{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "618ca9f7-b0c3-4251-8a90-ff1487dc1fd4", "code": "MA7PMG8G5N", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "34e4b67a-8e7b-4569-af50-4cfd9f441e76", "code": "21982679", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21982679", "code_system": "PUBCHEM", "references": [ "ff8f93cb-0d26-4680-b459-8867437b9a98" ] }, { "uuid": "7839554e-1e8e-4d79-936b-dca2e24fc285", "code": "270586-78-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=270586-78-2", "code_system": "CAS", "references": [ "02efa146-0f36-4aa0-9a3c-f9d9f9664e35" ] } ], "substance_class": "chemical", "names": [ { "uuid": "a2bcb4b0-a43e-4684-b081-72d39690551c", "name": "(Di-p-tolylphosphoryl)(mesityl)methanone", "stdName": "(DI-P-TOLYLPHOSPHORYL)(MESITYL)METHANONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "02efa146-0f36-4aa0-9a3c-f9d9f9664e35" ], "display_name": true }, { "uuid": "6d3786a1-ca20-4811-b539-d4416f40b90b", "name": "KX-2013", "stdName": "KX-2013", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "02efa146-0f36-4aa0-9a3c-f9d9f9664e35" ], "display_name": false }, { "uuid": "290bad0a-08c7-4a55-b2d9-e54321d4922e", "name": "Methanone, [bis(4-methylphenyl)phosphinyl](2,4,6-trimethylphenyl)-", "stdName": "METHANONE, (BIS(4-METHYLPHENYL)PHOSPHINYL)(2,4,6-TRIMETHYLPHENYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "02efa146-0f36-4aa0-9a3c-f9d9f9664e35" ], "display_name": false }, { "uuid": "dfb5d2a6-a62a-45d3-8d5e-c421dd921fb5", "name": "Phosphine oxide, bis(4-methylphenyl)(2,4,6-trimethylbenzoyl)-", "stdName": "PHOSPHINE OXIDE, BIS(4-METHYLPHENYL)(2,4,6-TRIMETHYLBENZOYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "02efa146-0f36-4aa0-9a3c-f9d9f9664e35" ], "display_name": false }, { "uuid": "af1d4f8a-af21-44f6-9081-a8282541f04d", "name": "[Bis(4-methylphenyl)phosphinyl](2,4,6-trimethylphenyl)methanone", "stdName": "(BIS(4-METHYLPHENYL)PHOSPHINYL)(2,4,6-TRIMETHYLPHENYL)METHANONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "02efa146-0f36-4aa0-9a3c-f9d9f9664e35" ], "display_name": false } ], "references": [ { "uuid": "02efa146-0f36-4aa0-9a3c-f9d9f9664e35", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "ff8f93cb-0d26-4680-b459-8867437b9a98", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "856961a1-34f4-462c-ae4d-7d541c4a8571", "id": "856961a1-34f4-462c-ae4d-7d541c4a8571", "molfile": "\n CDK 10292414092D\n\n 27 29 0 0 0 0 0 0 0 0999 V2000\n 24.3601 -7.0205 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1401 -5.6695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.7110 -7.8005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.3601 -4.3185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7001 -8.3715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7001 -2.9675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2401 -12.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9560 -3.9006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.3800 -5.6695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.5801 -8.3715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0201 -8.3715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.3601 -9.7225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2401 -9.7225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.5801 -11.0736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0201 -11.0736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.0090 -6.2406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.0090 -4.6806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6580 -7.0205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6580 -3.9006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3071 -6.2406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3071 -4.6806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7001 -5.6695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4801 -7.0205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4801 -4.3185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0400 -7.0205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0400 -4.3185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8200 -5.6695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 2 0 0 0 0\n 1 10 1 0 0 0 0\n 1 16 1 0 0 0 0\n 2 4 2 0 0 0 0\n 2 22 1 0 0 0 0\n 5 23 1 0 0 0 0\n 6 24 1 0 0 0 0\n 7 15 1 0 0 0 0\n 8 21 1 0 0 0 0\n 9 27 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 12 14 2 0 0 0 0\n 13 15 2 0 0 0 0\n 14 15 1 0 0 0 0\n 16 17 2 0 0 0 0\n 16 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 18 20 2 0 0 0 0\n 19 21 2 0 0 0 0\n 20 21 1 0 0 0 0\n 22 23 2 0 0 0 0\n 22 24 1 0 0 0 0\n 23 25 1 0 0 0 0\n 24 26 2 0 0 0 0\n 25 27 2 0 0 0 0\n 26 27 1 0 0 0 0\nM END", "smiles": "Cc1ccc(cc1)P(=O)(c2ccc(C)cc2)C(=O)c3c(C)cc(C)cc3C", "formula": "C24H25O2P", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "4ab8e150-8b6a-40ed-9df1-5ae301785660" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "376.4288", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "42aa1326-a430-4ebc-8a17-5150761cdf20", "version": "5", "structure": { "id": "1a471d41-c933-4a51-a020-5bc9c110f31f", "molfile": "\n JSDraw210292414092D\n\n 27 29 0 0 0 0 0 V2000\n 24.3601 -7.0205 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1401 -5.6695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.7110 -7.8005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.3601 -4.3185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7001 -8.3715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7001 -2.9675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2401 -12.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9560 -3.9006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.3800 -5.6695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.5801 -8.3715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0201 -8.3715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.3601 -9.7225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2401 -9.7225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.5801 -11.0736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0201 -11.0736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.0090 -6.2406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.0090 -4.6806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6580 -7.0205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6580 -3.9006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3071 -6.2406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3071 -4.6806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7001 -5.6695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4801 -7.0205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4801 -4.3185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0400 -7.0205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.0400 -4.3185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8200 -5.6695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 2 0 0 0 0\n 1 10 1 0 0 0 0\n 1 16 1 0 0 0 0\n 2 4 2 0 0 0 0\n 2 22 1 0 0 0 0\n 5 23 1 0 0 0 0\n 6 24 1 0 0 0 0\n 7 15 1 0 0 0 0\n 8 21 1 0 0 0 0\n 9 27 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 12 14 2 0 0 0 0\n 13 15 2 0 0 0 0\n 14 15 1 0 0 0 0\n 16 17 2 0 0 0 0\n 16 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 18 20 2 0 0 0 0\n 19 21 2 0 0 0 0\n 20 21 1 0 0 0 0\n 22 23 2 0 0 0 0\n 22 24 1 0 0 0 0\n 23 25 1 0 0 0 0\n 24 26 2 0 0 0 0\n 25 27 2 0 0 0 0\n 26 27 1 0 0 0 0\nM END", "smiles": "Cc1ccc(cc1)P(=O)(c2ccc(C)cc2)C(=O)c3c(C)cc(C)cc3C", "formula": "C24H25O2P", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "376.4288", "optical_activity": "NONE", "references": [ "02efa146-0f36-4aa0-9a3c-f9d9f9664e35" ], "stereo_centers": 0 }, "unii": "MA7PMG8G5N" } ] }