{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f8a29c44-8e7f-41e7-969a-2beb3c84fb66",
          "code": "950782-86-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=950782-86-2",
          "code_system": "CAS",
          "references": [
            "b84c7e74-b473-4474-866e-acd58012e519",
            "d4bbc8c8-5ed6-42c5-bc0c-95db0e1a89de"
          ]
        },
        {
          "uuid": "254fd5e8-9fc7-4038-9af6-e319b9b4bfc0",
          "code": "44146693",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44146693",
          "code_system": "PUBCHEM",
          "references": [
            "b84c7e74-b473-4474-866e-acd58012e519"
          ]
        },
        {
          "uuid": "1fba8948-39e8-bf88-38cc-58ce3af4dadb",
          "code": "DTXSID0058223",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0058223",
          "code_system": "EPA CompTox",
          "references": [
            "329eb1b9-8e7a-f648-65c8-92b3d014e10d"
          ]
        },
        {
          "uuid": "4c323516-4c78-4226-9026-7c81fbf9c784",
          "code": "M64ZDU291E",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3d993951-30f8-f964-22d9-168c8dd3fdfe",
          "code": "Indaziflam",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Indaziflam",
          "code_system": "WIKIPEDIA",
          "references": [
            "b7524aa4-2797-00ca-933b-6e6175c0ed16"
          ]
        },
        {
          "uuid": "184e2a5c-2ae2-e4ad-9160-240e0cc5360e",
          "code": "indaziflam",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/indaziflam.html",
          "code_system": "ALANWOOD",
          "references": [
            "7c15134f-8bed-08e3-5591-b0be659c0286"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "35f415e4-56dc-4338-a198-5421c1107f03",
          "name": "1,3,5-TRIAZINE-2,4-DIAMINE, N2-((1R,2S)-2,3-DIHYDRO-2,6-DIMETHYL-1H-INDEN-1-YL)-6-(1-FLUOROETHYL)-",
          "stdName": "1,3,5-TRIAZINE-2,4-DIAMINE, N2-((1R,2S)-2,3-DIHYDRO-2,6-DIMETHYL-1H-INDEN-1-YL)-6-(1-FLUOROETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af773794-56eb-4505-92b6-b85602ecd4e5",
            "5c7b5877-bc9b-4df1-9ef7-0c310b3abb44"
          ],
          "display_name": false
        },
        {
          "uuid": "05749f10-b37e-49dd-af2c-efd3d9238079",
          "name": "INDAZIFLAM",
          "stdName": "INDAZIFLAM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af773794-56eb-4505-92b6-b85602ecd4e5",
            "0e86e7b0-42be-413b-b275-bef7ca557c5c",
            "60d901fc-cfc9-4b70-9a83-304e41947f40",
            "0ad4107e-d126-43f5-9d18-297b9a7aa986"
          ],
          "display_name": true
        },
        {
          "uuid": "1bafca34-cb73-477c-adcd-816115ae4ba1",
          "name": "INDAZIFLAM [ISO]",
          "stdName": "INDAZIFLAM [ISO]",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0e86e7b0-42be-413b-b275-bef7ca557c5c",
            "af773794-56eb-4505-92b6-b85602ecd4e5"
          ],
          "display_name": false
        },
        {
          "uuid": "0b52b42e-fdcd-4072-a1e9-c461ec517f16",
          "name": "N2-((1R,2S)-2,3-DIHYDRO-2,6-DIMETHYL-1H-INDEN-1-YL)-6-((1RS)-1-FLUOROETHYL)-1,3,5-TRIAZINE-2,4-DIAMINE",
          "stdName": "N2-((1R,2S)-2,3-DIHYDRO-2,6-DIMETHYL-1H-INDEN-1-YL)-6-((1RS)-1-FLUOROETHYL)-1,3,5-TRIAZINE-2,4-DIAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af773794-56eb-4505-92b6-b85602ecd4e5",
            "58a96236-eb5e-4bfa-b502-955c6cf01a01"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0ad4107e-d126-43f5-9d18-297b9a7aa986",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "af773794-56eb-4505-92b6-b85602ecd4e5",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c7b5877-bc9b-4df1-9ef7-0c310b3abb44",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "58a96236-eb5e-4bfa-b502-955c6cf01a01",
          "citation": "http://www.alanwood.net/pesticides/indaziflam.html",
          "url": "http://www.alanwood.net/pesticides/indaziflam.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e86e7b0-42be-413b-b275-bef7ca557c5c",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b84c7e74-b473-4474-866e-acd58012e519",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392245000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a9ec2b7c-e69c-44ff-9118-af3f43dba9a3",
          "citation": "SRS import [M64ZDU291E]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=M64ZDU291E",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392245000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60d901fc-cfc9-4b70-9a83-304e41947f40",
          "citation": "INDAZIFLAM [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "329eb1b9-8e7a-f648-65c8-92b3d014e10d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=950782-86-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b7524aa4-2797-00ca-933b-6e6175c0ed16",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "7c15134f-8bed-08e3-5591-b0be659c0286",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "d4bbc8c8-5ed6-42c5-bc0c-95db0e1a89de",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6b5fe92f-ce10-45ba-9514-338257fff1dc",
