{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d81df690-cc1f-c8bc-e0d1-f9ea99eab96f",
          "code": "70687128",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/70687128",
          "code_system": "PUBCHEM",
          "references": [
            "2ae9fe0d-b206-cf5c-6366-8dc3811fbef6"
          ]
        },
        {
          "uuid": "48719ccf-0c4d-46e2-bb2e-a32af618b972",
          "code": "103882-51-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=103882-51-5",
          "code_system": "CAS"
        },
        {
          "uuid": "72b661db-2103-4ba7-9199-20271f4482f8",
          "code": "M63B4SGR6F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "9c88f736-ba9e-4a77-93ad-a9720e78eecb",
          "amount": {
            "uuid": "4a3c8906-02f3-413d-b72e-3668b88d34f9"
          },
          "type": "ENANTIOMER->ENANTIOMER",
          "related_substance": {
            "uuid": "c6d21861-132d-4de7-9f85-dd2e86a752c1",
            "refuuid": "86c7fc9a-4738-48af-9e81-cf8fd7f414f7",
            "name": "1,3-BENZODIOXOLYLBUTANAMINE, (S)-",
            "unii": "FB5KVH97AH",
            "linking_id": "FB5KVH97AH",
            "ref_pname": "1,3-BENZODIOXOLYLBUTANAMINE, (S)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "51609b5b-6b22-8c94-8f61-161d284e42a7",
          "amount": {
            "uuid": "fed308b8-f033-ba62-8348-bd7af58e4f6a"
          },
          "type": "RACEMATE->ENANTIOMER",
          "related_substance": {
            "uuid": "8b6c18f0-8f3d-807d-6fd8-6e6cce1d557e",
            "refuuid": "79d0a390-3fb2-4123-9ea5-0ff17da2c69d",
            "name": "1,3-BENZODIOXOLYLBUTANAMINE",
            "unii": "CM58WOT28Y",
            "linking_id": "CM58WOT28Y",
            "ref_pname": "1,3-BENZODIOXOLYLBUTANAMINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b2d89fca-b7bd-06da-2e1e-68b5f9b73882",
          "name": "(αR)-α-Ethyl-1,3-benzodioxole-5-ethanamine",
          "stdName": "(.ALPHA.R)-.ALPHA.-ETHYL-1,3-BENZODIOXOLE-5-ETHANAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b26512e-1fdd-c433-4d4f-da822838c5b0"
          ],
          "display_name": false
        },
        {
          "uuid": "3c366abc-2a3a-7dd6-d5b2-33efdd41e326",
          "name": "1,3-BENZODIOXOLYLBUTANAMINE, (R)-",
          "stdName": "1,3-BENZODIOXOLYLBUTANAMINE, (R)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "884ea80a-b29f-d250-06b9-e9d555e76776"
          ],
          "display_name": true
        },
        {
          "uuid": "cc616ec8-662b-026d-7fa0-87726f206401",
          "name": "1,3-Benzodioxole-5-ethanamine, α-ethyl-, (R)-",
          "stdName": "1,3-BENZODIOXOLE-5-ETHANAMINE, .ALPHA.-ETHYL-, (R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b26512e-1fdd-c433-4d4f-da822838c5b0"
          ],
          "display_name": false
        },
        {
          "uuid": "59c165d1-5108-5b58-6d1f-f6f9282558e8",
          "name": "1,3-Benzodioxole-5-ethanamine, α-ethyl-, (αR)-",
          "stdName": "1,3-BENZODIOXOLE-5-ETHANAMINE, .ALPHA.-ETHYL-, (.ALPHA.R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b26512e-1fdd-c433-4d4f-da822838c5b0"
          ],
          "display_name": false
        },
        {
          "uuid": "db4bc0fa-9484-38e6-0308-c0ea8d814f8e",
          "name": "3,4-methylenedioxy-α-ethylphenethylamine, (R)-",
          "stdName": "3,4-METHYLENEDIOXY-.ALPHA.-ETHYLPHENETHYLAMINE, (R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "884ea80a-b29f-d250-06b9-e9d555e76776"
          ],
          "display_name": false
        },
        {
          "uuid": "21b5e656-e2e1-c1a2-d8cc-70bd833433e3",
          "name": "3,4-methylenedioxybutanphenamine, (R)-",
          "stdName": "3,4-METHYLENEDIOXYBUTANPHENAMINE, (R)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "884ea80a-b29f-d250-06b9-e9d555e76776"
          ],
          "display_name": false
        },
        {
          "uuid": "6b8c1bda-b2c6-3e7e-a6fd-275a6f8d0863",
          "name": "BDB, (R)-",
          "stdName": "BDB, (R)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "884ea80a-b29f-d250-06b9-e9d555e76776"
          ],
          "display_name": false
        },
        {
          "uuid": "27fe96fc-82f9-646c-0719-6cf06cd0ddaf",
          "name": "J (PSYCHEDELIC), (R)-",
          "stdName": "J (PSYCHEDELIC), (R)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "884ea80a-b29f-d250-06b9-e9d555e76776"
          ],
          "display_name": false
        },
