{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "40e96c78-4156-4e1b-bdb2-2eba44c3911d",
          "code": "2784-73-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2784-73-8",
          "code_system": "CAS",
          "references": [
            "dcefa442-6991-4482-a016-dd672e2bbcf0",
            "a1845524-1bd8-43ca-ab22-90b27557381f"
          ]
        },
        {
          "uuid": "efa89e2c-fdef-4caf-b56b-96c872809a0d",
          "code": "C026979",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67026979",
          "code_system": "MESH",
          "references": [
            "dcefa442-6991-4482-a016-dd672e2bbcf0"
          ]
        },
        {
          "uuid": "c932c577-1967-4389-b245-fadd6c5b4366",
          "code": "6-MONOACETYLMORPHINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/6-Monoacetylmorphine",
          "code_system": "WIKIPEDIA",
          "references": [
            "dcefa442-6991-4482-a016-dd672e2bbcf0"
          ]
        },
        {
          "uuid": "e0dbc151-579c-453c-9bcc-fc831e12d468",
          "code": "SUB32914",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "dcefa442-6991-4482-a016-dd672e2bbcf0"
          ]
        },
        {
          "uuid": "fb420dda-b290-446c-9d63-a40e42b6df52",
          "code": "5462507",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5462507",
          "code_system": "PUBCHEM",
          "references": [
            "dcefa442-6991-4482-a016-dd672e2bbcf0"
          ]
        },
        {
          "uuid": "1fe42392-d725-60d7-7e4c-3c7cbe58d824",
          "code": "DTXSID60182154",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60182154",
          "code_system": "EPA CompTox",
          "references": [
            "43619b98-5d0c-257e-6433-2abbc4092950"
          ]
        },
        {
          "uuid": "a8522e8a-54ec-4bf5-8842-7d8067aaaf41",
          "code": "M5E47P1ZCH",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "53951cb1-1064-4a9b-2c35-c85066dca6da",
          "code": "100000125987",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "3cf1615d-b23c-5451-de07-0cd2da752054"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "175b1310-51b0-4d91-9de6-1e2038052f3b",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "c84a515c-bf52-430c-91fc-8ebe791c39bf",
            "refuuid": "01a5992a-4ac3-43b4-ae7c-1ec6d9aafe1f",
            "name": "6-ACETYLMORPHINE",
            "unii": "M5E47P1ZCH",
            "linking_id": "M5E47P1ZCH",
            "ref_pname": "6-ACETYLMORPHINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "341d8d27-9d4d-4192-993e-8c968dbd7ffe",
          "amount": {
            "uuid": "8295f634-15be-42ac-85fb-c2b71be2b03a"
          },
          "comments": "6-MAM is a metabolite unique to heroin",
          "type": "PRODRUG->METABOLITE ACTIVE",
          "references": [
            "72e97a0c-8352-46dc-b6ba-78fce1b42d23"
          ],
          "related_substance": {
            "uuid": "d3f2e57e-792d-4279-8a42-d9cd598761f3",
            "refuuid": "da48bb06-4799-44f6-905f-7a81bbba6c14",
            "name": "DIAMORPHINE",
            "unii": "70D95007SX",
            "linking_id": "70D95007SX",
            "ref_pname": "DIAMORPHINE"
          }
        },
        {
          "uuid": "d4588ef9-0d98-4d47-b86c-ca4654689fb3",
          "type": "TARGET->AGONIST",
          "references": [
            "d00a9a56-1006-47e5-8cdb-b01459c6f239"
          ],
          "related_substance": {
            "uuid": "ae45a782-576b-4916-81f9-5883760f4dcb",
            "refuuid": "39262e4f-d963-4b83-9b34-52fd55036f0e",
            "name": "MU-TYPE OPIOID RECEPTOR",
            "unii": "1PE72K8X46",
            "linking_id": "1PE72K8X46",
            "ref_pname": "MU-TYPE OPIOID RECEPTOR",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "514dcb68-8ef7-4645-9601-f421ac996096",
          "name": "6-ACETYLMORPHINE",
          "stdName": "6-ACETYLMORPHINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b9b1c51-3542-4600-bf66-8da6c10e5003"
          ],
          "display_name": true
        },
        {
          "uuid": "0f8742c8-8471-4222-92f3-d21ca61c2a38",
          "name": "6-MAM",
          "stdName": "6-MAM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b9b1c51-3542-4600-bf66-8da6c10e5003"
          ],
          "display_name": false
        },
        {
          "uuid": "84f32b29-4f4d-4ff2-8e60-16e7a7a4251d",
          "name": "6-MONOACETYLMORPHINE",
          "stdName": "6-MONOACETYLMORPHINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b9b1c51-3542-4600-bf66-8da6c10e5003"
          ],
          "display_name": false
        },
        {
          "uuid": "86b44630-635b-42c7-84ff-3640f4d98e09",
          "name": "6-O-ACETYLMORPHINE",
          "stdName": "6-O-ACETYLMORPHINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f05a5a9d-2f50-4886-bcab-f107ea88e629"
          ],
          "display_name": false
        },
        {
          "uuid": "89837424-8d13-42d0-bd17-4bd9f1a46786",
          "name": "6-O-MONOACETYLMORPHINE",
          "stdName": "6-O-MONOACETYLMORPHINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f05a5a9d-2f50-4886-bcab-f107ea88e629"
          ],
          "display_name": false
        },
        {
          "uuid": "794ed19b-e4e5-4283-92ae-836c0b465ab3",
          "name": "MAM",
          "stdName": "MAM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "daf327c6-c720-4565-9c49-a114e5c09158"
          ],
          "display_name": false
        },
        {
          "uuid": "b6b7a527-ab02-46ff-a48a-1d812b44e008",
          "name": "MONOACETYLMORPHINE",
          "stdName": "MONOACETYLMORPHINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b9b1c51-3542-4600-bf66-8da6c10e5003"
          ],
          "display_name": false
        },
        {
          "uuid": "77d7417a-d38e-4ee3-b64e-afdd4912df61",
          "name": "MORPHINAN-3,6-DIOL, 7,8-DIDEHYDRO-4,5-EPOXY-17-METHYL- (5.ALPHA.,6.ALPHA.)-, 6-ACETATE",
          "stdName": "MORPHINAN-3,6-DIOL, 7,8-DIDEHYDRO-4,5-EPOXY-17-METHYL- (5.ALPHA.,6.ALPHA.)-, 6-ACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f05a5a9d-2f50-4886-bcab-f107ea88e629"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a1845524-1bd8-43ca-ab22-90b27557381f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d00a9a56-1006-47e5-8cdb-b01459c6f239",
          "citation": "https://en.wikipedia.org/wiki/Heroin",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+561-27-3",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0b9b1c51-3542-4600-bf66-8da6c10e5003",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f05a5a9d-2f50-4886-bcab-f107ea88e629",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "daf327c6-c720-4565-9c49-a114e5c09158",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dcefa442-6991-4482-a016-dd672e2bbcf0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389950000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b2a01d7d-43b1-473e-bdff-334a046cbc0c",
