{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4cd246c0-10f4-4072-9a98-a1a863d4fc87",
          "code": "2781-10-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2781-10-4",
          "code_system": "CAS",
          "references": [
            "4d05f580-f2c5-4aea-98f2-e66062d23f2f",
            "879140d5-eba3-4703-a967-5116b8944861"
          ]
        },
        {
          "uuid": "e2611d63-c425-4106-aded-608748e66359",
          "code": "220-481-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.018.620",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4d05f580-f2c5-4aea-98f2-e66062d23f2f"
          ]
        },
        {
          "uuid": "32a828f8-3c13-cec2-f8ec-2d07922d3d49",
          "code": "DTXSID9051953",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9051953",
          "code_system": "EPA CompTox",
          "references": [
            "807203ab-2fbb-7913-3ade-815688a0f425"
          ]
        },
        {
          "uuid": "da140416-b89c-96b4-4cc1-635356ee11e7",
          "code": "16682803",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16682803",
          "code_system": "PUBCHEM",
          "references": [
            "5a243c2e-5909-109a-0458-37ba22788389"
          ]
        },
        {
          "uuid": "681be0e9-b22d-4adf-8fdf-d527103bec08",
          "code": "MSX21S9RGM",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0e8e0b93-f70e-531c-90eb-81b7d36216cb",
          "code": "73733",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=73733",
          "code_system": "NSC",
          "references": [
            "716a0e32-0ac9-1099-a28c-5be13ffe42de"
          ]
        },
        {
          "uuid": "b5f5d2c0-616c-562d-bd87-f88b1708ede3",
          "code": "300000053312",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "9c6a62e3-22be-d1e0-2ba3-e902f7893f2c"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fdd748a8-e5af-472a-9daf-d5c07fe01ff6",
          "name": "DIBUTYLTIN BIS(.ALPHA.-ETHYLHEXANOATE)",
          "stdName": "DIBUTYLTIN BIS(.ALPHA.-ETHYLHEXANOATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "807a5f85-33dd-496d-a1fe-34f88ce4f6ac",
            "e3fab6f4-d34b-42b1-bc35-6972e0bab274"
          ],
          "display_name": false
        },
        {
          "uuid": "4c355486-e46c-4f1e-9f5d-d8b5326de710",
          "name": "DIBUTYLTIN BIS(2-ETHYLHEXANOATE)",
          "stdName": "DIBUTYLTIN BIS(2-ETHYLHEXANOATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "807a5f85-33dd-496d-a1fe-34f88ce4f6ac",
            "e3fab6f4-d34b-42b1-bc35-6972e0bab274"
          ],
          "display_name": true
        },
        {
          "uuid": "3ccc7ea9-7a09-4f32-9a4e-c6d33ff73f59",
          "name": "DIBUTYLTIN DI(2-ETHYLHEXOATE)",
          "stdName": "DIBUTYLTIN DI(2-ETHYLHEXOATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9bd65fca-e3ab-49d4-b62a-3d9def1ebed0",
            "e3fab6f4-d34b-42b1-bc35-6972e0bab274"
          ],
          "display_name": false
        },
        {
          "uuid": "bedfa0ab-9db1-4229-8c61-9539a4a901d4",
          "name": "FASCAT 4208",
          "stdName": "FASCAT 4208",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "807a5f85-33dd-496d-a1fe-34f88ce4f6ac",
            "e3fab6f4-d34b-42b1-bc35-6972e0bab274"
          ],
          "display_name": false
        },
        {
          "uuid": "ca830a00-e167-47b6-aad8-5e44b0a334df",
          "name": "HEXANOIC ACID, 2-ETHYL-, 1,1'-(DIBUTYLSTANNYLENE) ESTER",
          "stdName": "HEXANOIC ACID, 2-ETHYL-, 1,1'-(DIBUTYLSTANNYLENE) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "807a5f85-33dd-496d-a1fe-34f88ce4f6ac",
            "e3fab6f4-d34b-42b1-bc35-6972e0bab274"
          ],
          "display_name": false
        },
        {
          "uuid": "89d896ca-ea90-493b-a31d-926e9ec1ba9a",
          "name": "NSC-73733",
          "stdName": "NSC-73733",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9bd65fca-e3ab-49d4-b62a-3d9def1ebed0",
            "e3fab6f4-d34b-42b1-bc35-6972e0bab274"
          ],
          "display_name": false
        },
        {
          "uuid": "6c65ada9-9e5f-402e-b771-c3ec24b4319f",
          "name": "STANNANE, BIS(2-ETHYLHEXANOYLOXY)DIBUTYL-",
          "stdName": "STANNANE, BIS(2-ETHYLHEXANOYLOXY)DIBUTYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9bd65fca-e3ab-49d4-b62a-3d9def1ebed0",
            "e3fab6f4-d34b-42b1-bc35-6972e0bab274"
          ],
          "display_name": false
        },
        {
          "uuid": "bb7806c2-d32f-49a2-a92d-ab9fac10b9de",
          "name": "STANNANE, DIBUTYLBIS((2-ETHYL-1-OXOHEXYL)OXY)-",
          "stdName": "STANNANE, DIBUTYLBIS((2-ETHYL-1-OXOHEXYL)OXY)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "807a5f85-33dd-496d-a1fe-34f88ce4f6ac",
            "e3fab6f4-d34b-42b1-bc35-6972e0bab274"
          ],
          "display_name": false
        },
        {
          "uuid": "36e9003b-8709-4534-a977-5bfa6dca55cd",
          "name": "STANNANE, DIBUTYLBIS((2-ETHYLHEXANOYL)OXY)-",
          "stdName": "STANNANE, DIBUTYLBIS((2-ETHYLHEXANOYL)OXY)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9bd65fca-e3ab-49d4-b62a-3d9def1ebed0",
            "e3fab6f4-d34b-42b1-bc35-6972e0bab274"
          ],
          "display_name": false
        },
        {
          "uuid": "32f4410e-9a30-4681-96e2-0f67bf085792",
          "name": "TIN, DIBUTYL-, DI(2-ETHYLHEXOATE)",
