{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e94f4341-abb4-4539-baf0-e0c0d7df37e0",
          "code": "30636-90-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=30636-90-9",
          "code_system": "CAS",
          "references": [
            "58d79653-d240-451b-aa05-9fe5a1e3f1ea",
            "185ac140-59f0-17d0-b352-891559dd1a44"
          ]
        },
        {
          "uuid": "80bc1549-34b1-462e-b890-2180137afff7",
          "code": "11213350",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11213350",
          "code_system": "PUBCHEM",
          "references": [
            "58d79653-d240-451b-aa05-9fe5a1e3f1ea"
          ]
        },
        {
          "uuid": "ca1740f8-dff1-4f8e-ace3-6ccab4544b68",
          "code": "MR8AEF5T1N",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5faf7381-10b4-64b1-96c4-b2495d151df6",
          "code": "75950",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:75950",
          "code_system": "CHEBI",
          "references": [
            "6795ba49-f5a4-e6fd-108a-36d493347e4a"
          ]
        },
        {
          "uuid": "bac1ad10-9395-6ece-fa11-ac543d9ae277",
          "code": "DTXSID10952905",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10952905",
          "code_system": "EPA CompTox",
          "references": [
            "6795ba49-f5a4-e6fd-108a-36d493347e4a"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "e13828b2-a7a6-46d5-bf68-f83009ecda20",
          "amount": {
            "uuid": "9d515dd5-ac6f-4ed3-80fa-ab3eb99c5974"
          },
          "comments": "IN VITRO",
          "type": "METABOLITE->PARENT",
          "references": [
            "2303517b-15a2-4ff9-8edd-2e68ae89a295"
          ],
          "related_substance": {
            "uuid": "1a2b5e98-d4ee-446d-9ada-0f533eb35e9b",
            "refuuid": "ce69f4e8-f181-4c6d-becd-37fd3d30e78e",
            "name": "DAMMARANE-3,12,20,24,25-PENTOL, (3.BETA.,12.BETA.,24R)-",
            "unii": "FB8R9W9SXS",
            "linking_id": "FB8R9W9SXS",
            "ref_pname": "DAMMARANE-3,12,20,24,25-PENTOL, (3.BETA.,12.BETA.,24R)-"
          }
        },
        {
          "uuid": "4c6d8276-8bd0-4f49-bbc9-c7bbe7936614",
          "amount": {
            "uuid": "59bb66fa-343b-4dbc-8da1-bdc5f4a02c06"
          },
          "comments": "IN VITRO",
          "type": "METABOLITE->PARENT",
          "references": [
            "f5018f90-db6e-4bb4-9a58-5e73ddfda808"
          ],
          "related_substance": {
            "uuid": "ce07ef0b-75d2-4e77-ac50-1dcc6168809b",
            "refuuid": "ca4a2237-0038-4266-b9fd-d2f12da3d645",
            "name": "20,24-EPOXYDAMMARANE-3BETA,12BETA,25-TRIOL, (20S,24S)-",
            "unii": "C37X3X4NMW",
            "linking_id": "C37X3X4NMW",
            "ref_pname": "20,24-EPOXYDAMMARANE-3BETA,12BETA,25-TRIOL, (20S,24S)-"
          }
        },
        {
          "uuid": "cd75d24b-701c-49af-87a0-17e39a96eb20",
          "amount": {
            "uuid": "84eea70c-6abb-4230-8539-c351332573a5"
          },
          "comments": "IN VITRO",
          "type": "METABOLITE->PARENT",
          "references": [
            "1c2658d8-69bb-4b27-8d49-286573a5783b"
          ],
          "related_substance": {
            "uuid": "e1f956f8-ee9e-4c9e-957d-99b0dd52f1d1",
            "refuuid": "81e203cc-46a6-4538-a1ef-e13f37281dbe",
            "name": "3-DEHYDROPYXINOL",
            "unii": "RCA3293YRJ",
            "linking_id": "RCA3293YRJ",
            "ref_pname": "3-DEHYDROPYXINOL"
          }
        },
        {
          "uuid": "c5a1603c-0539-408a-a3b3-707c7fa55721",
          "amount": {
            "uuid": "505a576a-2c4c-4eb2-bc0a-ef61e129b7b4"
          },
          "comments": "IN VITRO",
          "type": "METABOLITE->PARENT",
          "references": [
            "5d9d7d7a-1a4a-488c-8655-037bf7e8d85e"
          ],
          "related_substance": {
            "uuid": "3023b8b3-b31a-44af-92b5-ac217804a896",
            "refuuid": "48219ae2-8867-42fe-a9de-f3a69013697a",
            "name": "DAMMARANE-3,12,20,24,25-PENTOL, (3.BETA.,12.BETA.,24S)-",
            "unii": "PD8AMQ2AZ7",
            "linking_id": "PD8AMQ2AZ7",
            "ref_pname": "DAMMARANE-3,12,20,24,25-PENTOL, (3.BETA.,12.BETA.,24S)-"
          }
        },
        {
          "uuid": "b00bdc48-961c-47f6-967e-0fa51ded8047",
          "comments": "IN VITRO",
          "type": "METABOLITE->PARENT",
          "references": [
            "da9d1f2c-bed1-4687-a607-b7982359239a"
          ],
          "related_substance": {
            "uuid": "4ab5b0c2-cbef-45f4-8c0a-afbec1f940c4",
            "refuuid": "2bb0856c-613e-4ac3-b408-514ed93d4383",
            "name": "24,25-EPOXY-20-EPIPROTOPANAXADIOL",
            "unii": "8LCP6JTZ4F",
            "linking_id": "8LCP6JTZ4F",
            "ref_pname": "24,25-EPOXY-20-EPIPROTOPANAXADIOL"
          }
        },
        {
          "uuid": "edcb08e2-c15d-45a0-8055-3d31aa054c0d",
          "comments": "IN VITRO",
