{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "24aab6b1-882a-47f5-a7c1-c000b97ad50e",
          "code": "QA12CC06",
          "comments": "VATC|MINERAL SUPPLEMENTS|OTHER MINERAL SUPPLEMENTS|Magnesium|magnesium lactate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA12CC06&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "0ab0eb96-c058-491a-8773-ab5ed671c255"
          ]
        },
        {
          "uuid": "a7d40b69-6676-4b79-90ac-b0f803f22a4f",
          "code": "18917-93-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=18917-93-6",
          "code_system": "CAS",
          "references": [
            "0ab0eb96-c058-491a-8773-ab5ed671c255",
            "8e228865-96a0-4b4c-aff8-5e179ae1c212"
          ]
        },
        {
          "uuid": "6b593785-7a26-4d34-851b-431ecd128d06",
          "code": "A12CC06",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|MINERAL SUPPLEMENTS|OTHER MINERAL SUPPLEMENTS|Magnesium|magnesium lactate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A12CC06&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "0ab0eb96-c058-491a-8773-ab5ed671c255"
          ]
        },
        {
          "uuid": "70b738c4-ea2f-4726-a416-123d8992a212",
          "code": "INS-329",
          "comments": "Codex Alimentarius|Functional Classification|Acidity regulator|Flour treatment agent",
          "type": "PRIMARY",
          "url": "http://www.fao.org/gsfaonline/additives/details.html?id=362",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "0ab0eb96-c058-491a-8773-ab5ed671c255"
          ]
        },
        {
          "uuid": "2e03e36e-4284-49de-b977-b5d6481730a0",
          "code": "INS-329",
          "comments": "JECFA Evaluation|Functional Classification|ACIDITY REGULATOR|FLOUR TREATMENT AGENT|NUTRIENT SUPPLEMENT",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemINS=329",
          "code_system": "JECFA EVALUATION",
          "references": [
            "0ab0eb96-c058-491a-8773-ab5ed671c255"
          ]
        },
        {
          "uuid": "690905c9-0c6a-4cd1-a681-e4853c5d9cad",
          "code": "214688",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/214688/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "0ab0eb96-c058-491a-8773-ab5ed671c255"
          ]
        },
        {
          "uuid": "80711abc-f748-4b88-aeca-63790a349009",
          "code": "m7006",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7006?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "0ab0eb96-c058-491a-8773-ab5ed671c255"
          ]
        },
        {
          "uuid": "73cd9edc-e83a-4a37-82b2-bc4cefab7a26",
          "code": "SUB14431MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "0ab0eb96-c058-491a-8773-ab5ed671c255"
          ]
        },
        {
          "uuid": "dabc3616-a583-4b2c-98dc-a1090a8b9099",
          "code": "CHEMBL3707281",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL3707281",
          "code_system": "ChEMBL",
          "references": [
            "0ab0eb96-c058-491a-8773-ab5ed671c255"
          ]
        },
        {
          "uuid": "88b4588e-5c9e-49f8-ab49-449ffb81415b",
          "code": "242-671-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.038.777",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0ab0eb96-c058-491a-8773-ab5ed671c255"
          ]
        },
        {
          "uuid": "6ef52422-13be-519d-5c7a-b613fd29bf3c",
          "code": "Magnesium lactate",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Magnesium_lactate",
          "code_system": "WIKIPEDIA",
          "references": [
            "d6a5c565-2ff6-ce40-d48e-140ce3b9fec9"
          ]
        },
        {
          "uuid": "c223e275-f037-1d3b-f1f2-d594460a1e9e",
          "code": "DTXSID20872620",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20872620",
          "code_system": "EPA CompTox",
          "references": [
            "feb3407a-1c9a-b95b-1021-114b1511a339"
          ]
        },
        {
          "uuid": "1ddeded3-4ec4-64cf-dc2f-fb341d8bc288",
          "code": "5319192",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5319192",
