{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1e56e6e1-e66c-4781-a775-45388b7193d5",
          "code": "352010-68-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=352010-68-5",
          "code_system": "CAS",
          "references": [
            "7872ab83-3e85-4945-96df-cdb25c2c7881",
            "5552d8d1-7508-4399-836f-00e87499acd8"
          ]
        },
        {
          "uuid": "6ea233f2-a6d8-4eaf-98e8-7596f197093e",
          "code": "18986",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1549",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "7872ab83-3e85-4945-96df-cdb25c2c7881"
          ]
        },
        {
          "uuid": "7b9d91cb-2a8c-ab6d-1e69-c550c50a389c",
          "code": "DTXSID5058064",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5058064",
          "code_system": "EPA CompTox",
          "references": [
            "d3d250eb-8091-c574-c322-c3ae36b9974f"
          ]
        },
        {
          "uuid": "454c734e-a6d7-432b-8393-5ced6d79dce1",
          "code": "ML25YR3ZCH",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5c2ad3e5-dfaf-d57e-e7cb-10343a90efc1",
          "code": "bicyclopyrone",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/bicyclopyrone.html",
          "code_system": "ALANWOOD",
          "references": [
            "a8a1ca2b-15fd-d5b2-33f7-04161a75c5e2"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0147c235-07ab-469d-8f86-bbc736b6835c",
          "name": "BICYCLO(3.2.1)OCT-3-EN-2-ONE, 4-HYDROXY-3-((2-((2-METHOXYETHOXY)METHYL)-6-(TRIFLUOROMETHYL)-3-PYRIDINYL)CARBONYL)-",
          "stdName": "BICYCLO(3.2.1)OCT-3-EN-2-ONE, 4-HYDROXY-3-((2-((2-METHOXYETHOXY)METHYL)-6-(TRIFLUOROMETHYL)-3-PYRIDINYL)CARBONYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18bacf56-fa95-4497-bcee-e1dbbb619d9d",
            "b8dd2630-20f6-4176-a7f0-a3d9032da01b"
          ],
          "display_name": false
        },
        {
          "uuid": "a885e173-8e78-46d5-a8a8-86f42eeb512b",
          "name": "BICYCLOPYRONE",
          "stdName": "BICYCLOPYRONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18bacf56-fa95-4497-bcee-e1dbbb619d9d",
            "b8dd2630-20f6-4176-a7f0-a3d9032da01b"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "18bacf56-fa95-4497-bcee-e1dbbb619d9d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b8dd2630-20f6-4176-a7f0-a3d9032da01b",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7872ab83-3e85-4945-96df-cdb25c2c7881",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392699000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0421ed57-2a61-4e89-9415-c9f303f18a78",
          "citation": "SRS import [ML25YR3ZCH]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ML25YR3ZCH",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392699000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d3d250eb-8091-c574-c322-c3ae36b9974f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=352010-68-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a8a1ca2b-15fd-d5b2-33f7-04161a75c5e2",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "5552d8d1-7508-4399-836f-00e87499acd8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "be894b5e-681a-4483-b263-8e7adffdfa92",
          "id": "be894b5e-681a-4483-b263-8e7adffdfa92",
          "molfile": "\n  Marvin  01132109512D          \n\n 28 30  0  0  0  0            999 V2000\n    5.3010   -6.2573    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.4085   -5.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1151   -5.0134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8886   -5.3003    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.3711   -6.2371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1466   -6.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9645   -6.1915    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6948   -6.7742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1207   -7.4808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7217   -8.2029    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9455   -7.4653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3444   -6.7431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1693   -6.7276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5952   -7.4342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1963   -8.1563    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3714   -8.1718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9724   -8.8939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3983   -9.6005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2231   -9.5849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6490  -10.2915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4739  -10.2759    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8997  -10.9825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4200   -7.4186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8190   -6.6965    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2449   -7.4031    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8459   -8.1252    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8734   -6.8514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5865   -7.6249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  5  1  1  0  0  0\n  1 27  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  2  0  0  0  0\n  9  8  1  0  0  0  0\n  8 27  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 16  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  2  0  0  0  0\n 14 23  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 25  1  0  0  0  0\n 23 26  1  0  0  0  0\n 27 28  2  0  0  0  0\nM  END",
          "smiles": "COCCOCc1c(ccc(C(F)(F)F)n1)C(=O)C2=C([C@H]3CC[C@H](C3)C2=O)O",
          "formula": "C19H20F3NO5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ea81c00f-1d78-484d-8000-b4c789bbcc8c"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "399.3617",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d5de9051-c344-45f1-9b2d-f7000491b8ed",
      "version": "5",
      "structure": {
        "id": "62e5e606-628f-49a4-a371-79cc8e73083c",
        "molfile": "\n  Marvin  01132105082D          \n\n 28 30  0  0  0  0            999 V2000\n    7.1207   -7.4808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6948   -6.7742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1466   -6.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9645   -6.1915    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8886   -5.3003    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.3711   -6.2371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3010   -6.2573    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.4085   -5.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1151   -5.0134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8734   -6.8514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5865   -7.6249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9455   -7.4653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3444   -6.7431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1693   -6.7276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5952   -7.4342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4200   -7.4186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8190   -6.6965    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2449   -7.4031    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8459   -8.1252    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1963   -8.1563    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3714   -8.1718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9724   -8.8939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3983   -9.6005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2231   -9.5849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6490  -10.2915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4739  -10.2759    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8997  -10.9825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7217   -8.2029    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  5  9  1  0  0  0  0\n 10  7  1  0  0  0  0\n 10 11  1  0  0  0  0\n  2 10  2  0  0  0  0\n  1 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 16 19  1  0  0  0  0\n 20 15  2  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 12 21  2  0  0  0  0\n  1 28  2  0  0  0  0\n  5  6  1  1  0  0  0\n  7  6  1  1  0  0  0\nM  END",
        "smiles": "COCCOCc1c(ccc(C(F)(F)F)n1)C(=O)C2=C([C@@H]3CC[C@@H](C3)C2=O)O",
        "formula": "C19H20F3NO5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "399.3617",
        "optical_activity": "( + / - )",
        "references": [
          "0421ed57-2a61-4e89-9415-c9f303f18a78",
          "18bacf56-fa95-4497-bcee-e1dbbb619d9d"
        ],
        "stereo_centers": 2
      },
      "unii": "ML25YR3ZCH"
    }
  ]
}