{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4bfb78a1-6e9c-46c1-b95d-16bc6194f964",
          "code": "39236-46-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=39236-46-9",
          "code_system": "CAS",
          "references": [
            "2a115879-81fc-49f9-a3d1-0de811813837",
            "58f189c4-fea0-48a5-a42c-266da0bc4127"
          ]
        },
        {
          "uuid": "8fff50d3-b99b-4a26-b6e1-0e5bc0ca3415",
          "code": "C65895",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C65895",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2a115879-81fc-49f9-a3d1-0de811813837"
          ]
        },
        {
          "uuid": "c101cd55-77ca-4932-bfde-4afbe5e564a6",
          "code": "C006048",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67006048",
          "code_system": "MESH",
          "references": [
            "2a115879-81fc-49f9-a3d1-0de811813837"
          ]
        },
        {
          "uuid": "a98eda49-38cf-4d82-9dcf-d74bd174ca04",
          "code": "IMIDAZOLIDINYL UREA",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Imidazolidinyl_urea",
          "code_system": "WIKIPEDIA",
          "references": [
            "2a115879-81fc-49f9-a3d1-0de811813837"
          ]
        },
        {
          "uuid": "0c7ae029-1f3d-46bf-b236-f723514bcb7a",
          "code": "N0000185508",
          "comments": "Established Pharmacologic Class [EPC]|Standardized Chemical Allergen [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000185508",
          "code_system": "NDF-RT",
          "references": [
            "2a115879-81fc-49f9-a3d1-0de811813837"
          ]
        },
        {
          "uuid": "6b905607-9a1d-476a-86c1-57c22aaf3b99",
          "code": "1368885",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1368885/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "2a115879-81fc-49f9-a3d1-0de811813837"
          ]
        },
        {
          "uuid": "b79f82ff-4a4c-43bf-afd6-a7e510bd7e39",
          "code": "m6227",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6227?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "2a115879-81fc-49f9-a3d1-0de811813837"
          ]
        },
        {
          "uuid": "198f4791-63f9-4bd3-be7b-761088e566dd",
          "code": "SUB23453",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "2a115879-81fc-49f9-a3d1-0de811813837"
          ]
        },
        {
          "uuid": "70dda034-689d-436f-b904-54293de804a1",
          "code": "CHEMBL65433",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL65433",
          "code_system": "ChEMBL",
          "references": [
            "2a115879-81fc-49f9-a3d1-0de811813837"
          ]
        },
        {
          "uuid": "a609557d-121b-463b-bd7a-93a871e31386",
          "code": "N0000175629",
          "comments": "Increased Histamine Release [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175629",
          "code_system": "NDF-RT",
          "references": [
            "2a115879-81fc-49f9-a3d1-0de811813837"
          ]
        },
        {
          "uuid": "bc6075d9-bedf-4872-8e03-ed24dece2160",
          "code": "N0000171131",
          "comments": "Allergens [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000171131",
          "code_system": "NDF-RT",
          "references": [
            "2a115879-81fc-49f9-a3d1-0de811813837"
          ]
        },
        {
          "uuid": "c6033c8e-5504-4a88-a126-4785497138c4",
          "code": "N0000184306",
          "comments": "Cell-mediated Immunity [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000184306",
          "code_system": "NDF-RT",
          "references": [
            "2a115879-81fc-49f9-a3d1-0de811813837"
          ]
        },
        {
          "uuid": "c2c8c0e6-41a1-46d2-9f4a-46123282ea79",
          "code": "254-372-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.049.411",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "2a115879-81fc-49f9-a3d1-0de811813837"
          ]
        },
        {
          "uuid": "f56ae89f-968b-4dde-bc4b-44435c4b9a0d",
          "code": "38258",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/38258",
          "code_system": "PUBCHEM",
          "references": [
            "2a115879-81fc-49f9-a3d1-0de811813837"
          ]
        },
        {
          "uuid": "f9746a02-8f0b-fea2-51e4-16091e9a337a",
          "code": "DTXSID2040151",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2040151",
          "code_system": "EPA CompTox",
          "references": [
            "32fefeb2-4c3f-0671-6f83-f05f5a6ba7a3"
          ]
        },
        {
          "uuid": "0340ecbc-9e18-c6b4-7607-3cd5ddfd60d7",
          "code": "C45678",
          "comments": "Industrial Aid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45678",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f563add4-45b7-ae0d-2fb1-52cb3dd95148"
          ]
        },
        {