          "code_system": "PUBCHEM",
          "references": [
            "81030422-7061-87bf-c963-def8dcac243b"
          ]
        },
        {
          "uuid": "d3c8479c-4b36-43df-954f-14f5630b8206",
          "code": "MT6QI8324A",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3015f610-bf76-5f95-65b1-ac70b1434e4f",
          "code": "4592",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4592",
          "code_system": "DRUG CENTRAL",
          "references": [
            "29ed9694-6cb7-d997-e721-526116135ef6"
          ]
        },
        {
          "uuid": "0d434424-a57b-3864-a244-c9e884e61ad3",
          "code": "DB14515",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB14515",
          "code_system": "DRUG BANK",
          "references": [
            "29ed9694-6cb7-d997-e721-526116135ef6"
          ]
        },
        {
          "uuid": "fabc9ab6-68c4-56d6-2464-53092c3c014e",
          "code": "MT6QI8324A",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=MT6QI8324A",
          "code_system": "DAILYMED",
          "references": [
            "d2902db1-286c-c477-4b5c-94ce6b35a170"
          ]
        },
        {
          "uuid": "20f976be-9a44-90ad-2643-e33d16e7d1f5",
          "code": "100000089068",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2f10ba3c-ab64-18f4-71bb-219b79c2e30c"
          ]
        },
        {
          "uuid": "43916b70-c484-74f8-505c-0b9fa9826204",
          "code": "570",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=570",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "29ed9694-6cb7-d997-e721-526116135ef6"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "2f65576f-bff1-4f9e-b0bd-dbb887f8a045",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "43826da1-ace3-40e5-9cff-3c34ac24d909",
            "refuuid": "66b2f71b-ed33-477e-a787-234966de5e31",
            "name": "MAGNESIUM CATION",
            "unii": "T6V3LHY838",
            "linking_id": "T6V3LHY838",
            "ref_pname": "MAGNESIUM CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "eff02c3c-c8d1-4444-abeb-c4e3eb5ab5d4",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "deff255c-d1db-4992-988a-3f3547a9e77e",
            "refuuid": "e7fee0a8-1a38-4503-a268-f1654f22cc20",
            "name": "LACTIC ACID, DL-",
            "unii": "3B8D35Y7S4",
            "linking_id": "3B8D35Y7S4",
            "ref_pname": "LACTIC ACID, DL-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ef230b4c-53e4-46ff-bdfc-551bdf033118",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "62b3e604-35cd-4001-94b0-8e8658dedcad"
          ],
          "related_substance": {
            "uuid": "b26942fa-3ca0-4801-85e3-3c30c9a34819",
            "refuuid": "6c727e3a-2565-4dd6-bd42-76dc976425a3",
            "name": "MAGNESIUM LACTATE TRIHYDRATE",
            "unii": "Y0890ENQ6C",
            "linking_id": "Y0890ENQ6C",
            "ref_pname": "MAGNESIUM LACTATE TRIHYDRATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ec4401e4-a565-4066-a43b-120b08d43660",
          "name": "ANHYDROUS MAGNESIUM LACTATE, DL-",
          "stdName": "ANHYDROUS MAGNESIUM LACTATE, DL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "56882739-5adc-43c9-8e85-a81d056e730b",
            "38cb0bad-987b-4558-b042-596fc49e149f"
          ],
          "display_name": false
        },
        {
          "uuid": "9db845ea-d591-4e3b-b288-e1dc4b426a14",
          "name": "DL-LACTIC ACID MAGNESIUM SALT",
          "stdName": "DL-LACTIC ACID MAGNESIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f5299ee-4278-455e-ae1a-3c05a0645b48",
            "38cb0bad-987b-4558-b042-596fc49e149f"
          ],
          "display_name": false
        },
        {
          "uuid": "c91b51df-43f7-4638-a707-f791f912e84b",
          "name": "E-329",
          "stdName": "E-329",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f5299ee-4278-455e-ae1a-3c05a0645b48",
            "38cb0bad-987b-4558-b042-596fc49e149f"
          ],
          "display_name": false
        },
        {