          "type": "METABOLITE->PARENT",
          "references": [
            "4d9689ba-e974-49f5-9dc6-eddfd7f2da3d"
          ],
          "related_substance": {
            "uuid": "d3937cc5-2271-4464-98f3-72d7f0b3114a",
            "refuuid": "b7319abb-f9d6-4d2e-90e4-249f8d23bec3",
            "name": "PIXINOL",
            "unii": "C2PG825389",
            "linking_id": "C2PG825389",
            "ref_pname": "PIXINOL"
          }
        },
        {
          "uuid": "0d5a6054-9336-470b-ad6d-c3b8b31c1464",
          "comments": "IN VITRO",
          "type": "METABOLITE->PARENT",
          "references": [
            "b24b9edc-5d69-4013-bcdf-fa262939da8b"
          ],
          "related_substance": {
            "uuid": "3c3972cf-348d-4593-ab0a-15fe90d61af0",
            "refuuid": "4422f71f-2c0d-4244-a91b-edbac54751ba",
            "name": "20,24-EPOXYDAMMARANE-3BETA,12BETA-DIOL-25-O-GLUCORONIDE, (20S,24S)-",
            "unii": "6T3RCB5AXS",
            "linking_id": "6T3RCB5AXS",
            "ref_pname": "20,24-EPOXYDAMMARANE-3BETA,12BETA-DIOL-25-O-GLUCORONIDE, (20S,24S)-"
          }
        },
        {
          "uuid": "d33881b8-8320-481c-8e53-bc4dadc990f0",
          "comments": "IN VITRO",
          "type": "METABOLITE->PARENT",
          "references": [
            "9f6a5844-2ae2-48fb-84f6-bbef504f57af"
          ],
          "related_substance": {
            "uuid": "b8a3b5f2-9fcf-45a7-8c15-5615b9d27cd2",
            "refuuid": "3fcf5819-6f36-46ea-b8d1-b4a5048e78f0",
            "name": "20,24-EPOXY-12,25-DIHYDROXYDAMMARAN-3-ONE, (12BETA,24S)-",
            "unii": "YA3S38AH49",
            "linking_id": "YA3S38AH49",
            "ref_pname": "20,24-EPOXY-12,25-DIHYDROXYDAMMARAN-3-ONE, (12BETA,24S)-"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5ca79caf-b493-4d81-8eac-dcb80e6ae5e6",
          "name": "(20S)-PROTOPANAXADIOL",
          "stdName": "(20S)-PROTOPANAXADIOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "16829a97-d5f7-441f-9f13-ce9fc5404700"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "46e6693f-afba-4236-9adb-3bde0a9b6bf7",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "12b8b8fb-247b-4039-b80a-df3beeaaea91",
          "name": "(3.BETA.,12.BETA.)-DAMMAR-24-ENE-3,12,20-TRIOL",
          "stdName": "(3.BETA.,12.BETA.)-DAMMAR-24-ENE-3,12,20-TRIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "16829a97-d5f7-441f-9f13-ce9fc5404700"
          ],
          "display_name": false
        },
        {
          "uuid": "b3ba2e6c-3cea-44c7-a3a3-c0e107fe4c4a",
          "name": "20(S)-APPD",
          "stdName": "20(S)-APPD",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "16829a97-d5f7-441f-9f13-ce9fc5404700"
          ],
          "display_name": false
        },
        {
          "uuid": "411789d0-55e0-49d7-9ac0-f95189593ff4",
          "name": "20-EPIPROTOPANAXADIOL",
          "stdName": "20-EPIPROTOPANAXADIOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7eee2faa-51f9-49e7-a0ea-70b628f9bdb2"
          ],
          "display_name": true
        },
        {
          "uuid": "7146e823-ed19-4fd1-aebb-2e600358f01f",
          "name": "DAMMAR-24-ENE-3,12,20-TRIOL, (3.BETA.,12.BETA.)-",
          "stdName": "DAMMAR-24-ENE-3,12,20-TRIOL, (3.BETA.,12.BETA.)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "16829a97-d5f7-441f-9f13-ce9fc5404700"
          ],
          "display_name": false
        },
        {
          "uuid": "3cef2a21-be3d-4756-b1bf-09849e3b0bdf",
          "name": "DAMMAR-24-ENE-3.BETA.,12.BETA.,20-TRIOL",
          "stdName": "DAMMAR-24-ENE-3.BETA.,12.BETA.,20-TRIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "16829a97-d5f7-441f-9f13-ce9fc5404700"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7eee2faa-51f9-49e7-a0ea-70b628f9bdb2",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "16829a97-d5f7-441f-9f13-ce9fc5404700",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "58d79653-d240-451b-aa05-9fe5a1e3f1ea",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392238000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "185ac140-59f0-17d0-b352-891559dd1a44",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b24b9edc-5d69-4013-bcdf-fa262939da8b",
          "citation": "Li, Liang, et al. \"Identification of 20 (S)-protopanaxadiol metabolites in human liver microsomes and human hepatocytes.\" Drug metabolism and disposition 39.3 (2011): 472-483.",
          "url": "https://dmd.aspetjournals.org/content/dmd/39/3/472.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9f6a5844-2ae2-48fb-84f6-bbef504f57af",
          "citation": "Li, Liang, et al. \"Identification of 20 (S)-protopanaxadiol metabolites in human liver microsomes and human hepatocytes.\" Drug metabolism and disposition 39.3 (2011): 472-483.",
          "url": "https://dmd.aspetjournals.org/content/dmd/39/3/472.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5d9d7d7a-1a4a-488c-8655-037bf7e8d85e",
