{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "ffbc1255-6d35-43c3-9e8d-c029c3b337eb", "code": "992-78-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=992-78-9", "code_system": "CAS", "references": [ "2d7eba39-43b1-4d81-8476-436c3681e621", "1158818a-7501-413e-afad-d23be1b7a865" ] }, { "uuid": "2c9ac4b8-5699-44e0-8a62-685752146ab2", "code": "C026663", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67026663", "code_system": "MESH", "references": [ "2d7eba39-43b1-4d81-8476-436c3681e621" ] }, { "uuid": "4af26223-15a4-4033-913d-b5c064f0b392", "code": "UBIQUINOL", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Ubiquinol", "code_system": "WIKIPEDIA", "references": [ "2d7eba39-43b1-4d81-8476-436c3681e621" ] }, { "uuid": "f0ef7a84-429e-4edc-9196-38f544db9c84", "code": "39085", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/39085/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "2d7eba39-43b1-4d81-8476-436c3681e621" ] }, { "uuid": "15eecbfc-ed22-4d03-9180-406693705785", "code": "SUB32843", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "2d7eba39-43b1-4d81-8476-436c3681e621" ] }, { "uuid": "279bf939-f028-457b-b9ec-0d6bf1fed441", "code": "9962735", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9962735", "code_system": "PUBCHEM", "references": [ "2d7eba39-43b1-4d81-8476-436c3681e621" ] }, { "uuid": "62c1ec33-20c4-c6ba-deb3-3bffe058451b", "code": "179403", "comments": "ORPHAN DRUG|Designated|Treatment of Huntington's Disease", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=179403", "code_system": "FDA ORPHAN DRUG" }, { "uuid": "25b21607-cdd3-05ea-f892-316fe87fef35", "code": "EU/3/16/1765", "comments": "EU ORPHAN DRUG|Positive|Treatment of primary coenzyme Q10 deficiency syndrome", "type": "PRIMARY", "url": "https://www.ema.europa.eu/en/medicines/human/orphan-designations/eu3161765", "code_system": "EU-Orphan Drug", "references": [ "e8128a63-3aa7-4ad8-eab1-5c73f9208c17" ] }, { "uuid": "6108a298-1ad1-f329-5d93-918b60078376", "code": "DB11340", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB11340", "code_system": "DRUG BANK", "references": [ "e8128a63-3aa7-4ad8-eab1-5c73f9208c17" ] }, { "uuid": "3d68a83e-5bc6-4934-938c-5b7019c62574", "code": "M9NL0C577Y", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "a4287dfb-80fd-0293-db70-9740fd2a4259", "code": "17976", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17976", "code_system": "CHEBI", "references": [ "e8128a63-3aa7-4ad8-eab1-5c73f9208c17" ] }, { "uuid": "759ee247-9fd5-ba04-7cb9-c241221faffc", "code": "64183", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:64183", "code_system": "CHEBI", "references": [ "e8128a63-3aa7-4ad8-eab1-5c73f9208c17" ] }, { "uuid": "4dce03b0-2434-4580-cc41-619720434564", "code": "1705334", "type": "PRIMARY", "url": "https://store.usp.org/product/1705334", "code_system": "RS_ITEM_NUM", "references": [ "e8128a63-3aa7-4ad8-eab1-5c73f9208c17" ] }, { "uuid": "8db2aa99-33d1-fd13-e2fc-d594f795b8b2", "code": "M9NL0C577Y", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=M9NL0C577Y", "code_system": "DAILYMED", "references": [ "e83ad935-a50f-aa55-f2e4-947bed518fd9" ] }, { "uuid": "b3976701-01c7-b507-9dcc-2c68cd352718", "code": "100000125973", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "d1a41d26-496e-5d27-ec0d-8b74d6847e37" ] }, { "uuid": "dce2f9f9-d168-9189-3ad9-519a68744a41", "code": "DTXSID90912840", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90912840", "code_system": "EPA CompTox", "references": [ "a573bef0-b4db-29cf-38f6-cb2916ff9e25" ] } ], "relationships": [ { "uuid": "eb22d4d0-6ffb-48c6-90a3-a304fa5b0eaa", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "fc1851b9-1c53-4c21-bb68-2aec7010e9cd", "refuuid": "06a30d05-33e6-4b72-8d40-ab1edeb33eca", "name": "UBIQUINOL", "unii": "M9NL0C577Y", "linking_id": "M9NL0C577Y", "ref_pname": "UBIQUINOL", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "90ac7b3c-c89a-460c-a330-16d9897e18af", "name": "1,4-BENZENEDIOL, 2-((2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-DECAMETHYL-2,6,10,14,18,22,26,30,34,38-TETRACONTADECAEN-1-YL)-5,6-DIMETHOXY-3-METHYL-", "stdName": "1,4-BENZENEDIOL, 2-((2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-DECAMETHYL-2,6,10,14,18,22,26,30,34,38-TETRACONTADECAEN-1-YL)-5,6-DIMETHOXY-3-METHYL-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "22ed0642-f24a-4a8b-9475-93166ecec457" ], "display_name": false }, { "uuid": "1d4d285a-ac7b-4bca-a783-5b368f80d42a", "name": "DIHYDROCOENZYME Q10", "stdName": "DIHYDROCOENZYME Q10", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "22ed0642-f24a-4a8b-9475-93166ecec457" ], "display_name": false }, { "uuid": "81c83f0c-132e-4b23-9557-1456b46a4186", "name": "REDUCED COENZYME Q10", "stdName": "REDUCED COENZYME Q10", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "22ed0642-f24a-4a8b-9475-93166ecec457" ], "display_name": false }, { "uuid": "743eed22-245b-44cb-aa2f-82c919a6e57e", "name": "UBIQUINOL", "stdName": "UBIQUINOL", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "671dc16e-6823-4238-8483-cddfdd6771c9", "6f3271ec-fc39-41d5-9505-67ca69455baa", "e59fd037-db7c-4011-969e-db1e2ba5e830", "7b1ebff4-9750-49e8-b91f-9218ebd0c140", "34babcb1-2e36-4069-a86a-11905f1b7acb", "80754561-7d64-4685-bf36-35d2e26b6220", "4a546654-da07-45a6-b9ff-a82d4a620a6b" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "9da832b6-7b69-457a-8507-490e515ebeb1", "name_org": "INCI" } ] }, { "uuid": "343e9691-282f-4f39-ae3d-18c854ac8144", "name": "UBIQUINOL [USP-RS]", "stdName": "UBIQUINOL [USP-RS]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "34babcb1-2e36-4069-a86a-11905f1b7acb" ], "display_name": false }, { "uuid": "4bffae26-6a4b-482d-89b0-2b65a7b9347c", "name": "UBIQUINOL-10", "stdName": "UBIQUINOL-10", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bdc96b3c-5c55-4794-9455-8939c9286863" ], "display_name": false }, { "uuid": "d29653ba-5900-4708-86be-108145a42419", "name": "UBIQUINONE HYDROQUINONE", "stdName": "UBIQUINONE HYDROQUINONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9abe96e7-8b44-4788-8495-931a9c7c2b6c" ], "display_name": false }, { "uuid": "a37e6e7a-078c-e5f2-a80b-c7bbad4c5ad6", "name": "Ubiquinol [WHO-DD]", "stdName": "UBIQUINOL [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ecf92979-d46b-b535-adb3-f5676553a170" ], "display_name": false } ], "references": [ { "uuid": "34babcb1-2e36-4069-a86a-11905f1b7acb", "citation": "USP/NF", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "bdc96b3c-5c55-4794-9455-8939c9286863", "citation": "http://www.ncbi.nlm.nih.gov/pubmed/2352956", "url": "http://www.ncbi.nlm.nih.gov/pubmed/2352956", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "671dc16e-6823-4238-8483-cddfdd6771c9", "citation": "http://en.wikipedia.org/wiki/Ubiquinol", "url": "http://en.wikipedia.org/wiki/Ubiquinol", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9abe96e7-8b44-4788-8495-931a9c7c2b6c", "citation": "chemid", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6f3271ec-fc39-41d5-9505-67ca69455baa", "citation": "who-dd", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "22ed0642-f24a-4a8b-9475-93166ecec457", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7b1ebff4-9750-49e8-b91f-9218ebd0c140", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2d7eba39-43b1-4d81-8476-436c3681e621", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391622000, "tags": [ "NOMEN" ] }, { "uuid": "af7a4db1-4751-4778-a53f-3d3c222ffae9", "citation": "SRS import [M9NL0C577Y]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=M9NL0C577Y", "doc_type": "SRS", "public_domain": true, "document_date": 1493391622000, "tags": [ "NOMEN" ] }, { "uuid": "d6aba0f4-3c02-4828-af57-5552b8b3d908", "citation": "stn", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e59fd037-db7c-4011-969e-db1e2ba5e830", "citation": "UBIQUINOL [USP-RS]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "4a546654-da07-45a6-b9ff-a82d4a620a6b", "citation": "UBIQUINOL [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "80754561-7d64-4685-bf36-35d2e26b6220", "citation": "UBIQUINOL [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "e8128a63-3aa7-4ad8-eab1-5c73f9208c17", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "1158818a-7501-413e-afad-d23be1b7a865", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "ecf92979-d46b-b535-adb3-f5676553a170", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "e83ad935-a50f-aa55-f2e4-947bed518fd9", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "a573bef0-b4db-29cf-38f6-cb2916ff9e25", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "d1a41d26-496e-5d27-ec0d-8b74d6847e37", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "b359d7f3-a3f6-4344-8e1c-5e3635baeafc", "id": "b359d7f3-a3f6-4344-8e1c-5e3635baeafc", "molfile": "\n Marvin 01132109172D \n\n 63 63 0 0 0 0 999 V2000\n 3.5048 -5.5587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2192 -5.1462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9337 -5.5587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6482 -5.1462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6482 -4.3212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3626 -5.5587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0771 -5.1462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3626 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0771 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7915 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5060 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5060 -7.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2205 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9349 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6494 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3639 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3639 -7.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0784 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7928 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5073 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2218 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2218 -7.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9363 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6507 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3652 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0797 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0797 -7.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7941 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5086 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2231 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9375 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9375 -7.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.6520 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3665 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0809 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7954 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7954 -7.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.5098 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2243 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.9389 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.6532 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.6532 -7.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.3677 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.0823 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7967 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5111 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5111 -7.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2256 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9401 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.6546 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.3690 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.3690 -7.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0835 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.7980 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.5124 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.2269 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.9414 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.2269 -7.