          "stdName": "TIN, DIBUTYL-, DI(2-ETHYLHEXOATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9bd65fca-e3ab-49d4-b62a-3d9def1ebed0",
            "e3fab6f4-d34b-42b1-bc35-6972e0bab274"
          ],
          "display_name": false
        },
        {
          "uuid": "4c57c804-cdfb-435d-8d6c-2f3bed41f9e1",
          "name": "TIN, DIBUTYLBIS((2-ETHYLHEXANOYL)OXY)-",
          "stdName": "TIN, DIBUTYLBIS((2-ETHYLHEXANOYL)OXY)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "807a5f85-33dd-496d-a1fe-34f88ce4f6ac",
            "e3fab6f4-d34b-42b1-bc35-6972e0bab274"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9bd65fca-e3ab-49d4-b62a-3d9def1ebed0",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e3fab6f4-d34b-42b1-bc35-6972e0bab274",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "807a5f85-33dd-496d-a1fe-34f88ce4f6ac",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4d05f580-f2c5-4aea-98f2-e66062d23f2f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392051000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6be1e0f-ec42-4c73-abca-d53fd7811b78",
          "citation": "SRS import [MSX21S9RGM]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=MSX21S9RGM",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392051000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "807203ab-2fbb-7913-3ade-815688a0f425",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2781-10-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5a243c2e-5909-109a-0458-37ba22788389",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "879140d5-eba3-4703-a967-5116b8944861",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "716a0e32-0ac9-1099-a28c-5be13ffe42de",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "9c6a62e3-22be-d1e0-2ba3-e902f7893f2c",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b6fafbf8-8412-405a-a645-7d41f283956e",
          "id": "b6fafbf8-8412-405a-a645-7d41f283956e",
          "molfile": "\n  Marvin  01132109282D          \n\n 29 28  0  0  0  0            999 V2000\n   -5.0013   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8579   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.0000    0.0000 Sn  0  0  0  0  0  0  0  0  0  0  0  0\n    0.4125   -0.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4125   -2.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4125    0.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4125    2.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    2.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289   -0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1434    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8579    1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5724    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0013    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 16  1  0  0  0  0\n 11 20  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  2  0  0  0  0\n 21 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 26  1  0  0  0  0\n 24 25  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)C(=O)O[Sn](CCCC)(CCCC)OC(=O)C(CC)CCCC",
          "formula": "C24H48O4Sn",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0bd309e5-f3a9-4797-aebd-285766ff084f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "519.3465",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2f1fcc39-7877-4522-bffb-e970a6bceb7c",
      "version": "8",
      "structure": {
        "id": "c1c98a09-0af6-4248-880c-fcc2bc5ee10a",
        "molfile": "\n  Marvin  01132110012D          \n\n 29 28  0  0  0  0            999 V2000\n    0.0000    0.0000    0.0000 Sn  0  0  0  0  0  0  0  0  0  0  0  0\n    0.4125   -0.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4125   -2.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4125    0.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    1.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4125    2.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    2.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0013   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1434   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8579   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1434    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5724    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2868    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0013    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289   -0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8579    1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  1  2  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  1  6  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 10 16  2  0  0  0  0\n 10 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 11 18  1  0  0  0  0\n  1 17  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 20 26  2  0  0  0  0\n 20 27  1  0  0  0  0\n 28 29  1  0  0  0  0\n 21 28  1  0  0  0  0\n  1 27  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)C(=O)O[Sn](CCCC)(CCCC)OC(=O)C(CC)CCCC",
        "formula": "C24H48O4Sn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "519.3465",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "e6be1e0f-ec42-4c73-abca-d53fd7811b78",
          "807a5f85-33dd-496d-a1fe-34f88ce4f6ac"
        ],
        "stereo_centers": 2
      },
      "unii": "MSX21S9RGM"
    }
  ]
}