{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "89a1af3c-4e25-418f-bfbf-e7b1c84825d0", "code": "82469-79-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=82469-79-2", "code_system": "CAS", "references": [ "42e43297-d8f2-4cc6-bf56-7f803f61d6fb", "7fb4d912-b7d4-4def-b0c7-78502464d260" ] }, { "uuid": "2b2daf1f-eb92-4700-a30b-f7c2c704d0e6", "code": "133914", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/133914", "code_system": "PUBCHEM", "references": [ "42e43297-d8f2-4cc6-bf56-7f803f61d6fb" ] }, { "uuid": "cebb1df3-6e3b-75f6-5258-7666615fffbf", "code": "DTXSID0047535", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0047535", "code_system": "EPA CompTox", "references": [ "2428ac98-1779-2811-8b07-e4ecb6e326f9" ] }, { "uuid": "70ca829f-9ced-4f6e-9648-f1ed6746bd2c", "code": "M4974DI70C", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "b0c00624-f3e4-45d1-9454-39fc7c6fb19b", "name": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-(1-OXOBUTOXY)-, 1,2,3-TRIHEXYL ESTER", "stdName": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-(1-OXOBUTOXY)-, 1,2,3-TRIHEXYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "dfcb7cc1-39d4-45d6-8885-81d163c1f19c", "6205d7c2-298e-47ad-babc-c3c968ecd956" ], "display_name": false }, { "uuid": "92c6795e-eb0d-48c0-8460-7a5c539d58b2", "name": "BUTYRYL TRIHEXYL CITRATE", "stdName": "BUTYRYL TRIHEXYL CITRATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "dfcb7cc1-39d4-45d6-8885-81d163c1f19c", "6205d7c2-298e-47ad-babc-c3c968ecd956" ], "display_name": true }, { "uuid": "bbe22ec3-61d7-434b-9f7a-1aef6f6b781d", "name": "CITROFLEX B 6", "stdName": "CITROFLEX B 6", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "dfcb7cc1-39d4-45d6-8885-81d163c1f19c", "6205d7c2-298e-47ad-babc-c3c968ecd956" ], "display_name": false }, { "uuid": "a7eba8ce-fe51-4086-a60d-4f4a58630952", "name": "TRIHEXYL BUTYRYLCITRATE", "stdName": "TRIHEXYL BUTYRYLCITRATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "dfcb7cc1-39d4-45d6-8885-81d163c1f19c", "6205d7c2-298e-47ad-babc-c3c968ecd956" ], "display_name": false }, { "uuid": "9e58ad32-dd08-4002-9e94-835ba1603192", "name": "TRIHEXYL CITRATE BUTYRATE", "stdName": "TRIHEXYL CITRATE BUTYRATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "dfcb7cc1-39d4-45d6-8885-81d163c1f19c", "6205d7c2-298e-47ad-babc-c3c968ecd956" ], "display_name": false } ], "references": [ { "uuid": "dfcb7cc1-39d4-45d6-8885-81d163c1f19c", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "6205d7c2-298e-47ad-babc-c3c968ecd956", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "42e43297-d8f2-4cc6-bf56-7f803f61d6fb", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392697000, "tags": [ "NOMEN" ] }, { "uuid": "b97945b8-9408-40b7-b260-022dd3899216", "citation": "SRS import [M4974DI70C]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=M4974DI70C", "doc_type": "SRS", "public_domain": true, "document_date": 1493392697000, "tags": [ "NOMEN" ] }, { "uuid": "2428ac98-1779-2811-8b07-e4ecb6e326f9", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=82469-79-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "7fb4d912-b7d4-4def-b0c7-78502464d260", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "b593c8c0-1435-416e-a0ad-e1c280d483dd", "id": "b593c8c0-1435-416e-a0ad-e1c280d483dd", "molfile": "\n Marvin 01132109242D \n\n 36 35 0 0 0 0 999 V2000\n 10.4717 -20.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7577 -20.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0437 -20.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3297 -20.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6158 -20.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9018 -20.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1878 -20.5174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4738 -20.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4655 -19.2774 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7598 -20.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0459 -20.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3319 -20.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6179 -20.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6096 -19.2774 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9039 -20.5174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1900 -20.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4760 -20.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2380 -20.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9520 -20.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6659 -20.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3799 -20.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0376 -19.2774 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0376 -18.4507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3194 -18.0373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7515 -18.