{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b7355612-82ab-49e2-9e9a-1fd14c382352",
          "code": "H-89",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/H-89",
          "code_system": "WIKIPEDIA",
          "references": [
            "0c4420fa-21b8-4128-b908-86662e5e260a"
          ]
        },
        {
          "uuid": "07b843f7-dad8-4125-addb-fc6caf6d5da5",
          "code": "449241",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/449241",
          "code_system": "PUBCHEM",
          "references": [
            "0c4420fa-21b8-4128-b908-86662e5e260a"
          ]
        },
        {
          "uuid": "96144fb0-7179-4639-bbdc-09626860b939",
          "code": "127243-85-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=127243-85-0",
          "code_system": "CAS",
          "references": [
            "0c4420fa-21b8-4128-b908-86662e5e260a",
            "8f4bdd1a-f68d-470e-9af0-92be430b8ff2"
          ]
        },
        {
          "uuid": "959dc87c-c648-ea7a-a874-833c19d29c4d",
          "code": "DB07995",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB07995",
          "code_system": "DRUG BANK",
          "references": [
            "df69119c-9381-5f21-3464-cfeb54b26268"
          ]
        },
        {
          "uuid": "f152d57a-3277-4e5e-8ee5-c31a7d8477ea",
          "code": "M876330O56",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9b0685b0-9e10-9ab6-f1ad-4618f73896f3",
          "code": "DTXSID801022528",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID801022528",
          "code_system": "EPA CompTox",
          "references": [
            "df69119c-9381-5f21-3464-cfeb54b26268"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ccfcfbf0-d6e4-4fff-9294-78f996572311",
          "amount": {
            "uuid": "9820863a-1d77-48af-8c81-a13e9c308fcf"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "6bda1894-f2bd-4399-a008-cecf258b01bc",
            "refuuid": "78514451-07e8-489a-bbde-a54592a5b71c",
            "name": "H-89",
            "unii": "M876330O56",
            "linking_id": "M876330O56",
            "ref_pname": "H-89",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f41198fd-6c5e-4eec-9983-074325b4cf83",
          "amount": {
            "uuid": "7df67c3c-cdf7-4f93-8df0-26584a592d26",
            "average": 960,
            "units": "NANOMOLAR"
          },
          "comments": "Enzymatic Assay",
          "qualification": "IC50",
          "type": "TARGET->INHIBITOR",
          "references": [
            "1d7c175d-bfed-4c5b-864c-542f3a859409"
          ],
          "related_substance": {
            "uuid": "9e80a5ad-bd59-488a-bcc3-27f574b33c9e",
            "refuuid": "c294f653-d63d-4d91-a51b-a31e7fc6c928",
            "name": "PROTEIN KINASE C ALPHA TYPE",
            "unii": "W48I3O72LB",
            "linking_id": "W48I3O72LB",
            "ref_pname": "PROTEIN KINASE C ALPHA TYPE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "64c0445f-846d-4be5-a148-81a79f028cc7",
          "name": "5-ISOQUINOLINESULFONAMIDE, N-(2-((3-(4-BROMOPHENYL)-2-PROPEN-1-YL)AMINO)ETHYL)-",
          "stdName": "5-ISOQUINOLINESULFONAMIDE, N-(2-((3-(4-BROMOPHENYL)-2-PROPEN-1-YL)AMINO)ETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e7fea1c-4f33-4fe8-862d-e824221a6fa2",
            "52e6ac1c-414d-499d-a319-8f73dc406d13"
          ],
          "display_name": false
        },
        {
          "uuid": "9c2e703c-14ff-4806-93d0-9fd246c1ce57",
          "name": "H-89",
          "stdName": "H-89",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "578c13d1-efc8-418b-87ba-9f5b95631b88",
            "3574f487-cc24-4e82-8b21-40185887652c"
          ],
          "display_name": true
        },
        {
          "uuid": "74df5e45-5653-415b-8875-c72bab6eafe2",
          "name": "N-(2-(4-BROMOCINNAMYLAMINO)ETHYL)-5-ISOQUINOLINESULFONAMIDE",
          "stdName": "N-(2-(4-BROMOCINNAMYLAMINO)ETHYL)-5-ISOQUINOLINESULFONAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e7fea1c-4f33-4fe8-862d-e824221a6fa2",
            "2892b9d7-5a8e-4614-a1de-44943faca4bb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "578c13d1-efc8-418b-87ba-9f5b95631b88",
          "citation": "CHEMID 2011 Drugportal",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3574f487-cc24-4e82-8b21-40185887652c",
          "citation": "DRUGPORTAL 2011",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "52e6ac1c-414d-499d-a319-8f73dc406d13",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e7fea1c-4f33-4fe8-862d-e824221a6fa2",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2892b9d7-5a8e-4614-a1de-44943faca4bb",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c4420fa-21b8-4128-b908-86662e5e260a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391212000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8a679e3-2aa9-40ee-b139-194653e519ea",
          "citation": "SRS import [M876330O56]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=M876330O56",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391212000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b75e1700-6f56-487d-98aa-66f0e148a9c8",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1d7c175d-bfed-4c5b-864c-542f3a859409",
          "citation": "PKCalpha Human PKC Kinase Enzymatic HTRF Assay [Km ATP], Cerep",
          "url": "https://www.eurofinsdiscoveryservices.com/catalogmanagement/viewItem/4612",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "df69119c-9381-5f21-3464-cfeb54b26268",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "8f4bdd1a-f68d-470e-9af0-92be430b8ff2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1aec11c6-af2b-42f4-b2e7-4793f1b4aec1",
          "id": "1aec11c6-af2b-42f4-b2e7-4793f1b4aec1",
