{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6e09f665-8760-4059-adcb-a10f5c74a49e",
          "code": "80-43-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=80-43-3",
          "code_system": "CAS",
          "references": [
            "f6ab4736-c11b-4039-a12f-ff3282b2c62f",
            "c1ca308a-de94-4533-9972-5a2e3bdc4c0e"
          ]
        },
        {
          "uuid": "1b2b5683-fe0b-4aef-a685-a67b380520cc",
          "code": "C037517",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67037517",
          "code_system": "MESH",
          "references": [
            "f6ab4736-c11b-4039-a12f-ff3282b2c62f"
          ]
        },
        {
          "uuid": "7e856817-c6ec-42da-8912-874cd1335387",
          "code": "201-279-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.164",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f6ab4736-c11b-4039-a12f-ff3282b2c62f"
          ]
        },
        {
          "uuid": "d63f0d82-6ddd-4ca1-b2d3-2388859f838a",
          "code": "6641",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6641",
          "code_system": "PUBCHEM",
          "references": [
            "f6ab4736-c11b-4039-a12f-ff3282b2c62f"
          ]
        },
        {
          "uuid": "70799b93-808c-5ac8-f30d-836af63c7445",
          "code": "320",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/320",
          "code_system": "HSDB",
          "references": [
            "80150a9f-4e2b-e505-94f4-59d17b560368"
          ]
        },
        {
          "uuid": "b88785f4-1fd6-c701-6880-ae44ce21c915",
          "code": "DTXSID1025017",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1025017",
          "code_system": "EPA CompTox",
          "references": [
            "6d326753-1534-ce91-e3a9-d764c4164e26"
          ]
        },
        {
          "uuid": "36b02c32-26eb-442a-9e54-2118c3906847",
          "code": "M51X2J0U9D",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a3ce78ac-9599-7d4c-3496-b6beed5cae35",
          "code": "56772",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=56772",
          "code_system": "NSC",
          "references": [
            "b17d08a6-b0fa-36c8-966f-2e7f3a3ce37b"
          ]
        },
        {
          "uuid": "42f3b86d-97be-83d9-b89a-c6d8b6b8b495",
          "code": "300000053308",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "78a5c271-55e4-6a85-7ba7-46a126cff019"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "de58517c-55a0-4f10-8140-8fa773c68e0c",
          "name": "BIS(1-METHYL-1-PHENYLETHYL) PEROXIDE",
          "stdName": "BIS(1-METHYL-1-PHENYLETHYL) PEROXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c10fdb8f-8477-47c0-be3f-889a7ebfb283",
            "374e2f1b-d970-4d6b-9429-1641364c2b01"
          ],
          "display_name": false
        },
        {
          "uuid": "ef772f4a-21e7-4e5a-97d4-c7c39f230fe3",
          "name": "CUMENE PEROXIDE",
          "stdName": "CUMENE PEROXIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "374e2f1b-d970-4d6b-9429-1641364c2b01",
            "89c3d295-379d-4320-b00d-55e2a5c4da16"
          ],
          "display_name": false
        },
        {
          "uuid": "bee5efec-ce38-4c2e-97b3-cda16b1d26c6",
          "name": "CUMYL PEROXIDE",
          "stdName": "CUMYL PEROXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "374e2f1b-d970-4d6b-9429-1641364c2b01",
            "89c3d295-379d-4320-b00d-55e2a5c4da16"
          ],
          "display_name": false
        },
        {
          "uuid": "9a8a223d-9e62-42b1-87c3-f0a698413097",
          "name": "DI-CUP",
          "stdName": "DI-CUP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "374e2f1b-d970-4d6b-9429-1641364c2b01",
            "89c3d295-379d-4320-b00d-55e2a5c4da16"
          ],
          "display_name": false
        },
        {
          "uuid": "9b4b3ed6-1c30-4c4d-a02f-954a27d20c96",
          "name": "DICUMYL PEROXIDE",
          "stdName": "DICUMYL PEROXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c10fdb8f-8477-47c0-be3f-889a7ebfb283",
            "8c086104-81fa-444c-b7c3-d57a84d31442",
            "374e2f1b-d970-4d6b-9429-1641364c2b01",
            "720b4e45-2656-4d01-903e-028379bfd1d0"
          ],
          "display_name": true
        },
        {
          "uuid": "873d8519-a9fa-4199-af1c-3b5ee64f3e47",
          "name": "DICUMYL PEROXIDE [HSDB]",
          "stdName": "DICUMYL PEROXIDE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8c086104-81fa-444c-b7c3-d57a84d31442",
            "374e2f1b-d970-4d6b-9429-1641364c2b01"
          ],
          "display_name": false
        },
        {
          "uuid": "a2c54632-5020-4c02-b917-945b692671c7",
          "name": "NSC-56772",
          "stdName": "NSC-56772",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "003207ec-f048-4898-8856-4a4cfd14bc6f",
            "374e2f1b-d970-4d6b-9429-1641364c2b01"
          ],
          "display_name": false
        },
        {
          "uuid": "9dee90c4-35c3-42eb-88db-b6e74065731d",
          "name": "PEROXIDE, BIS(1-METHYL-1-PHENYLETHYL)",
          "stdName": "PEROXIDE, BIS(1-METHYL-1-PHENYLETHYL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "374e2f1b-d970-4d6b-9429-1641364c2b01",
            "89c3d295-379d-4320-b00d-55e2a5c4da16"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c10fdb8f-8477-47c0-be3f-889a7ebfb283",
          "citation": "SIGMA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "374e2f1b-d970-4d6b-9429-1641364c2b01",
          "citation": "SIGMA-ALDRICH",
