{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bef4564d-f47b-4ee6-a07c-d3df55509202",
          "code": "212905-61-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=212905-61-8",
          "code_system": "CAS",
          "references": [
            "7b13efb9-a7b0-4697-a1c0-e47cf0f22b13",
            "75e09a4e-19ac-4807-b673-d8e6c384ef24"
          ]
        },
        {
          "uuid": "2ac44590-134f-4a94-b774-c88b63906148",
          "code": "71587641",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587641",
          "code_system": "PUBCHEM",
          "references": [
            "7b13efb9-a7b0-4697-a1c0-e47cf0f22b13"
          ]
        },
        {
          "uuid": "30754bc7-fd1f-6a3c-7583-bdedda3a3879",
          "code": "DTXSID70175557",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70175557",
          "code_system": "EPA CompTox",
          "references": [
            "3275858b-a016-a1b7-f970-342ef1740898"
          ]
        },
        {
          "uuid": "ed5e9cbd-1644-4d7c-9630-69096c82806a",
          "code": "MF41BFB17F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8ef50db3-6de7-40a7-b7e4-b1b7898997b9",
          "name": "2-PIPERAZINEACETIC ACID, 3,6-DIOXO-5-(PHENYLMETHYL)-, 2-ETHYLHEXYL ESTER, (2S,5S)-",
          "stdName": "2-PIPERAZINEACETIC ACID, 3,6-DIOXO-5-(PHENYLMETHYL)-, 2-ETHYLHEXYL ESTER, (2S,5S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3fc85f1b-0cdf-4e4f-af3f-e0d66f16e156",
            "faf77779-71fd-4b0b-bd75-7a71e2bd1320"
          ],
          "display_name": false
        },
        {
          "uuid": "56632f37-951f-4888-826c-2cfd0aa67728",
          "name": "ETHYLHEXYL BENZYLDIOXOPIPERAZYL ACETATE",
          "stdName": "ETHYLHEXYL BENZYLDIOXOPIPERAZYL ACETATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "579b68b8-9170-4b67-8f40-3fe88b270351",
            "a8f395e2-c1c4-45de-8a6b-d6315a21eaa5",
            "faf77779-71fd-4b0b-bd75-7a71e2bd1320"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "c9998a55-79f7-4f6c-8d12-a1c42184ffa7",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "d1c71c6a-4804-4233-91b3-ad2da6a464f2",
          "name": "NOMCORT CA8",
          "stdName": "NOMCORT CA8",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a8f395e2-c1c4-45de-8a6b-d6315a21eaa5",
            "faf77779-71fd-4b0b-bd75-7a71e2bd1320"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a8f395e2-c1c4-45de-8a6b-d6315a21eaa5",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "faf77779-71fd-4b0b-bd75-7a71e2bd1320",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3fc85f1b-0cdf-4e4f-af3f-e0d66f16e156",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b13efb9-a7b0-4697-a1c0-e47cf0f22b13",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391506000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1163f417-d055-4481-a3d9-ed2e58ff3c7c",
          "citation": "SRS import [MF41BFB17F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=MF41BFB17F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391506000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "579b68b8-9170-4b67-8f40-3fe88b270351",
          "citation": "ETHYLHEXYL BENZYLDIOXOPIPERAZYL ACETATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3275858b-a016-a1b7-f970-342ef1740898",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=212905-61-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "75e09a4e-19ac-4807-b673-d8e6c384ef24",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2ff9dc31-1041-41d4-9dd1-5d5772f72249",
          "id": "2ff9dc31-1041-41d4-9dd1-5d5772f72249",
          "molfile": "\n  Marvin  01132102342D          \n\n 27 28  0  0  1  0            999 V2000\n    9.1481   -3.7410    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.9731   -3.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3856   -3.0265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9731   -2.3120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2106   -3.0265    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6231   -3.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4481   -3.7410    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   12.8606   -3.0265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4481   -2.3120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8606   -4.4554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4481   -5.1699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8606   -5.8844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4481   -6.5988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7356   -3.0265    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9106   -3.0265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4981   -2.3120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4981   -3.7410    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.6731   -3.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2606   -4.4554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6731   -5.1699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2606   -5.8843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4356   -5.8843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0231   -5.1699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4356   -4.4554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9106   -4.4554    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7356   -4.4554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1481   -5.1699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1 14  1  0  0  0  0\n 26  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 10  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  1  0  0  0\n 17 25  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 19 24  2  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  2  0  0  0  0\n 24 23  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  2  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)COC(=O)C[C@H]1C(=O)N[C@@H](Cc2ccccc2)C(=O)N1",
          "formula": "C21H30N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b49026cf-897f-485a-9ef1-1986a4af3038"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "374.4747",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a4aa8514-9de5-4594-a337-8baf478a7a5d",
      "version": "4",
      "structure": {
        "id": "e06118c4-0dbb-44b2-b08c-0e21e4eaccc5",
        "molfile": "\n  Marvin  01132111372D          \n\n 27 28  0  0  1  0            999 V2000\n   12.4481   -3.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8606   -3.0265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4481   -2.3120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8606   -4.4554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4481   -5.1699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8606   -5.8844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4481   -6.5988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6231   -3.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2106   -3.0265    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3856   -3.0265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9731   -2.3120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9731   -3.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1481   -3.7410    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.7356   -4.4554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1481   -5.1699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9106   -4.4554    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4981   -3.7410    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.6731   -3.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2606   -4.4554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6731   -5.1699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2606   -5.8843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4356   -5.8843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0231   -5.1699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4356   -4.4554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9106   -3.0265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4981   -2.3120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7356   -3.0265    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  1  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 13 12  1  1  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 14  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  1  0  0  0\n 18 19  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  2  0  0  0  0\n 19 24  1  0  0  0  0\n 25 17  1  0  0  0  0\n 25 26  2  0  0  0  0\n 27 25  1  0  0  0  0\n 13 27  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)COC(=O)C[C@H]1C(=O)N[C@@H](Cc2ccccc2)C(=O)N1",
        "formula": "C21H30N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "EPIMERIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "374.4747",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "3fc85f1b-0cdf-4e4f-af3f-e0d66f16e156",
          "1163f417-d055-4481-a3d9-ed2e58ff3c7c"
        ],
        "stereo_centers": 3
      },
      "unii": "MF41BFB17F"
    }
  ]
}