{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "051d477b-3aed-440c-8369-06d0f185e7e0",
          "code": "3089-55-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3089-55-2",
          "code_system": "CAS",
          "references": [
            "59e1a9c8-dc9c-499e-82ae-331671a064fd",
            "e980bbff-f867-417e-bd7e-9c22f416dfbd"
          ]
        },
        {
          "uuid": "261be6f3-96e9-4a77-a3ef-1b767a837348",
          "code": "221-431-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.019.483",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "59e1a9c8-dc9c-499e-82ae-331671a064fd"
          ]
        },
        {
          "uuid": "690a0085-09f0-4f0d-a8ee-fdfaab5dbf10",
          "code": "76534",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/76534",
          "code_system": "PUBCHEM",
          "references": [
            "59e1a9c8-dc9c-499e-82ae-331671a064fd"
          ]
        },
        {
          "uuid": "0c2ae7e9-e24b-3ea7-1627-39b73838b022",
          "code": "DTXSID20184896",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20184896",
          "code_system": "EPA CompTox",
          "references": [
            "80606fc4-21c0-080b-01e1-fda5b9996b2b"
          ]
        },
        {
          "uuid": "5c54f736-55b4-41a5-a239-e1dc34b69f91",
          "code": "MR5CLK3Y44",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4ba49893-2b04-4c6e-a60b-e021a3e16603",
          "name": "ADIMOLL BO",
          "stdName": "ADIMOLL BO",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bdee3640-f9ed-4cbb-9d48-daa91ea7a617",
            "590766c8-ebca-4d0b-a5c2-9dbe28a5097f"
          ],
          "display_name": false
        },
        {
          "uuid": "b9250b78-8521-4cc8-acda-c64f1e4ac06f",
          "name": "ADIPIC ACID, BENZYL OCTYL ESTER",
          "stdName": "ADIPIC ACID, BENZYL OCTYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bdee3640-f9ed-4cbb-9d48-daa91ea7a617",
            "590766c8-ebca-4d0b-a5c2-9dbe28a5097f"
          ],
          "display_name": false
        },
        {
          "uuid": "445ffb43-bcc5-4562-8103-eeb29f86b765",
          "name": "BENZYL OCTYL ADIPATE",
          "stdName": "BENZYL OCTYL ADIPATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67e32a55-dee5-4d77-ac9a-b9dd4adea866"
          ],
          "display_name": true
        },
        {
          "uuid": "2d8b6b58-2736-4162-b6bc-dddf89555d1b",
          "name": "HEXANEDIOIC ACID, 1-OCTYL 6-(PHENYLMETHYL) ESTER",
          "stdName": "HEXANEDIOIC ACID, 1-OCTYL 6-(PHENYLMETHYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bdee3640-f9ed-4cbb-9d48-daa91ea7a617",
            "590766c8-ebca-4d0b-a5c2-9dbe28a5097f"
          ],
          "display_name": false
        },
        {
          "uuid": "e73f8f6b-eb5c-4944-bb2b-254ee1c69aa5",
          "name": "HEXANEDIOIC ACID, OCTYL PHENYLMETHYL ESTER",
          "stdName": "HEXANEDIOIC ACID, OCTYL PHENYLMETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bdee3640-f9ed-4cbb-9d48-daa91ea7a617",
            "590766c8-ebca-4d0b-a5c2-9dbe28a5097f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "67e32a55-dee5-4d77-ac9a-b9dd4adea866",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "590766c8-ebca-4d0b-a5c2-9dbe28a5097f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bdee3640-f9ed-4cbb-9d48-daa91ea7a617",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "59e1a9c8-dc9c-499e-82ae-331671a064fd",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391016000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "485dfd9c-d3cb-47da-9d98-91c0834a97f3",
          "citation": "SRS import [MR5CLK3Y44]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=MR5CLK3Y44",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391016000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa97042c-138f-45b4-879c-c82031429178",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "80606fc4-21c0-080b-01e1-fda5b9996b2b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3089-55-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e980bbff-f867-417e-bd7e-9c22f416dfbd",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c4aada76-d5a5-4b62-8efe-e840296cafde",
          "id": "c4aada76-d5a5-4b62-8efe-e840296cafde",
          "molfile": "\n  Marvin  01132110102D          \n\n 25 25  0  0  0  0            999 V2000\n    2.6364   -8.9147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6364   -8.0827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3429   -7.6646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3429   -6.8279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0539   -6.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0539   -5.5732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7650   -5.1596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7650   -4.3231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4760   -3.9047    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4760   -3.0684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7650   -2.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1870   -2.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8981   -3.0684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6091   -2.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3201   -3.0684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0313   -2.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0313   -1.8135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7422   -3.0684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7422   -3.9047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4487   -4.3231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1597   -3.9047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8707   -4.3231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8707   -5.1596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1597   -5.5732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4487   -5.1596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 16  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 25 20  2  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCCCOC(=O)CCCCC(=O)OCc1ccccc1",
          "formula": "C21H32O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a12d9b15-c977-44b8-ad10-10f83e810501"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "348.4772",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8c04a0a6-33bf-4ae2-bc41-0573cb885c17",
      "version": "4",
      "structure": {
        "id": "33be05e0-5415-446c-8c15-964085943cc4",
        "molfile": "\n  Marvin  01132102462D          \n\n 25 25  0  0  0  0            999 V2000\n    9.0313   -2.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0313   -1.8135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7422   -3.0684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7422   -3.9047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4487   -4.3231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1597   -3.9047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8707   -4.3231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8707   -5.1596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1597   -5.5732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4487   -5.1596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3201   -3.0684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6091   -2.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8981   -3.0684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1870   -2.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4760   -3.0684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7650   -2.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4760   -3.9047    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7650   -4.3231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7650   -5.1596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0539   -5.5732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0539   -6.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3429   -6.8279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3429   -7.6646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6364   -8.0827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6364   -8.9147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10  5  1  0  0  0  0\n 11  1  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 15  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCCCOC(=O)CCCCC(=O)OCc1ccccc1",
        "formula": "C21H32O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "348.4772",
        "optical_activity": "NONE",
        "references": [
          "aa97042c-138f-45b4-879c-c82031429178",
          "485dfd9c-d3cb-47da-9d98-91c0834a97f3"
        ],
        "stereo_centers": 0
      },
      "unii": "MR5CLK3Y44"
    }
  ]
}