{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7e5114c3-d972-448d-bfa2-89ece9535eb3",
          "code": "3006-93-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3006-93-7",
          "code_system": "CAS",
          "references": [
            "2b6ce274-29a4-4a24-9f12-a89984b353fa",
            "56b2848a-36a7-4817-9e84-c8fe7e397955"
          ]
        },
        {
          "uuid": "1493ab09-51f1-4e5a-9ab2-a1497a65bc74",
          "code": "221-112-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.019.194",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "2b6ce274-29a4-4a24-9f12-a89984b353fa"
          ]
        },
        {
          "uuid": "989ab0ea-822f-4134-9c69-716772cee955",
          "code": "18156",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18156",
          "code_system": "PUBCHEM",
          "references": [
            "2b6ce274-29a4-4a24-9f12-a89984b353fa"
          ]
        },
        {
          "uuid": "32ac10ca-2ea0-181c-b48f-8578bf432b91",
          "code": "DTXSID3044415",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3044415",
          "code_system": "EPA CompTox",
          "references": [
            "f5c66fd8-27ed-68b5-352b-e779d5d4c6ed"
          ]
        },
        {
          "uuid": "0d848fb9-fdf1-485c-9957-3e88da354017",
          "code": "MD8KF155CT",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4f2a86b1-7e00-6601-ac70-e4a0767ca217",
          "code": "19639",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=19639",
          "code_system": "NSC",
          "references": [
            "284ec94f-b91c-2416-a2de-b07b137ffe7c"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1e843982-dc3a-4202-bf55-99c163fd100f",
          "name": "1,1'-(1,3-PHENYLENE)BIS(1H-PYRROLE-2,5-DIONE)",
          "stdName": "1,1'-(1,3-PHENYLENE)BIS(1H-PYRROLE-2,5-DIONE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "181d3c06-0b6e-4a56-b88d-8764e1e6e14f"
          ],
          "display_name": false
        },
        {
          "uuid": "444bf8b0-fbb8-4ff2-8f62-fe000c1d9cfd",
          "name": "1,3-BISMALEIMIDOBENZENE",
          "stdName": "1,3-BISMALEIMIDOBENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "181d3c06-0b6e-4a56-b88d-8764e1e6e14f"
          ],
          "display_name": false
        },
        {
          "uuid": "9d06e12c-9c08-46e2-a634-01a7f8df19bb",
          "name": "1,3-DIMALEIMIDOBENZENE",
          "stdName": "1,3-DIMALEIMIDOBENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "181d3c06-0b6e-4a56-b88d-8764e1e6e14f"
          ],
          "display_name": false
        },
        {
          "uuid": "96214afe-2fe8-4790-8fb2-e5d90267d845",
          "name": "1,3-PHENYLENEBISMALEIMIDE",
          "stdName": "1,3-PHENYLENEBISMALEIMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "181d3c06-0b6e-4a56-b88d-8764e1e6e14f"
          ],
          "display_name": false
        },
        {
          "uuid": "d0375ddb-0c4d-441c-bd64-d74c37bb118a",
          "name": "1H-PYRROLE-2,5-DIONE, 1,1'-(1,3-PHENYLENE)BIS-",
          "stdName": "1H-PYRROLE-2,5-DIONE, 1,1'-(1,3-PHENYLENE)BIS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "181d3c06-0b6e-4a56-b88d-8764e1e6e14f"
          ],
          "display_name": false
        },
        {
          "uuid": "e62f7697-5cd7-4ecc-bc5a-b7c57daf0635",
          "name": "BMI 3000",
          "stdName": "BMI 3000",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "181d3c06-0b6e-4a56-b88d-8764e1e6e14f"
          ],
          "display_name": false
        },
        {
          "uuid": "31c162c2-fd86-4cb2-9340-9b29a860f49c",
          "name": "BMI-MP",
          "stdName": "BMI-MP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "181d3c06-0b6e-4a56-b88d-8764e1e6e14f"
          ],
          "display_name": false
        },
        {
          "uuid": "0c9797da-04b5-4a0c-8cb4-a7a02a596f18",
          "name": "M-DIMALEIMIDOBENZENE",
          "stdName": "M-DIMALEIMIDOBENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "181d3c06-0b6e-4a56-b88d-8764e1e6e14f"
          ],
          "display_name": false
        },
        {
          "uuid": "4762f0ce-1c6f-40dc-90a7-c0eb23b9b3f1",
          "name": "M-PHENYLENEBISMALEIMIDE",
          "stdName": "M-PHENYLENEBISMALEIMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "181d3c06-0b6e-4a56-b88d-8764e1e6e14f"
          ],
          "display_name": false
        },
        {
          "uuid": "5d7e2275-1e99-4afd-8cd7-b398a039713f",
          "name": "M-PHENYLENEDIMALEIMIDE",
          "stdName": "M-PHENYLENEDIMALEIMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "181d3c06-0b6e-4a56-b88d-8764e1e6e14f"
          ],
          "display_name": false
        },
        {
          "uuid": "b829f2d9-16d0-44cf-8b24-62903fdcc26c",
          "name": "MALEIMIDE, N,N'-M-PHENYLENEDI-",
          "stdName": "MALEIMIDE, N,N'-M-PHENYLENEDI-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "181d3c06-0b6e-4a56-b88d-8764e1e6e14f"
          ],
          "display_name": false
        },
        {
          "uuid": "291fb88e-52a4-4349-aad6-b9e4ea262906",
          "name": "N,N'-1,3-PHENYLENEBISMALEIMIDE",
          "stdName": "N,N'-1,3-PHENYLENEBISMALEIMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "181d3c06-0b6e-4a56-b88d-8764e1e6e14f"
          ],
          "display_name": false
        },
        {
          "uuid": "9fc6446c-a854-4b93-8736-536b02518b17",
          "name": "N,N'-1,3-PHENYLENEDIMALEIMIDE",
          "stdName": "N,N'-1,3-PHENYLENEDIMALEIMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2ebce2c0-5e38-499f-8f00-34d5215b96e8"
          ],
          "display_name": true
        },
        {
          "uuid": "78da65a1-8d98-4904-b1dc-05278655f729",
          "name": "N,N'-M-PHENYLENEBIS(MALEIMIDE)",
          "stdName": "N,N'-M-PHENYLENEBIS(MALEIMIDE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "181d3c06-0b6e-4a56-b88d-8764e1e6e14f"
