{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "da33486b-d058-4818-a575-bec6c8171111",
          "code": "80-05-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=80-05-7",
          "code_system": "CAS",
          "references": [
            "4574093e-10cb-477d-b733-b35bd7acc537",
            "1a9bdfb4-59bd-467f-9b1b-cf096340d7aa"
          ]
        },
        {
          "uuid": "2e907257-ff51-4387-a00d-daea37b7afe1",
          "code": "C006780",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67006780",
          "code_system": "MESH",
          "references": [
            "4574093e-10cb-477d-b733-b35bd7acc537"
          ]
        },
        {
          "uuid": "d1b55563-3b00-4ca8-8f9f-1d6de646e38d",
          "code": "BISPHENOL A",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Bisphenol_A",
          "code_system": "WIKIPEDIA",
          "references": [
            "4574093e-10cb-477d-b733-b35bd7acc537"
          ]
        },
        {
          "uuid": "06386d23-9534-4b5a-95b2-9e13b75d5aa5",
          "code": "1433347",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1433347/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "4574093e-10cb-477d-b733-b35bd7acc537"
          ]
        },
        {
          "uuid": "3dbdb53b-2b25-4b4d-a3e4-abc71a45f12e",
          "code": "m2568",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2568?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4574093e-10cb-477d-b733-b35bd7acc537"
          ]
        },
        {
          "uuid": "b324d86e-fb8c-49ea-a1bb-4947b010ebe1",
          "code": "SUB169668",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "4574093e-10cb-477d-b733-b35bd7acc537"
          ]
        },
        {
          "uuid": "f8ef1f3f-3a3a-4f32-b51e-c05abe0e0666",
          "code": "201-245-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.133",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4574093e-10cb-477d-b733-b35bd7acc537"
          ]
        },
        {
          "uuid": "de0b9844-b0e8-4b00-82a0-6cb1806105c6",
          "code": "6623",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6623",
          "code_system": "PUBCHEM",
          "references": [
            "4574093e-10cb-477d-b733-b35bd7acc537"
          ]
        },
        {
          "uuid": "8ba71296-3dd4-2a0f-0872-debe1f476146",
          "code": "513",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/513",
          "code_system": "HSDB",
          "references": [
            "595df6ed-cccd-bfe2-8328-d75060b099ef"
          ]
        },
        {
          "uuid": "708aa393-b06b-d7b7-98e5-5c5e5ab7f654",
          "code": "DTXSID7020182",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7020182",
          "code_system": "EPA CompTox",
          "references": [
            "0d300a4c-4d2a-7f4c-277d-7ff71334fa1f"
          ]
        },
        {
          "uuid": "ca04c0b7-24cf-9300-bdb5-eb978c18e4fa",
          "code": "C45678",
          "comments": "Industrial Aid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45678",
          "code_system": "NCI_THESAURUS",
          "references": [
            "9f92271c-51eb-cba8-411a-98d0e5b11dba"
          ]
        },
        {
          "uuid": "d28b79d3-0976-9b54-7c91-9d1616ce0480",
          "code": "DB06973",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB06973",
          "code_system": "DRUG BANK",
          "references": [
            "9f92271c-51eb-cba8-411a-98d0e5b11dba"
          ]
        },
        {
          "uuid": "3b72cd4a-466e-4f7a-8eaa-66764f6312ba",
          "code": "MLT3645I99",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "391f6549-e456-4d88-dd17-554d880b752e",
          "code": "C152071",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C152071",
          "code_system": "NCI_THESAURUS",
          "references": [
            "149ee85a-c49b-20ff-181e-8885b09757d1"
          ]
        },
        {
          "uuid": "af2c8282-2a9e-360c-e182-a194e94c5130",
          "code": "33216",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:33216",
          "code_system": "CHEBI",
          "references": [
            "9f92271c-51eb-cba8-411a-98d0e5b11dba"
          ]
        },
        {
          "uuid": "72b6c8cd-63df-3155-e36b-524dc7837bd8",
          "code": "1075892",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1075892",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "9f92271c-51eb-cba8-411a-98d0e5b11dba"
          ]
        },
        {
          "uuid": "97636cc2-227f-a6a4-53bb-88ac852ec08d",
          "code": "100000159488",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "eac4963c-accc-d7d2-3959-aeda1990853f"
          ]
        },
        {
          "uuid": "37c248b2-d5ca-3546-d1fd-1bf77a0511fc",
          "code": "1767",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=1767",
          "code_system": "NSC",
          "references": [
            "cdbc2f06-5538-84e3-f95b-ac54428236f7"
          ]
        },
        {
          "uuid": "b846aa48-ef25-ce1c-1b26-efc754b2691d",
