{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "9d5bf622-c7fb-4472-a0d6-642157b64622", "code": "1003050-32-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1003050-32-5", "code_system": "CAS", "references": [ "65a9bea9-747f-43b0-b338-dd8cbd29cf58", "56feccad-75c0-42df-a8a4-6fd6ff64dbf5" ] }, { "uuid": "d548da35-49f2-4a18-b1f6-da8f30efb1c3", "code": "57579236", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/57579236", "code_system": "PUBCHEM", "references": [ "5b97c566-13ad-4964-8ced-950775514e7c" ] }, { "uuid": "ce7df564-05ab-4b7a-9be7-f2da4fbc5816", "code": "MXO6EXQ1T8", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "d3e08c9f-8b1f-d012-1728-ed1e6dadad49", "code": "DTXSID501019750", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID501019750", "code_system": "EPA CompTox" }, { "uuid": "d9cb4c7f-0ce7-7a55-4045-98d47494bf08", "code": "2058", "type": "PRIMARY", "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/2058/", "code_system": "JECFA MONOGRAPH", "references": [ "b6d19825-5af5-6930-5c45-fa47caf82309" ] } ], "substance_class": "chemical", "names": [ { "uuid": "2d842320-bfa0-44c9-b185-49550475c2a6", "name": "2,3,4,5,6-PENTAFLUORO-N-(2-METHYLCYCLOHEXYL)BENZAMIDE", "stdName": "2,3,4,5,6-PENTAFLUORO-N-(2-METHYLCYCLOHEXYL)BENZAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "5b97c566-13ad-4964-8ced-950775514e7c" ], "display_name": true }, { "uuid": "1d4c7d5b-0545-89e1-62dc-3b3354798f79", "name": "FEMA NO. 4678", "stdName": "FEMA NO. 4678", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "cdf924e2-e6f0-0c47-2614-0d4eac46e7b8" ], "display_name": false }, { "uuid": "c0bf7e8e-842a-e221-8159-895756e2fe15", "name": "N-(2-METHYLCYCLOHEXYL)-2,3,4,5,6-PENTAFLUOROBENZAMIDE", "stdName": "N-(2-METHYLCYCLOHEXYL)-2,3,4,5,6-PENTAFLUOROBENZAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "cdf924e2-e6f0-0c47-2614-0d4eac46e7b8" ], "display_name": false }, { "uuid": "1e680907-7289-8db8-f518-21badaaddbfe", "name": "PFMC BENZAMIDE", "stdName": "PFMC BENZAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "cdf924e2-e6f0-0c47-2614-0d4eac46e7b8" ], "display_name": false } ], "references": [ { "uuid": "5b97c566-13ad-4964-8ced-950775514e7c", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "65a9bea9-747f-43b0-b338-dd8cbd29cf58", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493394363000, "tags": [ "NOMEN" ] }, { "uuid": "cdf924e2-e6f0-0c47-2614-0d4eac46e7b8", "citation": "FHFI", "doc_type": "HANDBOOK OF FLAVOR INGREDIENTS", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "56feccad-75c0-42df-a8a4-6fd6ff64dbf5", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "b6d19825-5af5-6930-5c45-fa47caf82309", "citation": "JECFA", "doc_type": "JECFA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "e6a9a18e-cf3a-4879-9d09-8c7147deea5f", "id": "e6a9a18e-cf3a-4879-9d09-8c7147deea5f", "molfile": "\n Marvin 01132111562D \n\n 21 22 0 0 0 0 999 V2000\n 3.7710 -6.4454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0590 -6.0329 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 2.3452 -6.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6313 -6.0329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6313 -5.2058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3452 -4.7880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0590 -5.2058 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 3.7728 -4.7965 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7752 -3.9736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0639 -3.5601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4891 -3.5643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4891 -2.7372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7789 -2.3216 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2102 -2.3321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2175 -1.5093 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9241 -2.7499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6397 -2.3438 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9168 -3.5728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6270 -3.9884 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2030 -3.9821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1993 -4.8050 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 7 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 2 0 0 0 0\n 11 9 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 20 2 0 0 0 0\n 13 12 1 0 0 0 0\n 14 12 2 0 0 0 0\n 15 14 1 0 0 0 0\n 16 14 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 16 2 0 0 0 0\n 19 18 1 0 0 0 0\n 20 18 1 0 0 0 0\n 21 20 1 0 0 0 0\nM END", "smiles": "CC1CCCCC1NC(=O)c2c(c(c(c(c2F)F)F)F)F", "formula": "C14H14F5NO", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "6b6986bc-7d20-49c9-89e8-a562f469e9b7" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "307.2596", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "INCOMPLETE", "uuid": "7de12534-15d1-4b0b-b795-003a4d23af43", "version": "10", "structure": { "id": "7d52d35c-9278-45e8-810d-da459c86f1bf", "molfile": "\n Marvin 01132106302D \n\n 21 22 0 0 0 0 999 V2000\n 3.7789 -2.3216 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2175 -1.5093 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6397 -2.3438 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6270 -3.9884 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1993 -4.8050 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7710 -6.4454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0590 -5.2058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0590 -6.0329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3452 -6.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6313 -6.0329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6313 -5.2058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3452 -4.7880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4891 -3.5643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2030 -3.9821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9168 -3.5728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9241 -2.7499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2102 -2.3321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4891 -2.7372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7752 -3.9736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0639 -3.5601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7728 -4.7965 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 7 12 1 0 0 0 0\n 6 8 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 13 18 1 0 0 0 0\n 13 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 19 21 1 0 0 0 0\n 7 21 1 0 0 0 0\n 5 14 1 0 0 0 0\n 4 15 1 0 0 0 0\n 3 16 1 0 0 0 0\n 2 17 1 0 0 0 0\n 1 18 1 0 0 0 0\nM END", "smiles": "CC1CCCCC1NC(=O)c2c(c(c(c(c2F)F)F)F)F", "formula": "C14H14F5NO", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "307.2596", "optical_activity": "UNSPECIFIED", "references": [ "5b97c566-13ad-4964-8ced-950775514e7c" ], "stereo_centers": 2 }, "unii": "MXO6EXQ1T8" } ] }