "C22H30O2S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "cab15d28-22d2-4f61-af0d-6fd184a927a9" }, "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "358.5393", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "7afcba49-97ce-40aa-b2fc-28904fcf16c5", "version": "20", "structure": { "id": "1501b68b-698f-4a85-ad0b-2d175235ef49", "molfile": "\n Marvin 01132101172D \n\n 25 25 0 0 0 0 999 V2000\n -0.9645 -0.3504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9653 -1.1783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2513 -1.5931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4668 -1.1779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4648 -0.3478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2525 0.0615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1737 0.0701 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8920 -0.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6015 0.0818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3198 -0.3241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0293 0.0934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7475 -0.3124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4570 0.1051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1753 -0.3008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8848 0.1168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6030 -0.2891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3125 0.1284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0308 -0.2774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7403 0.1401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3270 -1.1503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1826 -1.1270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0381 -1.1037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1796 -1.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8920 -1.1708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1828 -2.4117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6 1 1 0 0 0 0\n 12 13 1 0 0 0 0\n 1 2 2 0 0 0 0\n 13 14 2 0 0 0 0\n 5 7 1 0 0 0 0\n 14 15 1 0 0 0 0\n 3 4 2 0 0 0 0\n 15 16 1 0 0 0 0\n 7 8 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 8 9 1 0 0 0 0\n 18 19 1 0 0 0 0\n 4 5 1 0 0 0 0\n 10 20 1 0 0 0 0\n 9 10 2 0 0 0 0\n 14 21 1 0 0 0 0\n 2 3 1 0 0 0 0\n 18 22 1 0 0 0 0\n 10 11 1 0 0 0 0\n 4 23 1 0 0 0 0\n 5 6 2 0 0 0 0\n 23 24 1 0 0 0 0\n 11 12 1 0 0 0 0\n 23 25 2 0 0 0 0\nM END", "smiles": "CC(=CCC/C(=C/CC/C(=C/CSc1ccccc1C(=O)O)/C)/C)C", "formula": "C22H30O2S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "358.5393", "optical_activity": "NONE", "references": [ "c0ed3c77-bf00-4397-b850-84e11ec649b4", "2ae82e0d-13ed-4f20-8523-5dd93aa481a2", "3e2daaba-c3d2-4c79-b8c6-730a8e19b0f3" ], "stereo_centers": 0 }, "unii": "MZH0OM550M" } ] }