          "code": "MLT3645I99",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=MLT3645I99",
          "code_system": "DAILYMED",
          "references": [
            "a9259b58-b540-89cb-5667-c35efb4c3938"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "342796b8-5dc5-48c8-a905-61ed7e2d2963",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "d6edde6c-8a9a-4aad-9d3d-eff01e493725",
            "refuuid": "52b81f81-daf8-4ec0-80a7-9db312b0bcb9",
            "name": "DISODIUM BISPHENOL A",
            "unii": "RW57K3X12M",
            "linking_id": "RW57K3X12M",
            "ref_pname": "DISODIUM BISPHENOL A",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "89558dd9-3f69-47f2-b542-c356944bf6a0",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "05f90287-3148-4338-aa3e-6795c449e1ed",
            "refuuid": "b7bda648-2012-4e4d-b2b5-11c3fec0f8e3",
            "name": "BISPHENOL A",
            "unii": "MLT3645I99",
            "linking_id": "MLT3645I99",
            "ref_pname": "BISPHENOL A",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f9a4dd5a-4945-4b71-be8b-5f9dd9b425d7",
          "name": "2,2-BIS(4-HYDROXYPHENYL)PROPANE",
          "stdName": "2,2-BIS(4-HYDROXYPHENYL)PROPANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eaa1de76-9179-4d78-99ca-134557b56ff8",
            "a1af98a8-b043-4878-a904-f6130d88964a"
          ],
          "display_name": false
        },
        {
          "uuid": "e18cfc25-d43f-4d9f-9a0b-6baa57ed84a6",
          "name": "4,4'-(1-METHYLETHYLIDENE)BISPHENOL",
          "stdName": "4,4'-(1-METHYLETHYLIDENE)BISPHENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eaa1de76-9179-4d78-99ca-134557b56ff8",
            "a1af98a8-b043-4878-a904-f6130d88964a"
          ],
          "display_name": false
        },
        {
          "uuid": "76fb2eda-0908-44c8-a99b-947801ca81ce",
          "name": "4,4'-ISOPROPYLIDENEDIPHENOL",
          "stdName": "4,4'-ISOPROPYLIDENEDIPHENOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "eaa1de76-9179-4d78-99ca-134557b56ff8",
            "1a8aa377-8980-48e2-9d11-a270f55e76df",
            "d33c1849-8342-4833-8796-b5c9fb30f2e6",
            "a1af98a8-b043-4878-a904-f6130d88964a"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "51f503c4-5712-4a67-bf66-1ddb0126ac27",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "f52ef8cc-3e65-44f1-8ad7-68f3992a7c77",
          "name": "BISPHENOL A",
          "stdName": "BISPHENOL A",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eaa1de76-9179-4d78-99ca-134557b56ff8",
            "208d7462-c332-4b5e-a0f5-7daf505b9c18",
            "49ba18bf-dd9f-487f-9951-7203f2344beb",
            "e8603b97-2897-4989-a4cd-47e07b90815a",
            "af38928f-cb48-453c-8cd9-116b59e51cbd",
            "a1af98a8-b043-4878-a904-f6130d88964a"
          ],
          "display_name": true
        },
        {
          "uuid": "860a3705-4d51-469e-b42d-faf42d551726",
          "name": "BISPHENOL A [HSDB]",
          "stdName": "BISPHENOL A [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eaa1de76-9179-4d78-99ca-134557b56ff8",
            "49ba18bf-dd9f-487f-9951-7203f2344beb"
          ],
          "display_name": false
        },
        {
          "uuid": "efca2aba-884f-4793-bb58-5dfc376a25fd",
          "name": "BISPHENOL A [MI]",
          "stdName": "BISPHENOL A [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eaa1de76-9179-4d78-99ca-134557b56ff8",
            "208d7462-c332-4b5e-a0f5-7daf505b9c18"
          ],
          "display_name": false
        },
        {
          "uuid": "ddc6e891-7bb3-007a-9a80-2dec11d7d62e",
          "name": "BISPHENOL A [USP-RS]",
          "stdName": "BISPHENOL A [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cee659e-0490-b7dc-f90d-3f42bd71f2f3"
          ],
          "display_name": false
        },
        {
          "uuid": "284b837f-bbd9-4c6d-ae52-83ea92a00b70",
          "name": "NSC-1767",
          "stdName": "NSC-1767",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a179358d-546a-4b1c-95f7-92e570712e0f",
            "eaa1de76-9179-4d78-99ca-134557b56ff8"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a1af98a8-b043-4878-a904-f6130d88964a",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "eaa1de76-9179-4d78-99ca-134557b56ff8",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "208d7462-c332-4b5e-a0f5-7daf505b9c18",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a8aa377-8980-48e2-9d11-a270f55e76df",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "49ba18bf-dd9f-487f-9951-7203f2344beb",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a179358d-546a-4b1c-95f7-92e570712e0f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4574093e-10cb-477d-b733-b35bd7acc537",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390869000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1e69c1c-98eb-40c0-8db3-0139d8a0029f",
          "citation": "SRS import [MLT3645I99]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=MLT3645I99",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390869000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af38928f-cb48-453c-8cd9-116b59e51cbd",
