{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3e3f48d5-e14e-4091-ac65-be2573a99bf8",
          "code": "28267-33-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=28267-33-6",
          "code_system": "CAS",
          "references": [
            "d7f53125-0e03-4800-bb9c-ab8ea088a5c2",
            "02845020-4881-4bfa-be33-b633c510577e"
          ]
        },
        {
          "uuid": "a66c7fcb-e1fe-4a9b-9667-2fb5c35ba714",
          "code": "14839733",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/14839733",
          "code_system": "PUBCHEM",
          "references": [
            "d7f53125-0e03-4800-bb9c-ab8ea088a5c2"
          ]
        },
        {
          "uuid": "927e5cf3-401a-ff32-6976-cb825fa79408",
          "code": "DTXSID40182516",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40182516",
          "code_system": "EPA CompTox",
          "references": [
            "b02a6797-be28-cfd0-e2ad-e063e5a661b7"
          ]
        },
        {
          "uuid": "bbfabf13-e07f-479e-a93d-1b41ff2db2e9",
          "code": "MI7SX74X8G",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "57b9765f-3b51-4c19-8f50-9063ecc9e349",
          "name": "1,3-PROPANEDIOL, DINONANOATE",
          "stdName": "1,3-PROPANEDIOL, DINONANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6cf1885c-a60e-4550-9c90-089dd58bad96",
            "5e377582-05bb-4479-94d7-576f1ef7fc64"
          ],
          "display_name": false
        },
        {
          "uuid": "953c33a2-9c3f-4d85-a5f5-a506a3441c80",
          "name": "NONANOIC ACID, 1,1'-(1,3-PROPANEDIYL) ESTER",
          "stdName": "NONANOIC ACID, 1,1'-(1,3-PROPANEDIYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6cf1885c-a60e-4550-9c90-089dd58bad96",
            "5e377582-05bb-4479-94d7-576f1ef7fc64"
          ],
          "display_name": false
        },
        {
          "uuid": "31ed0c33-8bfb-45c6-8d7b-6b405dab070c",
          "name": "NONANOIC ACID, 1,3-PROPANEDIYL ESTER",
          "stdName": "NONANOIC ACID, 1,3-PROPANEDIYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6cf1885c-a60e-4550-9c90-089dd58bad96",
            "5e377582-05bb-4479-94d7-576f1ef7fc64"
          ],
          "display_name": false
        },
        {
          "uuid": "2d484c6a-4936-4836-b350-79d7f76b990e",
          "name": "NONANOIC ACID, TRIMETHYLENE ESTER",
          "stdName": "NONANOIC ACID, TRIMETHYLENE ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6cf1885c-a60e-4550-9c90-089dd58bad96",
            "5e377582-05bb-4479-94d7-576f1ef7fc64"
          ],
          "display_name": false
        },
        {
          "uuid": "e4eed006-6383-430b-803f-eb18ba23bb36",
          "name": "PELEMOL P-99",
          "stdName": "PELEMOL P-99",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c5475e15-9f6e-4d0a-994c-92d113ba37e1",
            "5e377582-05bb-4479-94d7-576f1ef7fc64"
          ],
          "display_name": false
        },
        {
          "uuid": "4d95e197-f4d1-41fd-9831-3f8f98b7ee14",
          "name": "PROPANEDIOL DIPELARGONATE",
          "stdName": "PROPANEDIOL DIPELARGONATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c5475e15-9f6e-4d0a-994c-92d113ba37e1",
            "62d30472-429a-4ef7-ad1d-e7ab2ec3d7e4",
            "5e377582-05bb-4479-94d7-576f1ef7fc64"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "bba55435-5f38-4e2d-bdd4-c005de5716a8",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "fcce87c1-5f3b-4717-a12a-508d478021d5",
          "name": "TRIMETHYLENE DIPELARGONATE",
          "stdName": "TRIMETHYLENE DIPELARGONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6cf1885c-a60e-4550-9c90-089dd58bad96",
            "5e377582-05bb-4479-94d7-576f1ef7fc64"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c5475e15-9f6e-4d0a-994c-92d113ba37e1",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5e377582-05bb-4479-94d7-576f1ef7fc64",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6cf1885c-a60e-4550-9c90-089dd58bad96",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d7f53125-0e03-4800-bb9c-ab8ea088a5c2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391546000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a316462a-953c-49e8-98a2-ca686c331389",
          "citation": "SRS import [MI7SX74X8G]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=MI7SX74X8G",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391546000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "62d30472-429a-4ef7-ad1d-e7ab2ec3d7e4",
          "citation": "PROPANEDIOL DIPELARGONATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b02a6797-be28-cfd0-e2ad-e063e5a661b7",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=28267-33-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "02845020-4881-4bfa-be33-b633c510577e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3b9c987a-49da-4fdb-9610-4c2cb32eb350",
          "id": "3b9c987a-49da-4fdb-9610-4c2cb32eb350",
          "molfile": "\n  Marvin  01132103102D          \n\n 25 24  0  0  0  0            999 V2000\n    1.4397   -4.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1213   -4.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8360   -4.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5506   -4.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2652   -4.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9798   -4.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6944   -4.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4090   -4.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1237   -4.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1237   -3.3258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8383   -4.5626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5529   -4.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2400   -4.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9546   -4.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6693   -4.5626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3839   -4.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3839   -3.3258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0985   -4.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8132   -4.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5277   -4.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2423   -4.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9570   -4.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6716   -4.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3862   -4.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1009   -4.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCCCC(=O)OCCCOC(=O)CCCCCCCC",
          "formula": "C21H40O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "da1e7f70-fc54-4d4e-a954-c997d9cabd39"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "356.5407",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b717d468-1932-4711-ac62-ba9659f1b545",
      "version": "5",
      "structure": {
        "id": "f367a864-aacf-4071-8994-21fa28813c35",
        "molfile": "\n  Marvin  01132112372D          \n\n 25 24  0  0  0  0            999 V2000\n    7.1237   -3.3258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4397   -4.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1213   -4.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8360   -4.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5506   -4.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2652   -4.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9798   -4.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6944   -4.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4090   -4.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1237   -4.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8383   -4.5626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3839   -3.3258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3862   -4.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6716   -4.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9570   -4.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2423   -4.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5277   -4.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8132   -4.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0985   -4.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3839   -4.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6693   -4.5626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9546   -4.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2400   -4.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5529   -4.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1009   -4.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 10  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 24 11  1  0  0  0  0\n 20 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 13 25  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCCCC(=O)OCCCOC(=O)CCCCCCCC",
        "formula": "C21H40O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "356.5407",
        "optical_activity": "NONE",
        "references": [
          "a316462a-953c-49e8-98a2-ca686c331389",
          "6cf1885c-a60e-4550-9c90-089dd58bad96"
        ],
        "stereo_centers": 0
      },
      "unii": "MI7SX74X8G"
    }
  ]
}