{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "8df10bb9-8096-4a29-b7bf-0f46aa60de28", "code": "138460-25-0", "type": "NON-SPECIFIC STEREOCHEMISTRY", "url": "https://commonchemistry.cas.org/detail?cas_rn=138460-25-0", "code_system": "CAS", "references": [ "0f15dfbb-a4b9-40ca-b544-dcbc54e55924", "8b3962ea-abe7-4864-92cb-6251c90a9eb5" ] }, { "uuid": "5be1acde-14ed-4bb2-b294-da1af04833f4", "code": "4447", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4447", "code_system": "PUBCHEM", "references": [ "0f15dfbb-a4b9-40ca-b544-dcbc54e55924" ] }, { "uuid": "992a084a-e3a4-1a20-9c1b-b5f069265aef", "code": "DB07816", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB07816", "code_system": "DRUG BANK", "references": [ "c7dcf57c-aa22-9300-4b4f-e916d9a838df" ] }, { "uuid": "6f553e24-1e17-96a2-4025-a8fc857b8d1f", "code": "385425", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:385425", "code_system": "CHEBI", "references": [ "c7dcf57c-aa22-9300-4b4f-e916d9a838df" ] }, { "uuid": "9056b3ec-40be-2e0d-5124-e4f2d5aa23cd", "code": "DTXSID70930123", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70930123", "code_system": "EPA CompTox", "references": [ "c7dcf57c-aa22-9300-4b4f-e916d9a838df" ] }, { "uuid": "e0d5c9a0-5443-4b7c-b9c0-dac2a15c50ce", "code": "1808181-85-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1808181-85-2", "code_system": "CAS" }, { "uuid": "653dcfc3-bf82-4923-b32b-777989e486ef", "code": "MW7J9SU4JQ", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "6abe5dc5-34f3-4f82-a174-cd1c6a9b840f", "name": "(N(Z))-N-(((4-CYANOPHENYL)AMINO)((DIPHENYLMETHYL)AMINO)METHYLENE)GLYCINE", "stdName": "(N(Z))-N-(((4-CYANOPHENYL)AMINO)((DIPHENYLMETHYL)AMINO)METHYLENE)GLYCINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8b3962ea-abe7-4864-92cb-6251c90a9eb5" ], "display_name": false }, { "uuid": "f87120ce-4426-4259-8ed5-897f3f7e8886", "name": "GLYCINE, N-(((4-CYANOPHENYL)AMINO)((DIPHENYLMETHYL)AMINO)METHYLENE)-, (N(Z))-", "stdName": "GLYCINE, N-(((4-CYANOPHENYL)AMINO)((DIPHENYLMETHYL)AMINO)METHYLENE)-, (N(Z))-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8b3962ea-abe7-4864-92cb-6251c90a9eb5" ], "display_name": false }, { "uuid": "1ba0309c-3e4f-41c1-b386-7a0e7820107c", "name": "N-(P-CYANOPHENYL)-N'-DIPHENYLMETHYL-GUANIDINE-ACETIC ACID", "stdName": "N-(P-CYANOPHENYL)-N'-DIPHENYLMETHYL-GUANIDINE-ACETIC ACID", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b9ea0eac-fc3d-4739-9eb0-e2b8e9e93210", "614e7b67-a119-4d22-a29b-2e576f5fcb6d" ], "display_name": true } ], "references": [ { "uuid": "b9ea0eac-fc3d-4739-9eb0-e2b8e9e93210", "citation": "Drug Bank", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "0f15dfbb-a4b9-40ca-b544-dcbc54e55924", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393566000, "tags": [ "NOMEN" ] }, { "uuid": "9c12a42d-706e-4ddd-beb2-bbaf6e1fee05", "citation": "Drug Bank DB07816", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "614e7b67-a119-4d22-a29b-2e576f5fcb6d", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "c7dcf57c-aa22-9300-4b4f-e916d9a838df", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "8b3962ea-abe7-4864-92cb-6251c90a9eb5", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "29f8d29f-4102-4cdb-9934-a55a6b7475c1", "id": "29f8d29f-4102-4cdb-9934-a55a6b7475c1", "molfile": "\n Marvin 01132102172D \n\n 29 31 0 0 0 0 999 V2000\n -2.7295 -0.7211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7295 0.1039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4439 0.5164 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0150 0.5164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3005 0.1039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5860 0.5164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1284 0.1039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1284 -0.7211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8429 -1.1336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5574 -0.7211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2718 -1.1336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2718 -1.9586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5574 -2.3711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8429 -1.9586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5860 -1.1336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5860 -1.9586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3005 -2.3711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0150 -1.9586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0150 -1.1336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3005 -0.7211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5860 1.3414 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1284 1.7539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1284 2.5789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8429 2.9914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5574 2.5789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5574 1.7539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8429 1.3414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2718 2.9914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9863 3.4039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 4 2 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 6 21 2 3 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 8 15 1 0 0 0 0\n 10 9 1 0 0 0 0\n 14 9 2 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 20 2 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 27 2 0 0 0 0\n 23 24 2 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 25 28 1 0 0 0 0\n 26 27 1 0 0 0 0\n 28 29 3 0 0 0 0\nM END", "smiles": "c1ccc(cc1)C(c2ccccc2)NC(=Nc3ccc(cc3)C#N)NCC(=O)O", "formula": "C23H20N4O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "b644320e-3da1-43e1-a835-58f7a425aaba" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "384.4314", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "919905f4-cfc8-45a8-9cb5-497f9b0f4402", "version": "8", "structure": { "id": "7e437803-cf3f-4120-8d01-1635d887f026", "molfile": "\n Marvin 01132106332D \n\n 29 31 0 0 0 0 999 V2000\n 1.5574 -0.7211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2718 -1.1336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2718 -1.9586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5574 -2.3711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8429 -1.9586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8429 -1.1336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1284 -0.7211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1284 0.1039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5860 -1.1336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5860 -1.9586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3005 -2.3711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0150 -1.9586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0150 -1.1336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3005 -0.7211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5860 0.5164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3005 0.1039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0150 0.5164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7295 0.1039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7295 -0.7211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4439 0.5164 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5860 1.3414 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1284 1.7539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1284 2.5789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8429 2.9914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5574 2.5789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2718 2.9914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9863 3.4039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5574 1.7539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8429 1.3414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 6 2 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 8 15 1 0 0 0 0\n 9 10 2 0 0 0 0\n 9 14 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 15 16 2 0 0 0 0\n 15 21 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 20 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 29 2 0 0 0 0\n 23 24 2 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 28 2 0 0 0 0\n 26 27 3 0 0 0 0\n 28 29 1 0 0 0 0\nM END", "smiles": "c1ccc(cc1)C(c2ccccc2)N/C(=N/CC(=O)O)/Nc3ccc(cc3)C#N", "formula": "C23H20N4O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "384.4314", "optical_activity": "NONE", "references": [ "9c12a42d-706e-4ddd-beb2-bbaf6e1fee05" ], "stereo_centers": 0 }, "unii": "MW7J9SU4JQ" } ] }