{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "79d981ca-88a5-44db-8b6c-6d2509870fe3",
          "code": "33570-04-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=33570-04-6",
          "code_system": "CAS",
          "references": [
            "d84fba0f-87b7-4b86-817c-8cc9698081cf",
            "36843612-92fb-4630-8f26-1a27e9de21c9"
          ]
        },
        {
          "uuid": "112a45d5-257c-4d5e-aadd-05beb9877884",
          "code": "BILOBALIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Bilobalide",
          "code_system": "WIKIPEDIA",
          "references": [
            "d84fba0f-87b7-4b86-817c-8cc9698081cf"
          ]
        },
        {
          "uuid": "060fad92-85ea-4ef0-b361-d93f66313ad4",
          "code": "m2494",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2494?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d84fba0f-87b7-4b86-817c-8cc9698081cf"
          ]
        },
        {
          "uuid": "98a6c6f1-377b-4b33-b224-f980aecc2d6a",
          "code": "SUB184976",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "d84fba0f-87b7-4b86-817c-8cc9698081cf"
          ]
        },
        {
          "uuid": "48edb279-c446-43c0-9e29-79a48abde82c",
          "code": "73581",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/73581",
          "code_system": "PUBCHEM",
          "references": [
            "d84fba0f-87b7-4b86-817c-8cc9698081cf"
          ]
        },
        {
          "uuid": "d4827eff-aa00-4fac-9e13-7a391cf10270",
          "code": "M81D2O8H7U",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8d1fb7a0-23a8-f11e-01c3-2a5189a176d9",
          "code": "100000170820",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a45f7327-d492-d595-d64d-ba13fb05b1ce"
          ]
        },
        {
          "uuid": "14a86a75-8313-4352-bea0-5e500ed49ac9",
          "code": "DTXSID10873207",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10873207",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "610b010a-a74d-4217-9a81-a3116a1493e2",
          "name": "(-)-BILOBALIDE",
          "stdName": "(-)-BILOBALIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3050ce3-6fc6-4903-a853-e61d4039f59a"
          ],
          "display_name": false
        },
        {
          "uuid": "e4e99b12-f72e-476c-b210-b19d5b259242",
          "name": "4H,5AH,9H-FURO(2,3-B)FURO(3',2':2,3)CYCLOPENTA(1,2-C)FURAN-2,4,7(3H,8H)-TRIONE, 9-(1,1-DIMETHYLETHYL)-10,10A-DIHYDRO-8,9-DIHYDROXY-, (3AS,5AR,8R,8AS,9R,10AS)-",
          "stdName": "4H,5AH,9H-FURO(2,3-B)FURO(3',2':2,3)CYCLOPENTA(1,2-C)FURAN-2,4,7(3H,8H)-TRIONE, 9-(1,1-DIMETHYLETHYL)-10,10A-DIHYDRO-8,9-DIHYDROXY-, (3AS,5AR,8R,8AS,9R,10AS)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3050ce3-6fc6-4903-a853-e61d4039f59a"
          ],
          "display_name": false
        },
        {
          "uuid": "5f76e684-3db6-472c-9189-a926d21ecd41",
          "name": "BILOBALID",
          "stdName": "BILOBALID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3050ce3-6fc6-4903-a853-e61d4039f59a"
          ],
          "display_name": false
        },
        {
          "uuid": "3de71ccd-db11-44e8-ac6f-c7df483ad27d",
          "name": "BILOBALIDE",
          "stdName": "BILOBALIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e922e7d8-a46a-4c9f-a2a4-8f8de0694795",
            "3f2883c2-d96d-4862-85a1-e07f3a4df9c7",
            "17379e4b-3770-401a-ac34-cefaf8bb6adb"
          ],
          "display_name": true
        },
        {
          "uuid": "29cdeb45-2e49-4c85-8f1d-11a1df5b45c4",
          "name": "BILOBALIDE (CONSTITUENT OF GINKGO) [DSC]",
          "stdName": "BILOBALIDE (CONSTITUENT OF GINKGO) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9ddc171c-e60b-4f93-85f0-749127192e8f"
          ],
          "display_name": false
        },
        {
          "uuid": "0cb1d90d-b542-421f-b949-44eb3d1732b4",
          "name": "BILOBALIDE [MI]",
          "stdName": "BILOBALIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e922e7d8-a46a-4c9f-a2a4-8f8de0694795"
          ],
          "display_name": false
        },
        {
          "uuid": "80435f0c-6dd9-ece6-1d19-3553600d9170",
          "name": "Bilobalide [WHO-DD]",
          "stdName": "BILOBALIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8a15f8e-3393-7e33-bd00-c9cdf02ae302"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3f2883c2-d96d-4862-85a1-e07f3a4df9c7",
          "citation": "SWISS MEDIC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c3050ce3-6fc6-4903-a853-e61d4039f59a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9ddc171c-e60b-4f93-85f0-749127192e8f",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e922e7d8-a46a-4c9f-a2a4-8f8de0694795",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d84fba0f-87b7-4b86-817c-8cc9698081cf",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391865000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5d021132-0127-45c0-b395-723083daa4de",
          "citation": "SRS import [M81D2O8H7U]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=M81D2O8H7U",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391865000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1561d6f0-3d52-4a89-a423-a20bc8a1687d",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "17379e4b-3770-401a-ac34-cefaf8bb6adb",
          "citation": "BILOBALIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c8a15f8e-3393-7e33-bd00-c9cdf02ae302",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "36843612-92fb-4630-8f26-1a27e9de21c9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a45f7327-d492-d595-d64d-ba13fb05b1ce",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9204ef70-b7df-47b6-9a44-1a3da3a5052f",