          "id": "6b5fe92f-ce10-45ba-9514-338257fff1dc",
          "molfile": "\n  Marvin  01132105352D          \n\n 22 24  0  0  1  0            999 V2000\n    9.7972   -2.7697    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   10.5818   -2.5148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1298   -2.2848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4624   -2.7697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6554   -2.5982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1034   -3.2113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3584   -3.9959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8063   -4.6090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1653   -4.1674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7173   -3.5544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5423   -3.5544    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   10.0272   -4.2218    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6917   -4.9754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8712   -5.0617    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5357   -5.8154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7151   -5.9016    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0206   -6.4828    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8410   -6.3965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1766   -5.6429    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3260   -7.0640    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   11.1464   -6.9777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9904   -7.8176    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 11  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n 10  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  1  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 19  2  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\nM  END",
          "smiles": "Cc1ccc2C[C@H](C)[C@H](c2c1)Nc3nc(C(C)F)nc(N)n3",
          "formula": "C16H20FN5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "05edf850-fe31-428a-8821-578e08f3f34d"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "301.3625",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e8aad7f0-2703-4f9e-9b48-335a7714dc1a",
      "version": "5",
      "structure": {
        "id": "03f8df4c-0704-4259-9e03-9ed62295dc71",
        "molfile": "\n  Marvin  01132100302D          \n\n 22 24  0  0  1  0            999 V2000\n   10.0272   -4.2218    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5423   -3.5544    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.7972   -2.7697    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.5818   -2.5148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1298   -2.2848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4624   -2.7697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6554   -2.5982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1034   -3.2113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3584   -3.9959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8063   -4.6090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1653   -4.1674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7173   -3.5544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6917   -4.9754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8712   -5.0617    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5357   -5.8154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7151   -5.9016    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0206   -6.4828    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8410   -6.3965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3260   -7.0640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9904   -7.8176    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1464   -6.9777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1766   -5.6429    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  6  0  0  0\n  3  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  2  0  0  0  0\n 12  6  1  0  0  0  0\n  2 12  1  0  0  0  0\n  1 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 22 18  2  0  0  0  0\n 13 22  1  0  0  0  0\nM  END",
        "smiles": "Cc1ccc2C[C@H](C)[C@H](c2c1)Nc3nc(C(C)F)nc(N)n3",
        "formula": "C16H20FN5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "EPIMERIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "301.3625",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "a9ec2b7c-e69c-44ff-9118-af3f43dba9a3",
          "5c7b5877-bc9b-4df1-9ef7-0c310b3abb44"
        ],
        "stereo_centers": 3
      },
      "unii": "M64ZDU291E"
    }
  ]
}