          "citation": "BISPHENOL A [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d33c1849-8342-4833-8796-b5c9fb30f2e6",
          "citation": "4,4'-ISOPROPYLIDENEDIPHENOL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e8603b97-2897-4989-a4cd-47e07b90815a",
          "citation": "BISPHENOL A [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "595df6ed-cccd-bfe2-8328-d75060b099ef",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+80-05-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0d300a4c-4d2a-7f4c-277d-7ff71334fa1f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=80-05-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9f92271c-51eb-cba8-411a-98d0e5b11dba",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "8cee659e-0490-b7dc-f90d-3f42bd71f2f3",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "149ee85a-c49b-20ff-181e-8885b09757d1",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "1a9bdfb4-59bd-467f-9b1b-cf096340d7aa",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "cdbc2f06-5538-84e3-f95b-ac54428236f7",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "a9259b58-b540-89cb-5667-c35efb4c3938",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "eac4963c-accc-d7d2-3959-aeda1990853f",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "10b82eb5-9542-42dc-91c2-a86344a8bce9",
          "id": "10b82eb5-9542-42dc-91c2-a86344a8bce9",
          "molfile": "\n  Marvin  01132101062D          \n\n 17 18  0  0  0  0            999 V2000\n    4.8261   -4.6896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2993   -4.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9313   -4.5442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5848   -3.6013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8704   -4.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1559   -3.6013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1559   -2.7763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4414   -2.3638    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8704   -2.3638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5848   -2.7763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8827   -3.4306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6692   -2.6336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2524   -2.0502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0494   -2.2638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6328   -1.6804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2629   -3.0607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6795   -3.6440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  2 11  1  0  0  0  0\n  4  5  1  0  0  0  0\n 10  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 17 11  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(c1ccc(cc1)O)c2ccc(cc2)O",
          "formula": "C15H16O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f8a47fb4-fbb9-4cf5-94e5-dd03324e273f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "228.2869",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b7bda648-2012-4e4d-b2b5-11c3fec0f8e3",
      "version": "18",
      "structure": {
        "id": "cb1d34a9-4bad-49af-adeb-53dbb3fe9a0a",
        "molfile": "\n  Marvin  01132110292D          \n\n 17 18  0  0  0  0            999 V2000\n    2.4414   -2.3638    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1559   -2.7763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1559   -3.6013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8704   -4.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5848   -3.6013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2993   -4.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8261   -4.6896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9313   -4.5442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8827   -3.4306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6692   -2.6336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2524   -2.0502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0494   -2.2638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2629   -3.0607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6795   -3.6440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6328   -1.6804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5848   -2.7763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8704   -2.3638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14  9  2  0  0  0  0\n 12 15  1  0  0  0  0\n 16  5  2  0  0  0  0\n 17 16  1  0  0  0  0\n  2 17  2  0  0  0  0\nM  END",
        "smiles": "CC(C)(c1ccc(cc1)O)c2ccc(cc2)O",
        "formula": "C15H16O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "228.2869",
        "optical_activity": "NONE",
        "references": [
          "b1e69c1c-98eb-40c0-8db3-0139d8a0029f",
          "a1af98a8-b043-4878-a904-f6130d88964a"
        ],
        "stereo_centers": 0
      },
      "unii": "MLT3645I99"
    }
  ]
}