{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "12247f9f-38f3-4ccd-8eca-d19e615d0dc9",
          "code": "103-23-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=103-23-1",
          "code_system": "CAS",
          "references": [
            "b5f33f2f-d0fd-4c87-b2c2-703bb95c440c",
            "a670c0d0-0b53-4827-9b3d-1f9c5eae1c2e"
          ]
        },
        {
          "uuid": "b538f865-12eb-4579-bfd4-b82ecb341687",
          "code": "C013966",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67013966",
          "code_system": "MESH",
          "references": [
            "b5f33f2f-d0fd-4c87-b2c2-703bb95c440c"
          ]
        },
        {
          "uuid": "75cfd1b2-dc0e-4b73-9230-772c8befa5c1",
          "code": "BIS(2-ETHYLHEXYL) ADIPATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Bis(2-ethylhexyl)_adipate",
          "code_system": "WIKIPEDIA",
          "references": [
            "b5f33f2f-d0fd-4c87-b2c2-703bb95c440c"
          ]
        },
        {
          "uuid": "88f2fa7e-3cb2-40e6-8bf0-997b000c8186",
          "code": "203-090-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.810",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b5f33f2f-d0fd-4c87-b2c2-703bb95c440c"
          ]
        },
        {
          "uuid": "8e821b4b-0d61-455d-9824-16a8fba7086d",
          "code": "1306945",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1306945/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "b5f33f2f-d0fd-4c87-b2c2-703bb95c440c"
          ]
        },
        {
          "uuid": "3fdbe601-7d85-4af7-b94f-5ef0db7f21f2",
          "code": "7641",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7641",
          "code_system": "PUBCHEM",
          "references": [
            "b5f33f2f-d0fd-4c87-b2c2-703bb95c440c"
          ]
        },
        {
          "uuid": "ff3130f9-c71e-25d8-b757-104dcfbe253c",
          "code": "343",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/343",
          "code_system": "HSDB",
          "references": [
            "06c36d48-6e9e-316d-5b72-7ba06d2f72f8"
          ]
        },
        {
          "uuid": "dcb71c85-6925-586b-b494-c5043d45b0f8",
          "code": "DTXSID0020606",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0020606",
          "code_system": "EPA CompTox",
          "references": [
            "488efe1f-7954-e511-136a-9d9d4abecbf4"
          ]
        },
        {
          "uuid": "5c665cd8-3f73-47e4-bd06-af59eac26e33",
          "code": "MBY1SL921L",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e770c118-07a7-c0e1-0536-c0afdde65a14",
          "code": "34675",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:34675",
          "code_system": "CHEBI",
          "references": [
            "68c29abc-203b-539e-c108-7987b02725bd"
          ]
        },
        {
          "uuid": "b8e308e6-ff8e-4bf8-9a4a-6a99c664f4eb",
          "code": "56775",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=56775",
          "code_system": "NSC",
          "references": [
            "6f450158-e09a-c173-793f-8f474fc5f3b6"
          ]
        },
        {
          "uuid": "d27e93c6-46ca-2935-c8ad-6d0aaad3549d",
          "code": "300000031164",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "615da218-558e-2089-edbc-33cc636f785d"
          ]
        },
        {
          "uuid": "b0f52c90-b92d-7f5e-0780-311b464d199c",
          "code": "MBY1SL921L",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=MBY1SL921L",
          "code_system": "DAILYMED",
          "references": [
            "ea840515-64eb-e6f2-e348-d4d9ae664359"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "321cddc1-90f3-4295-9e69-38a542fba31e",
          "name": "ADIPIC ACID DI(2-ETHYLHEXYL) ESTER",
          "stdName": "ADIPIC ACID DI(2-ETHYLHEXYL) ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "477c7b38-5932-4b95-849d-9f7d9b849c55",
            "51145d3c-7dce-410d-9573-af2b354cffda"
          ],
          "display_name": false
        },
        {
          "uuid": "1eef9e11-4b0a-4b7e-b19a-6efd4e88b762",
          "name": "BIS(2-ETHYLHEXYL) ADIPATE",
          "stdName": "BIS(2-ETHYLHEXYL) ADIPATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "477c7b38-5932-4b95-849d-9f7d9b849c55",
            "51145d3c-7dce-410d-9573-af2b354cffda"
          ],
          "display_name": false
        },
        {
          "uuid": "58713469-67c3-48ab-9b8c-db82d54f700f",
          "name": "BIS(2-ETHYLHEXYL)HEXANEDIOATE [HSDB]",
          "stdName": "BIS(2-ETHYLHEXYL)HEXANEDIOATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e570e951-d34f-4f1d-9626-fe1b4af29b55",
            "51145d3c-7dce-410d-9573-af2b354cffda"
          ],
          "display_name": false
        },
        {
          "uuid": "17347ec0-092d-410e-9279-059908544fde",
          "name": "CRODAMOL DOA",
          "stdName": "CRODAMOL DOA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "667023cf-6b74-4626-bfc9-ba2130d594c0",
            "51145d3c-7dce-410d-9573-af2b354cffda"
          ],
          "display_name": false
        },
        {
          "uuid": "d9243e40-bbf3-431e-9a65-25ad9e80bbfd",
          "name": "DEHA",
          "stdName": "DEHA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bf6b1860-a11a-4ff3-be7b-8cde90488cdf",
