{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8ca8e589-b05b-4be4-ab30-29091ea0da7b",
          "code": "498-40-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=498-40-8",
          "code_system": "CAS",
          "references": [
            "57c99697-68c8-424f-8b0e-ca0e2d12339d",
            "ea9a4112-c9bb-4256-a1ef-8b6c456bdda9"
          ]
        },
        {
          "uuid": "1041365d-31fb-45f7-aab9-41d3ed272593",
          "code": "207-861-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.148",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "57c99697-68c8-424f-8b0e-ca0e2d12339d"
          ]
        },
        {
          "uuid": "2f536ce1-38e9-41dd-a8b9-b9a3e518f11a",
          "code": "72886",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/72886",
          "code_system": "PUBCHEM",
          "references": [
            "57c99697-68c8-424f-8b0e-ca0e2d12339d"
          ]
        },
        {
          "uuid": "adde3268-f4cb-a3e9-98b4-469502c923d8",
          "code": "Cysteic acid",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Cysteic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "6dfe6b45-3720-6569-f53a-941d0f9d86dd"
          ]
        },
        {
          "uuid": "14d57ec4-0cdf-b96c-272f-d5c1a137fd46",
          "code": "DTXSID7075424",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7075424",
          "code_system": "EPA CompTox",
          "references": [
            "817f439e-0011-6f8b-2b85-cdbf83f8ceb1"
          ]
        },
        {
          "uuid": "189853a6-684a-e385-72ff-daa4f0f935d8",
          "code": "DB03661",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB03661",
          "code_system": "DRUG BANK",
          "references": [
            "85f4ac72-12d4-b784-2c1c-7422136fa01d"
          ]
        },
        {
          "uuid": "be7d36bb-be49-4f4c-ab2e-4df851830a92",
          "code": "M6W2DJ6N5K",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c97343c6-d092-43b0-e482-3c08ecea9f90",
          "code": "17285",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17285",
          "code_system": "CHEBI",
          "references": [
            "85f4ac72-12d4-b784-2c1c-7422136fa01d"
          ]
        },
        {
          "uuid": "cd4a54eb-c2b3-3fc4-dfc8-0f2002d219d4",
          "code": "M6W2DJ6N5K",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=M6W2DJ6N5K",
          "code_system": "DAILYMED",
          "references": [
            "94229c16-ea5e-ba83-0483-e64fcf194c3e"
          ]
        },
        {
          "uuid": "b0f32013-709b-b396-4d36-f994a766f020",
          "code": "254030",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=254030",
          "code_system": "NSC",
          "references": [
            "104d5a53-857b-28a4-36d0-51b16fdae023"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "c2d57e00-3331-fd41-fdd8-6f4cfaf240a1",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "ea9a4112-c9bb-4256-a1ef-8b6c456bdda9"
          ],
          "related_substance": {
            "uuid": "756e0ef4-022a-4024-bd05-4927f32cc8e6",
            "refuuid": "e82094dc-b77f-427a-8621-2b723ab92285",
            "name": "CYSTEIC ACID MONOHYDRATE, L-",
            "unii": "VN8X20T18R",
            "linking_id": "VN8X20T18R",
            "ref_pname": "CYSTEIC ACID MONOHYDRATE, L-"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c429d4bb-b03d-4b53-aea9-c53488fb7d00",
          "name": "ALANINE, 3-SULFO-, L-",
          "stdName": "ALANINE, 3-SULFO-, L-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b64d85f-c160-4fe2-8dad-b4986a09efb7",
            "10fca930-181b-4af7-9fcd-5841587d0290"
          ],
          "display_name": false
        },
        {
          "uuid": "faaddf91-8209-4a96-8ce8-5a7e8e536160",
          "name": "CYSTEIC ACID",
          "stdName": "CYSTEIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "958f53bc-ee9a-4043-804e-ea67fc87d0c7",
            "fe5a1c79-6378-498c-8d1b-edc9dff10fcb",
            "9b64d85f-c160-4fe2-8dad-b4986a09efb7"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b4b5b1a5-1add-4009-aa11-8b90eb3e32bb",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "ab77de0f-8692-4ec7-9efc-6a0e816317e2",
          "name": "CYSTEIC ACID, (+)-",
          "stdName": "CYSTEIC ACID, (+)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cab48b78-958d-43a9-b2f3-ac26929f886d",
            "9b64d85f-c160-4fe2-8dad-b4986a09efb7"
          ],
          "display_name": false
        },
        {
          "uuid": "ea430626-31e4-48ef-93e2-374aba0fcaef",
          "name": "CYSTEIC ACID, L-",
          "stdName": "CYSTEIC ACID, L-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cab48b78-958d-43a9-b2f3-ac26929f886d"
          ],
          "display_name": true
        },
        {
          "uuid": "0d0ddefa-058b-4c1f-8ca0-b18bdd57d637",
          "name": "CYSTEINESULFONATE",
          "stdName": "CYSTEINESULFONATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b64d85f-c160-4fe2-8dad-b4986a09efb7",
            "10fca930-181b-4af7-9fcd-5841587d0290"
          ],
          "display_name": false
        },
        {
          "uuid": "d3d7ce8e-305f-40d0-8dde-1423ec10d9a7",
          "name": "CYSTEINESULFONIC ACID",
          "stdName": "CYSTEINESULFONIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b64d85f-c160-4fe2-8dad-b4986a09efb7",
            "10fca930-181b-4af7-9fcd-5841587d0290"
          ],
          "display_name": false
        },
        {
          "uuid": "564088b4-74bc-4664-a8fd-6dd10a6fb109",
          "name": "L-CYSTEIC ACID",
          "stdName": "L-CYSTEIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2998d8c2-ef69-42ce-b3ac-5f762fed32d5",
