{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "947c4ebb-9b06-476d-a5b1-06e1caaa69df",
          "code": "18378-20-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=18378-20-6",
          "code_system": "CAS",
          "references": [
            "37f9777b-7fc4-4030-b001-9aa4806abc80",
            "463090bb-4d23-49ce-b79c-d8b1d1e27bbe"
          ]
        },
        {
          "uuid": "176b340d-d215-4826-af6e-e95685459458",
          "code": "242-261-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.038.404",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "37f9777b-7fc4-4030-b001-9aa4806abc80"
          ]
        },
        {
          "uuid": "5c7814c6-d616-44f4-ae95-1c6aa3d1660c",
          "code": "87615",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/87615",
          "code_system": "PUBCHEM",
          "references": [
            "37f9777b-7fc4-4030-b001-9aa4806abc80"
          ]
        },
        {
          "uuid": "b345683e-794b-093d-69aa-66298ebdc35e",
          "code": "DTXSID90171475",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90171475",
          "code_system": "EPA CompTox",
          "references": [
            "32e8cbb1-4ec0-f4ce-f784-4c507c1ad836"
          ]
        },
        {
          "uuid": "0262c191-32e1-4dc9-8b8c-2ac92bcd02c1",
          "code": "MKU6C7CU72",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6c15a6c8-25f7-717c-97e2-547f05ef9b13",
          "code": "240867",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=240867",
          "code_system": "NSC",
          "references": [
            "2743f957-a5f2-aeb4-a36d-921254342577"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "79c07733-c8a1-476b-8927-08f2d9e6e832",
          "name": "2,1,3-Benzoxadiazol-4-amine, 7-nitro-N-(phenylmethyl)-",
          "stdName": "2,1,3-BENZOXADIAZOL-4-AMINE, 7-NITRO-N-(PHENYLMETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "463090bb-4d23-49ce-b79c-d8b1d1e27bbe"
          ],
          "display_name": false
        },
        {
          "uuid": "9e85dcb2-15c4-4d9f-81b1-61e0a1d7fc80",
          "name": "7-Nitro-N-(benzyl)benzofurazan-4-amine",
          "stdName": "7-NITRO-N-(BENZYL)BENZOFURAZAN-4-AMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e59ccaa-3b05-4aa6-8ddb-d9af5de5ef0f",
            "956e3856-8e35-4537-b251-d6531f6f7aa6"
          ],
          "display_name": true
        },
        {
          "uuid": "a4c13e44-91f3-48da-a569-6778e49da5a8",
          "name": "7-Nitro-N-(phenylmethyl)-2,1,3-benzoxadiazol-4-amine",
          "stdName": "7-NITRO-N-(PHENYLMETHYL)-2,1,3-BENZOXADIAZOL-4-AMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "463090bb-4d23-49ce-b79c-d8b1d1e27bbe"
          ],
          "display_name": false
        },
        {
          "uuid": "170c7c25-00b7-4fdd-b0af-9a48d451a09c",
          "name": "N-benzyl-4-nitro-2,1,3-benzoxadiazol-7-amine",
          "stdName": "N-BENZYL-4-NITRO-2,1,3-BENZOXADIAZOL-7-AMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6195386b-a7e8-4826-8a2b-76e563c44202"
          ],
          "display_name": false
        },
        {
          "uuid": "38cc2f0e-f2ec-fd54-6462-e892dcad4fd9",
          "name": "NSC-240867",
          "stdName": "NSC-240867",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2743f957-a5f2-aeb4-a36d-921254342577"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4e59ccaa-3b05-4aa6-8ddb-d9af5de5ef0f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "956e3856-8e35-4537-b251-d6531f6f7aa6",
          "citation": "EPA",
          "doc_type": "EPA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37f9777b-7fc4-4030-b001-9aa4806abc80",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393799000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "32e8cbb1-4ec0-f4ce-f784-4c507c1ad836",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=18378-20-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "463090bb-4d23-49ce-b79c-d8b1d1e27bbe",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2743f957-a5f2-aeb4-a36d-921254342577",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6195386b-a7e8-4826-8a2b-76e563c44202",
          "citation": "PUBCHEM",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/87615",
          "doc_type": "PUBCHEM",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d8686ec4-e4d4-4d28-aa30-50c81f68f26a",
          "id": "d8686ec4-e4d4-4d28-aa30-50c81f68f26a",
          "molfile": "\n  Marvin  01132111132D          \n\n 20 22  0  0  0  0            999 V2000\n    2.5796   -4.2797    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.2980   -3.8784    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    3.3035   -3.0555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0181   -4.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0162   -5.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7363   -5.5550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4583   -5.1559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1747   -5.5795    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8967   -5.1804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6168   -5.6062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6150   -6.4311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3315   -6.8549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0535   -6.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0554   -5.6307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3388   -5.2070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4602   -4.3309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0808   -3.7745    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8185   -2.9146    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9286   -3.0932    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7401   -3.9050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  4 20  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  7 16  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 15 10  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 16 20  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\nM  CHG  2   1  -1   2   1\nM  END",
          "smiles": "c1ccc(cc1)CNc2ccc(c3c2non3)[N+](=O)[O-]",
          "formula": "C13H10N4O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2dfe945f-68ea-445e-8a1d-e9df97a1856d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "270.244",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5ee65493-415e-4201-b1b0-bfb7a0dd4c5c",
      "version": "8",
      "structure": {
        "id": "7dbb5382-4e24-43ee-bf88-f25dfdfb6ece",
        "molfile": "\n  Marvin  01132106322D          \n\n 20 22  0  0  0  0            999 V2000\n    4.7401   -3.9050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0181   -4.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4602   -4.3309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2980   -3.8784    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    4.9286   -3.0932    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0162   -5.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0808   -3.7745    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4583   -5.1559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8185   -2.9146    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7363   -5.5550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1747   -5.5795    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5796   -4.2797    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.3035   -3.0555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8967   -5.1804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6168   -5.6062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3388   -5.2070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6150   -6.4311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3315   -6.8549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0554   -5.6307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0535   -6.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  1  2  0  0  0  0\n  6  2  2  0  0  0  0\n  7  3  2  0  0  0  0\n  8  3  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10  8  2  0  0  0  0\n 11  8  1  0  0  0  0\n 12  4  1  0  0  0  0\n 13  4  2  0  0  0  0\n 14 11  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 15  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 16  1  0  0  0  0\n 20 18  1  0  0  0  0\n  9  7  1  0  0  0  0\n  6 10  1  0  0  0  0\n 19 20  2  0  0  0  0\nM  CHG  2   4   1  12  -1\nM  END",
        "smiles": "c1ccc(cc1)CNc2ccc(c3c2non3)[N+](=O)[O-]",
        "formula": "C13H10N4O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "270.244",
        "optical_activity": "NONE",
        "references": [
          "4e59ccaa-3b05-4aa6-8ddb-d9af5de5ef0f"
        ],
        "stereo_centers": 0
      },
      "unii": "MKU6C7CU72"
    }
  ]
}