            "51145d3c-7dce-410d-9573-af2b354cffda"
          ],
          "display_name": false
        },
        {
          "uuid": "3e2c2b9a-f00d-4bb2-bab5-42b1fb592587",
          "name": "DI(2-ETHYLHEXYL) ADIPATE",
          "stdName": "DI(2-ETHYLHEXYL) ADIPATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "51145d3c-7dce-410d-9573-af2b354cffda",
            "f63c1765-0611-429d-8835-763d84a28ab7"
          ],
          "display_name": false
        },
        {
          "uuid": "aaef5d20-e86e-e7f0-1b49-71b9e1a4d0fb",
          "name": "DI(2-ETHYLHEXYL) ADIPATE [IARC]",
          "stdName": "DI(2-ETHYLHEXYL) ADIPATE [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b200eb8a-8ba6-7ac4-22c8-9ec94ced5529"
          ],
          "display_name": false
        },
        {
          "uuid": "575c24e5-cc2f-4b52-bbbb-161e9bb3bc93",
          "name": "DI-(2-ETHYLHEXYL)ADIPATE [MART.]",
          "stdName": "DI-(2-ETHYLHEXYL)ADIPATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a27c4845-a63a-44ca-9166-057b0c491f5b"
          ],
          "display_name": false
        },
        {
          "uuid": "e8307383-6f0c-4ed5-80c0-7460e644bc2a",
          "name": "DIETHYLHEXYL ADIPATE",
          "stdName": "DIETHYLHEXYL ADIPATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e2c3a56-3905-448e-864a-010dd8ccaf19",
            "51145d3c-7dce-410d-9573-af2b354cffda",
            "12fc20e6-15f4-4ac1-9466-726f1e74adc4",
            "2b183b0b-8ccb-41f9-87cc-d822f142543d"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "0a0e3d1f-1d02-4d55-9dab-e504931e0310",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "52347d40-6451-46ec-858a-6f5d28317a7b",
          "name": "DOA",
          "stdName": "DOA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "477c7b38-5932-4b95-849d-9f7d9b849c55",
            "51145d3c-7dce-410d-9573-af2b354cffda"
          ],
          "display_name": false
        },
        {
          "uuid": "644fd2a4-7199-4721-b33f-b573ef333d6b",
          "name": "HEXANEDIOIC ACID, 1,6-BIS(2-ETHYLHEXYL) ESTER",
          "stdName": "HEXANEDIOIC ACID, 1,6-BIS(2-ETHYLHEXYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "51145d3c-7dce-410d-9573-af2b354cffda",
            "1a132f36-5b4c-4517-85b0-0900a717369c"
          ],
          "display_name": false
        },
        {
          "uuid": "276c46d6-66e7-41d6-9ba8-37bad11a3c07",
          "name": "NSC-56775",
          "stdName": "NSC-56775",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "51145d3c-7dce-410d-9573-af2b354cffda",
            "1a132f36-5b4c-4517-85b0-0900a717369c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "477c7b38-5932-4b95-849d-9f7d9b849c55",
          "citation": "Sigma-Aldrich",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "51145d3c-7dce-410d-9573-af2b354cffda",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf6b1860-a11a-4ff3-be7b-8cde90488cdf",
          "citation": "Wikipedia",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a132f36-5b4c-4517-85b0-0900a717369c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "12fc20e6-15f4-4ac1-9466-726f1e74adc4",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a27c4845-a63a-44ca-9166-057b0c491f5b",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e2c3a56-3905-448e-864a-010dd8ccaf19",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e570e951-d34f-4f1d-9626-fe1b4af29b55",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "667023cf-6b74-4626-bfc9-ba2130d594c0",
          "citation": "pcpc",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f63c1765-0611-429d-8835-763d84a28ab7",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5f33f2f-d0fd-4c87-b2c2-703bb95c440c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390847000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8142dbda-515a-48c4-9755-2dd4d4ca160f",
          "citation": "SRS import [MBY1SL921L]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=MBY1SL921L",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390847000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37550370-ae26-4107-97fd-96113123fabb",
          "citation": "HAWLEYS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b183b0b-8ccb-41f9-87cc-d822f142543d",
          "citation": "DIETHYLHEXYL ADIPATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "06c36d48-6e9e-316d-5b72-7ba06d2f72f8",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+103-23-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "488efe1f-7954-e511-136a-9d9d4abecbf4",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=103-23-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b200eb8a-8ba6-7ac4-22c8-9ec94ced5529",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "68c29abc-203b-539e-c108-7987b02725bd",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a670c0d0-0b53-4827-9b3d-1f9c5eae1c2e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6f450158-e09a-c173-793f-8f474fc5f3b6",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "ea840515-64eb-e6f2-e348-d4d9ae664359",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "615da218-558e-2089-edbc-33cc636f785d",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0cd93ac0-9220-48cc-8bf5-8af2a9dadfc5",
