{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "dd0bc2d5-4bdb-43a3-9cb8-825783743b61",
          "code": "55458-76-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=55458-76-9",
          "code_system": "CAS",
          "references": [
            "415977b8-31a1-45d3-af73-2f9a6aaa6ecb",
            "9ae975bb-4d2c-40e9-973f-0a179e53293a"
          ]
        },
        {
          "uuid": "7e8ad1ac-421b-45cb-9019-65ff2aaa36eb",
          "code": "3043417",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3043417",
          "code_system": "PUBCHEM",
          "references": [
            "415977b8-31a1-45d3-af73-2f9a6aaa6ecb"
          ]
        },
        {
          "uuid": "dca61492-5c38-e5f9-5a16-700f8a7bb635",
          "code": "DTXSID00204021",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00204021",
          "code_system": "EPA CompTox",
          "references": [
            "f169b85a-d5d1-cac9-6d15-b43008fe8f94"
          ]
        },
        {
          "uuid": "2720bd2f-b92b-4622-ada2-3e60096f292e",
          "code": "M9UWK6ML2K",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "50116f24-b3a8-448a-8689-a415a93c35df",
          "name": "3-PYRIDINECARBOXAMIDE, N-(2-(4-HYDROXYPHENYL)ETHYL)-",
          "stdName": "3-PYRIDINECARBOXAMIDE, N-(2-(4-HYDROXYPHENYL)ETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "007a71bb-2daf-405d-afcf-59cb447f5929",
            "02cc8d28-0662-4a52-89ff-2ca91489b9ea"
          ],
          "display_name": false
        },
        {
          "uuid": "54455372-bf27-4b45-a247-9002ea9028dd",
          "name": "EP-NDT",
          "stdName": "EP-NDT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02cc8d28-0662-4a52-89ff-2ca91489b9ea",
            "f40d5e5b-05b2-492c-9b24-db43dd560ef6"
          ],
          "display_name": false
        },
        {
          "uuid": "9f0b31f4-e3b3-457e-a527-361e6b7ffdeb",
          "name": "N-(3-PYRIDYLCARBONYL)TYRAMINE",
          "stdName": "N-(3-PYRIDYLCARBONYL)TYRAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "007a71bb-2daf-405d-afcf-59cb447f5929",
            "02cc8d28-0662-4a52-89ff-2ca91489b9ea"
          ],
          "display_name": false
        },
        {
          "uuid": "a61207bc-6867-4787-8fd4-2e513cf20677",
          "name": "N-NICOTINOYL TYRAMINE",
          "stdName": "N-NICOTINOYL TYRAMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02cc8d28-0662-4a52-89ff-2ca91489b9ea",
            "6c3a10f9-9224-4475-a1c3-c60290bf0ddc",
            "f40d5e5b-05b2-492c-9b24-db43dd560ef6"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b52b1f44-abda-46cd-8783-7f00b5247efb",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "38fb9a5a-de4b-440a-bfa1-57ba0b277f98",
          "name": "N-NICOTINOYLTYRAMINE",
          "stdName": "N-NICOTINOYLTYRAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "007a71bb-2daf-405d-afcf-59cb447f5929",
            "02cc8d28-0662-4a52-89ff-2ca91489b9ea"
          ],
          "display_name": false
        },
        {
          "uuid": "792f0a68-fc91-4606-875d-fd5669a88b1e",
          "name": "NICOTINAMIDE, N-(P-HYDROXYPHENETHYL)-",
          "stdName": "NICOTINAMIDE, N-(P-HYDROXYPHENETHYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "007a71bb-2daf-405d-afcf-59cb447f5929",
            "02cc8d28-0662-4a52-89ff-2ca91489b9ea"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f40d5e5b-05b2-492c-9b24-db43dd560ef6",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "02cc8d28-0662-4a52-89ff-2ca91489b9ea",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "007a71bb-2daf-405d-afcf-59cb447f5929",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "415977b8-31a1-45d3-af73-2f9a6aaa6ecb",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391545000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b94a555-7b34-4cd4-bc91-79d12a77a4ac",
          "citation": "SRS import [M9UWK6ML2K]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=M9UWK6ML2K",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391545000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c3a10f9-9224-4475-a1c3-c60290bf0ddc",
          "citation": "N-NICOTINOYL TYRAMINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f169b85a-d5d1-cac9-6d15-b43008fe8f94",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=55458-76-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9ae975bb-4d2c-40e9-973f-0a179e53293a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "390c67ae-ba96-4b6e-832e-9f2dc757d594",
          "id": "390c67ae-ba96-4b6e-832e-9f2dc757d594",
          "molfile": "\n  Marvin  01132103022D          \n\n 18 19  0  0  0  0            999 V2000\n   15.3225   -5.7165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6080   -5.3040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8936   -5.7165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1791   -5.3040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1791   -4.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4646   -4.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7502   -4.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0357   -4.0665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3212   -4.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3212   -5.3040    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6068   -4.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8923   -4.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1778   -4.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1778   -3.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8923   -2.8290    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6068   -3.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8936   -4.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6080   -4.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 18  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 17  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  0  0  0  0\n 16 11  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "c1cc(cnc1)C(=O)NCCc2ccc(cc2)O",
          "formula": "C14H14N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9dada2a3-216f-43c3-8424-19a856d9690b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "242.2737",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "008face5-bdd2-4687-b54b-dd03afc419df",
      "version": "4",
      "structure": {
        "id": "308cf2ec-565e-4b17-a32d-1b780f44feaf",
        "molfile": "\n  Marvin  01132102362D          \n\n 18 19  0  0  0  0            999 V2000\n   11.0357   -4.0665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7502   -4.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4646   -4.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1791   -4.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1791   -5.3040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8936   -5.7165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6080   -5.3040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6080   -4.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8936   -4.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3225   -5.7165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3212   -5.3040    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3212   -4.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1778   -3.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1778   -4.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8923   -4.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6068   -4.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6068   -3.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8923   -2.8290    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n  4  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 16 12  1  0  0  0  0\n 18 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 12  1  1  0  0  0  0\nM  END",
        "smiles": "c1cc(cnc1)C(=O)NCCc2ccc(cc2)O",
        "formula": "C14H14N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "242.2737",
        "optical_activity": "NONE",
        "references": [
          "007a71bb-2daf-405d-afcf-59cb447f5929",
          "6b94a555-7b34-4cd4-bc91-79d12a77a4ac"
        ],
        "stereo_centers": 0
      },
      "unii": "M9UWK6ML2K"
    }
  ]
}