          "molfile": "\n  Marvin  01132101352D          \n\n 27 29  0  0  0  0            999 V2000\n   -2.4532   -3.0582    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7315   -3.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0263   -3.0373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3087   -3.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3004   -4.2681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4172   -4.6728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1265   -4.2556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8441   -4.6603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5533   -4.2388    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2710   -4.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9802   -4.2263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6978   -4.6353    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4071   -4.2138    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8146   -3.6381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9828   -3.6214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1288   -4.6227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8339   -4.1972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5599   -4.6018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5724   -5.4279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8632   -5.8494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8757   -6.6712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1664   -7.0926    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4488   -6.6921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4404   -5.8660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1413   -5.4488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0096   -4.6853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7273   -4.2806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n 27  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n 26  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 13  2  0  0  0  0\n 16 13  1  0  0  0  0\n 17 16  1  0  0  0  0\n 25 16  2  0  0  0  0\n 18 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 21 20  1  0  0  0  0\n 20 25  1  0  0  0  0\n 22 21  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 27 26  1  0  0  0  0\nM  END",
          "smiles": "c1cc2cnccc2c(c1)S(=O)(=O)NCCNC/C=C/c3ccc(cc3)Br",
          "formula": "C20H20BrN3O2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ff7c0edf-f8f5-4031-820c-90dc98ca2d73"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "446.3621",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "78514451-07e8-489a-bbde-a54592a5b71c",
      "version": "5",
      "structure": {
        "id": "05e95da7-b059-4a58-8e4b-475ee4b90b70",
        "molfile": "\n  Marvin  01132100362D          \n\n 27 29  0  0  0  0            999 V2000\n    5.4071   -4.2138    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1288   -4.6227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1413   -5.4488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8146   -3.6381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9828   -3.6214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6978   -4.6353    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1664   -7.0926    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4172   -4.6728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8632   -5.8494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1265   -4.2556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3004   -4.2681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7315   -3.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9802   -4.2263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5533   -4.2388    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4532   -3.0582    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3087   -3.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0096   -4.6853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8339   -4.1972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0263   -3.0373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7273   -4.2806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8757   -6.6712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4404   -5.8660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8441   -4.6603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5599   -4.6018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4488   -6.6921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2710   -4.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5724   -5.4279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  1  2  0  0  0  0\n  6  1  1  0  0  0  0\n  7 21  2  0  0  0  0\n  8 10  2  0  0  0  0\n  9  3  2  0  0  0  0\n 10 23  1  0  0  0  0\n 11  8  1  0  0  0  0\n 12 19  1  0  0  0  0\n 13  6  1  0  0  0  0\n 14 26  1  0  0  0  0\n 15 12  1  0  0  0  0\n 16 11  1  0  0  0  0\n 17 11  2  0  0  0  0\n 18  2  2  0  0  0  0\n 19 16  2  0  0  0  0\n 20 17  1  0  0  0  0\n 21  9  1  0  0  0  0\n 22  3  1  0  0  0  0\n 23 14  1  0  0  0  0\n 24 18  1  0  0  0  0\n 25 22  2  0  0  0  0\n 26 13  1  0  0  0  0\n 27  9  1  0  0  0  0\n 24 27  2  0  0  0  0\n  7 25  1  0  0  0  0\n 20 12  2  0  0  0  0\nM  END",
        "smiles": "c1cc2cnccc2c(c1)S(=O)(=O)NCCNC/C=C/c3ccc(cc3)Br",
        "formula": "C20H20BrN3O2S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "446.3621",
        "optical_activity": "NONE",
        "references": [
          "b75e1700-6f56-487d-98aa-66f0e148a9c8",
          "d8a679e3-2aa9-40ee-b139-194653e519ea"
        ],
        "stereo_centers": 0
      },
      "unii": "M876330O56"
    }
  ]
}