          "doc_type": "SIGMA-ALDRICH",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c086104-81fa-444c-b7c3-d57a84d31442",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89c3d295-379d-4320-b00d-55e2a5c4da16",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "003207ec-f048-4898-8856-4a4cfd14bc6f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6ab4736-c11b-4039-a12f-ff3282b2c62f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389673000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "400a7187-6796-4328-9d89-5bcec210e953",
          "citation": "SRS import [M51X2J0U9D]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=M51X2J0U9D",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389673000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "720b4e45-2656-4d01-903e-028379bfd1d0",
          "citation": "DICUMYL PEROXIDE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "80150a9f-4e2b-e505-94f4-59d17b560368",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+80-43-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6d326753-1534-ce91-e3a9-d764c4164e26",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=80-43-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c1ca308a-de94-4533-9972-5a2e3bdc4c0e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b17d08a6-b0fa-36c8-966f-2e7f3a3ce37b",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "78a5c271-55e4-6a85-7ba7-46a126cff019",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f43d34bf-7696-42f3-8d26-4dba4c4a86b6",
          "id": "f43d34bf-7696-42f3-8d26-4dba4c4a86b6",
          "molfile": "\n  Marvin  01132112402D          \n\n 20 21  0  0  0  0            999 V2000\n    5.2591   -4.3533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8061   -3.6434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3736   -2.9819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0887   -4.1116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4245   -3.7452    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7199   -4.2031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2644   -3.5060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1625   -4.8443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0506   -4.6382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3103   -4.2871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6157   -4.7323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6233   -5.5694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3841   -5.8976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0532   -5.4473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4880   -3.1752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2080   -3.5645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9128   -3.1040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9128   -2.3840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1470   -1.9463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4626   -2.4094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n 15  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  6  1  0  0  0  0\n 10  9  1  0  0  0  0\n 14  9  2  0  0  0  0\n 11 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 20 15  2  0  0  0  0\n 17 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(c1ccccc1)OOC(C)(C)c2ccccc2",
          "formula": "C18H22O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f4921b69-0590-44ca-a3f2-997af1699a7e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "270.3668",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "48f0d58e-dcfd-4254-a703-a338b3b6e64c",
      "version": "6",
      "structure": {
        "id": "f733e656-4cd2-479e-8eb3-8cf2d236b559",
        "molfile": "\n  Marvin  01132112492D          \n\n 20 21  0  0  0  0            999 V2000\n    2.7199   -4.2031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8061   -3.6434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0887   -4.1116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4245   -3.7452    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4880   -3.1752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0506   -4.6382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2591   -4.3533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2644   -3.5060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1625   -4.8443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3736   -2.9819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3103   -4.2871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2080   -3.5645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4626   -2.4094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0532   -5.4473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9128   -3.1040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1470   -1.9463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6157   -4.7323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3841   -5.8976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6233   -5.5694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9128   -2.3840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  2  1  0  0  0  0\n  8  1  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11  6  2  0  0  0  0\n 12  5  2  0  0  0  0\n 13  5  1  0  0  0  0\n 14  6  1  0  0  0  0\n 15 12  1  0  0  0  0\n 16 13  2  0  0  0  0\n 17 11  1  0  0  0  0\n 18 14  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 16  1  0  0  0  0\n 17 19  2  0  0  0  0\n 15 20  2  0  0  0  0\nM  END",
        "smiles": "CC(C)(c1ccccc1)OOC(C)(C)c2ccccc2",
        "formula": "C18H22O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "270.3668",
        "optical_activity": "NONE",
        "references": [
          "400a7187-6796-4328-9d89-5bcec210e953",
          "89c3d295-379d-4320-b00d-55e2a5c4da16"
        ],
        "stereo_centers": 0
      },
      "unii": "M51X2J0U9D"
    }
  ]
}