{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "82f8f324-14a9-41f5-826f-f0777fb868ed",
          "code": "82428-30-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=82428-30-6",
          "code_system": "CAS",
          "references": [
            "43132e12-b35d-4a67-baa1-50be1fdc84e1",
            "19e33fa0-dd97-4107-84f0-30632fb12fb8"
          ]
        },
        {
          "uuid": "b6c410d3-439a-48b8-b192-f5ce52f14cd6",
          "code": "121494101",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/121494101",
          "code_system": "PUBCHEM",
          "references": [
            "43132e12-b35d-4a67-baa1-50be1fdc84e1"
          ]
        },
        {
          "uuid": "3b49d1d4-601a-40eb-9e95-164a1a27616c",
          "code": "MYB5K91HKV",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "61202c94-820d-7ecc-bec9-fca99b4e5ab0",
          "code": "DTXSID701002678",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID701002678",
          "code_system": "EPA CompTox",
          "references": [
            "124b618c-ed54-998c-837e-f0a22411e035"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b20e6422-648f-4b4f-ac33-ef28dc374c97",
          "name": "(3,4-EPOXYCYCLOHEXYL)METHYL METHACRYLATE",
          "stdName": "(3,4-EPOXYCYCLOHEXYL)METHYL METHACRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e63cf6ea-0bdd-4cd7-95a3-d9964788e97c",
            "418cd7f8-1a6d-4806-8b38-2815a62f012a"
          ],
          "display_name": true
        },
        {
          "uuid": "7752d437-6438-4c7c-9606-ff0a067336d9",
          "name": "2-PROPENOIC ACID, 2-METHYL-, 7-OXABICYCLO(4.1.0)HEPT-3-YLMETHYL ESTER",
          "stdName": "2-PROPENOIC ACID, 2-METHYL-, 7-OXABICYCLO(4.1.0)HEPT-3-YLMETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7459094c-1afc-41e4-88db-362117e19e65",
            "e63cf6ea-0bdd-4cd7-95a3-d9964788e97c"
          ],
          "display_name": false
        },
        {
          "uuid": "d05105af-6983-4862-b0b5-1ac48d8db56d",
          "name": "CYCLOMER M 100",
          "stdName": "CYCLOMER M 100",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e63cf6ea-0bdd-4cd7-95a3-d9964788e97c",
            "418cd7f8-1a6d-4806-8b38-2815a62f012a"
          ],
          "display_name": false
        },
        {
          "uuid": "dd9e64e8-8089-4014-adc6-cf9923d305bf",
          "name": "M 100",
          "stdName": "M 100",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e63cf6ea-0bdd-4cd7-95a3-d9964788e97c",
            "418cd7f8-1a6d-4806-8b38-2815a62f012a"
          ],
          "display_name": false
        },
        {
          "uuid": "325de995-f78d-4dca-996c-29ca5b1ed611",
          "name": "METHACRYLIC ACID, 7-OXABICYCLO(4.1.0)HEPT-3-YLMETHYL ESTER",
          "stdName": "METHACRYLIC ACID, 7-OXABICYCLO(4.1.0)HEPT-3-YLMETHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e63cf6ea-0bdd-4cd7-95a3-d9964788e97c",
            "418cd7f8-1a6d-4806-8b38-2815a62f012a"
          ],
          "display_name": false
        },
        {
          "uuid": "28219cbe-8e25-4d35-9168-cee0296ea8a7",
          "name": "METHB (METHACRYLATE)",
          "stdName": "METHB (METHACRYLATE)",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e63cf6ea-0bdd-4cd7-95a3-d9964788e97c",
            "418cd7f8-1a6d-4806-8b38-2815a62f012a"
          ],
          "display_name": false
        },
        {
          "uuid": "61709223-435f-4cfa-aec2-321b802b7ddc",
          "name": "S 100 (EPOXY ACRYLATE)",
          "stdName": "S 100 (EPOXY ACRYLATE)",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e63cf6ea-0bdd-4cd7-95a3-d9964788e97c",
            "418cd7f8-1a6d-4806-8b38-2815a62f012a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7459094c-1afc-41e4-88db-362117e19e65",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e63cf6ea-0bdd-4cd7-95a3-d9964788e97c",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "418cd7f8-1a6d-4806-8b38-2815a62f012a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "43132e12-b35d-4a67-baa1-50be1fdc84e1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393038000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "be9b45c7-1f22-42d0-8f82-03f740d25a92",
          "citation": "SRS import [MYB5K91HKV]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=MYB5K91HKV",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393038000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00d218f6-43f5-4a97-be4b-1700031c8260",
          "citation": "CHEMID RECORD 82428-30-6",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "19e33fa0-dd97-4107-84f0-30632fb12fb8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "124b618c-ed54-998c-837e-f0a22411e035",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7dbf66e8-25fa-4c74-82b7-636b1f8a070b",
          "id": "7dbf66e8-25fa-4c74-82b7-636b1f8a070b",
          "molfile": "\n  Marvin  01132106322D          \n\n 14 15  0  0  0  0            999 V2000\n   12.5025   -4.8374    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   11.7914   -4.4309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0781   -4.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0797   -5.6648    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   10.3665   -6.0795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6553   -5.6729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9421   -6.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2289   -5.6775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9437   -6.9068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2305   -7.3215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6590   -7.3205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7950   -6.0785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5082   -5.6638    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   13.2214   -5.2492    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  1 13  1  0  0  0  0\n  1 14  1  1  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4 12  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  2  0  0  0  0\n 13 12  1  1  0  0  0\n 13 14  1  0  0  0  0\nM  END",
          "smiles": "C=C(C)C(=O)OCC1CC[C@@H]2[C@H](C1)O2",
          "formula": "C11H16O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7ebd5973-e9b1-43e4-9773-2bf7e11b1262"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "196.2434",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "INCOMPLETE",
      "uuid": "2cef5563-6d9a-40c8-aa76-2e2dad8ea941",
      "version": "9",
      "structure": {
        "id": "c6658c59-9416-4c2e-9e67-2d3dd0d6da7d",
        "molfile": "\n  Marvin  01132110152D          \n\n 14 15  0  0  1  0            999 V2000\n   13.2214   -5.2492    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5082   -5.6638    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.7950   -6.0785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0797   -5.6648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3665   -6.0795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6553   -5.6729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9421   -6.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9437   -6.9068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6590   -7.3205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2305   -7.3215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2289   -5.6775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0781   -4.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7914   -4.4309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5025   -4.8374    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  8  1  0  0  0  0\n 11  7  2  0  0  0  0\n 12  4  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14  1  1  1  0  0  0\n 13 14  1  0  0  0  0\n 14  2  1  0  0  0  0\nM  END",
        "smiles": "C=C(C)C(=O)OCC1CC[C@@H]2[C@H](C1)O2",
        "formula": "C11H16O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "196.2434",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "be9b45c7-1f22-42d0-8f82-03f740d25a92",
          "00d218f6-43f5-4a97-be4b-1700031c8260"
        ],
        "stereo_centers": 3
      },
      "unii": "MYB5K91HKV"
    }
  ]
}