          ],
          "display_name": false
        },
        {
          "uuid": "edecc5a0-8f74-4160-8b2f-9e105e5fe7cb",
          "name": "N,N'-M-PHENYLENEDIMALEIMIDE",
          "stdName": "N,N'-M-PHENYLENEDIMALEIMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "181d3c06-0b6e-4a56-b88d-8764e1e6e14f"
          ],
          "display_name": false
        },
        {
          "uuid": "7cddfd3f-1c78-43eb-83a9-ebd2dedecec8",
          "name": "NSC-19639",
          "stdName": "NSC-19639",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6c19b4b-cb9e-47c8-8f8a-3e9d58fb9625"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2ebce2c0-5e38-499f-8f00-34d5215b96e8",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "181d3c06-0b6e-4a56-b88d-8764e1e6e14f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6c19b4b-cb9e-47c8-8f8a-3e9d58fb9625",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b6ce274-29a4-4a24-9f12-a89984b353fa",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391994000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "24393425-4e38-4ecd-8788-f23de567b122",
          "citation": "SRS import [MD8KF155CT]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=MD8KF155CT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391994000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f5c66fd8-27ed-68b5-352b-e779d5d4c6ed",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3006-93-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "284ec94f-b91c-2416-a2de-b07b137ffe7c",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "56b2848a-36a7-4817-9e84-c8fe7e397955",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5ebd0263-9fed-4e14-86c8-928ff8bff446",
          "id": "5ebd0263-9fed-4e14-86c8-928ff8bff446",
          "molfile": "\n  Marvin  01132104542D          \n\n 20 22  0  0  0  0            999 V2000\n    3.6342   -3.0213    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2473   -2.4685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0463   -2.6381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4733   -1.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9095   -1.3246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0901   -0.5145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1597   -1.6475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4481   -1.2315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4481   -0.4105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7257    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0251   -0.4105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0251   -1.2315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7257   -1.6475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3136   -1.6475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2260   -2.4685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8390   -3.0213    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4269   -2.6381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5637   -1.3246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3831   -0.5145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  2  7  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 13  2  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 19  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  2  0  0  0  0\nM  END",
          "smiles": "c1cc(cc(c1)N2C(=O)C=CC2=O)N3C(=O)C=CC3=O",
          "formula": "C14H8N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0bbbad0a-240b-44f9-b77c-702030743b3e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "268.2249",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c58769c2-d122-433f-bfd5-6b8e94ca12f9",
      "version": "4",
      "structure": {
        "id": "1f6d0501-935d-4a04-8199-46c43dc422cd",
        "molfile": "\n  Marvin  01132101472D          \n\n 20 22  0  0  0  0            999 V2000\n    3.6342   -3.0213    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2473   -2.4685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1597   -1.6475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0463   -2.6381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9095   -1.3246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4481   -1.2315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4733   -1.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0901   -0.5145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7257   -1.6475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4481   -0.4105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0251   -1.2315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7257    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0251   -0.4105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3136   -1.6475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2260   -2.4685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5637   -1.3246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8390   -3.0213    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4269   -2.6381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3831   -0.5145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  4  7  2  0  0  0  0\n  5  7  1  0  0  0  0\n  5  8  2  0  0  0  0\n  6  9  2  0  0  0  0\n  6 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n 11 13  2  0  0  0  0\n 11 14  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 15 18  1  0  0  0  0\n 16 19  2  0  0  0  0\n 16 20  1  0  0  0  0\n 18 20  2  0  0  0  0\nM  END",
        "smiles": "c1cc(cc(c1)N2C(=O)C=CC2=O)N3C(=O)C=CC3=O",
        "formula": "C14H8N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "268.2249",
        "optical_activity": "NONE",
        "references": [
          "2ebce2c0-5e38-499f-8f00-34d5215b96e8",
          "24393425-4e38-4ecd-8788-f23de567b122"
        ],
        "stereo_centers": 0
      },
      "unii": "MD8KF155CT"
    }
  ]
}