          "uuid": "c9a80365-3e67-48d8-9871-b3e19ef29f74",
          "name": "INS NO.329",
          "stdName": "INS NO.329",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f5299ee-4278-455e-ae1a-3c05a0645b48",
            "38cb0bad-987b-4558-b042-596fc49e149f"
          ],
          "display_name": false
        },
        {
          "uuid": "f3fe7e6f-2e50-4926-bdc1-56669818f636",
          "name": "INS-329",
          "stdName": "INS-329",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f5299ee-4278-455e-ae1a-3c05a0645b48",
            "38cb0bad-987b-4558-b042-596fc49e149f"
          ],
          "display_name": false
        },
        {
          "uuid": "b6407bdc-63e3-4db5-957e-fdf826455d90",
          "name": "MAGNESIUM DL(-)-2-HYDROXYPROPIONATE",
          "stdName": "MAGNESIUM DL(-)-2-HYDROXYPROPIONATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f5299ee-4278-455e-ae1a-3c05a0645b48",
            "38cb0bad-987b-4558-b042-596fc49e149f"
          ],
          "display_name": false
        },
        {
          "uuid": "2379a891-ceb3-48eb-b0f0-bb377b5ab375",
          "name": "MAGNESIUM DL-LACTATE",
          "stdName": "MAGNESIUM DL-LACTATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "56882739-5adc-43c9-8e85-a81d056e730b",
            "38cb0bad-987b-4558-b042-596fc49e149f"
          ],
          "display_name": false
        },
        {
          "uuid": "b044cba6-b68e-401a-bcfe-dc2d08e7d85d",
          "name": "MAGNESIUM LACTATE",
          "stdName": "MAGNESIUM LACTATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fbd208e-e967-43a0-a676-0ad89b4c3a85",
            "002fc0e6-0c36-432a-a2b0-351534551095",
            "da5df5a2-1d65-4f4e-a3a6-c8a5275145e9",
            "13c0cd32-583e-4984-acdf-2811c0a82163",
            "70115434-5670-4ff3-bf92-08cb1c049b5d",
            "ce908c43-d665-47f3-bf51-0db0c097f64f",
            "a3f98356-28a5-4de9-b642-f0cefd47e238",
            "99ab334b-0e88-416d-945f-53e18dcf0dcd",
            "447e67a1-1e90-48a5-967e-ab18d032bbf3",
            "38cb0bad-987b-4558-b042-596fc49e149f"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "29b470e4-8fc5-439f-8568-1471491d7298",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "de9c2b9b-649a-484f-b728-4a8e86628398",
          "name": "MAGNESIUM LACTATE ANHYDROUS",
          "stdName": "MAGNESIUM LACTATE ANHYDROUS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "56882739-5adc-43c9-8e85-a81d056e730b",
            "38cb0bad-987b-4558-b042-596fc49e149f"
          ],
          "display_name": false
        },
        {
          "uuid": "a44dd3f5-f4a6-43e7-889e-1df4d7a74b10",
          "name": "MAGNESIUM LACTATE [FCC]",
          "stdName": "MAGNESIUM LACTATE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99ab334b-0e88-416d-945f-53e18dcf0dcd",
            "38cb0bad-987b-4558-b042-596fc49e149f"
          ],
          "display_name": false
        },
        {
          "uuid": "a1037718-70ca-40b3-8813-1d3eeddc4232",
          "name": "MAGNESIUM LACTATE [MI]",
          "stdName": "MAGNESIUM LACTATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "da5df5a2-1d65-4f4e-a3a6-c8a5275145e9",
            "38cb0bad-987b-4558-b042-596fc49e149f"
          ],
          "display_name": false
        },
        {
          "uuid": "fcc660d3-1b6e-44ed-8b70-a4b63408b501",
          "name": "MAGNESIUM LACTATE, (±)-",
          "stdName": "MAGNESIUM LACTATE, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "56882739-5adc-43c9-8e85-a81d056e730b",
            "38cb0bad-987b-4558-b042-596fc49e149f"
          ],
          "display_name": false
        },
        {
          "uuid": "2099eb64-e6a4-42ae-bb2e-e42823a357b8",
          "name": "MAGNESIUM LACTATE, ANHYDROUS",
          "stdName": "MAGNESIUM LACTATE, ANHYDROUS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "56882739-5adc-43c9-8e85-a81d056e730b",
            "38cb0bad-987b-4558-b042-596fc49e149f"
          ],
          "display_name": false
        },
        {
          "uuid": "4bae1633-fd8b-4ed8-8575-4f10e2498d72",
          "name": "MAGNESIUM LACTATE, DL-",