          "uuid": "2629b8a9-a34b-cb3b-5a1d-8372e1a633b8",
          "code": "DB14075",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB14075",
          "code_system": "DRUG BANK",
          "references": [
            "f563add4-45b7-ae0d-2fb1-52cb3dd95148"
          ]
        },
        {
          "uuid": "73f7a988-0945-4e9f-aeb6-1d6c4e9b60f1",
          "code": "M629807ATL",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a6ad254d-b8bf-1a93-2420-b69f708d97f8",
          "code": "51805",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:51805",
          "code_system": "CHEBI",
          "references": [
            "f563add4-45b7-ae0d-2fb1-52cb3dd95148"
          ]
        },
        {
          "uuid": "9a469244-974c-dee2-c4bf-d574a83e7660",
          "code": "1336806",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1336806",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "f563add4-45b7-ae0d-2fb1-52cb3dd95148"
          ]
        },
        {
          "uuid": "6273fc45-38e6-f219-713d-72696201e563",
          "code": "100000088780",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "02050bb4-0f0c-aede-a088-57acfeb0edb2"
          ]
        },
        {
          "uuid": "e9953845-d3c2-264b-0a2f-86b227deb3bc",
          "code": "M629807ATL",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=M629807ATL",
          "code_system": "DAILYMED",
          "references": [
            "53740a1f-53ff-e6fb-6065-33d1ca11bc4a"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "07ec15b8-cd10-4df3-a4cd-f6564b211bca",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "0bc9ff81-8eb4-4792-9da6-6f669d4c10ca",
            "refuuid": "dc9a6a08-1929-4b86-b569-982951056046",
            "name": "IMIDUREA",
            "unii": "M629807ATL",
            "linking_id": "M629807ATL",
            "ref_pname": "IMIDUREA",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2b743746-4a0e-448c-9505-6be645c7ba6e",
          "name": "1,1'-METHYLENEBIS(3-(3-(HYDROXYMETHYL)-2,5-DIOXO-4-IMIDAZOLIDINYL)UREA",
          "stdName": "1,1'-METHYLENEBIS(3-(3-(HYDROXYMETHYL)-2,5-DIOXO-4-IMIDAZOLIDINYL)UREA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8fceae9-ffa7-4e2d-aec1-b5e74e065d5c",
            "4c62ace8-3382-4104-b8ea-20c02f1dc3e5"
          ],
          "display_name": false
        },
        {
          "uuid": "30647ef5-b804-4106-b4f0-3b8113d44afd",
          "name": "IMIDAZOLIDINYL UREA",
          "stdName": "IMIDAZOLIDINYL UREA",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "88e1867b-acaa-41e1-90c7-4d528c2b46e9",
            "42138f38-95b4-4d9b-8f8c-cfc9b39cb65c",
            "42292a9e-8b62-45ab-92ad-9815a4f343c8",
            "df94ed4f-21cf-4a72-a9ad-f1ffbf446e2f",
            "4c62ace8-3382-4104-b8ea-20c02f1dc3e5",
            "8399ace7-2829-4f5b-939d-ec96592167fd"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "641cfa1e-cfe6-4178-8ce2-b47cd4047a08",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "7b260b8a-79c0-4cab-9d6d-97114fd461c8",
          "name": "IMIDAZOLIDINYL UREA [VANDF]",
          "stdName": "IMIDAZOLIDINYL UREA [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "88e1867b-acaa-41e1-90c7-4d528c2b46e9",
            "4c62ace8-3382-4104-b8ea-20c02f1dc3e5"
          ],
          "display_name": false
        },
        {
          "uuid": "96f83180-c840-4db1-a35d-65e828f0c5c0",
          "name": "IMIDUREA",
          "stdName": "IMIDUREA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0bb4556f-e68c-4400-be72-0a2d59aa3ecc",
            "c8fceae9-ffa7-4e2d-aec1-b5e74e065d5c",
            "76234476-d8b5-4421-a0ba-f2b68f7d77a5",
            "5db7b6f3-d871-4f17-9d2d-43418810a1d6",
            "e429c830-0343-461d-aa53-948d0e6e0c9c",
            "28dc938c-f625-44a8-bef4-19eef34b7fec",
            "88e1867b-acaa-41e1-90c7-4d528c2b46e9",
            "cba5bbd0-4a7e-4477-847f-e801ade7ea78",
            "4c62ace8-3382-4104-b8ea-20c02f1dc3e5",
            "79aac299-96bd-486d-92ac-3638ba7164be",
            "23512776-9490-4a91-a9a5-601f73bce766"
          ],
          "display_name": true
        },
        {
          "uuid": "d8f38811-744e-4a6d-977e-de5c8b76ef29",
          "name": "IMIDUREA [II]",
          "stdName": "IMIDUREA [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8fceae9-ffa7-4e2d-aec1-b5e74e065d5c"
          ],
          "display_name": false
        },
        {
          "uuid": "7315d5cf-8908-466e-bfc6-f445945ba8be",
          "name": "IMIDUREA [MART.]",
          "stdName": "IMIDUREA [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79aac299-96bd-486d-92ac-3638ba7164be"
          ],
          "display_name": false
        },
        {
          "uuid": "692902e0-74f9-4470-ab7f-965a86f8c57c",
          "name": "IMIDUREA [MI]",
          "stdName": "IMIDUREA [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c62ace8-3382-4104-b8ea-20c02f1dc3e5",
            "23512776-9490-4a91-a9a5-601f73bce766"
