{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "18efc159-5d99-48fe-bbb1-b94f747d5695", "code": "MV7XKZ9FYQ", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "97c7393a-5fc6-4c76-b0a2-4189fd8611e2", "code": "2374-14-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=2374-14-3", "code_system": "CAS", "references": [ "9eb27dc5-1212-4956-ab82-350095e5ed97", "4d02e593-307a-4228-b9b3-1c98ebd89a70" ] }, { "uuid": "d8986658-08ad-4bb6-8e8f-84713749763f", "code": "219-154-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.017.414", "code_system": "ECHA (EC/EINECS)", "references": [ "9eb27dc5-1212-4956-ab82-350095e5ed97" ] }, { "uuid": "16ef8b90-1788-48d7-9fb3-5fe423ba967d", "code": "75410", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/75410", "code_system": "PUBCHEM", "references": [ "9eb27dc5-1212-4956-ab82-350095e5ed97" ] }, { "uuid": "39cd0717-20d2-2d2a-0a3a-9de4c7980070", "code": "DTXSID7051892", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7051892", "code_system": "EPA CompTox", "references": [ "8662e2fc-0cd1-7528-231f-c4b0f308e877" ] } ], "substance_class": "chemical", "names": [ { "uuid": "4329ac5b-9a32-42f2-9458-c54534e31f40", "name": "2,4,6-Trimethyl-2,4,6-tris(3,3,3-trifluoropropyl)cyclotrisiloxane", "stdName": "2,4,6-TRIMETHYL-2,4,6-TRIS(3,3,3-TRIFLUOROPROPYL)CYCLOTRISILOXANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "95a45764-6a1b-42b3-8453-7c800f74a155" ], "display_name": true }, { "uuid": "e89b745c-c2eb-45b1-b940-6e0528ecad3b", "name": "Cyclotrisiloxane, 2,4,6-trimethyl-2,4,6-tris(3,3,3-trifluoropropyl)-", "stdName": "CYCLOTRISILOXANE, 2,4,6-TRIMETHYL-2,4,6-TRIS(3,3,3-TRIFLUOROPROPYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4d02e593-307a-4228-b9b3-1c98ebd89a70" ], "display_name": false } ], "references": [ { "uuid": "95a45764-6a1b-42b3-8453-7c800f74a155", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9eb27dc5-1212-4956-ab82-350095e5ed97", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392074000, "tags": [ "NOMEN" ] }, { "uuid": "8662e2fc-0cd1-7528-231f-c4b0f308e877", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2374-14-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4d02e593-307a-4228-b9b3-1c98ebd89a70", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "900a3bd1-26b8-6c2f-f3d6-87684b1791f3", "citation": "STARI", "doc_type": "CFSAN", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "0d001570-1cc1-4616-9fe5-34cd803ce20e", "id": "0d001570-1cc1-4616-9fe5-34cd803ce20e", "molfile": "\n Marvin 01132100552D \n\n 27 27 0 0 0 0 999 V2000\n 2.6614 -0.3300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8766 -1.1262 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1521 -0.7174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4419 -1.1262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7245 -0.7174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.3013 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3084 -1.4347 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1334 0.0000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8766 -1.9440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5868 -2.3601 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0057 -2.9483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5868 -3.1851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2970 -3.6012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2970 -4.4333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1220 -4.4333 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2970 -5.2582 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4792 -4.4333 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2970 -1.9584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2970 -1.1334 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1004 -1.3414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0216 -0.7174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7317 -1.1334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4491 -0.7174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1736 -0.3013 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8651 -1.4347 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0330 0.0000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5868 -0.7174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 9 1 0 0 0 0\n 2 27 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 5 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 10 18 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 14 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 21 1 0 0 0 0\n 19 27 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 25 1 0 0 0 0\n 23 26 1 0 0 0 0\nM END", "smiles": "C[Si]1(CCC(F)(F)F)O[Si](C)(CCC(F)(F)F)O[Si](C)(CCC(F)(F)F)O1", "formula": "C12H21F9O3Si3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "26d19a6c-0909-479a-be96-14bd5c7ccc62" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "468.5356", "optical_activity": "NONE", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "7696def6-eb70-4370-b89d-86d0a676c464", "version": "6", "structure": { "id": "ac851223-1430-4af7-b32a-f24dc0a98899", "molfile": "\n JSDraw212192417272D\n\n 27 27 0 0 0 0 0 V2000\n 22.4924 -9.8699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.4952 -8.6748 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 24.4979 -9.8699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.9644 -11.3357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.9671 -12.5308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.7721 -13.5336 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9699 -13.7259 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 26.1622 -11.5280 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 24.8462 -7.8948 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.8462 -6.3348 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 26.3825 -6.6057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.3797 -4.8689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.9160 -4.5980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4496 -3.1321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9155 -3.6656 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9831 -1.6661 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9836 -2.5985 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 23.4952 -5.5548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.1441 -6.3348 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6106 -4.8689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.6079 -6.6057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.6051 -5.4107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0688 -5.6816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7979 -4.1453 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5325 -5.9525 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3397 -7.2179 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 22.1441 -7.8948 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 5 8 1 0 0 0 0\n 2 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 14 17 1 0 0 0 0\n 10 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 25 1 0 0 0 0\n 23 26 1 0 0 0 0\n 19 27 1 0 0 0 0\n 2 27 1 0 0 0 0\nM END", "smiles": "C[Si]1(CCC(F)(F)F)O[Si](C)(CCC(F)(F)F)O[Si](C)(CCC(F)(F)F)O1", "formula": "C12H21F9O3Si3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "468.5356", "optical_activity": "NONE", "references": [ "95a45764-6a1b-42b3-8453-7c800f74a155", "4d02e593-307a-4228-b9b3-1c98ebd89a70" ], "stereo_centers": 3 }, "unii": "MV7XKZ9FYQ" } ] }