          "stdName": "MAGNESIUM LACTATE, DL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "56882739-5adc-43c9-8e85-a81d056e730b",
            "38cb0bad-987b-4558-b042-596fc49e149f"
          ],
          "display_name": false
        },
        {
          "uuid": "fd92bab7-ad7d-478c-85fb-d64d8e69abeb",
          "name": "MAGNESIUM, BIS(2-(HYDROXY-.KAPPA.O)PROPANOATO-.KAPPA.O)-, (T-4)-",
          "stdName": "MAGNESIUM, BIS(2-(HYDROXY-.KAPPA.O)PROPANOATO-.KAPPA.O)-, (T-4)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "13c0cd32-583e-4984-acdf-2811c0a82163",
            "38cb0bad-987b-4558-b042-596fc49e149f"
          ],
          "display_name": false
        },
        {
          "uuid": "3168a803-996b-4149-a0f4-bbe43b70a89d",
          "name": "MAGNESIUM, BIS(2-HYDROXYPROPANOATO-O1,O2)-, (T-4)-",
          "stdName": "MAGNESIUM, BIS(2-HYDROXYPROPANOATO-O1,O2)-, (T-4)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "13c0cd32-583e-4984-acdf-2811c0a82163",
            "38cb0bad-987b-4558-b042-596fc49e149f"
          ],
          "display_name": false
        },
        {
          "uuid": "446e728a-73fe-4cc4-8c64-2cf2e6465487",
          "name": "MAGNESIUM, BIS(LACTATO)-",
          "stdName": "MAGNESIUM, BIS(LACTATO)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "13c0cd32-583e-4984-acdf-2811c0a82163",
            "38cb0bad-987b-4558-b042-596fc49e149f"
          ],
          "display_name": false
        },
        {
          "uuid": "b7d07f45-09c5-e5b6-7df2-fcfd64acd991",
          "name": "Magnesium lactate [WHO-DD]",
          "stdName": "MAGNESIUM LACTATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26372abe-aa40-5f97-0825-9ab0249d20d7"
          ],
          "display_name": false
        },
        {
          "uuid": "355870d0-1d00-4a2f-8c1e-a6012d2f3eff",
          "name": "PROMAGSAN",
          "stdName": "PROMAGSAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "13c0cd32-583e-4984-acdf-2811c0a82163",
            "38cb0bad-987b-4558-b042-596fc49e149f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "38cb0bad-987b-4558-b042-596fc49e149f",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13c0cd32-583e-4984-acdf-2811c0a82163",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99ab334b-0e88-416d-945f-53e18dcf0dcd",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "70115434-5670-4ff3-bf92-08cb1c049b5d",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a3f98356-28a5-4de9-b642-f0cefd47e238",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f5299ee-4278-455e-ae1a-3c05a0645b48",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "da5df5a2-1d65-4f4e-a3a6-c8a5275145e9",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ab0eb96-c058-491a-8773-ab5ed671c255",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391120000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a92a2b4-3cbd-4c03-9f24-11e80597deec",
          "citation": "SRS import [MT6QI8324A]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=MT6QI8324A",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391120000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "002fc0e6-0c36-432a-a2b0-351534551095",
          "citation": "MAGNESIUM LACTATE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ce908c43-d665-47f3-bf51-0db0c097f64f",
          "citation": "MAGNESIUM LACTATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4fbd208e-e967-43a0-a676-0ad89b4c3a85",
          "citation": "MAGNESIUM LACTATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "447e67a1-1e90-48a5-967e-ab18d032bbf3",