          ],
          "display_name": false
        },
        {
          "uuid": "4f8e9f82-5905-4823-9972-5f5dfa1fee0f",
          "name": "IMIDUREA [USP-RS]",
          "stdName": "IMIDUREA [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c62ace8-3382-4104-b8ea-20c02f1dc3e5",
            "e429c830-0343-461d-aa53-948d0e6e0c9c"
          ],
          "display_name": false
        },
        {
          "uuid": "2a8be714-7171-4d3d-b783-4f41857ec080",
          "name": "IMIDUREA [VANDF]",
          "stdName": "IMIDUREA [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "88e1867b-acaa-41e1-90c7-4d528c2b46e9",
            "4c62ace8-3382-4104-b8ea-20c02f1dc3e5"
          ],
          "display_name": false
        },
        {
          "uuid": "fb57fa9a-aba2-408d-8251-d2b109871df2",
          "name": "N,N''-METHYLENEBIS(N'-(3-(HYDROXYMETHYL)-2,5-DIOXO-4-IMIDAZOLIDINYL)UREA)",
          "stdName": "N,N''-METHYLENEBIS(N'-(3-(HYDROXYMETHYL)-2,5-DIOXO-4-IMIDAZOLIDINYL)UREA)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8fceae9-ffa7-4e2d-aec1-b5e74e065d5c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c8fceae9-ffa7-4e2d-aec1-b5e74e065d5c",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "42292a9e-8b62-45ab-92ad-9815a4f343c8",
          "citation": "http://ntp.niehs.nih.gov/ntp/htdocs/Chem_Background/ExSumPdf/ImidazolidinylUrea.pdf",
          "url": "http://ntp.niehs.nih.gov/ntp/htdocs/Chem_Background/ExSumPdf/ImidazolidinylUrea.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4c62ace8-3382-4104-b8ea-20c02f1dc3e5",
          "citation": "NCI DRUG DICTIONARY",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "79aac299-96bd-486d-92ac-3638ba7164be",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "23512776-9490-4a91-a9a5-601f73bce766",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "df94ed4f-21cf-4a72-a9ad-f1ffbf446e2f",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e429c830-0343-461d-aa53-948d0e6e0c9c",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "88e1867b-acaa-41e1-90c7-4d528c2b46e9",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2a115879-81fc-49f9-a3d1-0de811813837",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390703000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "49c7700d-4091-4ef1-b573-8b0e5083b34a",
          "citation": "SRS import [M629807ATL]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=M629807ATL",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390703000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0bb4556f-e68c-4400-be72-0a2d59aa3ecc",
          "citation": "IMIDUREA [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "76234476-d8b5-4421-a0ba-f2b68f7d77a5",
          "citation": "IMIDUREA [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8399ace7-2829-4f5b-939d-ec96592167fd",
          "citation": "IMIDAZOLIDINYL UREA [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5db7b6f3-d871-4f17-9d2d-43418810a1d6",
          "citation": "IMIDUREA [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cba5bbd0-4a7e-4477-847f-e801ade7ea78",
          "citation": "IMIDUREA [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "42138f38-95b4-4d9b-8f8c-cfc9b39cb65c",
          "citation": "IMIDAZOLIDINYL UREA [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "28dc938c-f625-44a8-bef4-19eef34b7fec",
          "citation": "IMIDUREA [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "32fefeb2-4c3f-0671-6f83-f05f5a6ba7a3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=39236-46-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f563add4-45b7-ae0d-2fb1-52cb3dd95148",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "58f189c4-fea0-48a5-a42c-266da0bc4127",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "53740a1f-53ff-e6fb-6065-33d1ca11bc4a",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "02050bb4-0f0c-aede-a088-57acfeb0edb2",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6a852344-286a-4bb3-9532-09f54db36bcf",
          "id": "6a852344-286a-4bb3-9532-09f54db36bcf",
          "molfile": "\n  Marvin  01132105322D          \n\n 27 28  0  0  0  0            999 V2000\n    1.7416   -1.6633    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4545   -2.0785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4597   -2.9062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2065   -3.2352    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.9193   -2.7965    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6374   -3.2117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6374   -4.0133    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3293   -2.7965    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0657   -3.2038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7472   -2.7756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4730   -3.1908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4835   -3.9950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1885   -2.7756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9875   -3.2038    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    8.9875   -3.9715    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2642   -4.3815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2590   -5.2118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7865   -4.1438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1285   -4.8880    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4497   -3.5120    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8100   -2.7965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1703   -2.0941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1960   -4.0577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7522   -4.5669    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3291   -4.2065    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9140   -3.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0967   -3.4467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n 26  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n 23  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 21 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 18 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 18  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  2  0  0  0  0\n 24 23  2  0  0  0  0\n 25 23  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  2  0  0  0  0\nM  END",
          "smiles": "C(NC(=O)NC1C(=O)NC(=O)N1CO)NC(=O)NC2C(=O)NC(=O)N2CO",
          "formula": "C11H16N8O8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5aeb2f3e-3b76-4b2e-9d64-95a03f454a8e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "388.294",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "dc9a6a08-1929-4b86-b569-982951056046",
      "version": "13",
      "structure": {
        "id": "b10bd45f-4a68-4f1c-965c-c31ee64da0a0",
        "molfile": "\n  Marvin  01132109112D          \n\n 27 28  0  0  0  0            999 V2000\n    8.9875   -3.9715    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4597   -2.9062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9140   -3.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7865   -4.1438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4497   -3.5120    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3291   -4.2065    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9875   -3.2038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2065   -3.2352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1960   -4.0577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8100   -2.7965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1885   -2.7756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9193   -2.7965    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6374   -3.2117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4730   -3.1908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7472   -2.7756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3293   -2.7965    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1285   -4.8880    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0967   -3.4467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0657   -3.2038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4545   -2.0785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2642   -4.3815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1703   -2.0941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7522   -4.5669    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6374   -4.0133    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4835   -3.9950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7416   -1.6633    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2590   -5.2118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  8  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  9  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8 12  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  7  1  0  0  0  0\n 11  7  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 16  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 19  1  0  0  0  0\n 17  4  2  0  0  0  0\n 18  3  2  0  0  0  0\n 19 15  1  0  0  0  0\n 20  2  1  0  0  0  0\n 21  1  1  0  0  0  0\n 22 10  2  0  0  0  0\n 23  9  2  0  0  0  0\n 24 13  2  0  0  0  0\n 25 14  2  0  0  0  0\n 26 20  1  0  0  0  0\n 27 21  1  0  0  0  0\n  5 10  1  0  0  0  0\n  3  6  1  0  0  0  0\nM  END",
        "smiles": "C(NC(=O)NC1C(=O)NC(=O)N1CO)NC(=O)NC2C(=O)NC(=O)N2CO",
        "formula": "C11H16N8O8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "388.294",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "49c7700d-4091-4ef1-b573-8b0e5083b34a",
          "c8fceae9-ffa7-4e2d-aec1-b5e74e065d5c"
        ],
        "stereo_centers": 2
      },
      "unii": "M629807ATL"
    }
  ]
}