{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e9cb3bcb-0d58-4c50-8997-c736578fb85c",
          "code": "MR3NL399EN",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0d6c0b9e-ee20-437c-8f63-e4eeaccb4393",
          "code": "75579-39-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=75579-39-4",
          "code_system": "CAS"
        },
        {
          "uuid": "53352bf2-9769-1471-71c1-56dee247eaf6",
          "code": "94842265",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/94842265",
          "code_system": "PUBCHEM",
          "references": [
            "0b532406-3431-4219-c954-804d317ab50a"
          ]
        },
        {
          "uuid": "d2d7a21d-605f-5129-baed-bf46c5deaa9d",
          "code": "DTXSID5040839",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5040839",
          "code_system": "EPA CompTox",
          "references": [
            "08550c1a-a86e-a6ab-2c49-b9d26fadb91d"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "304f082d-095b-4155-b90b-d91a8ba3c90b",
          "amount": {
            "uuid": "d8ca679d-113a-4702-82b9-2d16b101f999"
          },
          "type": "RACEMATE->ENANTIOMER",
          "references": [
            "68141f17-3451-4389-9dd4-9accd8ea04ed"
          ],
          "related_substance": {
            "uuid": "b551c284-10eb-496d-97f1-c07ba4d602f4",
            "refuuid": "4b6324cc-4f07-4131-aba6-64b01b4e24a8",
            "name": "Perfluoro(2-propoxypropionic) acid, (±)-",
            "unii": "R8C5T5N5HN",
            "linking_id": "R8C5T5N5HN",
            "ref_pname": "Perfluoro(2-propoxypropionic) acid, (±)-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f918ff94-9f99-49e5-b552-420557c8d8b0",
          "name": "(+)-Perfluoro(2-propoxypropionic) acid",
          "stdName": "(+)-PERFLUORO(2-PROPOXYPROPIONIC) ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68141f17-3451-4389-9dd4-9accd8ea04ed"
          ],
          "display_name": false
        },
        {
          "uuid": "46f442f3-4489-4bbe-a3ea-da0b3be3617f",
          "name": "(2R)-2,3,3,3-Tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoic acid",
          "stdName": "(2R)-2,3,3,3-TETRAFLUORO-2-(1,1,2,2,3,3,3-HEPTAFLUOROPROPOXY)PROPANOIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68141f17-3451-4389-9dd4-9accd8ea04ed"
          ],
          "display_name": false
        },
        {
          "uuid": "b5f5480b-df6f-472f-a532-ba91dba71c92",
          "name": "D-(+)-Perfluoro-2-(n-propoxy)propionic acid",
          "stdName": "D-(+)-PERFLUORO-2-(N-PROPOXY)PROPIONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68141f17-3451-4389-9dd4-9accd8ea04ed"
          ],
          "display_name": false
        },
        {
          "uuid": "3644d3f6-c47e-4d10-9ebf-d105ba85fe9e",
          "name": "Perfluoro(2-propoxypropionic) acid, (+)-",
          "stdName": "PERFLUORO(2-PROPOXYPROPIONIC) ACID, (+)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68141f17-3451-4389-9dd4-9accd8ea04ed"
          ],
          "display_name": true
        },
        {
          "uuid": "e0717aef-b46f-4e84-97ee-08eb1b3fa6fe",
          "name": "Propanoic acid, 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-, (2R)-",
          "stdName": "PROPANOIC ACID, 2,3,3,3-TETRAFLUORO-2-(1,1,2,2,3,3,3-HEPTAFLUOROPROPOXY)-, (2R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68141f17-3451-4389-9dd4-9accd8ea04ed"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "68141f17-3451-4389-9dd4-9accd8ea04ed",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0b532406-3431-4219-c954-804d317ab50a",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "08550c1a-a86e-a6ab-2c49-b9d26fadb91d",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4ab8a434-a2ac-4693-82c6-e75cd8ed0e62",
          "id": "4ab8a434-a2ac-4693-82c6-e75cd8ed0e62",
          "molfile": "\n  Marvin  09292212412D          \n\n 20 19  0  0  1  0            999 V2000\n   14.0517   -3.8637    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.3372   -3.4512    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0517   -4.6887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7662   -3.4512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0517   -3.0387    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6227   -3.8637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7662   -5.1012    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3372   -5.1012    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0517   -5.5137    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4806   -3.8637    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7662   -2.6262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9083   -3.4512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2103   -4.5782    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0352   -4.5782    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1938   -3.8637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3208   -2.7368    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4958   -2.7368    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4793   -4.2762    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1938   -4.6887    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4793   -3.4512    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  1  5  1  6  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  3  8  1  0  0  0  0\n  3  9  1  0  0  0  0\n  4 10  1  0  0  0  0\n  4 11  2  0  0  0  0\n  6 12  1  0  0  0  0\n  6 13  1  0  0  0  0\n  6 14  1  0  0  0  0\n 12 15  1  0  0  0  0\n 12 16  1  0  0  0  0\n 12 17  1  0  0  0  0\n 15 18  1  0  0  0  0\n 15 19  1  0  0  0  0\n 15 20  1  0  0  0  0\nM  END",
          "smiles": "C(=O)([C@](C(F)(F)F)(F)OC(C(C(F)(F)F)(F)F)(F)F)O",
          "formula": "C6HF11O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "40267456-ff37-4b48-8b43-db6e56d13925"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "330.053",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "15900f9f-7d30-42cf-a6a5-53565f171670",
      "version": "4",
      "structure": {
        "id": "72206db1-2bac-465a-ab6f-4fa557e69841",
        "molfile": "2,3,3,3-Tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoic acid\n   JSDraw209292212412D\n\n 20 19  0  0  1  0              0 V2000\n   26.5705   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2195   -6.5260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5705   -8.8660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.9215   -6.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5705   -5.7460    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8684   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.9215   -9.6460    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2195   -9.6460    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5705  -10.4260    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   29.2725   -7.3060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.9215   -4.9660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5175   -6.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0885   -8.6570    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   24.6484   -8.6570    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1665   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2975   -5.1750    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7376   -5.1750    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8155   -8.0860    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1665   -8.8660    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8155   -6.5260    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  1  5  1  6  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  3  8  1  0  0  0  0\n  3  9  1  0  0  0  0\n  4 10  1  0  0  0  0\n  4 11  2  0  0  0  0\n  6 12  1  0  0  0  0\n  6 13  1  0  0  0  0\n  6 14  1  0  0  0  0\n 12 15  1  0  0  0  0\n 12 16  1  0  0  0  0\n 12 17  1  0  0  0  0\n 15 18  1  0  0  0  0\n 15 19  1  0  0  0  0\n 15 20  1  0  0  0  0\nM  END",
        "smiles": "C(=O)([C@](C(F)(F)F)(F)OC(C(C(F)(F)F)(F)F)(F)F)O",
        "formula": "C6HF11O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "330.053",
        "optical_activity": "( + )",
        "references": [
          "68141f17-3451-4389-9dd4-9accd8ea04ed"
        ],
        "stereo_centers": 1
      },
      "unii": "MR3NL399EN"
    }
  ]
}