          "id": "9204ef70-b7df-47b6-9a44-1a3da3a5052f",
          "molfile": "\n  Marvin  01132107342D          \n\n 23 26  0  0  1  0            999 V2000\n    8.6418   -4.2446    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.3544   -3.8345    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1597   -4.6243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9568   -4.4119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8861   -5.4099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1241   -5.2398    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.4568   -5.7270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7898   -5.2395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0725   -5.6545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0424   -4.4587    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.3754   -4.9413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7083   -4.4587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9109   -4.6711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9609   -3.6728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7898   -3.6728    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.4571   -3.1855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1243   -3.6730    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.7839   -3.1852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1243   -2.8480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2581   -2.4291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9057   -2.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9759   -1.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8668   -4.4587    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 23  1  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  6  5  1  1  0  0  0\n  6  7  1  0  0  0  0\n 23  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  8  1  0  0  0  0\n 10 11  1  1  0  0  0\n 15 10  1  0  0  0  0\n 10 23  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  1  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  6  0  0  0\n 17 19  1  0  0  0  0\n 23 17  1  6  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 19 22  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)[C@@]1(C[C@H]2[C@@]3(CC(=O)O2)C(=O)O[C@H]4[C@]31[C@H](C(=O)O4)O)O",
          "formula": "C15H18O8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7a953d6b-df9f-4c39-b736-9c74db410632"
          },
          "defined_stereo": 6,
          "ez_centers": 0,
          "molecular_weight": "326.2992",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 6
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0ae04cae-b0a8-43e8-aa9d-d355043e09e9",
      "version": "8",
      "structure": {
        "id": "525ad846-9d4c-43d5-b1bb-a81a969decd5",
        "molfile": "\n  Marvin  01132104172D          \n\n 25 28  0  0  1  0            999 V2000\n    6.3740   -4.9403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0410   -4.4577    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.7884   -3.6720    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.9597   -3.6720    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7071   -4.4577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9099   -4.6701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4555   -3.1849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1225   -3.6722    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.8652   -4.4577    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.1223   -5.2388    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.4552   -5.7258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7884   -5.2385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0713   -5.6533    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8843   -5.4087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1577   -4.6233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6400   -4.2438    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.3524   -3.8337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9548   -4.4109    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3347   -6.0360    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7821   -3.1846    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1225   -2.8474    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.2565   -2.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9039   -2.1229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9743   -1.7405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3738   -2.9549    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  3  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  6  0  0  0\n  2  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n  2 12  1  6  0  0  0\n 12 13  2  0  0  0  0\n 10 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n  9 16  1  0  0  0  0\n 16 17  1  1  0  0  0\n 15 18  2  0  0  0  0\n 10 19  1  6  0  0  0\n  8 20  1  6  0  0  0\n  8 21  1  1  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 21 24  1  0  0  0  0\n  3 25  1  6  0  0  0\nM  END",
        "smiles": "CC(C)(C)[C@@]1(C[C@@]2([H])[C@@]3(CC(=O)O2)C(=O)O[C@@]4([H])[C@]31[C@H](C(=O)O4)O)O",
        "formula": "C15H18O8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 6,
        "ez_centers": 0,
        "molecular_weight": "326.2992",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "5d021132-0127-45c0-b395-723083daa4de",
          "1561d6f0-3d52-4a89-a423-a20bc8a1687d"
        ],
        "stereo_centers": 6
      },
      "unii": "M81D2O8H7U"
    }
  ]
}