{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "06b26df6-013e-4032-8dcb-9186786aaec6",
          "code": "217-250-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.015.683",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "fe1cc834-7de7-49a4-ab6d-7004afdb05aa"
          ]
        },
        {
          "uuid": "6a086adf-e51e-416b-b652-cd2e80a94888",
          "code": "1787-61-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1787-61-7",
          "code_system": "CAS",
          "references": [
            "fe1cc834-7de7-49a4-ab6d-7004afdb05aa",
            "8674c1da-0e81-42d8-a516-8f3fe6fc0500"
          ]
        },
        {
          "uuid": "c2b28127-a56c-4ad2-b785-ce2ff8df8a30",
          "code": "ERIOCHROME BLACK T",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Eriochrome_Black_T",
          "code_system": "WIKIPEDIA",
          "references": [
            "fe1cc834-7de7-49a4-ab6d-7004afdb05aa"
          ]
        },
        {
          "uuid": "36a054e8-3c91-4ad4-985b-652ceeeb2eb4",
          "code": "m4995",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4995?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "fe1cc834-7de7-49a4-ab6d-7004afdb05aa"
          ]
        },
        {
          "uuid": "c666d310-4ed0-42de-332a-206ae43fd51c",
          "code": "DTXSID4061969",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4061969",
          "code_system": "EPA CompTox",
          "references": [
            "2c5d663e-fe6b-d220-3ff6-e06ed82ebb9d"
          ]
        },
        {
          "uuid": "0c2f78fd-0f0e-4eb9-bc98-1afa82f47cb6",
          "code": "MPC0KHJ23C",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "db01c8c2-e9b4-1d45-8446-15e836b3af0b",
          "code": "7223",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=7223",
          "code_system": "NSC",
          "references": [
            "f86d816a-c84d-dfb5-df3d-92a0dcf3a2bb"
          ]
        },
        {
          "uuid": "fe526e34-d7ea-684f-11ee-3718f969b0c3",
          "code": "47712",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=47712",
          "code_system": "NSC",
          "references": [
            "f86d816a-c84d-dfb5-df3d-92a0dcf3a2bb"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a7b431ed-44ae-4805-93e8-a3439561624b",
          "name": "3-HYDROXY-4-((1-HYDROXY-2-NAPHTHALENYL)AZO)-7-NITRO-1-NAPHTHALENESULFONIC ACID MONOSODIUM SALT",
          "stdName": "3-HYDROXY-4-((1-HYDROXY-2-NAPHTHALENYL)AZO)-7-NITRO-1-NAPHTHALENESULFONIC ACID MONOSODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd860876-4bf3-4996-959a-f8376fa8c433",
            "836f83f5-21c9-472a-8813-ef53413c4a09"
          ],
          "display_name": false
        },
        {
          "uuid": "a022a21f-2b1e-4416-aa58-e3cf5cde0649",
          "name": "3-HYDROXY-4-(2-(1-HYDROXY-2-NAPHTHALENYL)DIAZENYL)-7-NITRO-1-NAPHTHALENESULFONIC ACID SODIUM SALT (1:1)",
          "stdName": "3-HYDROXY-4-(2-(1-HYDROXY-2-NAPHTHALENYL)DIAZENYL)-7-NITRO-1-NAPHTHALENESULFONIC ACID SODIUM SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd860876-4bf3-4996-959a-f8376fa8c433",
            "836f83f5-21c9-472a-8813-ef53413c4a09"
          ],
          "display_name": false
        },
        {
          "uuid": "c0083adb-8633-496e-a8b3-dd69a16dbd92",
          "name": "C.I. 14645",
          "stdName": "C.I. 14645",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd860876-4bf3-4996-959a-f8376fa8c433",
            "836f83f5-21c9-472a-8813-ef53413c4a09"
          ],
          "display_name": false
        },
        {
          "uuid": "2df72e6c-4b75-4de3-930a-a98d19993def",
          "name": "C.I. MORDANT BLACK 11",
          "stdName": "C.I. MORDANT BLACK 11",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd860876-4bf3-4996-959a-f8376fa8c433",
            "836f83f5-21c9-472a-8813-ef53413c4a09"
          ],
          "display_name": false
        },
        {
          "uuid": "d07a31ae-bb32-4579-9099-060332806f3b",
          "name": "ERIOCHROME BLACK T",
          "stdName": "ERIOCHROME BLACK T",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0fd12a8b-b79c-496a-b8a4-19349dc72279",
            "836f83f5-21c9-472a-8813-ef53413c4a09",
            "406a8ea8-b47f-4893-9bf9-1ca1efff8592",
            "f318be8e-d273-4722-ac70-c7f738ae5bc4"
          ],
          "display_name": true
        },
        {
          "uuid": "fe98d186-bc20-42a3-a92f-2a3f9b6b69be",
          "name": "ERIOCHROME BLACK T [MI]",
          "stdName": "ERIOCHROME BLACK T [MI]",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "836f83f5-21c9-472a-8813-ef53413c4a09",
            "f318be8e-d273-4722-ac70-c7f738ae5bc4"
          ],
          "display_name": false
        },
        {
          "uuid": "7789f173-0216-48bb-848b-465ff8bf13d7",
          "name": "MORDANT BLACK 11",
          "stdName": "MORDANT BLACK 11",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a297b375-6dab-468f-a9c8-b31e8890c781",
            "836f83f5-21c9-472a-8813-ef53413c4a09"
          ],
          "display_name": false
        },
        {
          "uuid": "b7ffe0e6-17f8-408f-baaf-df04c4118dda",
          "name": "NSC-47712",
          "stdName": "NSC-47712",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "836f83f5-21c9-472a-8813-ef53413c4a09",
            "b75c6ecb-e4ad-469e-984d-594243035a13"
          ],
          "display_name": false
        },
        {
          "uuid": "3f477ddc-1697-4ec1-995f-cf67dc61cb70",
          "name": "NSC-7223",
          "stdName": "NSC-7223",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "836f83f5-21c9-472a-8813-ef53413c4a09",
            "b75c6ecb-e4ad-469e-984d-594243035a13"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0fd12a8b-b79c-496a-b8a4-19349dc72279",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f318be8e-d273-4722-ac70-c7f738ae5bc4",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "836f83f5-21c9-472a-8813-ef53413c4a09",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd860876-4bf3-4996-959a-f8376fa8c433",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b75c6ecb-e4ad-469e-984d-594243035a13",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a297b375-6dab-468f-a9c8-b31e8890c781",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe1cc834-7de7-49a4-ab6d-7004afdb05aa",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390948000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3be4c086-1b43-47fe-b550-a2170c295da7",
          "citation": "SRS import [MPC0KHJ23C]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=MPC0KHJ23C",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390948000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8e458e6-5635-44fb-84ee-f67b6d0d78ee",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "406a8ea8-b47f-4893-9bf9-1ca1efff8592",
          "citation": "ERIOCHROME BLACK T [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2c5d663e-fe6b-d220-3ff6-e06ed82ebb9d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1787-61-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8674c1da-0e81-42d8-a516-8f3fe6fc0500",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f86d816a-c84d-dfb5-df3d-92a0dcf3a2bb",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "43c09942-580f-4801-81d4-c896e7a94ec8",
