{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "519fc143-23a0-43bf-86a8-174393acd79d",
          "code": "159534-89-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=159534-89-1",
          "code_system": "CAS",
          "references": [
            "3c0980de-a910-45db-b26b-8cb4d2d0c7c9",
            "f5913c1d-c34e-4326-96a9-1925eefab712"
          ]
        },
        {
          "uuid": "1bb9076e-adc3-4133-bc97-7221fd0e9c24",
          "code": "11278197",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11278197",
          "code_system": "PUBCHEM",
          "references": [
            "3c0980de-a910-45db-b26b-8cb4d2d0c7c9"
          ]
        },
        {
          "uuid": "ab42857f-7dfc-1738-69c5-c1e6fc373c82",
          "code": "DTXSID00166675",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00166675",
          "code_system": "EPA CompTox",
          "references": [
            "7eaccbc1-050b-563d-2df7-8ffcd5e51dbf"
          ]
        },
        {
          "uuid": "66acaa54-2194-417e-8789-5e3881c05bd4",
          "code": "MEQ6O2FROG",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7fb7a437-d174-46a3-a88e-39b3297bb24a",
          "name": "11-OCTADECEN-9-YNOIC ACID, ETHYL ESTER, (11E)-",
          "stdName": "11-OCTADECEN-9-YNOIC ACID, ETHYL ESTER, (11E)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e9d7b60-199a-4c0a-8383-31b4ff92d467",
            "b5f08369-1536-4fcc-8878-a6dce79008fc"
          ],
          "display_name": false
        },
        {
          "uuid": "7813d880-7439-4685-87d4-e722b16bf460",
          "name": "11-OCTADECEN-9-YNOIC ACID, ETHYL ESTER, (E)-",
          "stdName": "11-OCTADECEN-9-YNOIC ACID, ETHYL ESTER, (E)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9916cf5-4e70-4813-a6ab-0d1e8f8b8dbf",
            "b5f08369-1536-4fcc-8878-a6dce79008fc"
          ],
          "display_name": false
        },
        {
          "uuid": "4ab61811-b3fe-471d-9ffe-f62b19174f4d",
          "name": "ETHYL SANTALBATE",
          "stdName": "ETHYL SANTALBATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9916cf5-4e70-4813-a6ab-0d1e8f8b8dbf",
            "b5f08369-1536-4fcc-8878-a6dce79008fc"
          ],
          "display_name": false
        },
        {
          "uuid": "aa780c26-e74a-4eba-812b-dc7ea48822a0",
          "name": "ETHYL XIMENYNATE",
          "stdName": "ETHYL XIMENYNATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9916cf5-4e70-4813-a6ab-0d1e8f8b8dbf",
            "b5f08369-1536-4fcc-8878-a6dce79008fc",
            "6d98e9ba-37d2-498b-bc35-aab8f6fd3214"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "07b74499-3123-4cab-8e03-0fa3aee7f183",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "16e64c7e-d9a9-416f-aee6-1fa0c7e05658",
          "name": "EYEDREN",
          "stdName": "EYEDREN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9916cf5-4e70-4813-a6ab-0d1e8f8b8dbf",
            "b5f08369-1536-4fcc-8878-a6dce79008fc"
          ],
          "display_name": false
        },
        {
          "uuid": "be844e0a-87b0-9935-d602-f4333acab720",
          "name": "Ethyl ximenyate [WHO-DD]",
          "stdName": "ETHYL XIMENYATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e4e98db3-3eda-e0fd-57f0-61115c68e635"
          ],
          "display_name": false
        },
        {
          "uuid": "877187e6-0faa-4394-8ed6-ff7cfb719abe",
          "name": "X-SOLVE",
          "stdName": "X-SOLVE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9916cf5-4e70-4813-a6ab-0d1e8f8b8dbf",
            "b5f08369-1536-4fcc-8878-a6dce79008fc"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c9916cf5-4e70-4813-a6ab-0d1e8f8b8dbf",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b5f08369-1536-4fcc-8878-a6dce79008fc",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2e9d7b60-199a-4c0a-8383-31b4ff92d467",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c0980de-a910-45db-b26b-8cb4d2d0c7c9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391523000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "255aaec9-1c2b-4bd0-8d36-72347f0d4522",
          "citation": "SRS import [MEQ6O2FROG]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=MEQ6O2FROG",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391523000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d98e9ba-37d2-498b-bc35-aab8f6fd3214",
          "citation": "ETHYL XIMENYNATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "79052be1-1f06-f9d9-7330-213d2515fc0b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=159534-89-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f5913c1d-c34e-4326-96a9-1925eefab712",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e4e98db3-3eda-e0fd-57f0-61115c68e635",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "7eaccbc1-050b-563d-2df7-8ffcd5e51dbf",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f2a6ef32-5a6b-4a95-a733-db38ea275cca",
          "id": "f2a6ef32-5a6b-4a95-a733-db38ea275cca",
          "molfile": "\n  Marvin  01132112352D          \n\n 22 21  0  0  0  0            999 V2000\n    2.0020   -1.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3967   -2.4956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2215   -2.5158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6163   -3.2402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4410   -3.2606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8358   -3.9850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6606   -4.0052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0554   -4.7296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8801   -4.7499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7049   -4.7702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5296   -4.7906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9244   -5.5149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7492   -5.5352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1439   -6.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9687   -6.2799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3635   -7.0043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1882   -7.0246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5830   -7.7490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1531   -8.4531    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4078   -7.7693    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8026   -8.4937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6273   -8.5140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  3  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\nM  END",
          "smiles": "CCCCCC/C=C/C#CCCCCCCCC(=O)OCC",
          "formula": "C20H34O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "16bcee58-2120-4e86-b21e-e8f115558f52"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "306.4835",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "96a335a5-3a7e-4fb1-a41a-6496575dc7e5",
      "version": "9",
      "structure": {
        "id": "8609ef7b-fc0b-4ed9-93d9-fdb13ced2218",
        "molfile": "\n  Marvin  01132106572D          \n\n 22 21  0  0  0  0            999 V2000\n    2.0020   -1.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3967   -2.4956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2215   -2.5158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6163   -3.2402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4410   -3.2606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8358   -3.9850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6606   -4.0052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0554   -4.7296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8801   -4.7499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7049   -4.7702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5296   -4.7906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9244   -5.5149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7492   -5.5352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1439   -6.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9687   -6.2799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3635   -7.0043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1882   -7.0246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5830   -7.7490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4078   -7.7693    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8026   -8.4937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6273   -8.5140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1531   -8.4531    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  3  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 18 22  2  0  0  0  0\nM  END",
        "smiles": "CCCCCC/C=C/C#CCCCCCCCC(=O)OCC",
        "formula": "C20H34O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "306.4835",
        "optical_activity": "NONE",
        "references": [
          "255aaec9-1c2b-4bd0-8d36-72347f0d4522",
          "2e9d7b60-199a-4c0a-8383-31b4ff92d467"
        ],
        "stereo_centers": 0
      },
      "unii": "MEQ6O2FROG"
    }
  ]
}