          "id": "0cd93ac0-9220-48cc-8bf5-8af2a9dadfc5",
          "molfile": "\n  Marvin  01132100552D          \n\n 26 25  0  0  0  0            999 V2000\n    9.6624   -3.9622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6391   -3.1450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9047   -2.7441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8943   -1.9268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1650   -1.5337    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    8.1365   -0.7087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9047   -0.3207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4693   -1.9527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7399   -1.5725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0339   -1.9992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0571   -2.8294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3019   -1.6113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6062   -2.0380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8769   -1.6475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1838   -2.0846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4648   -1.6811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4493   -0.8665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7665   -2.1234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0371   -1.7199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3311   -2.1596    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.3544   -2.9743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3517   -3.4010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3853   -1.7561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0914   -2.1932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8104   -1.7898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5164   -2.2320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  8  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 16  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 23 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)COC(=O)CCCCC(=O)OCC(CC)CCCC",
          "formula": "C22H42O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "266bb674-940c-41be-ac60-601f8588d654"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "370.5673",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "023a7290-c68c-42a1-b29e-0a4738163f81",
      "version": "11",
      "structure": {
        "id": "e98c1728-0224-4597-b35d-66792a2fc5be",
        "molfile": "\n  Marvin  01132112052D          \n\n 26 25  0  0  0  0            999 V2000\n    6.0339   -1.9992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4648   -1.6811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4493   -0.8665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0571   -2.8294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7399   -1.5725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7665   -2.1234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4693   -1.9527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0371   -1.7199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3019   -1.6113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1838   -2.0846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1650   -1.5337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3311   -2.1596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1365   -0.7087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3544   -2.9743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8769   -1.6475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6062   -2.0380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3853   -1.7561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8943   -1.9268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8104   -1.7898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6391   -3.1450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9047   -2.7441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0914   -2.1932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9047   -0.3207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3517   -3.4010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6624   -3.9622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5164   -2.2320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2 10  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  1  2  0  0  0  0\n  5  1  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10 15  1  0  0  0  0\n 11  7  1  0  0  0  0\n 12  8  1  0  0  0  0\n 11 13  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16  9  1  0  0  0  0\n 17 12  1  0  0  0  0\n 18 11  1  0  0  0  0\n 19 22  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 18  1  0  0  0  0\n 22 17  1  0  0  0  0\n 23 13  1  0  0  0  0\n 24 14  1  0  0  0  0\n 25 20  1  0  0  0  0\n 26 19  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)COC(=O)CCCCC(=O)OCC(CC)CCCC",
        "formula": "C22H42O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "370.5673",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "8142dbda-515a-48c4-9755-2dd4d4ca160f",
          "37550370-ae26-4107-97fd-96113123fabb"
        ],
        "stereo_centers": 2
      },
      "unii": "MBY1SL921L"
    }
  ]
}