          "id": "43c09942-580f-4801-81d4-c896e7a94ec8",
          "molfile": "\n  Marvin  01132103342D          \n\n  1  0  0  0  0  0            999 V2000\n    2.6783   -6.3653    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ec2eb4f3-1742-4506-be12-af62ea952c30"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "abb83544-7043-4ec7-a6d4-5a0f49a8edf4",
          "id": "abb83544-7043-4ec7-a6d4-5a0f49a8edf4",
          "molfile": "\n  Marvin  01132108552D          \n\n 31 34  0  0  0  0            999 V2000\n    6.2962   -2.4506    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8949   -3.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3045   -3.9157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8873   -4.6441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0684   -4.6441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6432   -3.9324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8287   -3.9324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4068   -3.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7957   -2.4960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6308   -2.4960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0353   -3.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1279   -3.9157    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5367   -4.6205    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3754   -4.6205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7841   -3.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3919   -3.1591    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.6037   -3.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0248   -4.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6812   -5.3243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0658   -6.0194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6812   -6.7608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8008   -6.7608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3919   -6.0404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8016   -5.3243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0580   -7.4808    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    9.6159   -8.1849    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   10.8599   -7.4808    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8468   -4.6076    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8468   -5.3983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8468   -3.7401    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7151   -4.6076    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 11  2  0  0  0  0\n  3  4  2  0  0  0  0\n 12  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n 11  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11 10  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 24 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  2  0  0  0  0\n 18 28  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 24  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 21 25  1  0  0  0  0\n 23 22  2  0  0  0  0\n 24 23  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  2  0  0  0  0\n 28 29  1  0  0  0  0\n 28 30  2  0  0  0  0\n 28 31  2  0  0  0  0\nM  CHG  3  16  -1  25   1  26  -1\nM  END",
          "smiles": "c1ccc2c(c1)ccc(c2O)/N=N/c3c4ccc(cc4c(cc3[O-])S(=O)(=O)O)[N+](=O)[O-]",
          "formula": "C20H12N3O7S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1b63402d-b943-4c94-9583-724a7e238513"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "438.392",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ce46b2ee-6cd2-4d1f-a577-5eb8c1f18e5e",
      "version": "5",
      "structure": {
        "id": "306c4b07-7da3-4857-a576-36175a82d7f0",
        "molfile": "\n  Marvin  01132102362D          \n\n 32 34  0  0  0  0            999 V2000\n    9.6812   -5.3243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8016   -5.3243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3754   -4.6205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7841   -3.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3919   -3.1591    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6037   -3.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0248   -4.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8468   -4.6076    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8468   -3.7401    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7151   -4.6076    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8468   -5.3983    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.5367   -4.6205    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1279   -3.9157    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3045   -3.9157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8949   -3.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0353   -3.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6432   -3.9324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8287   -3.9324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4068   -3.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7957   -2.4960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6308   -2.4960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0684   -4.6441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8873   -4.6441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2962   -2.4506    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3919   -6.0404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8008   -6.7608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6812   -6.7608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0658   -6.0194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0580   -7.4808    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    9.6159   -8.1849    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   10.8599   -7.4808    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6783   -6.3653    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  1  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  2  0  0  0  0\n  8 11  1  0  0  0  0\n  3 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 16 21  2  0  0  0  0\n 17 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 14 23  1  0  0  0  0\n 15 24  1  0  0  0  0\n  2 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  2  0  0  0  0\n  1 28  1  0  0  0  0\n 27 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 29 31  2  0  0  0  0\nM  CHG  4  11  -1  29   1  30  -1  32   1\nM  END",
        "smiles": "c1ccc2c(c1)ccc(c2O)/N=N/c3c4ccc(cc4c(cc3O)S(=O)(=O)[O-])[N+](=O)[O-].[Na+]",
        "formula": "C20H12N3O7S.Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "461.3818",
        "optical_activity": "NONE",
        "references": [
          "3be4c086-1b43-47fe-b550-a2170c295da7",
          "d8e458e6-5635-44fb-84ee-f67b6d0d78ee"
        ],
        "stereo_centers": 0
      },
      "unii": "MPC0KHJ23C"
    }
  ]
}