            "e5846f3c-c1eb-4593-bd31-663355914bdf",
            "9b64d85f-c160-4fe2-8dad-b4986a09efb7",
            "10fca930-181b-4af7-9fcd-5841587d0290"
          ],
          "display_name": false
        },
        {
          "uuid": "88bde78d-5d65-44ed-95c2-5271ef64324e",
          "name": "L-CYSTEIC ACID [MI]",
          "stdName": "L-CYSTEIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2998d8c2-ef69-42ce-b3ac-5f762fed32d5",
            "9b64d85f-c160-4fe2-8dad-b4986a09efb7"
          ],
          "display_name": false
        },
        {
          "uuid": "2e50db2e-0e58-4272-9e1b-4ea8725505c6",
          "name": "NSC-254030",
          "stdName": "NSC-254030",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b64d85f-c160-4fe2-8dad-b4986a09efb7",
            "10fca930-181b-4af7-9fcd-5841587d0290"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "cab48b78-958d-43a9-b2f3-ac26929f886d",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "958f53bc-ee9a-4043-804e-ea67fc87d0c7",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b64d85f-c160-4fe2-8dad-b4986a09efb7",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10fca930-181b-4af7-9fcd-5841587d0290",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2998d8c2-ef69-42ce-b3ac-5f762fed32d5",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57c99697-68c8-424f-8b0e-ca0e2d12339d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391763000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e06f7db0-8fff-4aff-8f8a-64890cb45fb8",
          "citation": "SRS import [M6W2DJ6N5K]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=M6W2DJ6N5K",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391763000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "59e79693-04c9-4624-88e5-3b99c474049e",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe5a1c79-6378-498c-8d1b-edc9dff10fcb",
          "citation": "CYSTEIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e5846f3c-c1eb-4593-bd31-663355914bdf",
          "citation": "L-CYSTEIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6dfe6b45-3720-6569-f53a-941d0f9d86dd",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Lithium_hydroxide",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "817f439e-0011-6f8b-2b85-cdbf83f8ceb1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=498-40-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "85f4ac72-12d4-b784-2c1c-7422136fa01d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ea9a4112-c9bb-4256-a1ef-8b6c456bdda9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "104d5a53-857b-28a4-36d0-51b16fdae023",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "94229c16-ea5e-ba83-0483-e64fcf194c3e",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "7cf53659-cd14-4896-80f2-4065ae5a1c0c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6a92242c-9473-487a-91f5-e68406a142c3",
          "id": "6a92242c-9473-487a-91f5-e68406a142c3",
          "molfile": "\n  Marvin  01132105322D          \n\n 10  9  0  0  1  0            999 V2000\n    6.3257   -5.1847    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.5435   -5.9817    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9142   -4.6008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7112   -4.8094    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5082   -5.0225    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9243   -4.0124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4979   -5.6110    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5379   -4.9762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9587   -5.5601    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3248   -4.1838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  8  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  2  0  0  0  0\n  7  4  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\nM  END",
          "smiles": "C([C@@H](C(=O)O)N)S(=O)(=O)O",
          "formula": "C3H7NO5S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2d8fdda8-baf6-4478-9ba8-dde7265ef997"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "169.1576",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f4dc0783-81a5-40bf-a9db-1271325635af",
      "version": "12",
      "structure": {
        "id": "557bb922-8531-46c5-bc41-a6eaf332a9d0",
        "molfile": "\n  Marvin  01132104272D          \n\n 10  9  0  0  1  0            999 V2000\n    7.7112   -4.8094    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9142   -4.6008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3257   -5.1847    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.5379   -4.9762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9587   -5.5601    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3248   -4.1838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5435   -5.9817    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9243   -4.0124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4979   -5.6110    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5082   -5.0225    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  4  1  0  0  0  0\n  3  7  1  6  0  0  0\n  8  1  2  0  0  0  0\n  9  1  2  0  0  0  0\n 10  1  1  0  0  0  0\nM  END",
        "smiles": "C([C@@H](C(=O)O)N)S(=O)(=O)O",
        "formula": "C3H7NO5S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "169.1576",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "e06f7db0-8fff-4aff-8f8a-64890cb45fb8",
          "59e79693-04c9-4624-88e5-3b99c474049e"
        ],
        "stereo_centers": 1
      },
      "unii": "M6W2DJ6N5K"
    }
  ]
}