{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f69755fd-8e39-4c9f-9e2f-a14a7fcaf531",
          "code": "138495-42-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=138495-42-8",
          "code_system": "CAS",
          "references": [
            "96c122fa-6a60-4491-8ed0-fc5acab38e2d",
            "17ec5d1d-da88-46ab-9436-918d030518d0"
          ]
        },
        {
          "uuid": "407a6057-3e45-41d8-8ce8-0aa315a23a8e",
          "code": "86240",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/86240",
          "code_system": "PUBCHEM",
          "references": [
            "96c122fa-6a60-4491-8ed0-fc5acab38e2d"
          ]
        },
        {
          "uuid": "1fa38620-a6a7-66f4-f284-c722b0a20fa5",
          "code": "8303",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/8303",
          "code_system": "HSDB",
          "references": [
            "46d47fb8-8b95-d6f4-e6ea-d906b3b17909"
          ]
        },
        {
          "uuid": "b6aa5b30-b27e-4ea2-bae7-1a89b1b71995",
          "code": "MC53096Z2M",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "04f33709-08bb-f33b-2664-71ec6271ca95",
          "code": "DTXSID30869884",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30869884",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0e0d9af7-0b0e-491a-96e4-716095277a49",
          "name": "1,1,1,2,2,3,4,5,5,5-DECAFLUOROPENTANE",
          "stdName": "1,1,1,2,2,3,4,5,5,5-DECAFLUOROPENTANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc6e5c2e-2090-4fa7-b508-786c26d9d010",
            "fb4893af-e408-497c-8b11-8becc3e84e8c"
          ],
          "display_name": false
        },
        {
          "uuid": "03ce349e-0067-4512-8521-9c2e699c335b",
          "name": "1,1,1,2,3,4,4,5,5,5-DECAFLUOROPENTANE",
          "stdName": "1,1,1,2,3,4,4,5,5,5-DECAFLUOROPENTANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc6e5c2e-2090-4fa7-b508-786c26d9d010",
            "fb4893af-e408-497c-8b11-8becc3e84e8c"
          ],
          "display_name": false
        },
        {
          "uuid": "8d525a08-39ee-4be6-b9f7-3e6aa7eb0830",
          "name": "2,3-DIHYDRODECAFLUOROPENTANE",
          "stdName": "2,3-DIHYDRODECAFLUOROPENTANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc6e5c2e-2090-4fa7-b508-786c26d9d010",
            "fb4893af-e408-497c-8b11-8becc3e84e8c"
          ],
          "display_name": false
        },
        {
          "uuid": "d6e05655-5f77-4e84-a564-2307dc4b33a1",
          "name": "2,3-DIHYDROPERFLUOROPENTANE",
          "stdName": "2,3-DIHYDROPERFLUOROPENTANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc6e5c2e-2090-4fa7-b508-786c26d9d010",
            "fb4893af-e408-497c-8b11-8becc3e84e8c"
          ],
          "display_name": false
        },
        {
          "uuid": "72c35376-5ec2-4701-bf03-a64a462d14bb",
          "name": "2H,3H-DECAFLUOROPENTANE",
          "stdName": "2H,3H-DECAFLUOROPENTANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc6e5c2e-2090-4fa7-b508-786c26d9d010",
            "fb4893af-e408-497c-8b11-8becc3e84e8c"
          ],
          "display_name": true
        },
        {
          "uuid": "22396533-6256-46ee-9d45-f226c6682237",
          "name": "DECAFLUOROPENTANE",
          "stdName": "DECAFLUOROPENTANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "fb4893af-e408-497c-8b11-8becc3e84e8c",
            "e8f1a732-eaa5-44c9-a3a8-b0ac2b4b2f34",
            "dabff603-e7ff-45c5-8e4e-ee2f49b7fdf2"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "9f5c844d-e720-448d-bb0a-0bf89a4589c7",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "671ea2cf-a105-4997-bdc0-305d79787e6e",
          "name": "PENTANE, 1,1,1,2,2,3,4,5,5,5-DECAFLUORO-",
          "stdName": "PENTANE, 1,1,1,2,2,3,4,5,5,5-DECAFLUORO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27e2fc65-d771-4119-a56a-ebdb3f5fa944",
            "fb4893af-e408-497c-8b11-8becc3e84e8c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "dabff603-e7ff-45c5-8e4e-ee2f49b7fdf2",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fb4893af-e408-497c-8b11-8becc3e84e8c",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc6e5c2e-2090-4fa7-b508-786c26d9d010",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27e2fc65-d771-4119-a56a-ebdb3f5fa944",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96c122fa-6a60-4491-8ed0-fc5acab38e2d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392888000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c776fd11-fa89-47ed-a836-545d8a9af502",
