{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "69a0ce6d-7bd6-41f6-823f-4ada706f607f",
          "code": "119-90-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=119-90-4",
          "code_system": "CAS",
          "references": [
            "79f4bfae-8e18-41dc-89f5-eab29650f897",
            "460db629-8d4a-42de-b885-1eb60a8b4e5f"
          ]
        },
        {
          "uuid": "94959c3d-28c1-474d-86af-e6d6344f15e9",
          "code": "C44365",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C44365",
          "code_system": "NCI_THESAURUS",
          "references": [
            "79f4bfae-8e18-41dc-89f5-eab29650f897"
          ]
        },
        {
          "uuid": "e27d84ae-5531-4caf-8f7e-b7774e47d04a",
          "code": "D003962",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68003962",
          "code_system": "MESH",
          "references": [
            "79f4bfae-8e18-41dc-89f5-eab29650f897"
          ]
        },
        {
          "uuid": "18406579-8769-4502-bbae-3c1af414ef57",
          "code": "204-355-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.003.960",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "79f4bfae-8e18-41dc-89f5-eab29650f897"
          ]
        },
        {
          "uuid": "c98ac166-6397-402c-83f5-79ea25ef0ede",
          "code": "m4262",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4262?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "79f4bfae-8e18-41dc-89f5-eab29650f897"
          ]
        },
        {
          "uuid": "a90ba731-304e-41d5-b04f-f37f48463160",
          "code": "8411",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8411",
          "code_system": "PUBCHEM",
          "references": [
            "79f4bfae-8e18-41dc-89f5-eab29650f897"
          ]
        },
        {
          "uuid": "94950568-dd57-aebe-eb0d-573766072871",
          "code": "DTXSID3025091",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3025091",
          "code_system": "EPA CompTox",
          "references": [
            "d8b212a2-ffa3-67a9-f736-c254c99e10e4"
          ]
        },
        {
          "uuid": "21e60bf7-413e-5183-cd3e-87ebda197859",
          "code": "1627",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1627",
          "code_system": "HSDB",
          "references": [
            "e2b8a105-92ba-489b-b340-2ca2ad70e63a"
          ]
        },
        {
          "uuid": "7748bb1a-9b90-689c-dc07-7400ccc7ce2e",
          "code": "C45178",
          "comments": "Chemical Modifier[C1932]|Carcinogen[C347]|Chemical Carcinogen[C1743]|Organic Carcinogen[C45175]|Organo-nitrogen Carcinogen[C45176]|Carcinogenic Aromatic Amine",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45178",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f2c12484-0264-4be1-42f5-6975f4359bf8"
          ]
        },
        {
          "uuid": "f38ab754-9d5d-3291-b6dd-219e12a206a0",
          "code": "C461",
          "comments": "Industrial Aid[C45678]|Dye",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C461",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f2c12484-0264-4be1-42f5-6975f4359bf8"
          ]
        },
        {
          "uuid": "e98a16e3-8968-4bf6-b149-48d3ba9156a7",
          "code": "MJY508JZXV",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f3f697b5-2315-5a5f-bd8e-fc433a3a679b",
          "code": "o-Dianisidine",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/O-Dianisidine",
          "code_system": "WIKIPEDIA",
          "references": [
            "4a449408-dc3d-2964-1645-ece80f5251bb"
          ]
        },
        {
          "uuid": "421277be-1245-d9c2-d2c9-68741628b79b",
          "code": "3168",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=3168",
          "code_system": "NSC",
          "references": [
            "b6e82024-4793-a2c3-5be6-152c4c4abcfe"
          ]
        },
        {
          "uuid": "938e9e76-5ab6-6008-7919-dfadea740477",
          "code": "300000053242",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2c681fef-3524-cc9d-bb7b-def095baa940"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ff629c2c-8a24-4e31-9143-e2163005222a",
          "name": "3,3'-DIMETHOXY-(1,1'-BIPHENYL)-4,4'-DIAMINE",
          "stdName": "3,3'-DIMETHOXY-(1,1'-BIPHENYL)-4,4'-DIAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "abf7d240-e7d2-411a-9d56-3763ca2292a7",
            "56b23e82-f049-41b4-96f0-d7f8a5b431fa"
          ],
          "display_name": false
        },
        {
          "uuid": "15534f07-a6df-4b6d-a573-873ff0c5d619",
          "name": "3,3'-DIMETHOXY-4,4'-DIAMINOBIPHENYL",
          "stdName": "3,3'-DIMETHOXY-4,4'-DIAMINOBIPHENYL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "abf7d240-e7d2-411a-9d56-3763ca2292a7",
            "56b23e82-f049-41b4-96f0-d7f8a5b431fa"
          ],
          "display_name": false
        },
        {
          "uuid": "3c91e620-cb61-4e59-8558-754a74a8ff98",
          "name": "3,3'-DIMETHOXYBENZIDINE",
          "stdName": "3,3'-DIMETHOXYBENZIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "abf7d240-e7d2-411a-9d56-3763ca2292a7",
            "56b23e82-f049-41b4-96f0-d7f8a5b431fa",
            "c0f102e2-487b-4e02-bd46-29234b57633a",
            "9453eb0f-c76e-4d49-bd5b-f8e527de2570"
          ],
          "display_name": false
        },
        {
          "uuid": "c7683862-1df5-436d-9050-6d50da070757",
          "name": "3,3'-DIMETHOXYBENZIDINE [HSDB]",
          "stdName": "3,3'-DIMETHOXYBENZIDINE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "56b23e82-f049-41b4-96f0-d7f8a5b431fa",
            "9453eb0f-c76e-4d49-bd5b-f8e527de2570"
          ],
          "display_name": false
        },
        {
          "uuid": "e040a149-49fc-787f-66dc-ec857ef540c2",
          "name": "3,3'-DIMETHOXYBENZIDINE [IARC]",
          "stdName": "3,3'-DIMETHOXYBENZIDINE [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa6c4b0d-a3a4-7f60-b8c2-e7f97d4a279c"
          ],
          "display_name": false
        },
        {
          "uuid": "ccdb0a0d-3923-474e-966c-bfcf3827779a",
          "name": "DIANISIDINE",
          "stdName": "DIANISIDINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0e43a1fd-ba5b-4fb7-857b-5690a3edb640",
            "abf7d240-e7d2-411a-9d56-3763ca2292a7",
            "56b23e82-f049-41b4-96f0-d7f8a5b431fa",
            "fad496ac-9df2-4ebf-9685-dacfe1847295"
          ],
          "display_name": true
        },
        {
          "uuid": "a60f2c09-6476-42f2-8c61-567bd05ad09d",
          "name": "DIANISIDINE [MI]",
          "stdName": "DIANISIDINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "56b23e82-f049-41b4-96f0-d7f8a5b431fa",
            "fad496ac-9df2-4ebf-9685-dacfe1847295"
          ],
          "display_name": false
        },
        {