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4655 -18.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1795 -18.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0376 -20.9225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3236 -21.3316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7515 -21.3358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4655 -20.9225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1795 -21.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8935 -20.9225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6074 -21.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3214 -20.9225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0354 -21.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 2 0 0 0 0\n 8 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 22 11 1 0 0 0 0\n 28 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 2 0 0 0 0\n 15 13 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 2 0 0 0 0\n 25 23 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 29 28 2 0 0 0 0\n 30 28 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 1 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 1 0 0 0 0\n 36 35 1 0 0 0 0\nM END", "smiles": "CCCCCCOC(=O)CC(CC(=O)OCCCCCC)(C(=O)OCCCCCC)OC(=O)CCC", "formula": "C28H50O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "b8c4f97e-c26a-4d97-bc0b-e1390997dcb7" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "514.6929", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "1f552516-c1b7-4c35-a770-5129af8101fb", "version": "4", "structure": { "id": "88d12ad9-48c4-4ddc-9bee-0da8b1213a0b", "molfile": "\n Marvin 01132107062D \n\n 36 35 0 0 0 0 999 V2000\n 4.0459 -20.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3319 -20.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7598 -20.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0376 -20.9225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0376 -19.2774 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6179 -20.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4738 -20.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0376 -18.4507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3236 -21.3316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6096 -19.2774 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4655 -19.2774 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3194 -18.0373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7515 -21.3358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9039 -20.5174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1878 -20.5174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7515 -18.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4655 -20.9225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9018 -20.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1900 -20.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4655 -18.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6158 -20.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1795 -21.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4760 -20.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6659 -20.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3214 -20.9225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7577 -20.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6074 -21.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9520 -20.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0437 -20.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3297 -20.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2380 -20.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8935 -20.9225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4717 -20.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0354 -21.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3799 -20.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1795 -18.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 1 1 0 0 0 0\n 4 1 1 0 0 0 0\n 5 1 1 0 0 0 0\n 6 2 1 0 0 0 0\n 7 3 1 0 0 0 0\n 8 5 1 0 0 0 0\n 9 4 2 0 0 0 0\n 10 6 2 0 0 0 0\n 11 7 2 0 0 0 0\n 12 8 2 0 0 0 0\n 13 4 1 0 0 0 0\n 14 6 1 0 0 0 0\n 15 7 1 0 0 0 0\n 16 8 1 0 0 0 0\n 17 13 1 0 0 0 0\n 18 15 1 0 0 0 0\n 19 14 1 0 0 0 0\n 20 16 1 0 0 0 0\n 21 18 1 0 0 0 0\n 22 17 1 0 0 0 0\n 23 19 1 0 0 0 0\n 24 28 1 0 0 0 0\n 25 27 1 0 0 0 0\n 26 29 1 0 0 0 0\n 27 32 1 0 0 0 0\n 28 31 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 21 1 0 0 0 0\n 31 23 1 0 0 0 0\n 32 22 1 0 0 0 0\n 33 26 1 0 0 0 0\n 34 25 1 0 0 0 0\n 35 24 1 0 0 0 0\n 36 20 1 0 0 0 0\nM END", "smiles": "CCCCCCOC(=O)CC(CC(=O)OCCCCCC)(C(=O)OCCCCCC)OC(=O)CCC", "formula": "C28H50O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "514.6929", "optical_activity": "NONE", "references": [ "b97945b8-9408-40b7-b260-022dd3899216", "dfcb7cc1-39d4-45d6-8885-81d163c1f19c" ], "stereo_centers": 0 }, "unii": "M4974DI70C" } ] }