          "citation": "SRS import [MC53096Z2M]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=MC53096Z2M",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392888000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "23af2962-6070-44ab-9dbe-9b645632e017",
          "citation": "CHEMID RECORD 138495-42-8",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e8f1a732-eaa5-44c9-a3a8-b0ac2b4b2f34",
          "citation": "DECAFLUOROPENTANE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "46d47fb8-8b95-d6f4-e6ea-d906b3b17909",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+138495-42-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "17ec5d1d-da88-46ab-9436-918d030518d0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f6ddd5ad-f33d-4101-af7d-c1901e086bc1",
          "id": "f6ddd5ad-f33d-4101-af7d-c1901e086bc1",
          "molfile": "\n  Marvin  01132112482D          \n\n 15 14  0  0  0  0            999 V2000\n    1.2526   -5.9290    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2568   -6.7557    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.5428   -7.1690    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.5386   -7.9957    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1712   -6.7557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1754   -5.9290    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1754   -7.5824    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8851   -7.1690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8893   -7.9957    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3027   -6.4508    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6868   -7.3820    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9708   -7.1690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3799   -6.4508    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3799   -7.8830    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7975   -7.1690    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 12  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  8  5  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 12 15  1  0  0  0  0\nM  END",
          "smiles": "C(C(C(F)(F)F)F)(C(C(F)(F)F)(F)F)F",
          "formula": "C5H2F10",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8eee47c5-4d64-4d88-9486-0f44bcc8f9b2"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "252.0536",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "de56d503-52c2-4a03-9ef7-cdf2c7f34ba8",
      "version": "5",
      "structure": {
        "id": "2cf5ca7f-1e71-4397-b603-b98bac1d3372",
        "molfile": "\n  Marvin  01132102252D          \n\n 15 14  0  0  0  0            999 V2000\n   -0.8851   -7.1690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1712   -6.7557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5428   -7.1690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2568   -6.7557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9708   -7.1690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8893   -7.9957    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3799   -6.4508    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3799   -7.8830    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7975   -7.1690    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3027   -6.4508    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6868   -7.3820    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1754   -5.9290    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1754   -7.5824    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5386   -7.9957    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2526   -5.9290    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  5  8  1  0  0  0  0\n  5  9  1  0  0  0  0\n  4  5  1  0  0  0  0\n  1 10  1  0  0  0  0\n  2  3  1  0  0  0  0\n  1 11  1  0  0  0  0\n  1  6  1  0  0  0  0\n  2 12  1  0  0  0  0\n  1  2  1  0  0  0  0\n  2 13  1  0  0  0  0\n  5  7  1  0  0  0  0\n  3 14  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4 15  1  0  0  0  0\nM  END",
        "smiles": "C(C(C(F)(F)F)F)(C(C(F)(F)F)(F)F)F",
        "formula": "C5H2F10",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "252.0536",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "23af2962-6070-44ab-9dbe-9b645632e017",
          "c776fd11-fa89-47ed-a836-545d8a9af502"
        ],
        "stereo_centers": 2
      },
      "unii": "MC53096Z2M"
    }
  ]
}