{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "012b6bbb-ace3-4157-8100-5d67f591744b",
          "code": "68345-22-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=68345-22-2",
          "code_system": "CAS",
          "references": [
            "c9a0656b-7f01-4cf0-926a-8e186474adbd",
            "338476bc-91ed-4ebf-920f-764f6162e560"
          ]
        },
        {
          "uuid": "e7d69156-8725-4546-96c9-587066a6bc17",
          "code": "269-851-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.063.481",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c9a0656b-7f01-4cf0-926a-8e186474adbd"
          ]
        },
        {
          "uuid": "ba0857d6-8a62-4607-9059-a3fa036fb390",
          "code": "71544",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71544",
          "code_system": "PUBCHEM",
          "references": [
            "c9a0656b-7f01-4cf0-926a-8e186474adbd"
          ]
        },
        {
          "uuid": "439c9cf8-2963-562a-c15e-a1f86b2f27e7",
          "code": "DTXSID2071441",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2071441",
          "code_system": "EPA CompTox",
          "references": [
            "e24da866-4327-756e-b201-439a62f26d37"
          ]
        },
        {
          "uuid": "99b24016-0473-4c55-8cc3-c35f96d6793e",
          "code": "M7DD3LIZ6U",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "14b267e5-bfc6-cf8b-2b60-ecc5bb182ad5",
          "code": "939",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/939/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "0ddcf534-d346-861c-52cd-b1c0669dfb0d"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e81fd6cb-4106-4223-bbce-b7d1867a9fea",
          "name": "(2,2-BIS(2-METHYLPROPOXY)ETHYL)BENZENE",
          "stdName": "(2,2-BIS(2-METHYLPROPOXY)ETHYL)BENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a34b8ca-12d8-4c84-ac1f-be5a3ff20af1"
          ],
          "display_name": false
        },
        {
          "uuid": "50e72c9f-9001-4b91-ad46-049f3872c95b",
          "name": "1,1-DIISOBUTOXY-2-PHENYLETHANE",
          "stdName": "1,1-DIISOBUTOXY-2-PHENYLETHANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a34b8ca-12d8-4c84-ac1f-be5a3ff20af1"
          ],
          "display_name": false
        },
        {
          "uuid": "d9b33392-f47a-478f-bb12-92bc0daad261",
          "name": "BENZENE, (2,2-BIS(2-METHYLPROPOXY)ETHYL)-",
          "stdName": "BENZENE, (2,2-BIS(2-METHYLPROPOXY)ETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a34b8ca-12d8-4c84-ac1f-be5a3ff20af1"
          ],
          "display_name": false
        },
        {
          "uuid": "2bae54db-4d0f-4787-85e0-378431dfe392",
          "name": "FEMA NO. 3384",
          "stdName": "FEMA NO. 3384",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d5c3180-c2f2-4280-ab2b-20435d2dbe40",
            "1ec5f121-b2fa-442d-be23-ea5eb877c8db"
          ],
          "display_name": false
        },
        {
          "uuid": "452cd03c-bae4-436e-9f07-9d62683568ca",
          "name": "PHENYL ACETALDEHYDE DIISOBUTYL ACETAL",
          "stdName": "PHENYL ACETALDEHYDE DIISOBUTYL ACETAL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe1a92ca-94e6-4551-befa-0268590ae53b"
          ],
          "display_name": true
        },
        {
          "uuid": "1d942bfb-7f16-4f09-8f1f-2cfe45e54c1d",
          "name": "PHENYLACETALDEHYDE DIISOBUTYL ACETAL",
          "stdName": "PHENYLACETALDEHYDE DIISOBUTYL ACETAL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e122e5d0-043b-4651-9151-aa19e4862a9a",
            "3ee909c9-5056-4fcc-b1b9-47f58001cdec",
            "056e2d89-210f-46ff-add0-1305e7ea40f6"
          ],
          "display_name": false
        },
        {
          "uuid": "26174c1d-7265-46f2-b49a-590fd47ab695",
          "name": "PHENYLACETALDEHYDE DIISOBUTYL ACETAL [FHFI]",
          "stdName": "PHENYLACETALDEHYDE DIISOBUTYL ACETAL [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ee909c9-5056-4fcc-b1b9-47f58001cdec"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1ec5f121-b2fa-442d-be23-ea5eb877c8db",
          "citation": "CHEMID FEMA BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8d5c3180-c2f2-4280-ab2b-20435d2dbe40",
          "citation": "CHEMID BATCH 2010",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe1a92ca-94e6-4551-befa-0268590ae53b",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a34b8ca-12d8-4c84-ac1f-be5a3ff20af1",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3ee909c9-5056-4fcc-b1b9-47f58001cdec",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "056e2d89-210f-46ff-add0-1305e7ea40f6",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c9a0656b-7f01-4cf0-926a-8e186474adbd",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390979000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01ccf1e1-3575-4901-9b35-b31c752535bf",
          "citation": "SRS import [M7DD3LIZ6U]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=M7DD3LIZ6U",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390979000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d1a6ca60-a2a9-4162-8367-6230d445a5a5",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e122e5d0-043b-4651-9151-aa19e4862a9a",
          "citation": "PHENYLACETALDEHYDE DIISOBUTYL ACETAL [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e24da866-4327-756e-b201-439a62f26d37",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=68345-22-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "338476bc-91ed-4ebf-920f-764f6162e560",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0ddcf534-d346-861c-52cd-b1c0669dfb0d",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bde86ef8-0565-4730-9aa9-63b482789743",
          "id": "bde86ef8-0565-4730-9aa9-63b482789743",
          "molfile": "\n  Marvin  01132109492D          \n\n 18 18  0  0  0  0            999 V2000\n    9.3141   -3.6703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5307   -3.3532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5307   -2.5698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7101   -3.6703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7101   -4.5655    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9548   -5.0691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9548   -5.8800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6682   -6.2906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6682   -7.1204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3814   -7.5310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0968   -7.1178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0968   -6.2891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3815   -5.8780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2041   -4.5981    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2041   -3.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4767   -3.4184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4767   -2.6957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7073   -3.7261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 14  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 13  8  2  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\nM  END",
          "smiles": "CC(C)COC(Cc1ccccc1)OCC(C)C",
          "formula": "C16H26O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ff173941-9e6b-46df-a2f8-a5e6b8215bdb"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "250.377",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4df43fa5-9633-40e5-8979-47fbb72c79c4",
      "version": "4",
      "structure": {
        "id": "fab71094-cdb3-48e8-9d29-62b4c1415f99",
        "molfile": "\n  Marvin  01132112592D          \n\n 18 18  0  0  0  0            999 V2000\n    6.9548   -5.8800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9548   -5.0691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7101   -4.5655    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7101   -3.6703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5307   -3.3532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3141   -3.6703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5307   -2.5698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2041   -4.5981    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2041   -3.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4767   -3.4184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4767   -2.6957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7073   -3.7261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6682   -6.2906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6682   -7.1204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3814   -7.5310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0968   -7.1178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0968   -6.2891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3815   -5.8780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  2  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n  1 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 13  1  0  0  0  0\nM  END",
        "smiles": "CC(C)COC(Cc1ccccc1)OCC(C)C",
        "formula": "C16H26O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "250.377",
        "optical_activity": "NONE",
        "references": [
          "01ccf1e1-3575-4901-9b35-b31c752535bf",
          "d1a6ca60-a2a9-4162-8367-6230d445a5a5"
        ],
        "stereo_centers": 0
      },
      "unii": "M7DD3LIZ6U"
    }
  ]
}