        {
          "uuid": "2f9532b9-77b3-440e-9c8e-5fbc939f6943",
          "name": "J, (R)-",
          "stdName": "J, (R)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "884ea80a-b29f-d250-06b9-e9d555e76776"
          ],
          "display_name": false
        },
        {
          "uuid": "81089cf1-2465-865a-ece3-9a04864d7197",
          "name": "MDB, (R)-",
          "stdName": "MDB, (R)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "884ea80a-b29f-d250-06b9-e9d555e76776"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2ae9fe0d-b206-cf5c-6366-8dc3811fbef6",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "884ea80a-b29f-d250-06b9-e9d555e76776",
          "citation": "SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0b26512e-1fdd-c433-4d4f-da822838c5b0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "521ba80b-11a2-4748-954b-dadfa3ccb7f3",
          "id": "521ba80b-11a2-4748-954b-dadfa3ccb7f3",
          "molfile": "\n  Marvin  09092216272D          \n\n 14 15  0  0  1  0            999 V2000\n   12.6752   -4.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9608   -4.4825    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.2463   -4.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9608   -3.6575    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5319   -4.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8186   -4.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8186   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1042   -4.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6032   -4.7375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1042   -3.2450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6032   -3.4025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3897   -4.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0881   -4.0700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3897   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 12  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  1  0  0  0\n  3  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  2  0  0  0  0\n  6  9  1  0  0  0  0\n  7 10  2  0  0  0  0\n  7 11  1  0  0  0  0\n  8 12  1  0  0  0  0\n  9 13  1  0  0  0  0\n 10 14  1  0  0  0  0\n 11 13  1  0  0  0  0\n 12 14  2  0  0  0  0\nM  END",
          "smiles": "CC[C@H](Cc1ccc2c(c1)OCO2)N",
          "formula": "C11H15NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b1adf0b8-cc90-4978-958a-504de50fd5e2"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "193.2427",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "fb642dd1-64df-4441-a0e9-957fc9895da9",
      "version": "5",
      "structure": {
        "id": "5bce6b10-b425-4772-984a-6543688d2272",
        "molfile": "(?S)-?-Ethyl-1,3-benzodioxole-5-ethanamine\n   JSDraw209092216272D\n\n 14 15  0  0  1  0              0 V2000\n   23.9677   -9.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.6168   -8.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2658   -9.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.6168   -6.9160    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   19.9148   -8.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.0207   -8.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.0207   -6.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.6697   -9.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.5043   -8.9581    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.6697   -6.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.5043   -6.4339    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.3187   -8.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.4212   -7.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.3187   -6.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 12  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  1  0  0  0\n  3  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  2  0  0  0  0\n  6  9  1  0  0  0  0\n  7 10  2  0  0  0  0\n  7 11  1  0  0  0  0\n  8 12  1  0  0  0  0\n  9 13  1  0  0  0  0\n 10 14  1  0  0  0  0\n 11 13  1  0  0  0  0\n 12 14  2  0  0  0  0\nM  END",
        "smiles": "CC[C@H](Cc1ccc2c(c1)OCO2)N",
        "formula": "C11H15NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "193.2427",
        "optical_activity": "( - )",
        "references": [
          "0b26512e-1fdd-c433-4d4f-da822838c5b0"
        ],
        "stereo_centers": 1
      },
      "unii": "M63B4SGR6F"
    }
  ]
}