          "citation": "MAGNESIUM LACTATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "56882739-5adc-43c9-8e85-a81d056e730b",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d6a5c565-2ff6-ce40-d48e-140ce3b9fec9",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Naringin_dihydrochalcone",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "feb3407a-1c9a-b95b-1021-114b1511a339",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=18917-93-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "62b3e604-35cd-4001-94b0-8e8658dedcad",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "81030422-7061-87bf-c963-def8dcac243b",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "8e228865-96a0-4b4c-aff8-5e179ae1c212",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "29ed9694-6cb7-d997-e721-526116135ef6",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "26372abe-aa40-5f97-0825-9ab0249d20d7",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d2902db1-286c-c477-4b5c-94ce6b35a170",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "2f10ba3c-ab64-18f4-71bb-219b79c2e30c",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2e625d0e-cdae-4085-b9d7-52d9cc61162f",
          "id": "2e625d0e-cdae-4085-b9d7-52d9cc61162f",
          "molfile": "\n  Marvin  01132102302D          \n\n  1  0  0  0  0  0            999 V2000\n    2.2652   -3.0552    0.0000 Mg  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Mg+2]",
          "formula": "Mg",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fbb3e5d6-2acc-40ca-816b-fd331d05686b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "24.3051",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "e3ed5fea-ed80-4fde-a216-70a5ef5c4fbf",
          "id": "e3ed5fea-ed80-4fde-a216-70a5ef5c4fbf",
          "molfile": "\n  Marvin  01132111482D          \n\n  6  5  0  0  0  0            999 V2000\n    3.7733   -3.9821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4370   -3.5961    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.4370   -2.8286    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.0530   -4.1449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8440   -4.9436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8395   -3.8859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  2  0  0  0  0\nM  CHG  1   3  -1\nM  END",
          "smiles": "CC(C(=O)O)[O-]",
          "formula": "C3H5O3",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "ebd3be9d-92ac-4de3-9dc8-34c11cb8a4fb"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "89.0701",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8e0e5ae8-9d47-4770-98fd-fe77c5952387",
      "version": "17",
      "structure": {
        "id": "bf806a7a-0aad-4767-9467-66b24c528953",
        "molfile": "\n  Marvin  01132109542D          \n\n 13 10  0  0  0  0            999 V2000\n    2.2652   -3.0552    0.0000 Mg  0  2  0  0  0  0  0  0  0  0  0  0\n    4.4370   -2.8286    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4370   -3.5961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0530   -4.1449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8440   -4.9436    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.8395   -3.8859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7733   -3.9821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4370   -2.8286    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4370   -3.5961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0530   -4.1449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8440   -4.9436    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.8395   -3.8859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7733   -3.9821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  2  0  0  0  0\n  7  3  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 13  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\nM  CHG  3   1   2   5  -1  11  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 12   2   3   4   5   6   7   8   9  10  11  12  13\nM  SPA   1  6   2   3   4   5   6   7\nM  SDI   1  4    3.3533   -5.3636    3.3533   -2.4086\nM  SDI   1  4    6.2595   -2.4086    6.2595   -5.3636\nM  SMT   1 2\nM  END",
        "smiles": "CC(C(=O)[O-])O.CC(C(=O)[O-])O.[Mg+2]",
        "formula": "2C3H5O3.Mg",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "202.4453",
        "optical_activity": "( + / - )",
        "references": [
          "7a92a2b4-3cbd-4c03-9f24-11e80597deec",
          "da5df5a2-1d65-4f4e-a3a6-c8a5275145e9"
        ],
        "stereo_centers": 2
      },
      "unii": "MT6QI8324A"
    }
  ]
}