          "uuid": "a93a1e25-748d-41b8-bc8a-60fc2abaa8a8",
          "name": "DIMETHOXYBENZIDINE, 3,3'-",
          "stdName": "DIMETHOXYBENZIDINE, 3,3'-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8db37d96-6cdc-49cf-9570-b73d685121ac"
          ],
          "display_name": false
        },
        {
          "uuid": "d033cd06-9351-425f-a770-ff49dcc4c4bf",
          "name": "NSC-3168",
          "stdName": "NSC-3168",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "56b23e82-f049-41b4-96f0-d7f8a5b431fa",
            "85cc3810-53d3-4ae2-b2e8-31af243c2b7c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8db37d96-6cdc-49cf-9570-b73d685121ac",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fad496ac-9df2-4ebf-9685-dacfe1847295",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "56b23e82-f049-41b4-96f0-d7f8a5b431fa",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "abf7d240-e7d2-411a-9d56-3763ca2292a7",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85cc3810-53d3-4ae2-b2e8-31af243c2b7c",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9453eb0f-c76e-4d49-bd5b-f8e527de2570",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "79f4bfae-8e18-41dc-89f5-eab29650f897",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390895000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3f4bba3f-89ce-4b84-bde2-e752bad437cb",
          "citation": "SRS import [MJY508JZXV]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=MJY508JZXV",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390895000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "133df6ab-cfc1-4a20-bf73-ec2a697f079c",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e43a1fd-ba5b-4fb7-857b-5690a3edb640",
          "citation": "DIANISIDINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c0f102e2-487b-4e02-bd46-29234b57633a",
          "citation": "3,3'-DIMETHOXYBENZIDINE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e2b8a105-92ba-489b-b340-2ca2ad70e63a",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+119-90-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d8b212a2-ffa3-67a9-f736-c254c99e10e4",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=119-90-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "aa6c4b0d-a3a4-7f60-b8c2-e7f97d4a279c",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "f2c12484-0264-4be1-42f5-6975f4359bf8",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "4a449408-dc3d-2964-1645-ece80f5251bb",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "b6e82024-4793-a2c3-5be6-152c4c4abcfe",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "460db629-8d4a-42de-b885-1eb60a8b4e5f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2c681fef-3524-cc9d-bb7b-def095baa940",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "00c877bb-51e0-4f49-a808-cb82d72648ca",
          "id": "00c877bb-51e0-4f49-a808-cb82d72648ca",
          "molfile": "\n  Marvin  01132100212D          \n\n 18 19  0  0  0  0            999 V2000\n    5.0269   -6.5935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6144   -5.8791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0269   -5.1646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8519   -5.1646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2643   -4.4501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8519   -3.7357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0269   -3.7357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6144   -4.4501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7894   -4.4501    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0894   -4.4501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5019   -3.7357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3269   -3.7357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7394   -4.4501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5643   -4.4501    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3269   -5.1646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7394   -5.8791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3269   -6.5935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5019   -5.1646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  8  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n 10  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 18 10  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 18  1  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "COc1cc(ccc1N)-c2ccc(c(c2)OC)N",
          "formula": "C14H16N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d1322747-f832-46c5-9e56-6e676ec35fcd"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "244.2896",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "08e0d476-54c1-4957-bde1-c4845747453e",
      "version": "11",
      "structure": {
        "id": "10e5df91-a820-4563-afb5-4f105887ebf6",
        "molfile": "\n  Marvin  01132101062D          \n\n 18 19  0  0  0  0            999 V2000\n    7.5019   -3.7357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3269   -3.7357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7394   -4.4501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3269   -5.1646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5019   -5.1646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0894   -4.4501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2643   -4.4501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8519   -5.1646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0269   -5.1646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6144   -4.4501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0269   -3.7357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8519   -3.7357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7894   -4.4501    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6144   -5.8791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0269   -6.5935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7394   -5.8791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3269   -6.5935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5643   -4.4501    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  1  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12  7  1  0  0  0  0\n 10 13  1  0  0  0  0\n  9 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n  4 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n  3 18  1  0  0  0  0\nM  END",
        "smiles": "COc1cc(ccc1N)-c2ccc(c(c2)OC)N",
        "formula": "C14H16N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "244.2896",
        "optical_activity": "NONE",
        "references": [
          "133df6ab-cfc1-4a20-bf73-ec2a697f079c",
          "3f4bba3f-89ce-4b84-bde2-e752bad437cb"
        ],
        "stereo_centers": 0
      },
      "unii": "MJY508JZXV"
    }
  ]
}