          "citation": "SRS import [M5E47P1ZCH]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=M5E47P1ZCH",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389950000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4d8c3914-4e78-4991-98f5-c73535f897b2",
          "citation": "wikipedia",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "43619b98-5d0c-257e-6433-2abbc4092950",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2784-73-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3cf1615d-b23c-5451-de07-0cd2da752054",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "72e97a0c-8352-46dc-b6ba-78fce1b42d23",
          "citation": "https://en.wikipedia.org/wiki/Heroin",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+561-27-3",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "45145713-c56f-401e-b57a-189e87e6d910",
          "id": "45145713-c56f-401e-b57a-189e87e6d910",
          "molfile": "\n  Marvin  01132103382D          \n\n 24 28  0  0  1  0            999 V2000\n    8.1420   -5.0791    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.3118   -5.5463    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4919   -5.0543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9094   -4.3535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4919   -3.6328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9044   -2.9369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7344   -2.9369    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.1270   -2.2910    0.0000 N   0  0  2  0  0  0  0  0  0  0  0  0\n    8.1270   -1.3814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2851   -2.2910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3158   -4.3535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7344   -4.3535    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.1518   -3.6378    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.9868   -3.6378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3992   -4.3585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9769   -5.0791    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.3943   -5.7998    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2144   -5.7998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6270   -6.5105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6270   -5.0842    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6818   -3.6328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2691   -4.3386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6719   -5.0543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2592   -5.7551    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1 12  1  0  0  0  0\n  1 16  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n 23  3  2  0  0  0  0\n  5  4  2  0  0  0  0\n 12  4  1  1  0  0  0\n  6  5  1  0  0  0  0\n 21  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  1  0  0  0\n 13  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  6  0  0  0\n 14 15  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  6  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 18  2  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\nM  END",
          "smiles": "CC(=O)O[C@H]1C=C[C@H]2[C@H]3Cc4ccc(c5c4[C@@]2(CCN3C)[C@H]1O5)O",
          "formula": "C19H21NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a77d0bf7-efd1-4a15-86fb-2c74d821b8e2"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "327.3751",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "01a5992a-4ac3-43b4-ae7c-1ec6d9aafe1f",
      "version": "8",
      "structure": {
        "id": "e7108ae7-cbbb-46a5-9d79-8974012b956e",
        "molfile": "\n  Marvin  01132111572D          \n\n 26 30  0  0  1  0            999 V2000\n    7.7238   -4.3476    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.8999   -4.3476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4829   -5.0474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6641   -5.0474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2520   -5.7472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2619   -4.3327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6740   -3.6278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4829   -3.6278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8949   -2.9329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7238   -2.9329    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.1406   -3.6327    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.9745   -3.6327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3863   -4.3526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9646   -5.0721    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.1308   -5.0721    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.3018   -5.5386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3913   -5.9890    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3814   -5.7919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2003   -5.7919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6124   -5.0772    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6124   -6.5015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3118   -3.6327    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1159   -2.2878    0.0000 N   0  0  1  0  0  0  0  0  0  0  0  0\n    9.2723   -2.2878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3043   -4.3476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1159   -1.3796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  2  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11  1  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15  1  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16  3  1  0  0  0  0\n 15 17  1  1  0  0  0\n 14 18  1  6  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 19  1  0  0  0  0\n 11 22  1  1  0  0  0\n 10 23  1  1  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n  1 25  1  1  0  0  0\n 26 23  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)O[C@H]1C=C[C@@]2([H])[C@H]3Cc4ccc(c5c4[C@@]2(CCN3C)[C@@]1([H])O5)O",
        "formula": "C19H21NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "327.3751",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b2a01d7d-43b1-473e-bdff-334a046cbc0c",
          "4d8c3914-4e78-4991-98f5-c73535f897b2"
        ],
        "stereo_centers": 5
      },
      "unii": "M5E47P1ZCH"
    }
  ]
}