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6482 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6482 -7.6212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9337 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2192 -6.7962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5048 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 3 61 2 0 0 0 0\n 4 5 1 0 0 0 0\n 6 4 2 0 0 0 0\n 6 7 1 0 0 0 0\n 8 6 1 0 0 0 0\n 8 9 1 0 0 0 0\n 59 8 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 26 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 31 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 2 0 0 0 0\n 36 37 1 0 0 0 0\n 36 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 2 0 0 0 0\n 41 42 1 0 0 0 0\n 41 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 1 0 0 0 0\n 45 46 2 0 0 0 0\n 46 47 1 0 0 0 0\n 46 48 1 0 0 0 0\n 48 49 1 0 0 0 0\n 49 50 1 0 0 0 0\n 50 51 2 0 0 0 0\n 51 52 1 0 0 0 0\n 51 53 1 0 0 0 0\n 53 54 1 0 0 0 0\n 54 55 1 0 0 0 0\n 55 56 2 0 0 0 0\n 56 57 1 0 0 0 0\n 56 58 1 0 0 0 0\n 59 60 1 0 0 0 0\n 59 61 1 0 0 0 0\n 61 62 1 0 0 0 0\n 62 63 1 0 0 0 0\nM END", "smiles": "CC(=CCC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/Cc1c(C)c(c(c(c1O)OC)OC)O)/C)/C)/C)/C)/C)/C)/C)/C)/C)C", "formula": "C59H92O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "d0051e7a-1d7f-4e67-a50f-30e2c11bbf50" }, "defined_stereo": 0, "ez_centers": 9, "molecular_weight": "865.3616", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "06a30d05-33e6-4b72-8d40-ab1edeb33eca", "version": "19", "structure": { "id": "5fded331-5b49-4c65-892f-4bbb71d43967", "molfile": "\n Marvin 01132104582D \n\n 63 63 0 0 0 0 999 V2000\n 5.6482 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6482 -7.6212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9337 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2192 -6.7962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5048 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9337 -5.5587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2192 -5.1462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5048 -5.5587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6482 -5.1462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6482 -4.3212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3626 -5.5587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0771 -5.1462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3626 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0771 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7915 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5060 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5060 -7.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2205 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9349 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6494 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3639 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3639 -7.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0784 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7928 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5073 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2218 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2218 -7.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9363 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6507 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3652 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0797 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0797 -7.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7941 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5086 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2231 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9375 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9375 -7.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.6520 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3665 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0809 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7954 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7954 -7.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.5098 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2243 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.9389 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.6532 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.6532 -7.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.3677 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.0823 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7967 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5111 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5111 -7.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2256 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.9401 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.6546 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.3690 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.3690 -7.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0835 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.7980 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.5124 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.2269 -6.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.9414 -6.3837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.2269 -7.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 3 1 0 0 0 0\n 1 13 2 0 0 0 0\n 13 11 1 0 0 0 0\n 11 9 2 0 0 0 0\n 9 6 1 0 0 0 0\n 6 3 2 0 0 0 0\n 1 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 26 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 31 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 2 0 0 0 0\n 36 37 1 0 0 0 0\n 36 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 2 0 0 0 0\n 41 42 1 0 0 0 0\n 41 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 1 0 0 0 0\n 45 46 2 0 0 0 0\n 46 47 1 0 0 0 0\n 46 48 1 0 0 0 0\n 48 49 1 0 0 0 0\n 49 50 1 0 0 0 0\n 50 51 2 0 0 0 0\n 51 52 1 0 0 0 0\n 51 53 1 0 0 0 0\n 53 54 1 0 0 0 0\n 54 55 1 0 0 0 0\n 55 56 2 0 0 0 0\n 56 57 1 0 0 0 0\n 56 58 1 0 0 0 0\n 58 59 1 0 0 0 0\n 59 60 1 0 0 0 0\n 60 61 2 0 0 0 0\n 61 62 1 0 0 0 0\n 61 63 1 0 0 0 0\nM END", "smiles": "CC(=CCC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/Cc1c(C)c(c(c(c1O)OC)OC)O)/C)/C)/C)/C)/C)/C)/C)/C)/C)C", "formula": "C59H92O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 9, "molecular_weight": "865.3616", "optical_activity": "NONE", "references": [ "af7a4db1-4751-4778-a53f-3d3c222ffae9", "d6aba0f4-3c02-4828-af57-5552b8b3d908" ], "stereo_centers": 0 }, "unii": "M9NL0C577Y" } ] }