{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "1e94d7e1-ea90-45e3-8287-08d983deee1f", "code": "201668-31-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=201668-31-7", "code_system": "CAS", "references": [ "f4b40337-ddef-4b16-9b97-a80199cd5887", "94513537-a805-4229-9858-ce1bed57a591" ] }, { "uuid": "f2f22eb5-b24d-4e7c-93eb-ba7e2128ba6f", "code": "16212222", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16212222", "code_system": "PUBCHEM", "references": [ "f4b40337-ddef-4b16-9b97-a80199cd5887" ] }, { "uuid": "99c7e868-7d2c-4399-96e2-d6d049491eb6", "code": "MHK948F670", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "16880d44-987e-e890-849f-2674991e278e", "code": "DTXSID2037552", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2037552", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "54c5a53a-b1a2-45ce-829b-c2ecad9f364f", "name": "FLUFENACET OA", "stdName": "FLUFENACET OA", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "640caab3-d01d-48e5-827b-9a07e95e6379" ], "display_name": false }, { "uuid": "9ac9cc6f-2835-4067-af26-8d57c1208c15", "name": "FLUFENACET OXALATE", "stdName": "FLUFENACET OXALATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "58563322-758b-4976-b21c-5a458c6e7037" ], "display_name": true } ], "references": [ { "uuid": "640caab3-d01d-48e5-827b-9a07e95e6379", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "58563322-758b-4976-b21c-5a458c6e7037", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f4b40337-ddef-4b16-9b97-a80199cd5887", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392272000, "tags": [ "NOMEN" ] }, { "uuid": "d0a98608-fd56-457a-aa02-c4de5d2f2be5", "citation": "SRS import [MHK948F670]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=MHK948F670", "doc_type": "SRS", "public_domain": true, "document_date": 1493392272000, "tags": [ "NOMEN" ] }, { "uuid": "94513537-a805-4229-9858-ce1bed57a591", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a3c2d963-55cd-4e75-9d3a-b785f49c163d", "id": "a3c2d963-55cd-4e75-9d3a-b785f49c163d", "molfile": "\n Marvin 01132108302D \n\n 16 16 0 0 0 0 999 V2000\n 0.0000 -1.6455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6973 -1.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6846 -0.4209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4202 -1.6455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4202 -2.4576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6973 -2.8701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1260 -2.8701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1260 -3.7035 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8531 -2.4576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1260 -1.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8318 -1.6455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5547 -1.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5547 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2520 0.0000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8318 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1260 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 2 1 0 0 0 0\n 5 4 1 0 0 0 0\n 4 10 1 0 0 0 0\n 5 6 2 0 0 0 0\n 7 5 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 2 0 0 0 0\n 10 11 1 0 0 0 0\n 10 16 2 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 13 2 0 0 0 0\n 16 15 1 0 0 0 0\nM END", "smiles": "CC(C)N(c1ccc(cc1)F)C(=O)C(=O)O", "formula": "C11H12FNO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "8f670fce-c819-40bf-90cd-f0174fd8e684" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "225.2167", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "c2f912ae-b38d-41d9-83c3-9f4f262463c5", "version": "4", "structure": { "id": "c65c5aa2-8c57-47b8-b1f4-ad7488fa5dd4", "molfile": "\n Marvin 01132110152D \n\n 16 16 0 0 0 0 999 V2000\n 2.1260 -2.8701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1260 -3.7035 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8531 -2.4576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4202 -2.4576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4202 -1.6455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1260 -1.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8318 -1.6455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1260 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5547 -1.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8318 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5547 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2520 0.0000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6973 -1.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.6455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6846 -0.4209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6973 -2.8701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 1 3 1 0 0 0 0\n 1 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 16 2 0 0 0 0\n 5 6 1 0 0 0 0\n 5 13 1 0 0 0 0\n 6 7 2 0 0 0 0\n 6 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 8 10 2 0 0 0 0\n 9 11 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\nM END", "smiles": "CC(C)N(c1ccc(cc1)F)C(=O)C(=O)O", "formula": "C11H12FNO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "225.2167", "optical_activity": "NONE", "references": [ "d0a98608-fd56-457a-aa02-c4de5d2f2be5", "640caab3-d01d-48e5-827b-9a07e95e6379" ], "stereo_centers": 0 }, "unii": "MHK948F670" } ] }