          "citation": "Li, Liang, et al. \"Identification of 20 (S)-protopanaxadiol metabolites in human liver microsomes and human hepatocytes.\" Drug metabolism and disposition 39.3 (2011): 472-483.",
          "url": "https://dmd.aspetjournals.org/content/dmd/39/3/472.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4d9689ba-e974-49f5-9dc6-eddfd7f2da3d",
          "citation": "Li, Liang, et al. \"Identification of 20 (S)-protopanaxadiol metabolites in human liver microsomes and human hepatocytes.\" Drug metabolism and disposition 39.3 (2011): 472-483.",
          "url": "https://dmd.aspetjournals.org/content/dmd/39/3/472.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "da9d1f2c-bed1-4687-a607-b7982359239a",
          "citation": "Li, Liang, et al. \"Identification of 20 (S)-protopanaxadiol metabolites in human liver microsomes and human hepatocytes.\" Drug metabolism and disposition 39.3 (2011): 472-483.",
          "url": "https://dmd.aspetjournals.org/content/dmd/39/3/472.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2303517b-15a2-4ff9-8edd-2e68ae89a295",
          "citation": "Li, Liang, et al. \"Identification of 20 (S)-protopanaxadiol metabolites in human liver microsomes and human hepatocytes.\" Drug metabolism and disposition 39.3 (2011): 472-483.",
          "url": "https://dmd.aspetjournals.org/content/dmd/39/3/472.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1c2658d8-69bb-4b27-8d49-286573a5783b",
          "citation": "Li, Liang, et al. \"Identification of 20 (S)-protopanaxadiol metabolites in human liver microsomes and human hepatocytes.\" Drug metabolism and disposition 39.3 (2011): 472-483.",
          "url": "https://dmd.aspetjournals.org/content/dmd/39/3/472.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f5018f90-db6e-4bb4-9a58-5e73ddfda808",
          "citation": "Li, Liang, et al. \"Identification of 20 (S)-protopanaxadiol metabolites in human liver microsomes and human hepatocytes.\" Drug metabolism and disposition 39.3 (2011): 472-483.",
          "url": "https://dmd.aspetjournals.org/content/dmd/39/3/472.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6795ba49-f5a4-e6fd-108a-36d493347e4a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "956503b8-6049-49e9-b04f-de8b419b4f16",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b95694c6-fbdc-4e59-8c97-0502641e2d4d",
          "id": "b95694c6-fbdc-4e59-8c97-0502641e2d4d",
          "molfile": "\n  Marvin  01132109352D          \n\n 33 36  0  0  1  0            999 V2000\n    7.9428   -2.2344    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.4470   -2.9219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9428   -3.5636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1636   -3.3344    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.1636   -4.1594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1636   -2.5094    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.4303   -2.0969    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.4303   -1.2719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7428   -2.5094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7428   -3.3344    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.0095   -3.7469    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.0095   -2.9219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2761   -3.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5886   -3.7469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5886   -4.5719    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    2.8553   -4.9844    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2761   -4.9844    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.7720   -5.6261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8261   -5.6261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0095   -4.5719    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.7428   -4.9844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4303   -4.5719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4303   -3.7469    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.4303   -2.9219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2178   -1.4552    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.4470   -0.6761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9970   -1.7302    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3928   -1.1802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2553   -0.4011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4303   -0.1261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2928    0.6532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8886    1.2489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5136    0.9282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  6  1  1  0  0  0  0\n  1 25  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  6  0  0  0\n  6  4  1  6  0  0  0\n  4 23  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7  9  1  0  0  0  0\n 10  9  1  1  0  0  0\n 10 11  1  0  0  0  0\n 23 10  1  0  0  0  0\n 11 12  1  1  0  0  0\n 11 13  1  0  0  0  0\n 11 20  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  1  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 20 17  1  1  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  1  1  0  0  0\n 25 26  1  0  0  0  0\n 25 27  1  6  0  0  0\n 25 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 30 31  2  0  0  0  0\n 31 32  1  0  0  0  0\n 31 33  1  0  0  0  0\nM  END",
