{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "cf07416f-414c-4a8c-ac22-fabc652db971",
          "code": "1188-37-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1188-37-0",
          "code_system": "CAS",
          "references": [
            "8cf151dd-64d6-45a5-b2b3-0501bbbf03a2",
            "443ba0c0-d290-4cc0-b5ec-c9d990a42e85"
          ]
        },
        {
          "uuid": "8adfa5d1-79a6-4029-a2f8-3cd08cdbfc62",
          "code": "N-ACETYLGLUTAMIC ACID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/N-Acetylglutamic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "8cf151dd-64d6-45a5-b2b3-0501bbbf03a2"
          ]
        },
        {
          "uuid": "d6eb5c48-8b87-4e4a-81d4-62ab7fc5f453",
          "code": "214-708-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.013.372",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8cf151dd-64d6-45a5-b2b3-0501bbbf03a2"
          ]
        },
        {
          "uuid": "0efdf499-697f-40a5-a741-ac515983d9bd",
          "code": "70914",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/70914",
          "code_system": "PUBCHEM",
          "references": [
            "8cf151dd-64d6-45a5-b2b3-0501bbbf03a2"
          ]
        },
        {
          "uuid": "cb056469-b864-a273-e907-982342676375",
          "code": "DTXSID3046534",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3046534",
          "code_system": "EPA CompTox",
          "references": [
            "c43e4376-0eef-b4bd-d00b-ad56bbfe8714"
          ]
        },
        {
          "uuid": "0f168df7-60b9-d93a-bada-41e409737c03",
          "code": "2001205",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2001205/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "9840fe05-eed6-6cd8-b977-caaaf51b1aec"
          ]
        },
        {
          "uuid": "74508d91-0a20-3db1-22f5-9d03120f03fb",
          "code": "DB04075",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB04075",
          "code_system": "DRUG BANK",
          "references": [
            "673e900f-fd12-f428-f556-e4920b84f682"
          ]
        },
        {
          "uuid": "bd4d86c0-6581-49dc-aef4-3d8900317ccf",
          "code": "MA61H539YZ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a8a58379-b669-d6e2-f669-d519690a5005",
          "code": "17533",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17533",
          "code_system": "CHEBI",
          "references": [
            "673e900f-fd12-f428-f556-e4920b84f682"
          ]
        },
        {
          "uuid": "ef28b01a-4cca-367a-4c4a-00bf4c9df22b",
          "code": "MA61H539YZ",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=MA61H539YZ",
          "code_system": "DAILYMED",
          "references": [
            "cfd47e8c-014a-40da-e0e0-bdd1606641e5"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "70a111f6-e128-4cd9-b485-907b6c4bf4ff",
          "name": ".ALPHA.-(N-ACETYL)-L-GLUTAMIC ACID",
          "stdName": ".ALPHA.-(N-ACETYL)-L-GLUTAMIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fe9e881-cabf-41bc-8047-d92af933b231",
            "b4fd3e03-d907-49d5-a5d8-b1f77783130e"
          ],
          "display_name": false
        },
        {
          "uuid": "6c5e7eae-b8c0-4905-b95e-efcb0083fb0f",
          "name": "ACETYL GLUTAMIC ACID",
          "stdName": "ACETYL GLUTAMIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fe9e881-cabf-41bc-8047-d92af933b231",
            "2fb97f84-4255-46b5-bd5c-2cab72cdfe8b",
            "23605387-554c-40c4-8d68-a225348ec4dd"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "93ed4018-01a2-4167-b590-d4cd78c7b466",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "fcaf139f-9197-6284-25cb-9042ca785cb1",
          "name": "FEMA NO. 4752",
          "stdName": "FEMA NO. 4752",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3759aec3-4d8f-d44b-a137-634bf34adc12"
          ],
          "display_name": false
        },
        {
          "uuid": "f8ccba58-3e03-4799-8e9e-c5014d651b13",
          "name": "GLUTAMIC ACID, N-ACETYL-, L-",
          "stdName": "GLUTAMIC ACID, N-ACETYL-, L-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fe9e881-cabf-41bc-8047-d92af933b231",
            "b4fd3e03-d907-49d5-a5d8-b1f77783130e"
          ],
          "display_name": false
        },
        {
          "uuid": "c455f35e-158e-493d-af0e-b904b35bb465",
          "name": "L-GLUTAMIC ACID, N-ACETYL-",
          "stdName": "L-GLUTAMIC ACID, N-ACETYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fe9e881-cabf-41bc-8047-d92af933b231",
            "b4fd3e03-d907-49d5-a5d8-b1f77783130e"
          ],
          "display_name": false
        },
        {
          "uuid": "069f51ee-76b3-4ab3-8449-efc84ba4d18c",
          "name": "L-N-ACETYLGLUTAMIC ACID",
          "stdName": "L-N-ACETYLGLUTAMIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fe9e881-cabf-41bc-8047-d92af933b231",
            "b4fd3e03-d907-49d5-a5d8-b1f77783130e"
          ],
          "display_name": false
        },
        {
          "uuid": "40b6a6b2-e4c8-48b0-933f-9c1e8b2043dd",
          "name": "N-ACETYL-L-GLUTAMIC ACID",
          "stdName": "N-ACETYL-L-GLUTAMIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c88e075b-9aa7-4d46-b104-48b3900c3100",
            "7fe9e881-cabf-41bc-8047-d92af933b231"
          ],
          "display_name": false
        },
        {
          "uuid": "9dd78985-bcf3-4d36-98a6-a83e79458405",
          "name": "N-ACETYL-L-GLUTAMINIC ACID",
          "stdName": "N-ACETYL-L-GLUTAMINIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fe9e881-cabf-41bc-8047-d92af933b231",
            "b4fd3e03-d907-49d5-a5d8-b1f77783130e"
          ],
          "display_name": false
        },
        {
          "uuid": "d81e1614-821d-4539-ad66-ab8fb0a9e074",
          "name": "N-ACETYL-S-GLUTAMIC ACID",
