{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "fa56cd27-fe53-49e5-97a2-cbe523489370", "code": "1186040-97-0", "type": "SUPERSEDED", "url": "https://commonchemistry.cas.org/detail?cas_rn=1186040-97-0", "code_system": "CAS", "references": [ "b7f3895b-234e-4a0f-af72-d2b71d9d5288" ] }, { "uuid": "2d40259d-a7f6-43e8-99a4-75ace528e600", "code": "1185583-20-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1185583-20-3", "code_system": "CAS", "references": [ "b7f3895b-234e-4a0f-af72-d2b71d9d5288" ] }, { "uuid": "d673dd90-c1d9-4970-83ac-0b44032f0771", "code": "M64U5B3AEX", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "947fd6e9-20a3-15c2-9aba-f2e4e1a6beca", "code": "44200646", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44200646", "code_system": "PUBCHEM", "references": [ "c28d9537-b1c7-715e-b713-283f90bf000f" ] } ], "substance_class": "chemical", "names": [ { "uuid": "0a19ba7a-3937-4798-86ce-a0045078829c", "name": "1: PN: WO2014043009 PAGE: 44 claimed sequence", "stdName": "1: PN: WO2014043009 PAGE: 44 CLAIMED SEQUENCE", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "b7f3895b-234e-4a0f-af72-d2b71d9d5288" ], "display_name": false }, { "uuid": "804b331d-dea0-4ad6-89b9-744a33372a7b", "name": "Chronolux", "stdName": "CHRONOLUX", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "b7f3895b-234e-4a0f-af72-d2b71d9d5288" ], "display_name": false }, { "uuid": "5b7549c8-2b58-4b0a-9b3f-4a3824e846ce", "name": "L-Prolinamide, L-seryl-L-threonyl-", "stdName": "L-PROLINAMIDE, L-SERYL-L-THREONYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "b7f3895b-234e-4a0f-af72-d2b71d9d5288" ], "display_name": false }, { "uuid": "76c55d91-3d43-41af-8aad-11e719b2c91f", "name": "L-Seryl-L-threonyl-L-prolinamide", "stdName": "L-SERYL-L-THREONYL-L-PROLINAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "b7f3895b-234e-4a0f-af72-d2b71d9d5288" ], "display_name": false }, { "uuid": "a93abddb-1ddc-41bf-8bdd-5190bcb23971", "name": "Tripeptide-32", "stdName": "TRIPEPTIDE-32", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b7f3895b-234e-4a0f-af72-d2b71d9d5288" ], "display_name": true } ], "references": [ { "uuid": "b7f3895b-234e-4a0f-af72-d2b71d9d5288", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "c28d9537-b1c7-715e-b713-283f90bf000f", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "30fef68e-c45c-46d8-8c21-d10131d5aec3", "id": "30fef68e-c45c-46d8-8c21-d10131d5aec3", "molfile": "\n CDK 02022416282D\n\n 21 21 0 0 1 0 0 0 0 0999 V2000\n 17.5671 -4.1666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2161 -4.9466 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 20.2532 -7.2789 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 21.6150 -6.5067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2257 -9.1455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6216 -9.7114 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.0695 -11.1956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.5671 -7.2789 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8226 -7.7491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9956 -10.2804 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 22.9084 -7.2789 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9183 -6.5067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8541 -7.2789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5085 -6.5067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8922 -8.8273 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1281 -9.7632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9183 -4.9466 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6195 -11.2254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9013 -4.2145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2161 -6.5067 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 20.2532 -8.8655 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 20 1 0 0 0 0\n 2 19 1 0 0 0 0\n 2 1 1 1 0 0 0\n 3 4 1 0 0 0 0\n 20 8 1 6 0 0 0\n 6 5 1 1 0 0 0\n 13 14 2 0 0 0 0\n 13 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 6 7 1 0 0 0 0\n 13 20 1 0 0 0 0\n 16 18 1 0 0 0 0\n 5 9 2 0 0 0 0\n 12 17 2 0 0 0 0\n 5 10 1 0 0 0 0\n 8 12 1 0 0 0 0\n 3 21 1 6 0 0 0\n 4 11 1 0 0 0 0\n 6 15 1 0 0 0 0\n 3 12 1 0 0 0 0\n 7 18 1 0 0 0 0\nM END", "smiles": "C[C@H]([C@@H](C(=O)N1CCC[C@H]1C(=O)N)NC(=O)[C@H](CO)N)O", "formula": "C12H22N4O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "96008361-6d41-4115-8c39-6ae4b7d7b41a" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "302.3274", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "df0364f0-6b03-4c45-a17a-dab8171e841e", "version": "3", "structure": { "id": "02ac8cca-c77e-4d91-bcca-bc9deace9a77", "molfile": "\n JSDraw202022416282D\n\n 21 21 0 0 1 0 0 V2000\n 17.5671 -4.1666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2161 -4.9466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2532 -7.2789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6150 -6.5067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2257 -9.1455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6216 -9.7114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0695 -11.1956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.5671 -7.2789 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8226 -7.7491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9956 -10.2804 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 22.9084 -7.2789 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9183 -6.5067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8541 -7.2789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5085 -6.5067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8922 -8.8273 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1281 -9.7632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9183 -4.9466 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6195 -11.2254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9013 -4.2145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2161 -6.5067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2532 -8.8655 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 20 1 0 0 0 0\n 2 19 1 0 0 0 0\n 2 1 1 1 0 0 0\n 3 4 1 0 0 0 0\n 20 8 1 6 0 0 0\n 6 5 1 1 0 0 0\n 13 14 2 0 0 0 0\n 13 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 6 7 1 0 0 0 0\n 13 20 1 0 0 0 0\n 16 18 1 0 0 0 0\n 5 9 2 0 0 0 0\n 12 17 2 0 0 0 0\n 5 10 1 0 0 0 0\n 8 12 1 0 0 0 0\n 3 21 1 6 0 0 0\n 4 11 1 0 0 0 0\n 6 15 1 0 0 0 0\n 3 12 1 0 0 0 0\n 7 18 1 0 0 0 0\nM END", "smiles": "C[C@H]([C@@H](C(=O)N1CCC[C@H]1C(=O)N)NC(=O)[C@H](CO)N)O", "formula": "C12H22N4O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "302.3274", "optical_activity": "UNSPECIFIED", "references": [ "b7f3895b-234e-4a0f-af72-d2b71d9d5288" ], "stereo_centers": 4 }, "unii": "M64U5B3AEX" } ] }