          "smiles": "CC(=CCC[C@@](C)([C@H]1CC[C@]2(C)[C@@H]1[C@@H](C[C@@H]3[C@@]4(C)CC[C@@H](C(C)(C)[C@@H]4CC[C@]32C)O)O)O)C",
          "formula": "C30H52O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "70df83f5-09db-4fe5-9800-091e745ffd9e"
          },
          "defined_stereo": 10,
          "ez_centers": 0,
          "molecular_weight": "460.7332",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 10
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a7727086-c462-4633-b91c-b2ed69cd7623",
      "version": "16",
      "structure": {
        "id": "dd94e4b2-76d2-4828-b8bf-a32b2bf1269c",
        "molfile": "\n  Marvin  01132111292D          \n\n 37 40  0  0  1  0            999 V2000\n    4.2761   -4.1594    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0095   -4.5719    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.7428   -4.9844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4303   -4.5719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4303   -3.7469    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.4303   -2.9219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7428   -3.3344    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.7428   -4.1594    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0095   -3.7469    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.0095   -2.9219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2761   -3.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5886   -3.7469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5886   -4.5719    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.8553   -4.9844    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2761   -4.9844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7720   -5.6261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8261   -5.6261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7428   -2.5094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4303   -2.0969    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4303   -1.2719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1636   -2.5094    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.3470   -1.6844    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1636   -3.3344    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.9428   -3.5636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4470   -2.9219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9428   -2.2344    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.7220   -2.0052    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2178   -1.4552    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.9970   -1.7302    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4470   -0.6761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3928   -1.1802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2553   -0.4011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4303   -0.1261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2928    0.6532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8886    1.2489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5136    0.9282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1636   -4.1594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  6  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  6  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  1  0  0  0\n  2  9  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  1  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 15  2  1  0  0  0  0\n 18  7  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  1  0  0  0\n 21 19  1  0  0  0  0\n 21 22  1  1  0  0  0\n 23 21  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  6  0  0  0\n 26 21  1  0  0  0  0\n 26 28  1  0  0  0  0\n 28 29  1  6  0  0  0\n 28 30  1  0  0  0  0\n 28 31  1  0  0  0  0\n 31 32  1  0  0  0  0\n 32 33  1  0  0  0  0\n 33 34  2  0  0  0  0\n 34 35  1  0  0  0  0\n 34 36  1  0  0  0  0\n 23 37  1  6  0  0  0\n  5 23  1  0  0  0  0\nM  END",
        "smiles": "CC(=CCC[C@@](C)([C@@]1([H])CC[C@]2(C)[C@]1([H])[C@@H](C[C@]3([H])[C@@]4(C)CC[C@@H](C(C)(C)[C@]4([H])CC[C@]32C)O)O)O)C",
        "formula": "C30H52O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 10,
        "ez_centers": 0,
        "molecular_weight": "460.7332",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "7eee2faa-51f9-49e7-a0ea-70b628f9bdb2"
        ],
        "stereo_centers": 10
      },
      "unii": "MR8AEF5T1N"
    }
  ]
}