          "stdName": "N-ACETYL-S-GLUTAMIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fe9e881-cabf-41bc-8047-d92af933b231",
            "b4fd3e03-d907-49d5-a5d8-b1f77783130e"
          ],
          "display_name": false
        },
        {
          "uuid": "440e427f-f416-4bf0-a5e1-0e4202be7c29",
          "name": "N-ACETYLGLUTAMATE",
          "stdName": "N-ACETYLGLUTAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fe9e881-cabf-41bc-8047-d92af933b231",
            "9ae4f7c7-eeac-4904-a109-4c735d6fc115"
          ],
          "display_name": false
        },
        {
          "uuid": "3a95452a-1817-4b37-af10-195bff3781d0",
          "name": "N-ACETYLGLUTAMIC ACID",
          "stdName": "N-ACETYLGLUTAMIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fe9e881-cabf-41bc-8047-d92af933b231",
            "b4fd3e03-d907-49d5-a5d8-b1f77783130e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "23605387-554c-40c4-8d68-a225348ec4dd",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7fe9e881-cabf-41bc-8047-d92af933b231",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b4fd3e03-d907-49d5-a5d8-b1f77783130e",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c88e075b-9aa7-4d46-b104-48b3900c3100",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9ae4f7c7-eeac-4904-a109-4c735d6fc115",
          "citation": "http://www.uniprot.org/uniprot/Q8N159",
          "url": "http://www.uniprot.org/uniprot/Q8N159",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8cf151dd-64d6-45a5-b2b3-0501bbbf03a2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391405000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a0b2dca-0574-4e37-b005-9a3a255a3a66",
          "citation": "SRS import [MA61H539YZ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=MA61H539YZ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391405000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2fb97f84-4255-46b5-bd5c-2cab72cdfe8b",
          "citation": "ACETYL GLUTAMIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cfd47e8c-014a-40da-e0e0-bdd1606641e5",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "c43e4376-0eef-b4bd-d00b-ad56bbfe8714",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1188-37-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3759aec3-4d8f-d44b-a137-634bf34adc12",
          "citation": "FHFI",
          "doc_type": "HANDBOOK OF FLAVOR INGREDIENTS",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "443ba0c0-d290-4cc0-b5ec-c9d990a42e85",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9840fe05-eed6-6cd8-b977-caaaf51b1aec",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "673e900f-fd12-f428-f556-e4920b84f682",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "29f8de4d-454b-4ce7-93d4-303ed41f9b11",
          "id": "29f8de4d-454b-4ce7-93d4-303ed41f9b11",
          "molfile": "\n  Marvin  01132102172D          \n\n 13 12  0  0  1  0            999 V2000\n    6.2116   -4.9003    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.9193   -5.3128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6379   -4.9003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3566   -5.3128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0642   -4.9003    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3566   -6.1378    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4920   -5.3128    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4920   -6.1320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2055   -6.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7734   -6.5445    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2116   -4.0753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9285   -3.6628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5022   -3.6628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  7  1  6  0  0  0\n  1 11  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  2  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)N[C@@H](CCC(=O)O)C(=O)O",
          "formula": "C7H11NO5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2d1dc751-aa9d-4341-a7f4-c5549cfd6043"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "189.1662",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "81ec1b32-d737-431a-881c-2a23b44d5233",
      "version": "12",
      "structure": {
        "id": "b0e22e81-751f-421f-a1cd-1407f2b372c6",
        "molfile": "\n  Marvin  01132109102D          \n\n 13 12  0  0  1  0            999 V2000\n    4.7734   -6.5445    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4920   -6.1320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4920   -5.3128    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2116   -4.9003    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.2116   -4.0753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9285   -3.6628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5022   -3.6628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9193   -5.3128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6379   -4.9003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3566   -5.3128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0642   -4.9003    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3566   -6.1378    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2055   -6.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  4  8  1  6  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n  2 13  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)N[C@@H](CCC(=O)O)C(=O)O",
        "formula": "C7H11NO5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "189.1662",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "1a0b2dca-0574-4e37-b005-9a3a255a3a66",
          "23605387-554c-40c4-8d68-a225348ec4dd"
        ],
        "stereo_centers": 1
      },
      "unii": "MA61H539YZ"
    }
  ]
}